Record Information
Version 1.0
Update Date 1/22/2018 12:54:53 PM
Metabolite IDPAMDB001633
Identification
Name: Hydrogen ion
Description:Hydrogen ion is recommended by IUPAC as a general term for all ions of hydrogen and its isotopes. Depending on the charge of the ion, two different classes can be distinguished: positively charged ions and negatively charged ions. Under aqueous conditions found in biochemistry, hydrogen ions exist as the hydrated form hydronium, H3O+, but these are often still referred to as hydrogen ions or even protons by biochemists. (WikiPedia)
Structure
Thumb
Synonyms:
  • H
  • H(+)
  • H+
  • Hydrogen ion
  • Hydron
  • Proton
Chemical Formula: H
Average Molecular Weight: 1.0079
Monoisotopic Molecular Weight: 1.007825032
InChI Key: GPRLSGONYQIRFK-UHFFFAOYSA-N
InChI:InChI=1S/p+1
CAS number: Not Available
IUPAC Name:hydron
Traditional IUPAC Name: hydron
SMILES:[H+]
Chemical Taxonomy
Taxonomy DescriptionThis compound belongs to the class of inorganic compounds known as other non-metal hydrides. These are inorganic compounds in which the heaviest atom bonded to a hydrogen atom is belongs to the class of 'other non-metals'.
Kingdom Inorganic compounds
Super ClassHomogeneous non-metal compounds
Class Other non-metal organides
Sub ClassOther non-metal hydrides
Direct Parent Other non-metal hydrides
Alternative Parents Not Available
Substituents
  • Other non-metal hydride
  • Acyclic compound
Molecular Framework Acyclic compounds
External Descriptors
Physical Properties
State: Not Available
Charge:0
Melting point: Not Available
Experimental Properties:
PropertyValueSource
Predicted Properties
PropertyValueSource
logP0ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count0ChemAxon
Hydrogen Donor Count0ChemAxon
Polar Surface Area0 Å2ChemAxon
Rotatable Bond Count0ChemAxon
Polarizability0.52 Å3ChemAxon
Number of Rings0ChemAxon
Bioavailability1ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations: Cytoplasm
Reactions:
-->-->Adenosine triphosphate + Water + Isethionic acid > ADP + Hydrogen ion + Isethionic acid + Phosphate
Coenzyme A + 2 flavodoxin semi oxidized + Pyruvic acid <> Acetyl-CoA + Carbon dioxide +2 Flavodoxin reduced + Hydrogen ion
Cytidine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dCTP +2 flavodoxin semi oxidized + Water
Adenosine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dATP +2 flavodoxin semi oxidized + Water
2 Flavodoxin reduced + Guanosine triphosphate + 2 Hydrogen ion > dGTP +2 flavodoxin semi oxidized + Water
2 Flavodoxin reduced + 2 Hydrogen ion + Uridine triphosphate > Deoxyuridine triphosphate +2 flavodoxin semi oxidized + Water
2 flavodoxin semi oxidized + NADPH >2 Flavodoxin reduced + Hydrogen ion + NADP
Adenosine triphosphate + Water + Potassium > ADP + Hydrogen ion + Potassium + Phosphate
Adenosine triphosphate + Water + Molybdate > ADP + Hydrogen ion + Molybdate + Phosphate
Adenosine triphosphate + Water + Putrescine > ADP + Hydrogen ion + Phosphate + Putrescine
Hydrogen ion + Menaquinol 8 + Trimethylamine N-Oxide > Water + Menaquinone 8 + Trimethylamine
Adenosine triphosphate + Water + Butanesulfonate > ADP + Butanesulfonate + Hydrogen ion + Phosphate
2 Hydrogen ion + Hydrogen (gas) + Ubiquinone-8 > Ubiquinol-8 +2 Hydrogen ion
2 Hydrogen ion + Hydrogen (gas) + Ubiquinone-8 > Ubiquinol-8 +2 Hydrogen ion
2-Demethylmenaquinone 8 + 2 Hydrogen ion + Hydrogen (gas) > 2-Demethylmenaquinol 8 +2 Hydrogen ion
2-Demethylmenaquinone 8 + 2 Hydrogen ion + Hydrogen (gas) > 2-Demethylmenaquinol 8 +2 Hydrogen ion
2 Hydrogen ion + Hydrogen (gas) + Menaquinone 8 > Menaquinol 8 +2 Hydrogen ion
2 Hydrogen ion + Hydrogen (gas) + Menaquinone 8 > Menaquinol 8 +2 Hydrogen ion
2 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Oxygen + Ubiquinol-8 > Water + Ubiquinone-8 +2 Hydrogen ion
2-Demethylmenaquinol 8 + Hydrogen ion + Trimethylamine N-Oxide > 2-Demethylmenaquinone 8 + Water + Trimethylamine
Adenosine triphosphate + Water + Spermidine > ADP + Hydrogen ion + Phosphate + Spermidine
2 Hydrogen ion + Nitrate + Ubiquinol-8 > Water + Nitrite + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Nitrate + Ubiquinol-8 > Water + Nitrite + Ubiquinone-8 +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Nitrate > Water + Menaquinone 8 + Nitrite +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Nitrate > Water + Menaquinone 8 + Nitrite +2 Hydrogen ion
2 Hydrogen ion + Menaquinone 8 + Formic acid > Menaquinol 8 + Carbon dioxide + Hydrogen ion
2 Hydrogen ion + Menaquinone 8 + Formic acid > Menaquinol 8 + Carbon dioxide + Hydrogen ion
Adenosine triphosphate + Water + D-Alanyl-D-alanine > ADP + D-Alanyl-D-alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + D-Galactose > ADP + D-Galactose + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Arginine > ADP + L-Arginine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sulfate > ADP + Hydrogen ion + Phosphate + Sulfate
Adenosine triphosphate + Water + Thiosulfate > ADP + Hydrogen ion + Phosphate + Thiosulfate
glutaredoxin + Phosphoadenosine phosphosulfate > glutaredoxin +2 Hydrogen ion + Adenosine 3',5'-diphosphate + Sulfite
Phosphoadenosine phosphosulfate + Reduced Thioredoxin >2 Hydrogen ion + Adenosine 3',5'-diphosphate + Sulfite + Oxidized Thioredoxin
2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + 2 Flavodoxin reduced + Hydrogen ion >2 flavodoxin semi oxidized + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water
Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + two linked disacharide pentapeptide murein units (uncrosslinked, middle of chain) > Hydrogen ion + Undecaprenyl diphosphate + three linked disacharide pentapeptide murein units (uncrosslinked, middle of chain)
2 Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine >2 Hydrogen ion +2 Undecaprenyl diphosphate + two linked disacharide pentapeptide murein units (uncrosslinked, middle of chain)
Adenosine triphosphate + Water + L-Leucine > ADP + Hydrogen ion + L-Leucine + Phosphate
Adenosine triphosphate + Water + Nickel > ADP + Hydrogen ion + Nickel + Phosphate
2-Ketobutyric acid + Hydrogen ion + Pyruvic acid > 2-Aceto-2-hydroxy-butyrate + Carbon dioxide
Hydrogen ion + 2 Pyruvic acid > (S)-2-Acetolactate + Carbon dioxide
Hydrogen ion + NADPH + Oxidized Thioredoxin > NADP + Reduced Thioredoxin
2 Hydrogen ion + Ubiquinone-8 + Formic acid > Ubiquinol-8 + Carbon dioxide + Hydrogen ion
2 Hydrogen ion + Ubiquinone-8 + Formic acid > Ubiquinol-8 + Carbon dioxide + Hydrogen ion
Formic acid + Hydrogen ion > Carbon dioxide + Hydrogen (gas)
Adenosine triphosphate + Water + Ribose > ADP + Hydrogen ion + Phosphate + Ribose
L-Aspartic acid + Carbamoylphosphate <> Ureidosuccinic acid + Hydrogen ion + Phosphate
2 Adenosine triphosphate + L-Glutamine + Water + Hydrogen carbonate >2 ADP + Carbamoylphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
1-Deoxy-D-xylulose 5-phosphate + NAD + O-Phospho-4-hydroxy-L-threonine > Carbon dioxide + Hydrogen ion +2 Water + NADH + Pyridoxine 5'-phosphate + Phosphate
Adenosine triphosphate + D-Xylulose <> ADP + Hydrogen ion + Xylulose 5-phosphate
Adenosine triphosphate + L-Threo-2-pentulose <> ADP + Hydrogen ion + L-Xylulose 5-phosphate
Adenosine triphosphate + Water + Thiamine > ADP + Hydrogen ion + Phosphate + Thiamine
Dihydroneopterin triphosphate + Water > Dihydroneopterin monophosphate + Hydrogen ion + Pyrophosphate
Guanosine triphosphate + Water > Guanosine monophosphate + Hydrogen ion + Pyrophosphate
dGTP + Water > 2'-Deoxyguanosine 5'-monophosphate + Hydrogen ion + Pyrophosphate
Ubiquinone-8 + D-Glucose + Water > Ubiquinol-8 + Gluconic acid + Hydrogen ion
Carbon dioxide + Water <> Hydrogen ion + Hydrogen carbonate
Adenosine triphosphate + Water + Ferric coprogen > ADP + Ferric coprogen + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Aerobactin > ADP + Aerobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferrichrome > ADP + Ferrichrome + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferroxamine > ADP + Ferroxamine + Hydrogen ion + Phosphate
Acetyl-CoA + Adenosine triphosphate + Hydrogen carbonate <> ADP + Hydrogen ion + Malonyl-CoA + Phosphate
Hydrogen ion + L-Lysine <> Cadaverine + Carbon dioxide
Adenosine triphosphate + Water + L-Methionine > ADP + Hydrogen ion + L-Methionine + Phosphate
Adenosine triphosphate + Water + D-Methionine > ADP + Hydrogen ion + D-Methionine + Phosphate
2,5-Diketo-D-gluconate + Hydrogen ion + NADPH >2 -Dehydro-L-gulonate + NADP
Acetaldehyde + Coenzyme A + NAD <> Acetyl-CoA + Hydrogen ion + NADH
Adenosine triphosphate + Water + Taurine > ADP + Hydrogen ion + Phosphate + Taurine
2 D-Alanine + Adenosine triphosphate <> ADP + D-Alanyl-D-alanine + Hydrogen ion + Phosphate
2-Dehydropantoate + Hydrogen ion + NADPH <> NADP + (R)-Pantoate
-->-->2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Water > 4-Amino-2-methyl-5-phosphomethylpyrimidine + Hydrogen ion + Phosphate
Tartronate semialdehyde + Hydrogen ion + NADH <> Glyceric acid + NAD
Adenosine triphosphate + Carbon dioxide + Ammonium <> ADP + Carbamoylphosphate +2 Hydrogen ion
Adenosine triphosphate + Water + Ferric enterobactin > ADP + Ferric enterobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + ferric 2,3-dihydroxybenzoylserine > ADP + ferric 2,3-dihydroxybenzoylserine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Glutamate > ADP + L-Glutamate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Aspartic acid > ADP + L-Aspartic acid + Hydrogen ion + Phosphate
Cyclic pyranopterin monophosphate + Copper + 2 MoaD Protein with thiocarboxylate >5 Hydrogen ion +2 MoaD Protein with carboxylate + Molybdopterin
Adenosine triphosphate + Water + L-Glutamine > ADP + L-Glutamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glutathione > ADP + Glutathione + Hydrogen ion + Phosphate
Water + Undecaprenyl diphosphate > Hydrogen ion + Phosphate + Undecaprenyl phosphate
Adenosine triphosphate + L-Cysteine + Water > ADP + Hydrogen ion + Phosphate + L-Cysteine
Adenosine triphosphate + Water + Ethanesulfonate > ADP + Ethanesulfonate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Methanesulfonate > ADP + Hydrogen ion + Methanesulfonate + Phosphate
Adenosine triphosphate + Water + Sulfoacetate > ADP + Hydrogen ion + Phosphate + Sulfoacetate
Flavin Mononucleotide + Hydrogen ion + NADH > FMNH + NAD
2 Hydrogen ion + Menaquinol 8 + Oxygen > Water + Menaquinone 8 +2 Hydrogen ion
2 Hydrogen ion + Menaquinol 8 + Oxygen > Water + Menaquinone 8 +2 Hydrogen ion
Hydrogen ion + Malonic semialdehyde + NADPH > 3-Hydroxypropanoate + NADP
Hydrogen ion + NADH + Oxygen + Uracil > NAD + Ureidoacrylate peracid
Glyoxylic acid + Hydrogen ion + NADPH + Glycolate <> Glycolic acid + NADP
Hydrogen ion + Hydroxypyruvic acid + NADH > Glyceric acid + NAD
Hydrogen ion + Hydroxypyruvic acid + NADPH > Glyceric acid + NADP
Dodecanoyl-ACP (n-C12:0ACP) + Hydrogen ion + Phosphate > acyl carrier protein + Dodecanoly-phosphate (n-C12:0)
Hydrogen ion + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1) + Phosphate > acyl carrier protein + Octadecanoyl-phosphate (n-C18:1)
Hydrogen ion + Myristoyl-ACP (n-C14:0ACP) + Phosphate > acyl carrier protein + Tetradecanoyl-phosphate (n-C14:0)
Hydrogen ion + Octadecanoyl-ACP (n-C18:0ACP) + Phosphate > acyl carrier protein + Octadecanoyl-phosphate (n-C18:0)
Hydrogen ion + Palmitoyl-ACP (n-C16:0ACP) + Phosphate > acyl carrier protein + Hexadecanoyl-phosphate (n-C16:0)
Butyryl-ACP (n-C4:0ACP) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -Oxohexanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Decanoyl-ACP (n-C10:0ACP) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -Oxododecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + Palmitoyl-ACP (n-C16:0ACP) >3 -Oxooctadecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Adenosine triphosphate + Water + L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine > L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + ADP + Hydrogen ion + Phosphate
Chorismate + L-Glutamine <> 2-Aminobenzoic acid + L-Glutamate + Hydrogen ion + Pyruvic acid
Adenosine triphosphate + Water + L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate > L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + ADP + Hydrogen ion + Phosphate
Ethanol + NAD <> Acetaldehyde + Hydrogen ion + NADH
NADH + NADP + 2 Hydrogen ion >2 Hydrogen ion + NAD + NADPH
NADH + NADP + 2 Hydrogen ion >2 Hydrogen ion + NAD + NADPH
Dihydrofolic acid + Hydrogen ion + NADPH <> NADP + Tetrahydrofolic acid
Adenosine triphosphate + Pyridoxal <> ADP + Hydrogen ion + Pyridoxal 5'-phosphate
[2Fe-1S] desulfurated iron-sulfur cluster + Adenosine triphosphate + Water + SufBCD scaffold complex + SufSE with bound sulfur > ADP +5 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster + SufSE sulfur acceptor complex
FADH2 + 2 Hydrogen ion + SufBCD with two bound [2Fe-2S] clusters > FAD + SufBCD with bound [4Fe-4S] cluster
4 Hydrogen ion + SufBCD with bound [2Fe-2S] cluster > [2Fe-2S] iron-sulfur cluster + SufBCD scaffold complex
4 Hydrogen ion + SufBCD with bound [4Fe-4S] cluster > [4Fe-4S] iron-sulfur cluster + SufBCD scaffold complex
3-Dehydro-shikimate + Hydrogen ion + NADPH <> NADP + Shikimic acid
Adenosine triphosphate + Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion > Adenosine monophosphate + Lauroyl-CoA + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion > Adenosine monophosphate + Lauroyl-CoA + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Palmitic acid > Adenosine monophosphate + Hydrogen ion + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Palmitic acid > Adenosine monophosphate + Hydrogen ion + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Tetradecanoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Tetradecanoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + (2E)-Tetradecenoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + (2E)-Tetradecenoyl-CoA
Adenosine triphosphate + Water + Adenosylcobalamin > Adenosylcobalamin + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cob(I)alamin > ADP + Cob(I)alamin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cobinamide > ADP + Cobinamide + Hydrogen ion + Phosphate
Cytidine triphosphate + Water > Cytidine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion > Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion > Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Caprylic acid > Adenosine monophosphate + Hydrogen ion + Octanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Caprylic acid > Adenosine monophosphate + Hydrogen ion + Octanoyl-CoA + Pyrophosphate
-->-->Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0) > Adenosine monophosphate + Hydrogen ion + Hexanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0) > Adenosine monophosphate + Hydrogen ion + Hexanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1) > Adenosine monophosphate + Hydrogen ion + Octadecenoyl-CoA (N-C18:1CoA) + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1) > Adenosine monophosphate + Hydrogen ion + Octadecenoyl-CoA (N-C18:1CoA) + Pyrophosphate
ADP + Hydrogen ion + Phosphoenolpyruvic acid <> Adenosine triphosphate + Pyruvic acid
Adenosine triphosphate + Water + Zinc > ADP + Hydrogen ion + Phosphate + Zinc
Adenosine triphosphate + Water + L-Arabinose > ADP + L-Arabinose + Hydrogen ion + Phosphate
L-Glutamine + Phosphoribulosylformimino-AICAR-P > Phosphoribosyl formamidocarboxamide + D-Erythro-imidazole-glycerol-phosphate + L-Glutamate + Hydrogen ion
(O16 antigen)x2 undecaprenyl diphosphate + O16 antigen undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x3 undecaprenyl diphosphate + Undecaprenyl diphosphate
(O16 antigen)x3 undecaprenyl diphosphate + O16 antigen undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x4 undecaprenyl diphosphate + Undecaprenyl diphosphate
2 O16 antigen undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x2 undecaprenyl diphosphate + Undecaprenyl diphosphate
Thymidine 5'-triphosphate + Glucose 1-phosphate + Hydrogen ion <> dTDP-D-Glucose + Pyrophosphate
Adenosine triphosphate + D-Galactose + Alpha-D-Galactose <> ADP + Galactose 1-phosphate + Hydrogen ion
4-Amino-5-hydroxymethyl-2-methylpyrimidine + Adenosine triphosphate <> 4-Amino-2-methyl-5-phosphomethylpyrimidine + ADP + Hydrogen ion + 4-amino-5-phosphonooxymethyl-2-methylpyrimidine
Adenosine triphosphate + Water + Choline > ADP + Choline + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Betaine > ADP + Betaine + Hydrogen ion + Phosphate
D-Lactic acid + NAD <> Hydrogen ion + NADH + Pyruvic acid
Dihydrouracil + NAD <> Hydrogen ion + NADH + Uracil
Adenosine triphosphate + Water + D-Glucose > ADP + D-Glucose + Hydrogen ion + Phosphate
S-Formylglutathione + Water <> Formic acid + Glutathione + Hydrogen ion
Adenosine triphosphate + Water + Heme > ADP + Hydrogen ion + Phosphate + Heme
2-Demethylmenaquinone 8 + 4 Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD +3 Hydrogen ion
2-Demethylmenaquinone 8 + 4 Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD +3 Hydrogen ion
4 Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8 +3 Hydrogen ion
4 Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8 +3 Hydrogen ion
4 Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD +3 Hydrogen ion
4 Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD +3 Hydrogen ion
Adenosine triphosphate + Water + L-Histidine > ADP + Hydrogen ion + L-Histidine + Phosphate
Adenosine triphosphate + Water + L-Lysine > ADP + Hydrogen ion + L-Lysine + Phosphate
Adenosine triphosphate + Water + Ornithine > ADP + Hydrogen ion + Ornithine + Phosphate
Acetyl-ACP + Hydrogen ion + Malonyl-[acyl-carrier protein] > acyl carrier protein + Acetoacetyl-ACP + Carbon dioxide
Dodecanoyl-ACP (n-C12:0ACP) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -Oxotetradecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Hexanoyl-ACP (n-C6:0ACP) + Malonyl-[acyl-carrier protein] >3 -Oxooctanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + Myristoyl-ACP (n-C14:0ACP) >3 -Oxohexadecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + Octanoyl-ACP (n-C8:0ACP) >3 -Oxodecanoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
O-Acetylserine + Hydrogen sulfide <> Acetic acid + L-Cysteine + Hydrogen ion
4 Hydrogen ion + IscU with bound [2Fe-2S] cluster > [2Fe-2S] iron-sulfur cluster + IscU scaffold protein
4 Hydrogen ion + IscU with bound [4Fe-4S] cluster > [4Fe-4S] iron-sulfur cluster + IscU scaffold protein
[2Fe-1S] desulfurated iron-sulfur cluster + IscS with bound sulfur + IscU scaffold protein >4 Hydrogen ion + IscS sulfur acceptor protein + IscU with bound [2Fe-2S] cluster
Adenosine triphosphate + Dehydroglycine + 1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + IscS with bound sulfur + NADPH > 4-Methyl-5-(2-phosphoethyl)-thiazole + Adenosine monophosphate + Carbon dioxide +2 Water + IscS sulfur acceptor protein + NADP + Pyrophosphate
trans-Cinnamic acid + Hydrogen ion + NADH + Oxygen > cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
Hydrogen ion + NADH + Oxygen + Hydrocinnamic acid > Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD
Water + NADP + Succinic acid semialdehyde >2 Hydrogen ion + NADPH + Succinic acid
Adenosine triphosphate + Water + Carnitine > ADP + Carnitine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Proline > ADP + Hydrogen ion + Phosphate + L-Proline
Adenosine triphosphate + Water + Crotonobetaine > ADP + Crotonobetaine + Hydrogen ion + Phosphate
Hydrogen ion + NADH + 2 Nitric oxide > Water + Nitrous oxide + NAD
Water + Pyrophosphate > Hydrogen ion +2 Phosphate
FAD + Hydrogen ion + NADPH > FADH2 + NADP
5 Hydrogen ion + 3 NADPH + Sulfite <>3 Water + Hydrogen sulfide +3 NADP
dATP + Water > Deoxyadenosine monophosphate + Hydrogen ion + Pyrophosphate
dCTP + Water > dCMP + Hydrogen ion + Pyrophosphate
Thymidine 5'-triphosphate + Water > 5-Thymidylic acid + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Guanosine diphosphate > Adenosine monophosphate + Hydrogen ion + Guanosine 3',5'-bis(diphosphate)
Water + Hypoxanthine + NAD > Hydrogen ion + NADH + Xanthine
Water + NAD + Xanthine <> Hydrogen ion + NADH + Uric acid
D-Erythrose 4-phosphate + Water + NAD <> 4-Phospho-D-erythronate +2 Hydrogen ion + NADH
Hydrogen ion + Ornithine + L-Ornithine <> Carbon dioxide + Putrescine + Ethylenediamine
Hydrogen ion + Pyruvaldehyde + NADPH > Acetol + NADP
Adenosine triphosphate + Water + (enterobacterial common antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (enterobacterial common antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + (O16 antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (O16 antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + cold adapted KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + cold adapted KDO(2)-lipid (A)
Adenosine triphosphate + Water + core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A
Adenosine triphosphate + Water + core oligosaccharide lipid A diphosphate > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A diphosphate
Adenosine triphosphate + Water + KDO2-Lipid A > ADP + Hydrogen ion + Phosphate + KDO2-Lipid A
Adenosine triphosphate + Water + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A
Adenosine triphosphate + Water + KDO(2)-lipid IV(A) > ADP + Hydrogen ion + Phosphate + KDO(2)-lipid IV(A)
Adenosine triphosphate + Water + Phosphoethanolamine KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + Phosphoethanolamine KDO(2)-lipid (A)
5 Hydrogen ion + 3 NADH + Nitrite >2 Water +3 NAD + Ammonium
Adenosine triphosphate + Shikimic acid <> ADP + Hydrogen ion + Shikimate 3-phosphate
Adenosine diphosphate ribose + Water <> Adenosine monophosphate +2 Hydrogen ion + D-Ribose-5-phosphate
Adenosine triphosphate + Water + Glycerophosphocholine > ADP + Glycerophosphocholine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerylphosphorylethanolamine > ADP + Glycerylphosphorylethanolamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 3-phosphate > ADP + Glycerol 3-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 2-phosphate > ADP + Glycerol 2-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoglycerol > ADP + Glycerophosphoglycerol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoserine > ADP + Glycerophosphoserine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sn-Glycero-3-phospho-1-inositol > ADP + Sn-Glycero-3-phospho-1-inositol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Alanine > ADP + L-Alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Threonine > ADP + Hydrogen ion + Phosphate + L-Threonine
Adenosine triphosphate + Water + L-Isoleucine > ADP + Hydrogen ion + L-Isoleucine + Phosphate
Adenosine triphosphate + Water + L-Valine > ADP + Hydrogen ion + Phosphate + L-Valine
apoprotein [acyl carrier protein] + Coenzyme A > acyl carrier protein + Hydrogen ion + Adenosine 3',5'-diphosphate
L-Glutamate + Hydrogen ion <> gamma-Aminobutyric acid + Carbon dioxide
Adenosine triphosphate + Water + Cysteinylglycine > ADP + Cysteinylglycine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Prolinylglycine > ADP + Hydrogen ion + Phosphate + L-Prolinylglycine
Glyoxylic acid + Hydrogen ion + NADH > Glycolic acid + NAD
Adenosine triphosphate + Water + D-Xylose > ADP + Hydrogen ion + Phosphate + D-Xylose
Deoxyuridine triphosphate + Water <> dUMP + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Water + Phosphate > ADP + Hydrogen ion +2 Phosphate
(enterobacterial common antigen)x2 undecaprenyl-diphosphate + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose > (enterobacterial common antigen)x3 undecaprenyl-diphosphate + Hydrogen ion + Undecaprenyl diphosphate
(enterobacterial common antigen)x3 undecaprenyl-diphosphate + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose > (enterobacterial common antigen)x4 undecaprenyl-diphosphate + Hydrogen ion + Undecaprenyl diphosphate
2 Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose > (enterobacterial common antigen)x2 undecaprenyl-diphosphate + Hydrogen ion + Undecaprenyl diphosphate
2 S-Adenosylmethionine + Uroporphyrinogen III >2 S-Adenosylhomocysteine + Precorrin 2 + Hydrogen ion
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD scaffold complex + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster +2 SufSE sulfur acceptor complex
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD with bound [2Fe-2S] cluster + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with two bound [2Fe-2S] clusters +2 SufSE sulfur acceptor complex
FADH2 + 2 Iron + 2 IscS with bound sulfur + IscU scaffold protein > FAD +6 Hydrogen ion +2 IscS sulfur acceptor protein + IscU with bound [2Fe-2S] cluster
FADH2 + 2 Iron + 2 IscS with bound sulfur + IscU with bound [2Fe-2S] cluster > FAD +6 Hydrogen ion +2 IscS sulfur acceptor protein + IscU with two bound [2Fe-2S] clusters
Hydrogen ion + NADPH + Riboflavin > NADP + Reduced riboflavin
Flavin Mononucleotide + Hydrogen ion + NADPH <> FMNH + NADP
Acetoacetyl-CoA + Hydrogen ion + NADH <> 3-Hydroxybutyryl-CoA + NAD
3-Oxotetradecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxytetradecanoyl-CoA + NAD
3-Oxododecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxydodecanoyl-CoA + NAD
3-Oxodecanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxydecanoyl-CoA + NAD
3-Oxooctanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxyoctanoyl-CoA + NAD
3-Oxohexanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxyhexanoyl-CoA + NAD
3-Oxohexadecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxyhexadecanoyl-CoA + NAD
3-Oxooctadecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxyoctadecanoyl-CoA + NAD
Guanosine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor mono-guanine dinucleotide + Pyrophosphate
tungsten bispterin cofactor mono-guanine dinucleotide + Guanosine triphosphate + Hydrogen ion > tungsten bispterin cofactor guanine dinucleotide + Pyrophosphate
Adenosine triphosphate + L-Glutamate + Ammonium > ADP + L-Glutamine + Hydrogen ion + Phosphate
2 Hydrogen ion + 2 Superoxide anion > Hydrogen peroxide + Oxygen
Adenosine triphosphate + Fructose 6-phosphate > ADP + Fructose 1,6-bisphosphate + Hydrogen ion
L-Homoserine + NADP <> L-Aspartate-semialdehyde + Hydrogen ion + NADPH
Water + NAD <> Adenosine monophosphate +2 Hydrogen ion + Nicotinamide ribotide + NMN
Acetyl-CoA + Glyoxylic acid + Water <> Coenzyme A + Hydrogen ion + L-Malic acid
5-Methyltetrahydrofolic acid + L-Homocysteine <> Hydrogen ion + L-Methionine + Tetrahydrofolic acid
Adenosine triphosphate + Water + D-Maltose > ADP + Hydrogen ion + D-Maltose + Phosphate
Adenosine triphosphate + Water + Maltotriose > ADP + Hydrogen ion + Maltotriose + Phosphate
Adenosine triphosphate + Water + Maltotetraose > ADP + Hydrogen ion + Maltotetraose + Phosphate
Adenosine triphosphate + Water + 1,4-alpha-D-glucan > 1,4-alpha-D-glucan + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Maltohexaose > ADP + Hydrogen ion + Maltohexaose + Phosphate
Adenosine triphosphate + Water + Maltopentaose > ADP + Hydrogen ion + Maltopentaose + Phosphate
3 Ubiquinol-8 + 2 Hydrogen ion + Nitrite >3 Ubiquinone-8 +2 Water + Ammonium
3 Menaquinol 8 + 2 Hydrogen ion + Nitrite >3 Menaquinone 8 +2 Water + Ammonium
Adenosine triphosphate + Water + D-Allose > ADP + D-Allose + Hydrogen ion + Phosphate
Water + Inosine triphosphate > Hydrogen ion + IDP + Phosphate
3-Dehydro-L-gulonate 6-phosphate + Hydrogen ion <> Carbon dioxide + L-Xylulose 5-phosphate
Carbamoylphosphate + Ornithine + L-Ornithine <> Citrulline + Hydrogen ion + Phosphate
Adenosine triphosphate + Gluconic acid <> 6-Phosphogluconic acid + ADP + Hydrogen ion
Adenosine triphosphate + Water + Fe(III)dicitrate > ADP +2 Citric acid + Fe3+ + Hydrogen ion + Phosphate
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN <> NAD + Pyrophosphate
Adenosine triphosphate + L-Homoserine <> ADP + Hydrogen ion + O-Phosphohomoserine
Adenosine triphosphate + Hydrogen ion + Molybdopterin <> Adenylated molybdopterin + Pyrophosphate
Adenosine triphosphate + Riboflavin <> ADP + Flavin Mononucleotide + Hydrogen ion
Adenosine triphosphate + Flavin Mononucleotide + Hydrogen ion > FAD + Pyrophosphate
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Water + Isopentenyl pyrophosphate + NAD
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Dimethylallylpyrophosphate + Water + NAD
2,3-Dihydrodipicolinic acid + Hydrogen ion + NADPH > NADP + Tetrahydrodipicolinate
Diadenosine tetraphosphate + Water <>2 ADP +2 Hydrogen ion
P1,P4-Bis(5'-guanosyl) tetraphosphate + Water >2 Guanosine diphosphate +2 Hydrogen ion
Adenosine triphosphate + L-Ribulose > ADP + Hydrogen ion + L-Ribulose 5-phosphate
alpha-Ketoisovaleric acid + Acetyl-CoA + Water + a-Ketoisovaleric acid <> 2-Isopropylmalic acid + Coenzyme A + Hydrogen ion
Diaminopimelic acid + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
D-Alanyl-D-alanine + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-6-carboxy-L-lysyl-D-alanyl-D-alanine
Adenosine triphosphate + D-Glutamic acid + UDP-N-Acetylmuramoyl-L-alanine <> ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate
Uridine diphosphate-N-acetylglucosamine + Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine > Hydrogen ion + Undecaprenyl-diphospho-N-acetylmuramoyl-(N-acetylglucosamine)-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + Uridine 5'-diphosphate
L-Alanine + Adenosine triphosphate + UDP-N-Acetylmuraminate <> ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanine
Guanosine monophosphate + 2 Hydrogen ion + NADPH > Inosinic acid + NADP + Ammonium
2 Hydrogen ion + Phosphoribosyl pyrophosphate + Quinolinic acid <> Carbon dioxide + Nicotinamide ribotide + Pyrophosphate
S-Adenosylmethionine + Hydrogen ion <> S-Adenosylmethioninamine + Carbon dioxide
S-Adenosylmethioninamine + Putrescine + Ethylenediamine <> 5'-Methylthioadenosine + Hydrogen ion + Spermidine
Cadaverine + S-Adenosylmethioninamine > 5'-Methylthioadenosine + Hydrogen ion + Aminopropylcadaverine
4 Copper + 4 Hydrogen ion + Oxygen >4 Copper +2 Water
4 Iron + 4 Hydrogen ion + Oxygen >4 Fe3+ +2 Water
L-Aspartic acid + Hydrogen ion <> beta-Alanine + Carbon dioxide
beta-Alanine + Adenosine triphosphate + (R)-Pantoate <> Adenosine monophosphate + Hydrogen ion + Pantothenic acid + Pyrophosphate
6-Hydroxymethyl dihydropterin + Adenosine triphosphate > 6-Hydroxymethyl-dihydropterin pyrophosphate + Adenosine monophosphate + Hydrogen ion
1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + NADPH <> 2-C-Methyl-D-erythritol-4-phosphate + NADP
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-didodecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadec-9-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dioctadec-11-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-Dioctadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradec-7-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
(R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine > acyl carrier protein + Hydrogen ion + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine
2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine <> Hydrogen ion + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate + Uridine 5'-diphosphate
Water + S-Lactoylglutathione > Glutathione + Hydrogen ion + D-Lactic acid
L-Glutamic acid 5-phosphate + Hydrogen ion + NADPH > L-Glutamic-gamma-semialdehyde + NADP + Phosphate
L-Homocysteine + S-Methylmethionine > Hydrogen ion +2 L-Methionine
S-Adenosylmethionine + L-Homocysteine + S-Methylmethionine <> S-Adenosylhomocysteine + Hydrogen ion + L-Methionine
Choline + NAD > Betaine aldehyde + Hydrogen ion + NADH
Betaine aldehyde + Water + NADP > Betaine +2 Hydrogen ion + NADPH
Betaine aldehyde + Water + NAD <> Betaine +2 Hydrogen ion + NADH
Water + Oxalacetic acid + Propionyl-CoA <> Methylcitric acid + Coenzyme A + Hydrogen ion + (2S,3S)-2-hydroxybutane-1,2,3-tricarboxylate
Cytosine + Hydrogen ion + Water > Ammonium + Uracil
Cyanate + 3 Hydrogen ion + Hydrogen carbonate >2 Carbon dioxide + Ammonium
3-(3-Hydroxyphenyl)propanoic acid + Hydrogen ion + NADH + Oxygen > 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > Trans-2,3-Dihydroxycinnamate + Water + NAD
3-(2,3-Dihydroxyphenyl)propionic acid + Oxygen > Hydrogen ion + 2-Hydroxy-6-ketononadienedicarboxylate
Trans-2,3-Dihydroxycinnamate + Oxygen > Hydrogen ion + 2-Hydroxy-6-ketononatrienedioate
Water + 2-Hydroxy-6-ketononadienedicarboxylate > Hydrogen ion + 2-Hydroxy-2,4-pentadienoate + Succinic acid
Water + 2-Hydroxy-6-ketononatrienedioate > Fumaric acid + Hydrogen ion + 2-Hydroxy-2,4-pentadienoate
D-Glyceraldehyde + Hydrogen ion + NADH <> Glycerol + NAD
S-(Hydroxymethyl)glutathione + NAD <> S-Formylglutathione + Hydrogen ion + NADH
alpha-Ketoglutarate + Oxygen + Taurine <> Aminoacetaldehyde + Carbon dioxide + Hydrogen ion + Sulfite + Succinic acid
L-D-1-Pyrroline-5-carboxylic acid + 2 Hydrogen ion + NADPH > NADP + L-Proline
Adenosine triphosphate + D-Fructose > ADP + Fructose 6-phosphate + Hydrogen ion
Decanoyl-ACP (n-C10:0ACP) + Water > acyl carrier protein + Decanoate (N-C10:0) + Hydrogen ion
Dodecanoyl-ACP (n-C12:0ACP) + Water > acyl carrier protein + Dodecanoate (N-C12:0) + Hydrogen ion
Water + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1) > acyl carrier protein + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + Myristoyl-ACP (n-C14:0ACP) > acyl carrier protein + Hydrogen ion + tetradecanoate (n-C14:0)
Water + Octanoyl-ACP (n-C8:0ACP) > acyl carrier protein + Hydrogen ion + Caprylic acid
Water + Palmitoyl-ACP (n-C16:0ACP) > acyl carrier protein + Hydrogen ion + Palmitic acid
2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Hydrogen ion + Water > 5-Amino-6-(5'-phosphoribosylamino)uracil + Ammonium
5-Amino-6-(5'-phosphoribosylamino)uracil + Hydrogen ion + NADPH > 5-Amino-6-(5'-phosphoribitylamino)uracil + NADP
D-Glyceraldehyde 3-phosphate + Hydrogen ion + Pyruvic acid <> Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate
Adenosine triphosphate + 7-Deaza-7-carboxyguanine + Ammonium > ADP + Hydrogen ion + Water + Phosphate + 7-Cyano-7-carbaguanine
Water + Octanoyl-CoA > Coenzyme A + Hydrogen ion + Caprylic acid
Water + Palmityl-CoA > Coenzyme A + Hydrogen ion + Palmitic acid
Water + Tetradecanoyl-CoA > Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0)
Water + Hexanoyl-CoA > Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0)
Water + (2E)-Tetradecenoyl-CoA > Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + Octadecenoyl-CoA (N-C18:1CoA) > Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1)
Water + Stearoyl-CoA > Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0)
Lauroyl-CoA + Water > Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion
Decanoyl-CoA (N-C10:0CoA) + Water > Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion
Adenosine + Adenosine triphosphate > ADP + Adenosine monophosphate + Hydrogen ion
Adenosine triphosphate + Guanosine > ADP + Guanosine monophosphate + Hydrogen ion
Adenosine triphosphate + Inosine <> ADP + Hydrogen ion + Inosinic acid
Water + Uridine diphosphate-N-acetylglucosamine > N-Acetyl-glucosamine 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphategalactose > Galactose 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + Uridine diphosphate glucuronic acid > D-Glucuronate 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Water + UDP-Glucose > Glucose 1-phosphate +2 Hydrogen ion + Uridine 5'-monophosphate
Adenosine triphosphate + Copper + Water > ADP + Hydrogen ion + Phosphate + Copper
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerylphosphorylethanolamine + Hydrogen ion
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + tetradecanoate (n-C14:0)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Palmitic acid
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)
1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecenoate (N-C18:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerophosphoglycerol + Hydrogen ion
1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Water > Glycerophosphoglycerol + Hydrogen ion + tetradecanoate (n-C14:0)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Palmitic acid
1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)
1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecenoate (N-C18:1)
1-Dodecanoyl-sn-glycerol 3-phosphate + Water > Dodecanoate (N-C12:0) + Glycerol 3-phosphate + Hydrogen ion
1-hexadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Palmitic acid
1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Octadecenoate (N-C18:1)
1-Octadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)
1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + Tetradecenoate (N-C14:1)
1-Tetradecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate + Hydrogen ion + tetradecanoate (n-C14:0)
2 Hydrogen ion + Water + (S)-Ureidoglycolic acid > Carbon dioxide + Glyoxylic acid +2 Ammonium
2 Glyoxylic acid + Hydrogen ion <> Tartronate semialdehyde + Carbon dioxide
Allantoin + Water > Allantoic acid + Hydrogen ion
Adenosine triphosphate + Glyceric acid > 3-Phosphoglycerate + ADP + Hydrogen ion
Allantoic acid + 2 Hydrogen ion + 2 Water > Carbon dioxide +2 Ammonium + (S)-Ureidoglycolic acid
NAD + (S)-Ureidoglycolic acid <> Hydrogen ion + NADH + Oxalureate
5-Aminoimidazole ribonucleotide + Adenosine triphosphate + Hydrogen carbonate > 5-Phosphoribosyl-5-carboxyaminoimidazole + ADP + Hydrogen ion + Phosphate
Water + UDP-2,3-Bis(3-hydroxytetradecanoyl)glucosamine <>2 Hydrogen ion + 2,3-Bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl 1-phosphate + Uridine 5'-monophosphate
Water + 5,10-Methenyltetrahydrofolate <> N10-Formyl-THF + Hydrogen ion
5,10-Methylene-THF + NADP <> 5,10-Methenyltetrahydrofolate + NADPH + Hydrogen ion
6,7-Dihydropteridine + 3 Hydrogen ion + NADH <> NAD + Tetrahydropteridine
6,7-Dihydropteridine + 3 Hydrogen ion + NADPH <> NADP + Tetrahydropteridine
3 (2,3-Dihydroxybenzoyl)adenylic acid + 3 L-Seryl-AMP >6 Adenosine monophosphate + Enterochelin +9 Hydrogen ion
Enterochelin + 3 Water >3 2,3-Dihydroxybenzoylserine +3 Hydrogen ion
Ferric enterobactin + 3 Water >3 2,3-Dihydroxybenzoylserine + Fe3+ +3 Hydrogen ion
Adenosine triphosphate + Hydrogen ion + L-Serine <> Pyrophosphate + L-Seryl-AMP
(2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate + NAD + 2,3-Dihydro-2,3-dihydroxybenzoic acid <> 2-Pyrocatechuic acid + Hydrogen ion + NADH
core oligosaccharide lipid A + Hydrogen ion + Palmitic acid > Water + hepta-acylated core oligosaccharide lipid A (E. coli)
[4Fe-4S] iron-sulfur cluster + 2 S-Adenosylmethionine + Hydrogen ion + NAD + octanoate (protein bound) > [2Fe-2S] iron-sulfur cluster +2 5'-Deoxyadenosine +2 Iron + lipoate (protein bound) +2 L-Methionine + NADH
Hydrogen ion + Octanoyl-ACP (n-C8:0ACP) > acyl carrier protein + octanoate (protein bound)
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide <> Nicotinic acid adenine dinucleotide + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + L-Asparagine + L-Glutamate + Hydrogen ion + Pyrophosphate
Acetyl-CoA + Water + Oxalacetic acid <> Citric acid + Coenzyme A + Hydrogen ion
1,4-Dihydroxy-2-naphthoyl-CoA + Water > Coenzyme A + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion
6-Phosphonoglucono-D-lactone + Water <> 6-Phosphogluconic acid + Hydrogen ion
[2Fe-2S] iron-sulfur cluster + S-Adenosylmethionine + Dethiobiotin > [2Fe-1S] desulfurated iron-sulfur cluster + Biotin + 5'-Deoxyadenosine + Hydrogen ion + L-Methionine
Adenosine triphosphate + Hydrogen ion + MoaD Protein with carboxylate > MoaD Protein with bound AMP + Pyrophosphate
2 Hydrogen ion + Molybdate + Adenylated molybdopterin > Adenosine monophosphate + Copper + Water + Molybdopterin
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PG(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PG(16:0/16:0)
Adenosine triphosphate + Water + PG(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PG(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PG(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PG(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + Water + PG(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PG(14:0/14:0)
Adenosine triphosphate + Water + PG(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PG(12:0/12:0)
Adenosine triphosphate + Water + PG(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PG(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PG(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PG(18:0/18:0)
Adenosine triphosphate + Water + PGP(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PGP(12:0/12:0)
Adenosine triphosphate + Water + PGP(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PGP(14:0/14:0)
Adenosine triphosphate + Water + PGP(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PGP(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PGP(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PGP(16:0/16:0)
Adenosine triphosphate + Water + PGP(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PGP(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PGP(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PGP(18:0/18:0)
Adenosine triphosphate + Water + PGP(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PGP(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate > ADP + Hydrogen ion + 2,3,2'3'-Tetrakis(beta-hydroxymyristoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1,4'-bisphosphate
FMNH + Oxygen + Sulfoacetate > Flavin Mononucleotide + Glyoxylic acid + Hydrogen ion + Water + Sulfite
FMNH + Isethionic acid + Oxygen > Flavin Mononucleotide + Glycolaldehyde + Hydrogen ion + Water + Sulfite
FMNH + Methanesulfonate + Oxygen > Formaldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Butanesulfonate + FMNH + Oxygen > Butanal + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Ethanesulfonate + FMNH + Oxygen > Acetaldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite
Water + Hexadecanoyl-phosphate (n-C16:0) >2 Hydrogen ion + Palmitic acid + Phosphate
Water + Octadecanoyl-phosphate (n-C18:0) >2 Hydrogen ion + Octadecanoate (N-C18:0) + Phosphate
Water + Octadecanoyl-phosphate (n-C18:1) >2 Hydrogen ion + Octadecenoate (N-C18:1) + Phosphate
Water + Tetradecanoyl-phosphate (n-C14:0) >2 Hydrogen ion + Phosphate + tetradecanoate (n-C14:0)
Dodecanoly-phosphate (n-C12:0) + Water > Dodecanoate (N-C12:0) +2 Hydrogen ion + Phosphate
Guanosine triphosphate + Water > Guanosine diphosphate + Hydrogen ion + Phosphate
3-Aminoacrylate + Hydrogen ion + Water > Malonic semialdehyde + Ammonium
Water + Ureidoacrylate peracid > Carbamic acid + Hydrogen ion + Peroxyaminoacrylate
FAD + L-Proline > L-D-1-Pyrroline-5-carboxylic acid + FADH2 + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD > L-Glutamate + Hydrogen ion + NADH
4,5-Dihydroorotic acid + Water <> Ureidosuccinic acid + Hydrogen ion
Acetyl-CoA + Hydrogen ion + Malonyl-[acyl-carrier protein] > Acetoacetyl-ACP + Carbon dioxide + Coenzyme A
Hydrogen ion + Malonyl-[acyl-carrier protein] + malonyl-CoA methyl ester > Carbon dioxide + Coenzyme A +3 -Oxo-glutaryl-[acyl-carrier protein] methyl ester
3 -oxo-cis-dodec-5-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-dodec-5-enoyl-[acyl-carrier protein] + NADP
3 -oxo-cis-myristol-7-eoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-myristol-7-eoyl-[acyl-carrier protein] + NADP
3 -oxo-cis-palm-9-eoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-palm-9-eoyl-[acyl-carrier protein] + NADP
3 -oxo-cis-vacc-11-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > (R)-3-hydroxy-cis-vacc-11-enoyl-[acyl-carrier protein] + NADP
3 -Oxodecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxydecanoyl-[acyl-carrier protein] + NADP
3 -Oxododecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxydodecanoyl-[acyl-carrier protein] + NADP
3 -Oxohexadecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> R-3-hydroxypalmitoyl-[acyl-carrier protein] + NADP
3 -Oxohexanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxyhexanoyl-[acyl-carrier protein] + NADP
3 -Oxooctadecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxyoctadecanoyl-[acyl-carrier protein] + NADP
3 -Oxooctanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxyoctanoyl-[acyl-carrier protein] + NADP
3 -Oxotetradecanoyl-[acyl-carrier protein] + Hydrogen ion + NADPH <> (R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + NADP
Acetoacetyl-ACP + Hydrogen ion + NADPH <> (3R)-3-Hydroxyacyl-[acyl-carrier protein] + NADP
Hydrogen ion + NADPH + 3 -Oxo-glutaryl-[acyl-carrier protein] methyl ester >3 -Hydroxyglutaryl-[acyl-carrier protein] methyl ester + NADP
Hydrogen ion + NADPH + 3 -Oxo-pimeloyl-[acyl-carrier protein] methyl ester >3 -Hydroxypimeloyl-[acyl-carrier protein] methyl ester + NADP
Hydrogen ion + cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + Malonyl-[acyl-carrier protein] >3 -oxo-cis-vacc-11-enoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
4-Amino-4-deoxychorismate <> p-Aminobenzoic acid + Hydrogen ion + Pyruvic acid
Adenosine triphosphate + Thiamine <> ADP + Hydrogen ion + Thiamine monophosphate
2-Demethylmenaquinone 8 + Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD
Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8
Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD
N-Acetyl-D-glucosamine + Adenosine triphosphate <> N-Acetyl-D-Glucosamine 6-Phosphate + ADP + Hydrogen ion
Water + Thiamine pyrophosphate > Hydrogen ion + Phosphate + Thiamine monophosphate
L-Glutamyl-tRNA(Glu) + Hydrogen ion + NADPH > (S)-4-Amino-5-oxopentanoate + NADP + tRNA (Glu)
N10-Formyl-THF + Water <> Formic acid + Hydrogen ion + Tetrahydrofolic acid
Glucose 1-phosphate + Hydrogen ion + Uridine triphosphate <> Pyrophosphate + UDP-Glucose
Adenosine triphosphate + Deoxyuridine > ADP + dUMP + Hydrogen ion
Adenosine triphosphate + Thymidine <> ADP + 5-Thymidylic acid + Hydrogen ion
1-(2-Carboxyphenylamino)-1'-deoxy-D-ribulose 5'-phosphate + Hydrogen ion <> Indoleglycerol phosphate + Carbon dioxide + Water
Adenosine triphosphate + Cob(I)alamin + Hydrogen ion <> Adenosylcobalamin + Triphosphate
Adenosine triphosphate + Cobinamide + Hydrogen ion <> Adenosyl cobinamide + Triphosphate
Guanosine triphosphate + 3 Water <> 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid +2 Hydrogen ion + Pyrophosphate + 2,5-diamino-6-hydroxy-4-(5-phospho-D-ribosylamino)pyrimidine
Hydrogen ion + Orotidylic acid <> Carbon dioxide + Uridine 5'-monophosphate
But-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH > Butyryl-ACP (n-C4:0ACP) + NAD
But-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH > Butyryl-ACP (n-C4:0ACP) + NADP
Hydrogen ion + NADH + trans-3-cis-11-vacceoyl-[acyl-carrier protein] > NAD + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1)
Hydrogen ion + NADH + trans-3-cis-5-dodecenoyl-[acyl-carrier protein] > cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + NAD
Hydrogen ion + NADH + trans-3-cis-7-myristoleoyl-[acyl-carrier protein] > NAD + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Hydrogen ion + NADH + trans-3-cis-9-palmitoleoyl-[acyl-carrier protein] > cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + NAD
Hydrogen ion + NADH + trans-Dec-2-enoyl-[acyl-carrier protein] > Decanoyl-ACP (n-C10:0ACP) + NAD
Hydrogen ion + NADH + trans-Dodec-2-enoyl-[acyl-carrier protein] > Dodecanoyl-ACP (n-C12:0ACP) + NAD
Hydrogen ion + NADH + trans-Hex-2-enoyl-[acyl-carrier protein] > Hexanoyl-ACP (n-C6:0ACP) + NAD
Hydrogen ion + NADH + trans-Hexadec-2-enoyl-[acyl-carrier protein] > NAD + Palmitoyl-ACP (n-C16:0ACP)
Hydrogen ion + NADH + trans-Oct-2-enoyl-[acyl-carrier protein] > NAD + Octanoyl-ACP (n-C8:0ACP)
Hydrogen ion + NADH + trans-octadec-2-enoyl-[acyl-carrier protein] > NAD + Octadecanoyl-ACP (n-C18:0ACP)
Hydrogen ion + NADH + trans-Tetradec-2-enoyl-[acyl-carrier protein] > Myristoyl-ACP (n-C14:0ACP) + NAD
Hydrogen ion + NADPH + trans-3-cis-11-vacceoyl-[acyl-carrier protein] > NADP + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1)
Hydrogen ion + NADPH + trans-3-cis-5-dodecenoyl-[acyl-carrier protein] > cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + NADP
Hydrogen ion + NADPH + trans-3-cis-7-myristoleoyl-[acyl-carrier protein] > NADP + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Hydrogen ion + NADPH + trans-3-cis-9-palmitoleoyl-[acyl-carrier protein] > cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + NADP
Hydrogen ion + NADPH + trans-Dec-2-enoyl-[acyl-carrier protein] > Decanoyl-ACP (n-C10:0ACP) + NADP
Hydrogen ion + NADPH + trans-Dodec-2-enoyl-[acyl-carrier protein] > Dodecanoyl-ACP (n-C12:0ACP) + NADP
Hydrogen ion + NADPH + trans-Hex-2-enoyl-[acyl-carrier protein] > Hexanoyl-ACP (n-C6:0ACP) + NADP
Hydrogen ion + NADPH + trans-Hexadec-2-enoyl-[acyl-carrier protein] > NADP + Palmitoyl-ACP (n-C16:0ACP)
Hydrogen ion + NADPH + trans-Oct-2-enoyl-[acyl-carrier protein] > NADP + Octanoyl-ACP (n-C8:0ACP)
Hydrogen ion + NADPH + trans-octadec-2-enoyl-[acyl-carrier protein] > NADP + Octadecanoyl-ACP (n-C18:0ACP)
Hydrogen ion + NADPH + trans-Tetradec-2-enoyl-[acyl-carrier protein] > Myristoyl-ACP (n-C14:0ACP) + NADP
Enoylglutaryl-[acyl-carrier protein] methyl ester + Hydrogen ion + NADPH > Glutaryl-[acyl-carrier protein] methyl ester + NADP
Enoylpimeloyl-[acyl-carrier protein] methyl ester + Hydrogen ion + NADPH > NADP + Pimeloyl-[acyl-carrier protein] methyl ester
Adenosine triphosphate + L-Glutamate + Putrescine + Ethylenediamine <> ADP + gamma-Glutamyl-L-putrescine + Hydrogen ion + Phosphate
Acetaldehyde + Water + NAD > Acetic acid +2 Hydrogen ion + NADH
gamma-Glutamyl-gamma-butyraldehyde + Water + NADP <> 4-(Glutamylamino) butanoate +2 Hydrogen ion + NADPH
Hydrogen cyanide + Thiosulfate > Hydrogen ion + Sulfite + Thiocyanate
Water + NAD + Phenylacetaldehyde <>2 Hydrogen ion + NADH + Benzeneacetic acid
2-Oxepin-2(3H)-ylideneacetyl-CoA + 2 Water + NADP > 3-Oxo-5,6-dehydrosuberyl-CoA +2 Hydrogen ion + NADPH
(3S)-3-Hydroxyadipyl-CoA + NAD <> Hydrogen ion + NADH + 3-Oxoadipyl-CoA
Water + Lactaldehyde + NAD + (S)-Lactaldehyde <>2 Hydrogen ion + L-Lactic acid + NADH
Glycolaldehyde + Water + NAD > Glycolic acid +2 Hydrogen ion + NADH
4-Aminobutyraldehyde + Water + NAD <> gamma-Aminobutyric acid +2 Hydrogen ion + NADH
Cyclic GMP + Water > Guanosine monophosphate + Hydrogen ion
D-Altronate + NAD <> Hydrogen ion + NADH + 5-Keto-D-gluconate + D-Tagaturonate
Water + NAD + Succinic acid semialdehyde >2 Hydrogen ion + NADH + Succinic acid
NADP + L-Serine <> 2-Aminomalonate semialdehyde + Hydrogen ion + NADPH
NADP + D-Serine <> 2-Aminomalonate semialdehyde + Hydrogen ion + NADPH
L-Allothreonine + NADP <> L-2-Amino-3-oxobutanoic acid + Hydrogen ion + NADPH
Acetyl-CoA + Spermidine > N1-Acetylspermidine + Coenzyme A + Hydrogen ion
Acetyl-CoA + Spermidine > Coenzyme A + Hydrogen ion + N8-Acetylspermidine
7,8-Dihydroneopterin + Hydrogen ion + NADPH > NADP + Tetrahydromonapterin
Adenosine + Hydrogen ion + Water > Inosine + Ammonium
Deoxyadenosine + Hydrogen ion + Water > Deoxyinosine + Ammonium
2 S-Adenosylmethionine + PE(14:0/14:0) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylethanolamine (dihexadec-9,10-cyclo-anoyl, N-C16:0 cyclo) +2 Hydrogen ion
2 S-Adenosylmethionine + PE(14:0/14:0) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylethanolamine (dioctadec-11,12-cyclo-anoyl, N-C18:0 cyclo) +2 Hydrogen ion
2 S-Adenosylmethionine + PG(16:1(9Z)/16:1(9Z)) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylglycerol (dihexadec-9,10-cyclo-anoyl, N-C16:0 cyclo) +2 Hydrogen ion
2 S-Adenosylmethionine + PG(18:1(11Z)/18:1(11Z)) >2 S-Adenosylhomocysteine + Cyclopropane phosphatidylglycerol (dioctadec-11,12-cyclo-anoyl, N-C18:0 cyclo) +2 Hydrogen ion
NAD + Quinate <> 3-Dehydroquinate +2 Hydrogen ion + NADH
Adenosine triphosphate + Water + Pyruvic acid <> Adenosine monophosphate +2 Hydrogen ion + Phosphoenolpyruvic acid + Phosphate
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonium > Adenosine monophosphate + Hydrogen ion + NAD + Pyrophosphate
2 Hydrogen ion + 2 Water + N2-Succinyl-L-arginine > Carbon dioxide +2 Ammonium + N2-Succinyl-L-ornithine
Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde <>2 Hydrogen ion + NADH + N-Succinyl-L-glutamate
L-Arginine + Succinyl-CoA <> Coenzyme A + Hydrogen ion + N2-Succinyl-L-arginine
L-Glutamate + Water + NADP <> alpha-Ketoglutarate + Hydrogen ion + NADPH + Ammonium
D-Glyceraldehyde 3-phosphate + NAD + Phosphate <> Glyceric acid 1,3-biphosphate + Hydrogen ion + NADH + 3-phospho-D-glyceroyl phosphate
Adenosine triphosphate + Formic acid + Glycineamideribotide > ADP + 5'-Phosphoribosyl-N-formylglycineamide + Hydrogen ion + Phosphate
Hydrogen ion + Oxalacetic acid > Carbon dioxide + Pyruvic acid
Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + Hydrogen ion + NADPH
Glucose 6-phosphate + UDP-Glucose > Hydrogen ion + Trehalose 6-phosphate + Uridine 5'-diphosphate
CDP-1,2-didodecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(12:0/12:0)
CDP-1,2-dihexadec-9-enoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:1(9Z)/16:1(9Z))
CDP-1,2-dihexadecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:1(11Z)/18:1(11Z))
CDP-1,2-Dioctadecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:0/18:0)
CDP-1,2-ditetradec-7-enoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(14:1(7Z)/14:1(7Z))
CDP-1,2-ditetradecanoylglycerol + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(14:0/14:0)
Dimethylbenzimidazole + Nicotinamide ribotide <> N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Hydrogen ion + Nicotinic acid
Adenosylcobinamide-GDP + N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole > Adenosylcobalamin + Guanosine monophosphate + Hydrogen ion
Adenosyl cobinamide + Adenosine triphosphate > Adenosyl cobinamide phosphate + ADP + Hydrogen ion
Adenosyl cobinamide phosphate + Guanosine triphosphate + Hydrogen ion > Adenosylcobinamide-GDP + Pyrophosphate
Water + L-Histidinol + 2 NAD >3 Hydrogen ion + L-Histidine +2 NADH
Water + Phosphoribosyl-ATP <> Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Water + 2 NAD + UDP-Glucose <>3 Hydrogen ion +2 NADH + Uridine diphosphate glucuronic acid + UDP-Glucuronic acid
6-Phosphogluconic acid + NADP <> Carbon dioxide + NADPH + D-Ribulose 5-phosphate + Hydrogen ion
O-Acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + UDP-Glucose > Glucosyl-O-acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + Hydrogen ion + Uridine 5'-diphosphate
Glucosyl-O-acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + UDP-D-Galacto-1,4-furanose > Galactofuranosyl-glucosyl-O-acetyl-rhamanosyl-N-acetylglucosamyl-undecaprenyl diphosphate + Hydrogen ion + Uridine 5'-diphosphate
dTDP-4-Dehydro-6-deoxy-L-mannose + Hydrogen ion + NADPH <> Deoxythymidine diphosphate-L-rhamnose + NADP
Guanosine diphosphate + Hydrogen ion + D-Mannose 1-phosphate > Guanosine diphosphate mannose + Phosphate
Guanosine diphosphate mannose + Water > Guanosine diphosphate + Hydrogen ion + D-Mannose
GDP-4-Oxo-L-fucose + Hydrogen ion + NADPH > GDP-L-Fucose + NADP
dCTP + Hydrogen ion + Water > Deoxyuridine triphosphate + Ammonium
Cytidine + Guanosine triphosphate > Cytidine monophosphate + Guanosine diphosphate + Hydrogen ion
Guanosine triphosphate + Uridine > Guanosine diphosphate + Hydrogen ion + Uridine 5'-monophosphate
Galactitol 1-phosphate + NAD <> Hydrogen ion + NADH + D-Tagatose 6-phosphate
5-(2-Hydroxyethyl)-4-methylthiazole + Adenosine triphosphate + 4-methyl-5-(2-hydroxyethyl)thiazole <> 4-Methyl-5-(2-phosphoethyl)-thiazole + ADP + Hydrogen ion
Deoxycytidine + Hydrogen ion + Water > Deoxyuridine + Ammonium
Cytidine + Hydrogen ion + Water > Ammonium + Uridine
Guanosine triphosphate + Water > Dihydroneopterin triphosphate + Formic acid + Hydrogen ion
Adenosine triphosphate + Fructose 1-phosphate > ADP + Fructose 1,6-bisphosphate + Hydrogen ion
2-Octaprenyl-6-hydroxyphenol + S-Adenosylmethionine > 2-Octaprenyl-6-methoxyphenol + S-Adenosylhomocysteine + Hydrogen ion
2-Octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol + S-Adenosylmethionine > S-Adenosylhomocysteine + Hydrogen ion + Ubiquinol-8
Glycerylphosphorylethanolamine + Water > Ethanolamine + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoglycerol + Water > Glycerol + Glycerol 3-phosphate + Hydrogen ion
Glycerophosphoserine + Water > Glycerol 3-phosphate + Hydrogen ion + L-Serine
Sn-Glycero-3-phospho-1-inositol + Water > Glycerol 3-phosphate + Hydrogen ion + Inositol
N10-Formyl-THF + Uridine 5''-diphospho-{beta}-4-deoxy-4-amino-L-arabinose <> Hydrogen ion + Tetrahydrofolic acid + Uridine 5''-diphospho-{beta}-4-deoxy-4-formamido-L-arabinose
Hydrogen ion + 2-Succinylbenzoyl-CoA > 1,4-Dihydroxy-2-naphthoyl-CoA + Water
alpha-Ketoglutarate + Hydrogen ion + Isochorismate <> 2-Succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + Carbon dioxide
4-Phospho-D-erythronate + NAD <> Hydrogen ion + NADH + 2-Oxo-3-hydroxy-4-phosphobutanoic acid
cis-dec-3-enoyl-[acyl-carrier protein] (n-C10:1) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -oxo-cis-dodec-5-enoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + Hydrogen ion + Malonyl-[acyl-carrier protein] >3 -oxo-cis-myristol-7-eoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1) >3 -oxo-cis-palm-9-eoyl-[acyl-carrier protein] + acyl carrier protein + Carbon dioxide
Hydrogen ion + Malonyl-[acyl-carrier protein] > Acetyl-ACP + Carbon dioxide
Glutaryl-[acyl-carrier protein] methyl ester + Hydrogen ion + Malonyl-[acyl-carrier protein] > acyl carrier protein + Carbon dioxide +3 -Oxo-pimeloyl-[acyl-carrier protein] methyl ester
Hydrogen ion + Oxalyl-CoA <> Carbon dioxide + Formyl-CoA
Adenosine triphosphate + D-Glucose > ADP + Glucose 6-phosphate + Hydrogen ion
Coproporphyrin III + 2 Hydrogen ion + Oxygen <>2 Carbon dioxide +2 Water + Protoporphyrinogen IX
Guanosine diphosphate mannose + Water > Guanosine monophosphate +2 Hydrogen ion + D-Mannose 1-phosphate
5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid + Adenosine triphosphate <> SAICAR + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Phosphoribosylformylglycineamidine <> ADP + 5-Aminoimidazole ribonucleotide +2 Hydrogen ion + Phosphate
N10-Formyl-THF + Glycineamideribotide <> 5'-Phosphoribosyl-N-formylglycineamide + Hydrogen ion + Tetrahydrofolic acid
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid > Adenosine monophosphate + L-Glutamate + Guanosine monophosphate +2 Hydrogen ion + Pyrophosphate
Water + Inosinic acid + NAD <> Hydrogen ion + NADH + Xanthylic acid
Hydrogen cyanide + 3-Mercaptopyruvic acid + Cyanide <> Hydrogen ion + Pyruvic acid + Thiocyanate
FADH2 + 2 Hydrogen ion + IscU with two bound [2Fe-2S] clusters > FAD + IscU with bound [4Fe-4S] cluster
cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD > Trans-2,3-Dihydroxycinnamate + Hydrogen ion + NADH
Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD > 3-(2,3-Dihydroxyphenyl)propionic acid + Hydrogen ion + NADH
Water + 5,10-Methenyltetrahydrofolate > N5-Formyl-H4F + Hydrogen ion
NADH + 2 Nitric oxide + 2 Oxygen > Hydrogen ion + NAD +2 Nitrate
NADPH + 2 Nitric oxide + 2 Oxygen > Hydrogen ion + NADP +2 Nitrate
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water <> ADP + Phosphoribosylformylglycineamidine + L-Glutamate + Hydrogen ion + Phosphate
L-Aspartic acid + Fumaric acid > Hydrogen ion + Iminoaspartic acid + Succinic acid
L-Aspartic acid + Oxygen <> Hydrogen ion + Hydrogen peroxide + Iminoaspartic acid
L-Aspartic acid + Ubiquinone-8 > Hydrogen ion + Iminoaspartic acid + Ubiquinol-8
L-Aspartic acid + Menaquinone 8 > Hydrogen ion + Iminoaspartic acid + Menaquinol 8
CDP-1,2-didodecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-dihexadec-9-enoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-dihexadecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-Dioctadecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-ditetradec-7-enoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
CDP-1,2-ditetradecanoylglycerol + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:0)
Adenosine triphosphate + NAD <> ADP + Hydrogen ion + NADP
Adenosine triphosphate + L-Cysteine + L-Glutamate <> ADP + gamma-Glutamylcysteine + Hydrogen ion + Phosphate
Adenosine phosphosulfate + Adenosine triphosphate <> ADP + Hydrogen ion + Phosphoadenosine phosphosulfate
Dihydroneopterin triphosphate + Water > Acetaldehyde + 6-Carboxy-5,6,7,8-tetrahydropterin + Hydrogen ion + Triphosphate
Adenosine triphosphate + L-Glutamine + Water + Uridine triphosphate > ADP + Cytidine triphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
Water + Uridine triphosphate > Hydrogen ion + Pyrophosphate + Uridine 5'-monophosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Guanosine triphosphate <> Adenosine monophosphate + Guanosine 3'-diphosphate 5'-triphosphate + Hydrogen ion
3 Hydrogen ion + 2 NADPH + 7-Cyano-7-carbaguanine >2 NADP + Queuine
Hydrogen ion + Lactaldehyde + NADH <> (S)-Propane-1,2-diol + NAD
Adenosine triphosphate + L-Fuculose <> ADP + L-Fuculose 1-phosphate + Hydrogen ion
3-Sulfinoalanine + 2 Hydrogen ion > L-Alanine + Sulfur dioxide
Acetyl-CoA + L-Glutamate <> N-Acetyl-L-alanine + Coenzyme A + Hydrogen ion + N-Acetylglutamic acid
Diaminopimelic acid + Hydrogen ion > Carbon dioxide + L-Lysine
Cytidine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin cytosine dinucleotide + Pyrophosphate
Guanine + Hydrogen ion + Water > Ammonium + Xanthine
3-Phosphoglycerate + NAD > Phosphohydroxypyruvic acid + Hydrogen ion + NADH
Hydrogen ion + (S)-Methylmalonyl-CoA <> Carbon dioxide + Propionyl-CoA
L-Arginine + Hydrogen ion <> Agmatine + Carbon dioxide
Adenosine triphosphate + gamma-Glutamylcysteine + Glycine <> ADP + Glutathione + Hydrogen ion + Phosphate
Water + Inosine triphosphate > Hydrogen ion + Inosinic acid + Pyrophosphate
Water + Xanthosine 5-triphosphate > Hydrogen ion + Pyrophosphate + Xanthylic acid
2'-Deoxyinosine triphosphate + Water > DIMP + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Glutathione + Spermidine <> ADP + Glutathionylspermidine + Hydrogen ion + Phosphate
2-Demethylmenaquinone 8 + Hydrogen ion + NADPH > 2-Demethylmenaquinol 8 + NADP
Hydrogen ion + NADPH + Ubiquinone-8 > NADP + Ubiquinol-8
Hydrogen ion + Menaquinone 8 + NADPH > Menaquinol 8 + NADP
Menaquinol 8 + 2 Oxygen >2 Hydrogen ion + Menaquinone 8 +2 Superoxide anion
2 Oxygen + Ubiquinol-8 >2 Hydrogen ion +2 Superoxide anion + Ubiquinone-8
D-Ribulose 5-phosphate <> 3,4-Dihydroxy-2-butanone-4-P + Formic acid + Hydrogen ion
Adenosine triphosphate + D-Glycero-D-manno-heptose 1-phosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
Glycerol 3-phosphate + Hexadecanoyl-phosphate (n-C16:0) > 1-hexadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Octadecanoyl-phosphate (n-C18:0) > 1-Octadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Octadecanoyl-phosphate (n-C18:1) > 1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Glycerol 3-phosphate + Tetradecanoyl-phosphate (n-C14:0) > 1-Tetradecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Dodecanoly-phosphate (n-C12:0) + Glycerol 3-phosphate > 1-Dodecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Glyceric acid > 2-Phospho-D-glyceric acid + ADP + Hydrogen ion
L-Aspartic acid + Adenosine triphosphate + Citrulline <> Adenosine monophosphate + Argininosuccinic acid + Hydrogen ion + Pyrophosphate
N-Acetylmannosamine + Adenosine triphosphate > N-Acetyl-D-mannosamine 6-phosphate + ADP + Hydrogen ion
L-Malic acid + NAD <> Hydrogen ion + NADH + Oxalacetic acid
N10-Formyl-THF + L-Methionyl-tRNA (Met) > N-Formylmethionyl-tRNA + Hydrogen ion + Tetrahydrofolic acid
Iron + Sirohydrochlorin >3 Hydrogen ion + Siroheme
Precorrin 2 + NAD > Hydrogen ion + NADH + Sirohydrochlorin
Adenosine triphosphate + Fructoselysine > ADP + Fructoselysine-6-phosphate + Hydrogen ion
Adenosine triphosphate + Water + Iron > ADP + Iron + Hydrogen ion + Phosphate
ADP-Glucose > ADP + Glycogen + Hydrogen ion
Adenosine triphosphate + Glucose 1-phosphate + Hydrogen ion <> ADP-Glucose + Pyrophosphate
L-Aspartate-semialdehyde + NADP + Phosphate <> L-Aspartyl-4-phosphate + Hydrogen ion + NADPH
Glycerophosphocholine + Water > Choline + Glycerol 3-phosphate + Hydrogen ion
Adenosine triphosphate + Cadmium + Water > ADP + Hydrogen ion + Phosphate + Cadmium
Arsenite + Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate + Arsenite
D-Biotin D-sulfoxide + Hydrogen ion + NADH > Biotin + Water + NAD
D-Biotin D-sulfoxide + Hydrogen ion + NADPH > Biotin + Water + NADP
2 -Dehydro-L-gulonate + Hydrogen ion + NADH > Gluconic acid + NAD
2 -Dehydro-L-gulonate + Hydrogen ion + NADH > D-Galactonate + NAD
2 -Dehydro-L-gulonate + Hydrogen ion + NADPH > Gluconic acid + NADP
2 -Dehydro-L-gulonate + Hydrogen ion + NADPH > D-Galactonate + NADP
2,5-Diketo-D-gluconate + Hydrogen ion + NADH > 5-Keto-D-gluconate + NAD
2,5-Diketo-D-gluconate + Hydrogen ion + NADPH > 5-Keto-D-gluconate + NADP
2,3-Diketo-L-gulonate + Hydrogen ion + NADH > 3-Dehydro-L-gulonate + NAD
3-Dehydro-L-gulonate + Adenosine triphosphate > 3-Dehydro-L-gulonate 6-phosphate + ADP + Hydrogen ion
Water + NADP + Propanal >2 Hydrogen ion + NADPH + Propionic acid
Acetaldehyde + Water + NADP > Acetic acid +2 Hydrogen ion + NADPH
Phosphoroselenoic acid > Hydrogen ion + Phosphate + L-Selenocysteinyl-tRNA(Sec)
Sorbitol-6-phosphate + NAD <> Fructose 6-phosphate + Hydrogen ion + NADH
Glycerol 3-phosphate + NADP <> Dihydroxyacetone phosphate + Hydrogen ion + NADPH
NAD + L-Threonine <> L-2-Amino-3-oxobutanoic acid + Hydrogen ion + NADH
ADP-L-Glycero-D-manno-heptose + heptosyl-kdo2-lipidA > ADP + Hydrogen ion + heptosyl-heptosyl-kdo2-lipidA
ADP-L-Glycero-D-manno-heptose + KDO2-Lipid A > ADP + Hydrogen ion + heptosyl-kdo2-lipidA
core oligosaccharide lipid A + (enterobacterial common antigen)x4 undecaprenyl-diphosphate > (enterobacterial common antigen)x4 core oligosaccharide lipid A + Hydrogen ion + Undecaprenyl diphosphate
core oligosaccharide lipid A + (O16 antigen)x4 undecaprenyl diphosphate > Hydrogen ion + (O16 antigen)x4 core oligosaccharide lipid A + Undecaprenyl diphosphate
ADP-L-Glycero-D-manno-heptose + glucosyl-glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A > ADP + core oligosaccharide lipid A + Hydrogen ion
CMP-3-Deoxy-D-manno-octulosonate + Phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > Cytidine monophosphate + Hydrogen ion + Kdo-phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
Adenosine triphosphate + Heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A + UDP-Glucose > glucosyl-glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
galactosyl-glucosyl-inner core oligosaccharide lipid A + UDP-Glucose > glucosyl-galactosyl-glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
glucosyl-inner core oligosaccharide lipid A + UDP-Glucose > galactosyl-glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
Deoxythymidine diphosphate-L-rhamnose + Kdo-phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > dTDP + Hydrogen ion + inner core oligosaccharide lipid A (E coli)
Adenosine triphosphate + heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Phospho-heptosyl-heptosyl-kdo2-lipidA
inner core oligosaccharide lipid A (E coli) + UDP-Glucose > glucosyl-inner core oligosaccharide lipid A + Hydrogen ion + Uridine 5'-diphosphate
ADP-L-Glycero-D-manno-heptose + Phospho-heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
CMP-3-Deoxy-D-manno-octulosonate + 2,3,2'3'-Tetrakis(beta-hydroxymyristoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1,4'-bisphosphate > Cytidine monophosphate + Hydrogen ion + KDO-lipid IV(A)
CMP-3-Deoxy-D-manno-octulosonate + KDO-lipid IV(A) > Cytidine monophosphate + Hydrogen ion + KDO(2)-lipid IV(A)
Adenosine triphosphate + Hydrogen ion + Pantetheine 4'-phosphate <> Dephospho-CoA + Pyrophosphate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine > 4-Phosphopantothenoylcysteine + Cytidine monophosphate + Hydrogen ion + Pyrophosphate
4-Phosphopantothenoylcysteine + Hydrogen ion <> Carbon dioxide + Pantetheine 4'-phosphate + pantotheine 4'-phosphate
Adenine + Hydrogen ion + Water > Hypoxanthine + Ammonium
Acetyl-CoA + N-Acetyl-glucosamine 1-phosphate > N-Acetyl-glucosamine 1-phosphate + Coenzyme A + Hydrogen ion
N-Acetyl-glucosamine 1-phosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + Uridine diphosphate-N-acetylglucosamine
L-Aspartic acid + Adenosine triphosphate + Ammonium > Adenosine monophosphate + L-Asparagine + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Ribose <> ADP + Hydrogen ion + D-Ribose-5-phosphate
2-Aceto-2-hydroxy-butyrate + Hydrogen ion + NADPH <> (R) 2,3-Dihydroxy-3-methylvalerate + NADP
(R)-2,3-Dihydroxy-isovalerate + NADP <> (S)-2-Acetolactate + Hydrogen ion + NADPH
Water + 2 NAD + UDP-N-Acetyl-D-mannosamine <>3 Hydrogen ion +2 NADH + UDP-N-Acetyl-D-mannosaminouronate
Acetyl-CoA + dTDP-D-Fucosamine > Coenzyme A + dTDP-4-Acetamido-4,6-dideoxy-D-galactose + Hydrogen ion
UDP-N-Acetyl-D-mannosaminouronate + Undecaprenyl-N-acetyl-alpha-D-glucosaminyl-pyrophosphate > Hydrogen ion + Uridine 5'-diphosphate + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate
Water + PA(16:0/16:0) > 1-Dodecanoyl-sn-glycerol 3-phosphate + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PA(16:0/16:0) > 1-hexadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Palmitic acid
Water + PA(16:0/16:0) > 1-Octadec-11-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PA(16:0/16:0) > 1-Octadecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PA(16:0/16:0) > 1-Tetradec-7-enoyl-sn-glycerol 3-phosphate + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PA(16:0/16:0) > 1-Tetradecanoyl-sn-glycerol 3-phosphate + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PE(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PE(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(16:0/16:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PG(16:0/16:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Hydrogen ion + Palmitic acid
Water + PG(18:1(11Z)/18:1(11Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(18:1(11Z)/18:1(11Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Hydrogen ion + Octadecenoate (N-C18:1)
Water + PG(14:0/14:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PG(14:0/14:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Hydrogen ion + tetradecanoate (n-C14:0)
Water + PG(12:0/12:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PG(12:0/12:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Dodecanoate (N-C12:0) + Hydrogen ion
Water + PG(14:1(7Z)/14:1(7Z)) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PG(14:1(7Z)/14:1(7Z)) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Hydrogen ion + Tetradecenoate (N-C14:1)
Water + PG(18:0/18:0) > 1-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
Water + PG(18:0/18:0) > 2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerylphosphorylethanolamine + Hydrogen ion
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + tetradecanoate (n-C14:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Tetradecenoate (N-C14:1)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Palmitic acid
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Water > Glycerylphosphorylethanolamine + Hydrogen ion + Octadecenoate (N-C18:1)
2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Water > Dodecanoate (N-C12:0) + Glycerophosphoglycerol + Hydrogen ion
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Water > Glycerophosphoglycerol + Hydrogen ion + tetradecanoate (n-C14:0)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Tetradecenoate (N-C14:1)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Palmitic acid
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecanoate (N-C18:0)
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Water > Glycerophosphoglycerol + Hydrogen ion + Octadecenoate (N-C18:1)
2-dodecanoyl-sn-glycerol 3-phosphate + Water > Dodecanoate (N-C12:0) + Glycerol 3-phosphate +2 Hydrogen ion
2-hexadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Palmitic acid
2-octadec-11-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Octadecenoate (N-C18:1)
2-octadecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Octadecanoate (N-C18:0)
2-tetradec-7-enoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + Tetradecenoate (N-C14:1)
2-tetradecanoyl-sn-glycerol 3-phosphate + Water > Glycerol 3-phosphate +2 Hydrogen ion + tetradecanoate (n-C14:0)
2-Demethylmenaquinol 8 + S-Adenosylmethionine > S-Adenosylhomocysteine + Hydrogen ion + Menaquinol 8
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-Adenosylmethionine > 2-Octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol + S-Adenosylhomocysteine + Hydrogen ion
FADH2 + 2 Fe3+ > FAD +2 Iron +2 Hydrogen ion
FAD + Hydrogen ion + NADH > FADH2 + NAD
Hydrogen ion + NADH + Riboflavin > NAD + Reduced riboflavin
Hydrogen ion + NADH + Succinic acid semialdehyde <> gamma-Hydroxybutyrate + NAD
Adenosine triphosphate + L-Rhamnulose <> ADP + Hydrogen ion + L-Rhamnulose 1-phosphate
Adenosine triphosphate + D-Sedoheptulose 7-phosphate > ADP + Hydrogen ion + Sedoheptulose 1,7-bisphosphate
Adenosine triphosphate + D-Tagatose 6-phosphate > ADP + Hydrogen ion + D-Tagatose 1,6-bisphosphate
CDP-1,2-didodecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dihexadec-9-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dihexadecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-dioctadec-11-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-Dioctadecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-ditetradec-7-enoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
CDP-1,2-ditetradecanoylglycerol + Water > Cytidine monophosphate +2 Hydrogen ion + PA(16:0/16:0)
Adenosine triphosphate + Glycerol <> ADP + Glycerol 3-phosphate + Hydrogen ion
1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion + Octaprenyl diphosphate > 2-Demethylmenaquinol 8 + Carbon dioxide + Pyrophosphate
L-Cysteine + O-Succinyl-L-homoserine <> L-Cystathionine + Hydrogen ion + Succinic acid
2 Hydrogen ion + 5,10-Methylene-THF + NADH > 5-Methyltetrahydrofolic acid + NAD
Acetol + Hydrogen ion + NADH > (R)-Propane-1,2-diol + NAD
Glycerol + NAD <> Dihydroxyacetone + Hydrogen ion + NADH
Aminoacetone + Hydrogen ion + NADH <> 1-Amino-2-propanol + NAD
Hydrogen ion + Pyruvaldehyde + NADH > D-Lactaldehyde + NAD
Carbon dioxide + Water + Phosphoenolpyruvic acid <> Hydrogen ion + Oxalacetic acid + Phosphate + Hydrogen carbonate
N-Acetyl-L-glutamate 5-semialdehyde + NADP + Phosphate <> N-Acetyl-L-glutamyl 5-phosphate + Hydrogen ion + NADPH
Hydrogen ion + NADPH + UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine <> NADP + UDP-N-Acetylmuraminate
Adenosine triphosphate + Pantothenic acid <> D-4'-Phosphopantothenate + ADP + Hydrogen ion
S-Adenosylmethionine + NADPH + L-Tyrosine > p-Cresol + 5'-Deoxyadenosine + Dehydroglycine + Hydrogen ion + L-Methionine + NADP
2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + 4-Methyl-5-(2-phosphoethyl)-thiazole + Hydrogen ion <> Pyrophosphate + Thiamine monophosphate
5-Aminoimidazole ribonucleotide + Water + NAD > 4-Amino-2-methyl-5-phosphomethylpyrimidine +2 Formic acid +3 Hydrogen ion + NADH
4 Hydrogen ion + Uroporphyrinogen III <>4 Carbon dioxide + Coproporphyrin III
Adenosine triphosphate + Glycine + 5-Phosphoribosylamine <> ADP + Glycineamideribotide + Hydrogen ion + Phosphate
1,2-Diacyl-sn-glycerol (didodecanoyl, n-C12:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dihexadec-9-enoyl, n-C16:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dihexadecanoyl, n-C16:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dioctadec-11-enoyl, n-C18:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (ditetradec-7-enoyl, n-C14:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
D-Allose + Adenosine triphosphate > ADP + D-Allose 6-phosphate + Hydrogen ion
2 Adenosine triphosphate + Hydrogen ion > Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + PS(16:0/16:0) <> Carbon dioxide + PE(14:0/14:0)
Cytidine triphosphate + Water > CDP + Hydrogen ion + Phosphate
L-Aspartic acid + Guanosine triphosphate + Inosinic acid <> Adenylsuccinic acid + Guanosine diphosphate +2 Hydrogen ion + Phosphate
L-Ascorbate 6-phosphate + Water > 3-Dehydro-L-gulonate 6-phosphate + Hydrogen ion
Adenosine 2',3'-cyclic phosphate + Water > 3'-AMP + Hydrogen ion
Guanosine 2',3'-cyclic phosphate + Water > Guanosine 3'-phosphate + Hydrogen ion
2',3'-Cyclic UMP + Water > 3'-UMP + Hydrogen ion
2',3'-Cyclic CMP + Water > 3'-CMP + Hydrogen ion
L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + Adenosine triphosphate + UDP-N-Acetylmuraminate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
Adenosine triphosphate + Water + Magnesium > ADP + Hydrogen ion + Magnesium + Phosphate
5-Keto-D-gluconate + Hydrogen ion + NADPH <> Gluconic acid + NADP
5-Keto-D-gluconate + Hydrogen ion + NADH <> D-Galactonate + NAD
5-Keto-D-gluconate + Hydrogen ion + NADPH > D-Galactonate + NADP
D-Mannonate + NAD <> D-Fructuronate + Hydrogen ion + NADH
FADH2 + 2 Ferroxamine > FAD +2 Iron +2 ferroxamine minus Fe(3) +2 Hydrogen ion
2 Ferroxamine + FMNH >2 Iron +2 ferroxamine minus Fe(3) + Flavin Mononucleotide +2 Hydrogen ion
2 Ferroxamine + Reduced riboflavin >2 Iron +2 ferroxamine minus Fe(3) +2 Hydrogen ion + Riboflavin
Adenosine triphosphate + Hydrogen ion + Caprylic acid > Adenosine monophosphate + octanoate (protein bound) + Pyrophosphate
2'-Deoxyinosine triphosphate + Water > DIDP + Hydrogen ion + Phosphate
dTDP-4-Acetamido-4,6-dideoxy-D-galactose + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate > dTDP + Hydrogen ion + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose
Adenosine triphosphate + Hydrogen ion + Water > Inosine triphosphate + Ammonium
Guanosine triphosphate + Hydrogen ion + Water > Ammonium + Xanthosine 5-triphosphate
L-Glutamic-gamma-semialdehyde > L-D-1-Pyrroline-5-carboxylic acid + Hydrogen ion + Water
dATP + Hydrogen ion + Water > 2'-Deoxyinosine triphosphate + Ammonium
Carbamic acid + 2 Hydrogen ion > Carbon dioxide + Ammonium
L-2-Amino-3-oxobutanoic acid + Hydrogen ion > Aminoacetone + Carbon dioxide
2-Isopropyl-3-oxosuccinate + Hydrogen ion > Ketoleucine + Carbon dioxide
2 [4Fe-4S] iron-sulfur cluster + 2 Hydrogen ion + Hydrogen peroxide >2 [3Fe-4S] damaged iron-sulfur cluster +2 Fe3+ +2 Water
2 [4Fe-4S] iron-sulfur cluster + 2 Hydrogen ion + 2 Nitric oxide >2 [3Fe-4S] damaged iron-sulfur cluster +2 Fe3+ + Water + Nitrous oxide
Oxygen + 4 Fe2+ + 4 Hydrogen ion + 4 Fe2+ <>4 Fe3+ +2 Water
2 L-Glutamate + NAD <> L-Glutamine + alpha-Ketoglutarate + NADH + Hydrogen ion
2 Glutathione + NAD <> Glutathione disulfide + NADH + Hydrogen ion
NAD + 2 Cob(II)alamin + 2 Water + Hydrogen ion <> NADH +2 Aquacobalamin
2 L-Glutamate + NADP <> L-Glutamine + alpha-Ketoglutarate + NADPH + Hydrogen ion
2 Glutathione + NADP <> Glutathione disulfide + NADPH + Hydrogen ion
L-Lactic acid + 2 Ferricytochrome c + Ferricytochrome c <> Pyruvic acid +2 Ferrocytochrome c +2 Hydrogen ion + Ferrocytochrome c
Pyruvaldehyde + NAD + Water <> Pyruvic acid + NADH + Hydrogen ion
L-Malic acid + NAD <> Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion
(R)-Malate + NAD <> Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion
L-Malic acid + NADP <> Pyruvic acid + Carbon dioxide + NADPH + Hydrogen ion
L-Glutamate + NAD + Water <> alpha-Ketoglutarate + Ammonia + NADH + Hydrogen ion
L-Glutamic-gamma-semialdehyde + NAD + Water <> L-Glutamate + NADH + Hydrogen ion
L-Glutamate + NADP + Water <> alpha-Ketoglutarate + Ammonia + NADPH + Hydrogen ion
Isocitric acid + NADP <> alpha-Ketoglutarate + Carbon dioxide + NADPH + Hydrogen ion
UDP-Glucose + Water + 2 NAD <> Uridine diphosphate glucuronic acid +2 NADH +2 Hydrogen ion
Protoporphyrin IX + Fe2+ <> Heme +2 Hydrogen ion + Fe2+
Glycolic acid + NADP <> Glyoxylic acid + NADPH + Hydrogen ion
Formic acid + NAD <> Hydrogen ion + Carbon dioxide + NADH
Primary alcohol + NAD <> Aldehyde + NADH + Hydrogen ion
L-D-1-Pyrroline-5-carboxylic acid + NADP + 2 Water <> L-Glutamate + NADPH + Hydrogen ion
Glycerol 3-phosphate + NAD <> Dihydroxyacetone phosphate + NADH + Hydrogen ion
Tetrahydrofolic acid + NAD <> Dihydrofolic acid + NADH + Hydrogen ion
Tetrahydrofolic acid + 2 NAD <> Folic acid +2 NADH +2 Hydrogen ion
Tetrahydrofolic acid + 2 NADP <> Folic acid +2 NADPH +2 Hydrogen ion
2-Ketobutyric acid + Carbon dioxide + NADH + Hydrogen ion <> D-Erythro-3-Methylmalate + NAD
D-Glyceraldehyde 3-phosphate + Phosphate + NAD <> Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion
Dethiobiotin + Sulfur donor + 2 S-Adenosylmethionine + 2 e- + 2 Hydrogen ion <> Biotin +2 L-Methionine +2 5'-Deoxyadenosine
2 Ferricytochrome c + Nitrite + Water <> Nitrate +2 Ferrocytochrome c +2 Hydrogen ion
Inosinic acid + Ammonia + NADP <> Guanosine monophosphate + NADPH + Hydrogen ion
L-Histidinal + Water + NAD <> L-Histidine + NADH + Hydrogen ion
Butanal + Coenzyme A + NAD <> Butanoyl-CoA + NADH + Hydrogen ion
2 Reduced ferredoxin + Acetyl-CoA + Carbon dioxide + 2 Hydrogen ion + Oxidized ferredoxin <>2 Oxidized ferredoxin + Pyruvic acid + Coenzyme A + Reduced ferredoxin
Glycine + Tetrahydrofolic acid + NAD <> 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH + Hydrogen ion
5-Methyltetrahydrofolic acid + NADP <> 5,10-Methylene-THF + NADPH + Hydrogen ion
L-Proline + NAD <> L-D-1-Pyrroline-5-carboxylic acid + NADH + Hydrogen ion
Lactaldehyde + NAD + Water <> L-Lactic acid + NADH + Hydrogen ion
3-Phospho-D-glycerate + NAD <> Phosphohydroxypyruvic acid + NADH + Hydrogen ion
6-Phosphogluconic acid + NADP <> D-Ribulose 5-phosphate + Carbon dioxide + NADPH + Hydrogen ion
2-Keto-3-deoxy-D-gluconic acid + NAD <> (4S)-4,6-Dihydroxy-2,5-dioxohexanoate + NADH + Hydrogen ion
Dihydrolipoamide + NAD <> Lipoamide + NADH + Hydrogen ion
Prephenate + NAD <> 4-Hydroxyphenylpyruvic acid + Carbon dioxide + NADH + Hydrogen ion
Gluconic acid + NADP <> 2-Keto-D-gluconic acid + NADPH + Hydrogen ion + 2-Dehydro-D-gluconate
Glyceric acid + NADP <> Tartronate semialdehyde + NADPH + Hydrogen ion
L-Homoserine + NAD <> L-Aspartate-semialdehyde + NADH + Hydrogen ion
Ethylene glycol + NAD <> Glycolaldehyde + NADH + Hydrogen ion
Isocitric acid + NADP <> Oxalosuccinic acid + NADPH + Hydrogen ion
Oxoadipic acid + Coenzyme A + NAD <> Glutaryl-CoA + Carbon dioxide + NADH + Hydrogen ion
(S)-3-Hydroxybutanoyl-CoA + NAD <> Acetoacetyl-CoA + NADH + Hydrogen ion
(S)-3-Hydroxybutanoyl-CoA + NADP + 3-Hydroxybutyryl-CoA <> Acetoacetyl-CoA + NADPH + Hydrogen ion
2 Reduced rubredoxin + NAD <>2 Oxidized rubredoxin + NADH + Hydrogen ion
Thioredoxin + NADP + Thioredoxin <> Thioredoxin disulfide + NADPH + Hydrogen ion + Thioredoxin disulfide
Retinol + NAD <> Retinal + NADH + Hydrogen ion
Dihydrofolic acid + NAD <> Folic acid + NADH + Hydrogen ion
Dihydrofolic acid + NADP <> Folic acid + NADPH + Hydrogen ion
Propylene glycol + NAD <> Lactaldehyde + NADH + Hydrogen ion
Meso-Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
D-Altronate + NAD <> 5-Keto-D-gluconate + NADH + Hydrogen ion
3-Dehydro-L-gulonate + NADP <> 2,3-Diketo-L-gulonate + NADPH + Hydrogen ion
2 3-Hydroxyanthranilic acid + 4 Oxygen <> Cinnavalininate +2 Superoxide anion +2 Hydrogen peroxide +2 Hydrogen ion
Sorbitol-6-phosphate + NAD <> beta-D-Fructose 6-phosphate + NADH + Hydrogen ion
beta-D-Glucose 6-phosphate + NADP <> 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion
Siroheme + 2 Hydrogen ion <> Fe2+ + Sirohydrochlorin
(S)-Ureidoglycolic acid + NADP <> Oxalureate + NADPH + Hydrogen ion
L-Histidinol + NAD <> L-Histidinal + NADH + Hydrogen ion
2-Acetolactate + NADPH + Hydrogen ion <> 2,3-Dihydroxyisovaleric acid + NADP
UDP-N-Acetylmuraminate + NAD <> UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine + NADH + Hydrogen ion
Hydroxyproline + NAD <> Pyrroline hydroxycarboxylic acid + NADH + Hydrogen ion
Hydroxyproline + NADP <> Pyrroline hydroxycarboxylic acid + NADPH + Hydrogen ion
L-Glutamic-gamma-semialdehyde + Phosphate + NADP <> L-Glutamyl 5-phosphate + NADPH + Hydrogen ion + L-Glutamic acid 5-phosphate
Cyanate + Hydrogen ion + Hydrogen carbonate <> Carbon dioxide + Carbamic acid
Hydrogen selenide + 3 NADP + 3 Water <> Selenite +3 NADPH +5 Hydrogen ion
Dihydrolipoylprotein + NAD <> Lipoylprotein + NADH + Hydrogen ion
L-Glutamyl-tRNA(Glu) + NADPH + Hydrogen ion + tRNA(Glu) <> (S)-4-Amino-5-oxopentanoate + tRNA(Glu) + NADP + L-Glutamyl-tRNA(Glu)
Tetrahydrodipicolinate + NAD <> 2,3-Dihydrodipicolinic acid + NADH + Hydrogen ion
Butyryl-[acp] + NAD <> But-2-enoyl-[acyl-carrier protein] + NADH + Hydrogen ion
(R)-2,3-Dihydroxy-isovalerate + NADP <> 3-Hydroxy-3-methyl-2-oxobutanoic acid + NADPH + Hydrogen ion
Pyrroline hydroxycarboxylic acid + NAD + 2 Water <> L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion
Pyrroline hydroxycarboxylic acid + NADP + 2 Water <> L-erythro-4-Hydroxyglutamate + NADPH + Hydrogen ion
(3R)-3-Hydroxybutanoyl-[acyl-carrier protein] + NADP <> Acetoacetyl-[acp] + NADPH + Hydrogen ion
(3R)-3-Hydroxyoctanoyl-[acyl-carrier protein] + NADP <> 3-Oxooctanoyl-[acp] + NADPH + Hydrogen ion
(3R)-3-Hydroxypalmitoyl-[acyl-carrier protein] + NADP <> 3-Oxohexadecanoyl-[acp] + NADPH + Hydrogen ion
(3R)-3-Hydroxytetradecanoyl-[acyl-carrier protein] + NADP <> 3-Oxotetradecanoyl-[acp] + NADPH + Hydrogen ion
Dodecanoyl-[acyl-carrier protein] + NAD <> trans-Dodec-2-enoyl-[acp] + NADH + Hydrogen ion
O-Acetylserine + Thiosulfate + Thioredoxin + Hydrogen ion <> L-Cysteine + Sulfite + Thioredoxin disulfide + Acetic acid
(R)-3-Hydroxyhexanoyl-[acp] + NADP <> 3-Oxohexanoyl-[acp] + NADPH + Hydrogen ion
Hexanoyl-[acp] + NAD <> trans-Hex-2-enoyl-[acp] + NADH + Hydrogen ion
Octanoyl-[acp] + NAD <> trans-Oct-2-enoyl-[acp] + NADH + Hydrogen ion
Decanoyl-[acp] + NAD <> trans-Dec-2-enoyl-[acp] + NADH + Hydrogen ion
(R)-3-Hydroxydodecanoyl-[acp] + NADP <> 3-Oxododecanoyl-[acp] + NADPH + Hydrogen ion
Tetradecanoyl-[acp] + NAD <> trans-Tetradec-2-enoyl-[acp] + NADH + Hydrogen ion
Hexadecanoyl-[acp] + NAD <> trans-Hexadec-2-enoyl-[acp] + NADH + Hydrogen ion
2-Octaprenylphenol + Oxygen + NADPH + Hydrogen ion <> 2-Octaprenyl-6-hydroxyphenol + NADP + Water
(S)-3-Hydroxyisobutyrate + NAD <> (S)-Methylmalonic acid semialdehyde + NADH + Hydrogen ion
(R) 2,3-Dihydroxy-3-methylvalerate + NADP <> (R)-3-Hydroxy-3-methyl-2-oxopentanoate + NADPH + Hydrogen ion
trans-3-Chloro-2-propene-1-ol + NAD <> trans-3-Chloroallyl aldehyde + NADH + Hydrogen ion
cis-3-Chloro-2-propene-1-ol + NAD <> cis-3-Chloroallyl aldehyde + NADH + Hydrogen ion
4-Chlorobiphenyl + Oxygen + NADH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxy-4'-chlorobiphenyl + NAD
4-Chlorobiphenyl + Oxygen + NADPH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxy-4'-chlorobiphenyl + NADP
Biphenyl + Oxygen + NADH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxybiphenyl + NAD
Biphenyl + Oxygen + NADPH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxybiphenyl + NADP
4-Nitrocatechol + Oxygen + 3 Hydrogen ion <> Benzene-1,2,4-triol + Nitrite + Water
4-Sulfolactone + Water <> HSO3- + 2-Maleylacetate + Hydrogen ion
Ethylbenzene + Oxygen + NADH + Hydrogen ion <> cis-1,2-Dihydro-3-ethylcatechol + NAD
3-Hydroxybutanoyl-CoA + NADP <> Acetoacetyl-CoA + NADPH + Hydrogen ion
O-Phospho-4-hydroxy-L-threonine + NAD <> 2-Amino-3-oxo-4-phosphonooxybutyrate + NADH + Hydrogen ion
L-Idonate + NADP <> 5-Dehydro-D-gluconate + NADPH + Hydrogen ion
GDP-L-Fucose + NADP <> GDP-4-Dehydro-6-deoxy-D-mannose + NADPH + Hydrogen ion
Ammonia + 2 Water + 6 Ferricytochrome c + Ferricytochrome c <> Nitrite +6 Ferrocytochrome c +6 Hydrogen ion + Ferrocytochrome c
1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADPH + Hydrogen ion <> Isopentenyl pyrophosphate + NADP + Water
Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
alpha-Pinene + Oxygen + 2 Hydrogen ion + 2 e- <> Pinocarveol + Water
Hydrocinnamic acid + Oxygen + NADH + Hydrogen ion <> cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD <> 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion
Quinate + NADP <> 3-Dehydroquinate + NADPH + Hydrogen ion
Shikimic acid + NAD <> 3-Dehydro-shikimate + NADH + Hydrogen ion
Bisphenol A + NADH + Hydrogen ion + Oxygen <> 1,2-Bis(4-hydroxyphenyl)-2-propanol + NAD + Water
2,2-Bis(4-hydroxyphenyl)-1-propanol + NADH + Hydrogen ion + Oxygen <> 2,3-Bis(4-hydroxyphenyl)-1,2-propanediol + NAD + Water
(2-Naphthyl)methanol + NAD <> 2-Naphthaldehyde + NADH + Hydrogen ion
Chloral hydrate + NADH + Hydrogen ion <> Trichloroethanol + NAD + Water
1,2-Dibromoethane + Glutathione + Hydrogen ion <> Glutathione episulfonium ion +2 Hydrobromic acid
Dimethylallylpyrophosphate + NADP + Water <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADPH + Hydrogen ion
gamma-Glutamyl-gamma-butyraldehyde + NAD + Water <> 4-(Glutamylamino) butanoate + NADH + Hydrogen ion
Enzyme N6-(dihydrolipoyl)lysine + NAD <> Enzyme N6-(lipoyl)lysine + NADH + Hydrogen ion
Uridine diphosphate glucuronic acid + NAD <> UDP-4-Keto-pyranose + Carbon dioxide + NADH + Hydrogen ion
Anthracene + Oxygen + 2 Hydrogen ion + 2 e- <> Anthracene-9,10-dihydrodiol
3-Oxooctadecanoyl-CoA + NADPH + Hydrogen ion <> 3-Hydroxyoctadecanoyl-CoA + NADP
3-Oxostearoyl-[acp] + NADPH + Hydrogen ion <> 3-Hydroxyoctadecanoyl-[acp] + NADP
(2E)-Octadecenoyl-[acp] + NADH + Hydrogen ion <> Octadecanoyl-[acyl-carrier protein] + NAD
Trinitrotoluene + 2 NADPH + 2 Hydrogen ion <> 4-Hydroxylamino-2,6-dinitrotoluene +2 NADP + Water
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 4-Hydroxylamino-2,6-dinitrotoluene +2 NAD + Water
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 2-Hydroxylamino-4,6-dinitrotoluene +2 NAD + Water
3-Hydroxy-5-methylhex-4-enoyl-CoA + NAD <> 5-Methyl-3-oxo-4-hexenoyl-CoA + NADH + Hydrogen ion
6-Thioinosine-5'-monophosphate + NAD + Water <> 6-Thioxanthine 5'-monophosphate + NADH + Hydrogen ion
2-Phenyl-1,3-propanediol monocarbamate + NAD <> 3-Carbamoyl-2-phenylpropionaldehyde + NADH + Hydrogen ion
4-Hydroxy-5-phenyltetrahydro-1,3-oxazin-2-one + NAD <> 5-Phenyl-1,3-oxazinane-2,4-dione + NADH + Hydrogen ion
2-Polyprenyl-3-methyl-6-methoxy-1,4-benzoquinone + Oxygen + NADPH + Hydrogen ion <> 2-Polyprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone + NADP + Water
2 NADPH + 2 Hydrogen ion + Methylselenic acid <>2 NADP +2 Water + Methaneselenol
3-Oxo-5,6-dehydrosuberyl-CoA semialdehyde + NADP + Water <> 3-Oxo-5,6-dehydrosuberyl-CoA + NADPH + Hydrogen ion
Phenylacetyl-CoA + Oxygen + NADPH + Hydrogen ion <> 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA + Water + NADP + 2-(1,2-Epoxy-1,2-dihydrophenyl)acetyl-CoA
Adenosine triphosphate + an aliphatic sulfonate + Water > an aliphatic sulfonate + ADP + Phosphate + Hydrogen ion
D-Ribulose + Adenosine triphosphate > Hydrogen ion + D-Ribulose-1-phosphate + ADP
4,6-Dideoxy-4-oxo-dTDP-D-glucose + NADH + Hydrogen ion <> Deoxythymidine diphosphate-L-rhamnose + NAD
Hydrogen ion + L-Glutamate + Adenosine triphosphate + NADPH > ADP + L-Glutamic-gamma-semialdehyde + NADP + Phosphate
4-(2-aminophenyl)-2,4-dioxobutanoate > kynurenate + Water + Hydrogen ion
an oxidized electron acceptor + Ascorbic acid + Hydrogen ion > a reduced electron acceptor + monodehydroascorbate
Guanosine triphosphate + hydroxyl radical > Hydrogen ion + 8-oxo-GTP
dGTP + hydroxyl radical > Hydrogen ion + 8-oxo-dGTP
2-Oxo-4-methylthiobutanoic acid + hydroxyl radical > Hydrogen ion + ethylene + methanethiol + Carbon dioxide
Hydrogen ion + Hydrogen peroxide + Iron > hydroxyl radical + OH<SUP>-</SUP> + Fe<SUP>3+</SUP>
dehydroascorbate (bicyclic form) > 2,3-Diketo-L-gulonate + Hydrogen ion
dehydroascorbate (bicyclic form) + Hydrogen peroxide > L-threonate + Oxalic acid + Hydrogen ion
Selenite + Glutathione + Hydrogen ion > Selenodiglutathione + Glutathione disulfide + Water
dehydroascorbate (bicyclic form) > cyclic-2,3-<i>O</i>-oxalyl-L-threonate + Hydrogen ion
2-carboxy-L-xylonolactone + Water > 2-carboxy-L-<i>threo</i>-pentonate + Hydrogen ion
monodehydroascorbate + Hydrogen ion > Ascorbic acid + L-dehydro-ascorbate
a 2(R)-hydroperoxy fatty acid + Hydrogen ion > a fatty aldehyde + Carbon dioxide + Water
(<i>S</i>)-2-acetolactate + an oxidized electron acceptor + Hydrogen ion > diacetyl + Carbon dioxide + a reduced electron acceptor
Hydrogen ion + coumarinate > coumarin + Water
Hydrogen ion + Sulfite <> bisulfite
2-Amino-3-oxo-4-phosphonooxybutyrate + Hydrogen ion > 1-Amino-propan-2-one-3-phosphate + Carbon dioxide
Propylene glycol + NAD <> acetol + NADH + Hydrogen ion
S-Adenosylmethionine + a [protein]-L-glutamine > Hydrogen ion + S-Adenosylhomocysteine + a [protein]-N<sup>5</sup>-methyl-L-glutamine
Ribose-1-phosphate + Adenosine triphosphate > Hydrogen ion + Ribose 1,5-bisphosphate + ADP
Hydrogen ion + Pyruvic acid + Acetaldehyde > acetoin + Carbon dioxide
2-Pyrocatechuic acid + Oxygen > Hydrogen ion + 2-Carboxymuconate
Hydrogen ion > Hydrogen (gas)
menadiol + Oxygen > Hydrogen ion + menadione + Superoxide anion
a 1,2-diacyl-<i>sn</i>-glycerol 3-diphosphate + Water PA(16:0/16:0) + Phosphate + Hydrogen ion
&alpha;-Kdo-(2->4)-&alpha;-Kdo-(2->6)-lipid IV<SUB>A</SUB> + ADP-L-Glycero-D-manno-heptose Hydrogen ion + heptosyl-Kdo<sub>2</sub>-lipid IV<sub>A</sub> + ADP
Ammonia + Hydrogen ion <> Ammonium
OH<SUP>-</SUP> + Hydrogen ion <> Water
Carbamic acid + Hydrogen ion > Ammonia + Carbon dioxide
an L-1-phosphatidyl-glycerol + Adenosine triphosphate > an L-1-phosphatidylglycerol-phosphate + ADP + Hydrogen ion
L-Galactonate + NAD > Hydrogen ion + D-tagaturonate + NADH
poly-&beta;-1,6-N-acetyl-D-glucosamine + Water Hydrogen ion + partially N-deacetylated poly-&beta;-1,6-N-acetyl-D-glucosamine + Acetic acid
Dihydromonapterin-triphosphate + Water > Hydrogen ion + 7,8-Dihydroneopterin + Phosphate
3-ureidoacrylate + Water > Hydrogen ion + Carbamic acid + 3-Aminoacrylate
Peroxyaminoacrylate + a reduced electron acceptor > 3-Aminoacrylate + Water + Hydrogen ion + an oxidized electron acceptor
bromoacetate + Glutathione Hydrogen ion + glutathione-S-acetate + Br<SUP>-</SUP>
curcumin + NADPH + Hydrogen ion > dihydrocurcumin + NADP
dihydrocurcumin + NADPH + Hydrogen ion > tetrahydrocurcumin + NADP
&alpha;-D-ribose-1,2-cyclic-phosphate-5-phosphate + Water > Hydrogen ion + Ribose 1,5-bisphosphate
D-Galactose + NAD 3-keto-&beta;-D-galactose + NADH + Hydrogen ion
&alpha;-D-ribose-1-methylphosphonate-5-triphosphate + Water > Hydrogen ion + &alpha;-D-ribose-1-methylphosphonate-5-phosphate + Pyrophosphate
Hydrogen ion + &alpha;-D-ribose-1-methylphosphonate-5-phosphate + S-Adenosylmethionine > &alpha;-D-ribose-1,2-cyclic-phosphate-5-phosphate + methane + 5'-Deoxyadenosine + L-Methionine
Hydrogen ion + 3-Mercaptopyruvic acid > Pyruvic acid + Hydrogen sulfide
&beta;-D-galactofuranose + Adenosine triphosphate + Water > &beta;-D-galactofuranose + ADP + Phosphate + Hydrogen ion
S-Adenosylmethionine + Uroporphyrinogen III <> S-Adenosylhomocysteine + precorrin-1 + Hydrogen ion
a lipopolysaccharide + Water + Adenosine triphosphate > a lipopolysaccharide + Phosphate + ADP + Hydrogen ion
Hydrogen ion + Water + Adenosine triphosphate <> Hydrogen ion + Phosphate + ADP
Hydrogen ion + Water + Adenosine triphosphate <> Hydrogen ion + Phosphate + ADP
-->-->NADP + Gluconic acid <> Hydrogen ion + 2-Dehydro-D-gluconate + NADPH
NAD(P)<sup>+</sup> + L-Idonate <> NAD(P)H + 5-Keto-D-gluconate + Hydrogen ion
Hydrogen ion + NADPH + 2,5-Diketo-D-gluconate <> 2-Dehydro-D-gluconate + NADP
an aldehyde + Water + an oxidized electron acceptor a carboxylate + a reduced electron acceptor + Hydrogen ion
NAD(P)<sup>+</sup> + Tetrahydropteridine <> NAD(P)H + 6,7-Dihydropteridine + Hydrogen ion
alpha-Ketoisovaleric acid + Acetyl-CoA + Water > Hydrogen ion + 3-Carboxy-3-hydroxy-isocaproate + Coenzyme A
Oxalacetic acid + Water + Propionyl-CoA <> Hydrogen ion + Methylcitric acid + Coenzyme A
2-Octaprenyl-6-methoxyphenol + Oxygen + NADPH + Hydrogen ion > 2-Octaprenyl-6-methoxy-1,4-benzoquinol + Water + NADP
S-Adenosylmethionine + a [protein]-L-&beta;-isoaspartate > S-Adenosylhomocysteine + a protein L-&beta;-isoaspartate &alpha;-methyl ester + Hydrogen ion
a phospholipid olefinic fatty acid + S-Adenosylmethionine > a phospholipid cyclopropane fatty acid + S-Adenosylhomocysteine + Hydrogen ion
Glucosamine-1P + Acetyl-CoA > Hydrogen ion + <i>N</i>-acetyl-&alpha;-D-glucosamine 1-phosphate + Coenzyme A
Hydrogen ion + Isochorismate + Oxoglutaric acid > 2-Succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate + Carbon dioxide
4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate > Hydrogen ion + 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP
Adenosine triphosphate + a [protein]-L-tyrosine > ADP + a protein-L-tyrosine phosphate + Hydrogen ion
Hydrogen ion + Nicotinamide ribotide + Adenosine triphosphate <> NAD + Pyrophosphate
Hydrogen ion + D-Mannose 1-phosphate + Guanosine triphosphate > Guanosine diphosphate mannose + Pyrophosphate
Hydrogen ion + 2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate > 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Hydrogen ion + Dephospho-CoA + Adenosine triphosphate > 2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + Adenine
<i>S</i>-sulfanyl-[acceptor] + Dethiobiotin + S-Adenosylmethionine > an unsulfurated sulfur acceptor + Biotin + 5'-Deoxyadenosine + L-Methionine + Hydrogen ion
3-Isopropylmalate + NAD <> 2-Isopropyl-3-oxosuccinate + NADH + Hydrogen ion
Hydrogen ion + 3-Octaprenyl-4-hydroxybenzoate > 2-Octaprenylphenol + Carbon dioxide
Water + formyl-L-methionyl peptide > Hydrogen ion + methionyl peptide + Formic acid
a nucleoside triphosphate + Water > a nucleoside monophosphate + Pyrophosphate + Hydrogen ion
2,3-diaminopropanoate + Water > Hydrogen ion + Ammonia + Pyruvic acid
L-Serine > Hydrogen ion + Pyruvic acid + Ammonia
Hydrogen ion + L-Alanine + pimeloyl-CoA > Carbon dioxide + Coenzyme A + 8-Amino-7-oxononanoate
Ni<SUP>2+</SUP> + Adenosine triphosphate + Water > Ni<SUP>2+</SUP> + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Water + an alkylphosphonate > ADP + Phosphate + an alkylphosphonate + Hydrogen ion
Adenosine triphosphate + beta-D-Ribopyranose + Water > ADP + Phosphate + beta-D-Ribopyranose + Hydrogen ion
Adenosine triphosphate + a dipeptide + Water > ADP + Phosphate + a dipeptide + Hydrogen ion
Adenosine triphosphate + Fe(III)dicitrate + Water > ADP + Phosphate + Fe(III)dicitrate + Hydrogen ion
Acetoacetic acid + Hydrogen ion acetone + Carbon dioxide
acetoin + NADP diacetyl + NADPH + Hydrogen ion
(R)-2,3-Dihydroxy-isovalerate + NADP <> (<i>S</i>)-2-acetolactate + NADPH + Hydrogen ion
Hydrogen ion + Pyruvic acid <> (<i>S</i>)-2-acetolactate + Carbon dioxide
Water + an acetic ester > an alcohol + Acetic acid + Hydrogen ion
an acyl-CoA + Water > Coenzyme A + a carboxylate + Hydrogen ion
Water + an acyl phosphate > Phosphate + a carboxylate + Hydrogen ion
L-Aspartic acid + Inosinic acid + Guanosine triphosphate > Hydrogen ion + adenylo-succinate + Phosphate + Guanosine diphosphate
Glycine + Acetyl-CoA <> Hydrogen ion + L-2-Amino-3-oxobutanoic acid + Coenzyme A
a primary alcohol + NAD <> an aldehyde + NADH + Hydrogen ion
NADP + an alcohol an aldehyde + NADPH + Hydrogen ion
an aldehyde + Water + NADP a carboxylate + NADPH + Hydrogen ion
Hydrogen ion + Allantoic acid + Water > <i>S</i>-ureidoglycine + Ammonia + Carbon dioxide
<i>S</i>-allantoin + Water > Hydrogen ion + Allantoic acid
NAD + D-Altronate <> Hydrogen ion + NADH + D-tagaturonate
Aminoacetone + Water + Oxygen > Hydrogen ion + Pyruvaldehyde + Ammonia + Hydrogen peroxide
an aliphatic amine + Water + Oxygen > an aldehyde + Ammonia + Hydrogen peroxide + Hydrogen ion
Water + Oxygen + Phenylethylamine > Hydrogen ion + Hydrogen peroxide + Ammonia + Phenylacetaldehyde
L-Aspartic acid + Citrulline + Adenosine triphosphate > Hydrogen ion + L-arginino-succinate + Pyrophosphate + Adenosine monophosphate
L-Asparagine + Water > Hydrogen ion + L-Aspartic acid + Ammonia
L-Aspartic acid <> Hydrogen ion + Fumaric acid + Ammonia
Ammonia + Carbon dioxide + Adenosine triphosphate < Hydrogen ion + Carbamoylphosphate + ADP
a carboxylic ester + Water > an alcohol + a carboxylate + Hydrogen ion
a CDP-diacylglycerol + Water <> PA(16:0/16:0) + Cytidine monophosphate + Hydrogen ion
Cytidine triphosphate + PA(16:0/16:0) + Hydrogen ion > Pyrophosphate + a CDP-diacylglycerol
Adenosylcobinamide-GDP + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole > adenosylcobalamin 5'-phosphate + Guanosine monophosphate + Hydrogen ion
a nucleoside 2',3'-cyclic phosphate + Water > a nucleoside 3'-phosphate + Hydrogen ion
L-Cystathionine + Water > Hydrogen ion + Pyruvic acid + Ammonia + L-Homocysteine
D-Cysteine + Water <> Pyruvic acid + Hydrogen sulfide + Ammonia + Hydrogen ion
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate > Hydrogen ion + 2-Dehydro-3-deoxy-D-galactonate-6-phosphate + ADP
2-Keto-3-deoxy-D-gluconic acid + Adenosine triphosphate > Hydrogen ion + 2-Keto-3-deoxy-6-phosphogluconic acid + ADP
Dephospho-CoA + Adenosine triphosphate > Hydrogen ion + Coenzyme A + ADP
Carbon dioxide + 7,8-Diaminononanoate + Adenosine triphosphate > Hydrogen ion + Dethiobiotin + Phosphate + ADP
Water + dGTP > Hydrogen ion + Triphosphate + Deoxyguanosine
Hydrogen ion + Adenosine triphosphate + 2-Pyrocatechuic acid > Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
NAD + (2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate > Hydrogen ion + NADH + 2-Pyrocatechuic acid
Adenosine triphosphate + a 1,2-diacylglycerol <> Hydrogen ion + PA(16:0/16:0) + ADP
an aliphatic &alpha;,&omega;-diamine + Acetyl-CoA <> an aliphatic <i>N</i>-acetyl-diamine + Coenzyme A + Hydrogen ion
Hydrogen ion + <i>meso</i>-diaminopimelate > L-Lysine + Carbon dioxide
(2E)-Decenoyl-CoA + NADP <> Hydrogen ion + trans-Delta2, cis-delta4-decadienoyl-CoA + NADPH
Pyruvic acid + L-Aspartate-semialdehyde <> Hydrogen ion + Water + 2,3-Dihydrodipicolinic acid
L-Glutamate + 7,8-Dihydropteroic acid + Adenosine triphosphate > Hydrogen ion + Dihydrofolic acid + Phosphate + ADP
NAD(P)<sup>+</sup> + Tetrahydrodipicolinate < NAD(P)H + 2,3-Dihydrodipicolinic acid + Hydrogen ion
all-<i>trans</i>-octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoic acid + Hydrogen ion > 2-Demethylmenaquinol 8 + Pyrophosphate + Carbon dioxide
D-Serine > Hydrogen ion + Pyruvic acid + Ammonia
NADP + Deoxythymidine diphosphate-L-rhamnose <> Hydrogen ion + NADPH + dTDP-4-dehydro-6-deoxy-&beta;-L-mannose
Adenosine triphosphate + L-Serine + 2-Pyrocatechuic acid > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Enterochelin
Ethanolamine > Hydrogen ion + Acetaldehyde + Ammonia
NAD(P)<sup>+</sup> + FMNH <> NAD(P)H + Flavin Mononucleotide + Hydrogen ion
Formic acid + Hydrogen ion + a menaquinone > Hydrogen ion + Carbon dioxide + a menaquinol
Formic acid + Hydrogen ion + a menaquinone > Hydrogen ion + Carbon dioxide + a menaquinol
D-Galactose + Adenosine triphosphate > Hydrogen ion + Galactose 1-phosphate + ADP
GDP-&alpha;-D-glucose + Water > Hydrogen ion + b-D-Glucose + Guanosine diphosphate
b-D-Glucose + Adenosine triphosphate > Hydrogen ion + Glucose 6-phosphate + ADP
NAD(P)<sup>+</sup> + Gluconic acid <> NAD(P)H + 5-Keto-D-gluconate + Hydrogen ion
Gluconolactone + Water > Hydrogen ion + Gluconic acid
Glucosamine 6-phosphate + Water <> Hydrogen ion + Fructose 6-phosphate + Ammonia
L-Glutamate + NADP < Hydrogen ion + L-Glutamine + Oxoglutaric acid + NADPH
Phosphoribulosylformimino-AICAR-P + L-Glutamine > Hydrogen ion + L-Glutamate + D-Erythro-imidazole-glycerol-phosphate + AICAR
L-Glutamine + Water > Hydrogen ion + L-Glutamate + Ammonia
L-Glutamate + Water + NADP <> Hydrogen ion + Oxoglutaric acid + Ammonia + NADPH
NAD(P)<sup>+</sup> + Glycerol 3-phosphate < NAD(P)H + Dihydroxyacetone phosphate + Hydrogen ion
a glycerophosphodiester + Water > an alcohol + Glycerol 3-phosphate + Hydrogen ion
D-Lactic acid + Hydrogen ion < Pyruvaldehyde + Water
Adenosine triphosphate + Xanthylic acid + Ammonia > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate
Water + Guanosine triphosphate > Hydrogen ion + Pyrophosphate + 2,5-Diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine + Formic acid
Guanosine diphosphate + Water > Hydrogen ion + Guanosine monophosphate + Phosphate
histidinal + NAD + Water > Hydrogen ion + L-Histidine + NADH
L-Histidinol + NAD > Hydrogen ion + histidinal + NADH
L-Homocysteine + S-Adenosylmethionine Hydrogen ion + L-Methionine + S-Adenosylhomocysteine
NAD(P)<sup>+</sup> + L-Homoserine < NAD(P)H + L-Aspartate-semialdehyde + Hydrogen ion
Propionyl-CoA + Water + Glyoxylic acid <> 2-hydroxyglutarate + Hydrogen ion + Coenzyme A
Isopentenyl pyrophosphate + NAD(P)<sup>+</sup> + Water < 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NAD(P)H + Hydrogen ion
CMP-3-Deoxy-D-manno-octulosonate + lipid IV<sub>A</sub> <> Hydrogen ion + KDO-lipid IV(A) + Cytidine monophosphate
KDO-lipid IV(A) + CMP-3-Deoxy-D-manno-octulosonate <> Hydrogen ion + &alpha;-Kdo-(2->4)-&alpha;-Kdo-(2->6)-lipid IV<SUB>A</SUB> + Cytidine monophosphate
NAD + 2-Deoxygluconate <> Hydrogen ion + NADH + 3-Dehydro-2-deoxy-D-gluconate
L-Cysteine + Water > Pyruvic acid + Ammonia + Hydrogen sulfide + Hydrogen ion
5-amino-6-(D-ribitylamino)uracil + 3,4-Dihydroxy-2-butanone-4-P > Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine + Phosphate + Water
2-Acylglycerophosphocholine + Water a carboxylate + Glycerophosphocholine + Hydrogen ion
L-xylulose + Adenosine triphosphate > Hydrogen ion + L-Xylulose 5-phosphate + ADP
D-Mannose + Adenosine triphosphate > Hydrogen ion + Mannose 6-phosphate + ADP
Hydrogen cyanide + 3-Mercaptopyruvic acid Hydrogen ion + Pyruvic acid + Thiocyanate
Hydrogen ion + 2-Ketobutyric acid + Succinic acid + Ammonia O-Succinyl-L-homoserine + Water
Hydrogen ion + 3-(3-Hydroxyphenyl)propionate + NADH + Oxygen > Water + 3-(2,3-Dihydroxyphenyl)propionic acid + NAD
S-methyl-L-methionine + L-Homocysteine Hydrogen ion + L-Methionine
L-Glutamate + Acetyl-CoA <> Hydrogen ion + <i>N</i>-acetyl-L-glutamate + Coenzyme A
N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimelyl-D-alanyl-D-alanine-diphosphoundecaprenol + Uridine diphosphate-N-acetylglucosamine <> Hydrogen ion + N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine-diphosphoundecaprenyl-N-acetylglucosamine + Uridine 5'-diphosphate
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + L-Glutamine + Water > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD + L-Glutamate
Hydrogen ion + a ubiquinone + NADH <> a ubiquinol + NAD
menadione + NADH + Hydrogen ion menadiol + NAD
Water + NAD <> Hydrogen ion + Adenosine diphosphate ribose + Niacinamide
Water + NAD > Hydrogen ion + Nicotinamide ribotide + Adenosine monophosphate
Hydrogen ion + <i>N</i>-acetyl-&alpha;-D-glucosamine 1-phosphate + Uridine triphosphate > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
Niacinamide + Water > Hydrogen ion + Nicotinic acid + Ammonia
Nicotinamide ribotide + Pyrophosphate < Hydrogen ion + Nicotinic acid + Phosphoribosyl pyrophosphate
Nitrous oxide + Water + Cytochromes-C-Oxidized Nitric oxide + Hydrogen ion + Cytochromes-C-Reduced
Nicotinamide ribotide + Water > Hydrogen ion + Nicotinamide ribotide + Ammonia
Water + Nicotinamide ribotide <> Hydrogen ion + D-Ribose-5-phosphate + Niacinamide
NAD(P)H + Hydrogen ion + a quinone a quinol + NAD(P)<sup>+</sup>
a nucleoside diphosphate + Water > a nucleoside monophosphate + Phosphate + Hydrogen ion
NAD + a (3<i>S</i>)-3-hydroxyacyl-CoA > NADH + a 3-oxoacyl-CoA + Hydrogen ion
Water + Porphobilinogen <> Hydrogen ion + Ammonia + Hydroxymethylbilane
Adenosine triphosphate + 4-Amino-5-hydroxymethyl-2-methylpyrimidine <> Hydrogen ion + ADP + 4-Amino-2-methyl-5-phosphomethylpyrimidine
Ornithine + Carbamoylphosphate <> Hydrogen ion + Citrulline + Phosphate
Hydrogen ion + Ornithine > Carbon dioxide + Putrescine
Hydrogen ion + 4-Phosphopantothenoylcysteine > Pantetheine 4'-phosphate + Carbon dioxide
1-Amino-propan-2-one-3-phosphate + 1-Deoxy-D-xylulose 5-phosphate > Hydrogen ion + Pyridoxine 5'-phosphate + Phosphate + Water
Water + NAD + Phenylacetaldehyde <> Hydrogen ion + NADH + phenylacetate
a CDP-diacylglycerol + Glycerol 3-phosphate <> Cytidine monophosphate + an L-1-phosphatidylglycerol-phosphate + Hydrogen ion
an L-1-phosphatidylserine + Hydrogen ion > PE(14:0/14:0) + Carbon dioxide
a CDP-diacylglycerol + L-Serine <> Cytidine monophosphate + an L-1-phosphatidylserine + Hydrogen ion
Oxygen + Water + Pyridoxamine 5'-phosphate > Hydrogen ion + Hydrogen peroxide + Ammonia + Pyridoxal 5'-phosphate
Adenosine triphosphate + Pyridoxine > Hydrogen ion + ADP + Pyridoxine 5'-phosphate
5-Aminolevulinic acid <> Hydrogen ion + Water + Porphobilinogen
Guanosine 3',5'-bis(diphosphate) + Water > Hydrogen ion + Pyrophosphate + Guanosine diphosphate
Water + Guanosine 3'-diphosphate 5'-triphosphate > Hydrogen ion + Phosphate + Guanosine 3',5'-bis(diphosphate)
Hydrogen ion + Prephenate > Phenylpyruvic acid + Water + Carbon dioxide
Adenosine triphosphate + Hydrogen carbonate + Propionyl-CoA > Hydrogen ion + ADP + Phosphate + (S)-Methylmalonyl-CoA
Iron + Protoporphyrin IX > Heme + Hydrogen ion
Adenosine triphosphate + D-Ribose-5-phosphate <> Hydrogen ion + Phosphoribosyl pyrophosphate + Adenosine monophosphate
Pseudouridine + Adenosine triphosphate > Hydrogen ion + Pseudouridine 5'-phosphate + ADP
Adenosine triphosphate + Pyridoxamine <> Hydrogen ion + ADP + Pyridoxamine 5'-phosphate
5-Aminoimidazole ribonucleotide + S-Adenosylmethionine 4-Amino-2-methyl-5-phosphomethylpyrimidine + 5'-Deoxyadenosine + L-Methionine + Formic acid + carbon monoxide + Hydrogen ion
NAD(P)<sup>+</sup> + L-Proline < NAD(P)H + L-D-1-Pyrroline-5-carboxylic acid + Hydrogen ion
Hydrogen ion + Pyruvic acid + Lipoamide S-Acetyldihydrolipoamide + Carbon dioxide
NAD(P)<sup>+</sup> + (S)-Ureidoglycolic acid > NAD(P)H + Oxalureate + Hydrogen ion
NADH + Copper Hydrogen ion + NAD + Cu<SUP>+</SUP>
an alcohol + Water + NAD < an organic hydroperoxide + NADH + Hydrogen ion
NAD(P)H + Nitric oxide + Oxygen > NAD(P)<sup>+</sup> + Nitrate + Hydrogen ion
Hydrogen ion + 6,7-Dimethyl-8-(1-D-ribityl)lumazine > 5-amino-6-(D-ribitylamino)uracil + Riboflavin
D-ribose + Adenosine triphosphate > Hydrogen ion + D-Ribose-5-phosphate + ADP
Nicotinamide riboside + Adenosine triphosphate > Hydrogen ion + Nicotinamide ribotide + ADP
L-Tyrosine + S-Adenosylmethionine + a reduced electron acceptor > Dehydroglycine + p-Cresol + 5'-Deoxyadenosine + L-Methionine + an oxidized electron acceptor + Hydrogen ion
8-oxo-dGTP + Water > Hydrogen ion + 8-oxo-dGMP + Pyrophosphate
L-Alanine + Hydrogen ion + Pimeloyl-ACPs > 8-Amino-7-oxononanoate + Carbon dioxide + ACP
2,5-Diketo-D-gluconate + NAD(P)H + Hydrogen ion > 2-keto-L-gulonate + NAD(P)<sup>+</sup>
2-keto-L-gulonate + NAD(P)H + Hydrogen ion > L-Idonate + NAD(P)<sup>+</sup>
Uridine 5'-diphosphate + Water > Phosphate + Uridine 5'-monophosphate + Hydrogen ion
CDP + Water > Phosphate + Cytidine monophosphate + Hydrogen ion
a methylated nucleobase within DNA + Oxygen + Oxoglutaric acid Hydrogen ion + a nucleobase within DNA + Carbon dioxide + Formaldehyde + Succinic acid
Ascorbic acid + Hydrogen peroxide + Hydrogen ion > Ascorbic acid + L-dehydro-ascorbate + Water
Reduced riboflavin + NAD(P)<sup>+</sup> Riboflavin + NAD(P)H + Hydrogen ion
L-Cysteine + a sulfur acceptor + Hydrogen ion L-Alanine + <i>S</i>-sulfanyl-[acceptor]
2-[(2<i>R</i>,5<i>Z</i>)-(2-carboxy-4-methylthiazol-5(2<i>H</i>)-ylidene]ethyl phosphate + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Hydrogen ion > Thiamine monophosphate + Carbon dioxide + Pyrophosphate
Thymine + Oxygen + FMNH > (<i>Z</i>)-2-methylureidoacrylate peracid + Flavin Mononucleotide + Hydrogen ion
(<i>Z</i>)-2-methylureidoacrylate peracid + Water > (<i>Z</i>)-2-methyl-peroxyaminoacrylate + Carbamic acid + Hydrogen ion
(<i>S</i>)-NADPHX + ADP NADPH + Adenosine monophosphate + Phosphate + Hydrogen ion
Adenosine triphosphate + Hydrogen carbonate + Ammonia > ADP + Phosphate + Carbamoylphosphate + Hydrogen ion
NAD(P)<sup>+</sup> + S-(Hydroxymethyl)glutathione <> NAD(P)H + S-Formylglutathione + Hydrogen ion
Hydrogen ion + Tetrahydrodipicolinate + Water > L-&alpha;-amino-&epsilon;-keto-pimelate
NAD(P)<sup>+</sup> + Quinate NAD(P)H + 3-Dehydroquinate + Hydrogen ion
NAD(P)<sup>+</sup> + Shikimic acid < NAD(P)H + 3-Dehydro-shikimate + Hydrogen ion
L-Proline + an oxidized electron acceptor > L-D-1-Pyrroline-5-carboxylic acid + a reduced electron acceptor + Hydrogen ion
Lactaldehyde + NADP < Pyruvaldehyde + NADPH + Hydrogen ion
a quaternary amine + Water + Adenosine triphosphate > a quaternary amine + Phosphate + ADP + Hydrogen ion
Oxalosuccinic acid + Hydrogen ion > Oxoglutaric acid + Carbon dioxide
2-hydroxyglutarate + NAD <> Hydrogen ion + Oxoglutaric acid + NADH
Hydrogen ion + Lipoic acid + Adenosine triphosphate > Lipoyl-AMP + Pyrophosphate
Coproporphyrinogen III + Oxygen + Hydrogen ion > Protoporphyrinogen IX + Carbon dioxide + Water
Iron + Hydrogen ion + Oxygen > Fe<SUP>3+</SUP> + Water
Hydrogen ion + Ethyl-2-methylacetoacetate + NADPH <> Ethyl-(2R)-methyl-(3S)-hydroxybutanoate + NADP
Phenylacetyl-CoA + Oxygen + NADPH + Hydrogen ion > 2-(1,2-epoxy-1,2-dihydrophenyl)acetyl-CoA + NADP + Water
3-Hydroxyadipyl-CoA + NAD <> Hydrogen ion + 3-Oxoadipyl-CoA + NADH
UDP-N-Acetylmuraminate + L-Ala-D-Glu-meso-A2pm + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + ADP + Phosphate
Hydrogen ion + molybdenum cofactor + Guanosine triphosphate <> Molybdopterin guanine dinucleotide + Pyrophosphate
NADPH + Hydrogen ion + an electron-transfer-related quinone > NADP + an electron-transfer-related quinol
3-Sulfinoalanine + Water Hydrogen ion + L-Alanine + Sulfite
an alkanesulfonate + Oxygen + FMNH > an aldehyde + Sulfite + Water + Flavin Mononucleotide + Hydrogen ion
Cu<SUP>+</SUP> + Hydrogen ion + Oxygen > Copper + Water
Taurine + Oxoglutaric acid + Oxygen > Hydrogen ion + Aminoacetaldehyde + Sulfite + Succinic acid + Carbon dioxide
Hydrogen ion + R-Methylmalonyl-CoA > Propionyl-CoA + Carbon dioxide
Formic acid + an oxidized electron acceptor + Hydrogen ion > Carbon dioxide + a reduced electron acceptor
a menaquinol + Nitrate + Hydrogen ion > a menaquinone + Nitrite + Water + Hydrogen ion
a menaquinol + Nitrate + Hydrogen ion > a menaquinone + Nitrite + Water + Hydrogen ion
Adenosine triphosphate + 1-Deoxy-D-xylulose > Hydrogen ion + 1-Deoxy-D-xylulose 5-phosphate + ADP
Putrescine + L-Glutamate + Adenosine triphosphate > Hydrogen ion + gamma-Glutamyl-L-putrescine + ADP + Phosphate
NAD(P)<sup>+</sup> + gamma-Glutamyl-gamma-butyraldehyde + Water > 4-(Glutamylamino) butanoate + NAD(P)H + Hydrogen ion
preQ<sub>1</sub> + NADP < 7-Cyano-7-carbaguanine + NADPH + Hydrogen ion
cyclic di-3',5'-guanylate + Water > Hydrogen ion + Linear dimeric GMP
D-Glycero-D-manno-heptose 7-phosphate + Adenosine triphosphate > Hydrogen ion + D-Glycero-D-manno-heptose 1,7-bisphosphate + ADP
Hydrogen ion + D-<i>glycero</i>-&beta;-D-<i>manno</i>-heptose 1-phosphate + Adenosine triphosphate > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
NADH + Water > Hydrogen ion + NMNH + Adenosine monophosphate
1,6-Anhydro-N-acetylmuramate + Adenosine triphosphate + Water > Hydrogen ion + N-Acetylmuramic acid 6-phosphate + ADP
Cyclic AMP + Water > Hydrogen ion + Adenosine monophosphate
Heptosyl-KDO2-lipid A + ADP-L-Glycero-D-manno-heptose > Hydrogen ion + Heptosyl2-KDO2-lipid A + ADP
N-6-isopentyl adenosine-37 tRNA + S-Adenosylmethionine + <i>S</i>-sulfanyl-[acceptor] 2-methylthio-N-6-isopentyl adenosine-37 tRNA + S-Adenosylhomocysteine + L-Methionine + 5'-Deoxyadenosine + an unsulfurated sulfur acceptor + Hydrogen ion
Xanthosine 5-triphosphate + Water > Hydrogen ion + XDP + Phosphate
Hydrogen ion + <i>N</i>-ethylmaleimide N-Ethylsuccinimide
Hydrogen ion + KDO2-Lipid A + ADP-L-Glycero-D-manno-heptose > Heptosyl-KDO2-lipid A + ADP
UDP-Glucose + Heptosyl2-KDO2-lipid A > Hydrogen ion + Glucosyl-heptosyl2-KDO2-lipid A + Uridine 5'-diphosphate
Glucosyl-heptosyl2-KDO2-lipid A + Adenosine triphosphate > Hydrogen ion + Glucosyl-heptosyl2-KDO2-lipid A-phosphate + ADP
Glucosyl-heptosyl2-KDO2-lipid A-phosphate + ADP-L-Glycero-D-manno-heptose > Hydrogen ion + Glucosyl-heptosyl3-KDO2-lipid A-phosphate + ADP
Glucosyl-heptosyl3-KDO2-lipid A-phosphate + Adenosine triphosphate > Hydrogen ion + Glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + ADP
Glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + Uridine diphosphategalactose > Hydrogen ion + Galactosyl-glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + Uridine 5'-diphosphate
UDP-Glucose + Galactosyl-glucosyl-heptosyl3-KDO2-lipid A-bisphosphate > Hydrogen ion + Galactosyl-glucosyl2-heptosyl3-KDO2-lipid A-bisphosphate + Uridine 5'-diphosphate
UDP-Glucose + Galactosyl-glucosyl2-heptosyl3-KDO2-lipid A-bisphosphate > Hydrogen ion + Galactosyl-glucosyl3-heptosyl3-KDO2-lipid A-bisphosphate + Uridine 5'-diphosphate
Galactosyl-glucosyl3-heptosyl3-KDO2-lipid A-bisphosphate + ADP-L-Glycero-D-manno-heptose > Hydrogen ion + Lipid A-core + ADP
an aminated amine donor + 2-Ketobutyric acid + Hydrogen ion 2-aminobutyrate + a deaminated amine donor
Hydrogen ion + Adenosine triphosphate + Adenosine triphosphate Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + ADP > Diadenosine triphosphate + Pyrophosphate
Hydrogen ion + Pyruvaldehyde + NADH acetol + NAD
a menaquinone + Hydrogen ion + Hydrogen (gas) > a menaquinol + Hydrogen ion
a menaquinone + Hydrogen ion + Hydrogen (gas) > a menaquinol + Hydrogen ion
a menaquinol + Hydrogen ion + Trimethylamine N-Oxide > a menaquinone + Water + Trimethylamine
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
Oxygen + Hydrogen ion + a ubiquinol > a ubiquinone + Water + Hydrogen ion
-->-->Pyruvic acid + Hydrogen ion > L-Lactic acid
Ubiquinone-8 + Hydrogen ion > Ubiquinol-8
NADH + Hydrogen ion + a menaquinone > a menaquinol + NAD
N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine-diphosphoundecaprenyl-N-acetylglucosamine > Hydrogen ion + a peptidoglycan dimer (<I>meso</I>-diaminopimelate containing) + Undecaprenyl diphosphate
Glycerol 3-phosphate + NADP < Hydrogen ion + L-Glyceraldehyde 3-phosphate + NADPH
3-hydroxypropionaldehyde + NAD + Water > Hydrogen ion + 3-Hydroxypropanoate + NADH
Cytidine triphosphate + a 2,3,4-saturated L-phosphatidate + Hydrogen ion > Pyrophosphate + a CDP-2,3,4-saturated-diacylglycerol
Hydrogen ion + molybdenum cofactor + Cytidine triphosphate > Molybdopterin cytosine dinucleotide + Pyrophosphate
<i>S</i>-sulfanyl-[acceptor] + Hydrogen cyanide an unsulfurated sulfur acceptor + Thiocyanate + Hydrogen ion
Nitrate + Hydrogen ion > Nitrite + Water
Gluconolactone + Hydrogen ion <> b-D-Glucose
Acetic acid + Carbon dioxide + Hydrogen ion <> Pyruvic acid + Water
NAD(P)H + Nitrite + Hydrogen ion > NAD(P)<sup>+</sup> + Ammonium + Water
Guanosine 3'-diphosphate 5'-triphosphate + Water > Hydrogen ion + Guanosine triphosphate + Pyrophosphate
Uracil + Oxygen + FMNH > Hydrogen ion + Ureidoacrylate peracid + Flavin Mononucleotide
3-hydroxypropionaldehyde + NADPH + Hydrogen ion 1,3-propanediol + NADP
Iron + a siderophore + NADP < an Fe(III)-siderophore + NADPH + Hydrogen ion
4-Hydroxy-L-threonine + Adenosine triphosphate > Hydrogen ion + O-Phospho-4-hydroxy-L-threonine + ADP
Dihydrothymine + NAD <> Thymine + NADH + Hydrogen ion
6-Carboxy-5,6,7,8-tetrahydropterin + S-Adenosylmethionine + Hydrogen ion > 7-carboxy-7-deazaguanine + 5'-Deoxyadenosine + L-Methionine + Ammonia
PE(14:0/14:0) + Water a fatty acid + a 2-lyso-phosphatidyl-ethanolamine + Hydrogen ion
(<i>S</i>)-NADHX + ADP > Hydrogen ion + NADH + Adenosine monophosphate + Phosphate
a guanine<sup>1516</sup> in 16S rRNA + S-Adenosylmethionine > an <i>N</i><sup>2</sup>-methylguanine<sup>1516</sup> in 16S rRNA + S-Adenosylhomocysteine + Hydrogen ion
Iron + (2,3-dihydroxybenzoylserine)<sub>3</sub> + NADP < ferric 2,3-dihydroxybenzoylserine + NADPH + Hydrogen ion
PE(14:0/14:0) + Water > a 1-lyso-2-acyl-<i>sn</i>-glycero-3-phosphoethanolamine + a fatty acid + Hydrogen ion
5-Aminoimidazole ribonucleotide + Adenosine triphosphate + Hydrogen carbonate > Hydrogen ion + N5-Carboxyaminoimidazole ribonucleotide + ADP + Phosphate
1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + Water + Oxidized-ferredoxins < 2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + Hydrogen ion + Reduced-ferredoxins
NAD(P)<sup>+</sup> + Dimethylallylpyrophosphate + Water < NAD(P)H + Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate
N1-Methyladenine + Oxygen + Oxoglutaric acid > Hydrogen ion + Adenine + Carbon dioxide + Formaldehyde + Succinic acid
N3-Methylcytosine + Oxygen + Oxoglutaric acid > Hydrogen ion + Cytosine + Carbon dioxide + Formaldehyde + Succinic acid
a reduced electron acceptor + Selenocysteine <> L-Alanine + Selenium + an oxidized electron acceptor + Hydrogen ion
Putrescine + S-Adenosylmethioninamine > Hydrogen ion + Spermidine + 5'-Methylthioadenosine
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water > N<SUP>2</SUP>-succinylglutamate + NADH + Hydrogen ion
Hydrogen ion + Sulfate + Adenosine triphosphate > Adenosine phosphosulfate + Pyrophosphate
2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate + Adenosine triphosphate <> Hydrogen ion + lipid IV<sub>A</sub> + ADP
Adenosine triphosphate + 5-(2-Hydroxyethyl)-4-methylthiazole > Hydrogen ion + ADP + 4-Methyl-5-(2-phosphoethyl)-thiazole
a 2,3,4-saturated fatty acyl CoA + Water a 2,3,4-saturated fatty acid + Coenzyme A + Hydrogen ion
L-Threonine > Hydrogen ion + 2-Ketobutyric acid + Ammonia
Trimethylamine N-Oxide + NADH + Hydrogen ion > Trimethylamine + NAD + Water
Adenosine triphosphate + Arsenate + Water > ADP + Arsenate + Phosphate + Hydrogen ion
Cu<SUP>+</SUP> + Water + Adenosine triphosphate > Cu<SUP>+</SUP> + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Water + N-Acetyl-D-glucosamine > N-Acetyl-D-glucosamine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + L-Ala-D-Glu-meso-A2pm + Water > L-Ala-D-Glu-meso-A2pm + ADP + Phosphate + Hydrogen ion
(2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine triphosphate + Water > (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + ADP + Phosphate + Hydrogen ion
selenate + Water + Adenosine triphosphate > selenate + ADP + Phosphate + Hydrogen ion
Selenite + Water + Adenosine triphosphate > Selenite + ADP + Phosphate + Hydrogen ion
&alpha;-D-galactofuranose + Adenosine triphosphate + Water > &alpha;-D-galactofuranose + Phosphate + ADP + Hydrogen ion
a 2,3,4-saturated fatty acyl CoA + NADP > a <i>trans</i>-2-enoyl-CoA + NADPH + Hydrogen ion
UDP-Glucose + &alpha;-D-glucose 6-phosphate > Hydrogen ion + Uridine 5'-diphosphate + Trehalose 6-phosphate
L-Tryptophan + Water <> Hydrogen ion + Indole + Pyruvic acid + Ammonia
NAD(P)<sup>+</sup> + Glyceric acid < NAD(P)H + Tartronate semialdehyde + Hydrogen ion
<i>meso</i>-diaminopimelate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + Phosphate + ADP
Undecaprenyl-N-acetyl-alpha-D-glucosaminyl-pyrophosphate + UDP-N-Acetyl-D-mannosaminouronate <> Hydrogen ion + Undecaprenyl phosphate + Uridine 5'-diphosphate
a UDP-sugar + Water > Uridine 5'-monophosphate + an &alpha;-D-aldose-1-phosphate + Hydrogen ion
Undecaprenyl diphosphate + Water > Hydrogen ion + Di-trans,poly-cis-undecaprenyl phosphate + Phosphate
Hydrogen ion + Uroporphyrinogen III > Carbon dioxide + Coproporphyrinogen III
<i>S</i>-ureidoglycine + Water > Hydrogen ion + Ammonia + (S)-Ureidoglycolic acid
Hydrogen ion + 2-Dehydro-D-gluconate + NADPH <> L-Idonate + NADP
Cyanate + Carbonic acid + 2 Hydrogen ion > Ammonia +2 Carbon dioxide
2 Iron + Hydrogen peroxide + 2 Hydrogen ion >2 Fe3+ +2 Water
2 reduced ferredoxin + NADP + Hydrogen ion >2 oxidized ferredoxin + NADPH
L-Lactic acid + 2 Ferricytochrome c > Pyruvic acid +2 Ferrocytochrome c +2 Hydrogen ion
Ammonia + 2 Water + 6 Ferricytochrome c > Nitrite +6 Ferrocytochrome c +7 Hydrogen ion
2 superoxide + 2 Hydrogen ion > Oxygen + Hydrogen peroxide
Trimethylamine + 2 (ferricytochrome c)-subunit + Water > Trimethylamine N-Oxide +2 (ferrocytochrome c)-subunit +2 Hydrogen ion
Quercetin + Oxygen > 2-(3,4-dihydroxybenzoyloxy)-4,6-dihydroxybenzoate + CO + Hydrogen ion
2 Iron + 2 an apo-siderophore + NADP + Hydrogen ion >2 an Fe(III)-siderophore + NADPH
Succinic acid semialdehyde + NAD + NADP + Water <> Succinic acid + NADH + NADPH +2 Hydrogen ion
Glyceric acid + NAD + NADP <> Tartronate semialdehyde + NADH + NADPH + Hydrogen ion
Protein dithiol + NAD + NADP <> Protein disulfide + NADH + NADPH + Hydrogen ion
Isopentenyl pyrophosphate + NAD + NADP + Water + Dimethylallylpyrophosphate <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + NADPH + Hydrogen ion
Tetrahydrodipicolinate + NAD + NADP + Water <> (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADH + NADPH + Hydrogen ion
Protein N6-(dihydrolipoyl)lysine + NAD <> Protein N6-(lipoyl)lysine + NADH + Hydrogen ion
NADP <> 2,5-Diketo-D-gluconate + NADPH + Hydrogen ion
Cyanate + Hydrogen carbonate + 2 Hydrogen ion + Carbamic acid <> Ammonia +2 Carbon dioxide
3-(3-Hydroxyphenyl)propanoic acid + NADH + Hydrogen ion + Oxygen + 3-Hydroxycinnamic acid <> 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD + Trans-2,3-Dihydroxycinnamate
NADH + Hydrogen ion + Acceptor <> NAD + Reduced acceptor
L-Allothreonine + NADP + L-2-Amino-3-oxobutanoic acid <> Aminoacetone + Carbon dioxide + NADPH + Hydrogen ion
Quinate + NAD + NADP + Shikimic acid <> 3-Dehydroquinate + NADH + NADPH + Hydrogen ion + 3-Dehydro-shikimate
Dihydrouracil + NAD + Dihydrothymine <> Uracil + NADH + Hydrogen ion + Thymine
NADH + Hydrogen ion + Oxygen + Hydrocinnamic acid <> cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + Trans-2,3-Dihydroxycinnamate
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol <> 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion + Trans-2,3-Dihydroxycinnamate
NAD + Hydrogen ion <> NADH
Nitric oxide + 2 Oxygen + NADH + NADPH <>2 Nitrate + NAD + NADP + Hydrogen ion
Sorbitol 6-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
7-Aminomethyl-7-carbaguanine + NADP <> 7-Cyano-7-carbaguanine + NADPH +2 Hydrogen ion
trans-2,3-Dehydroacyl-CoA + NADP <> trans,trans-2,3,4,5-Tetradehydroacyl-CoA + NADPH + Hydrogen ion
2 L-Glutamate + NADP + Ammonia + Water <> L-Glutamine + alpha-Ketoglutarate + NADPH + Hydrogen ion
3-Dehydro-L-gulonate + NAD + NADP <> 2,3-Diketo-L-gulonate + NADH + NADPH + Hydrogen ion
Mannitol 1-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
5-Methyltetrahydrofolic acid + NAD + NADP <> 5,10-Methylene-THF + NADH + NADPH + Hydrogen ion
NAD + 2-Amino-3-oxo-4-phosphonooxybutyrate + O-Phospho-4-hydroxy-L-threonine <> 3-Amino-2-oxopropyl phosphate + Carbon dioxide + NADH + Hydrogen ion
3-Isopropylmalate + NAD + 2-Isopropyl-3-oxosuccinate <> Ketoleucine + Carbon dioxide + NADH + Hydrogen ion
S-(Hydroxymethyl)glutathione + NAD + NADP <> S-Formylglutathione + NADH + NADPH + Hydrogen ion
L-Proline + NAD + NADP <> (S)-1-pyrroline-5-carboxylate + NADH + NADPH + Hydrogen ion
Tetrahydropteridine + NAD + NADP <> 6,7-Dihydropteridine + NADH + NADPH + Hydrogen ion
NADH + NADPH + Hydrogen ion + Quinone <> NAD + NADP + Hydroquinone
Acyl-[acyl-carrier protein] + NAD <> trans-2,3-Dehydroacyl-[acyl-carrier protein] + NADH + Hydrogen ion
Primary alcohol + NAD + Secondary alcohol <> Aldehyde + NADH + Hydrogen ion + Ketone
L-Gulonate + NAD <> D-Fructuronate + NADH + Hydrogen ion
Cholic acid + NAD <> NADH + Hydrogen ion
NAD + Galactitol 1-phosphate <> L-Tagatose-6-phosphate + NADH + Hydrogen ion
(3S)-3-Hydroxyacyl-CoA + NAD <> 3-Oxoacyl-CoA + NADH + Hydrogen ion
(R)-Propane-1,2-diol + (S)-Propane-1,2-diol + NAD <> D-Lactaldehyde + (S)-Lactaldehyde + NADH + Hydrogen ion
3-Phospho-D-glycerate + NAD + D-2-Hydroxyglutaric acid <> Phosphohydroxypyruvic acid + NADH + Hydrogen ion + alpha-Ketoglutarate
NADP + Hydrogen ion <> NADPH
Glycerol 3-phosphate + NAD + NADP <> Dihydroxyacetone phosphate + NADH + NADPH + Hydrogen ion
4-Hydroxybutanoic acid + NAD <> Succinic acid semialdehyde + NADH + Hydrogen ion
Reduced ferredoxin + NADP + Hydrogen ion <> Oxidized ferredoxin + NADPH
L-Tyrosine + S-Adenosylmethionine + NADPH <> 2-iminoacetate + p-Cresol + 5'-Deoxyadenosine + L-Methionine + NADP + Hydrogen ion
NADPH + Hydrogen ion + 2 Quinone <> NADP +2 Semiquinone
Gluconic acid + NAD + NADP <> 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion
L-Idonate + NAD + NADP <> 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion
Alcohol + NADP <> Aldehyde + NADPH + Hydrogen ion
Propionyl-CoA + NADP <> Acrylyl-CoA + NADPH + Hydrogen ion
Isocitric acid + NADP + Oxalosuccinic acid <> alpha-Ketoglutarate + Carbon dioxide + NADPH + Hydrogen ion
Ammonia + NAD + 3 NADP + 2 Water <> Nitrite + NADH +3 NADPH +5 Hydrogen ion
(3R)-3-Hydroxyacyl-[acyl-carrier protein] + NADP <> 3-Oxoacyl-[acyl-carrier protein] + NADPH + Hydrogen ion
(S)-Ureidoglycolic acid + NAD + NADP <> Oxalureate + NADH + NADPH + Hydrogen ion
1-Deoxy-D-xylulose 5-phosphate + 2-Amino-3-phosphonopropionic acid + 1-Deoxy-D-xylulose 5-phosphate + 2-Amino-3-phosphonopropionic acid > Pyridoxine 5'-phosphate + Phosphate + Hydrogen ion +2 Water
D-Glyceraldehyde 3-phosphate + Pyruvic acid + Hydrogen ion + D-Glyceraldehyde 3-phosphate > 1-Deoxy-D-xylulose 5-phosphate + Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate
D-Glyceraldehyde 3-phosphate + Hydrogen ion + D-Glyceraldehyde 3-phosphate > Carbon dioxide + 1-Deoxy-D-xylulose 5-phosphate + 1-Deoxy-D-xylulose 5-phosphate
Pyridoxine + Adenosine triphosphate > Pyridoxine 5'-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
4-amino-2-methyl-5-diphosphomethylpyrimidine + 2-((2R,5Z)-2-Carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate + 2 Hydrogen ion + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate > Thiamine monophosphate + Carbon dioxide + diphosphate + Thiamine monophosphate + Pyrophosphate
beta-D-Glucose 6-phosphate + NADP > 6-Phosphonoglucono-D-lactone + NADPH + Hydrogen ion + NADPH
Selenate + 2 Hydrogen ion + 2 Electron > Selenite + Water
Nitrite + 3 NADH + 5 Hydrogen ion + Nitrite Ammonia +2 Water +3 NAD
Nitrite + 6 ferrocytochrome c + 7 Hydrogen ion + Nitrite + 6 Ferrocytochrome c <> Ammonia +6 ferricytochrome c +2 Water +6 Ferricytochrome c
Hydrogen carbonate + Cyanate + Hydrogen ion + Cyanate > Carbamic acid
L-Glutamic acid + Adenosine triphosphate + Ammonium + L-Glutamate > L-Glutamine + Hydrogen ion + Adenosine diphosphate + Phosphate + ADP
Hydrogen ion + NADPH + Ammonia + NADPH <> Water + NADP + L-Glutamic acid + L-Glutamate
Oxoglutaric acid + NADPH + Ammonium + Hydrogen ion + NADPH > L-Glutamic acid + Water + NADP + L-Glutamate
2 L-Glutamic acid + NADP + 2 L-Glutamate > L-Glutamine + NADPH + Hydrogen ion + Oxoglutaric acid + NADPH
(3S)-3-hydroxyacyl-CoA + NAD > NADH + Hydrogen ion + a 3-oxoacyl-CoA?
3-Hydroxybutyryl-CoA + NAD + 3-Hydroxybutyryl-CoA > NADH + Hydrogen ion + Acetoacetyl-CoA + Acetoacetyl-CoA
(S)-Hydroxyoctanoyl-CoA + NAD + (S)-Hydroxyoctanoyl-CoA NADH + Hydrogen ion + 3-Oxooctanoyl-CoA
(S)-3-Hydroxyoctadecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxooctadecanoyl-CoA + 3-Oxooctadecanoyl-CoA
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2,3-Dihydroxybenzoic acid + NADH + Hydrogen ion
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2-Pyrocatechuic acid + NADH + Hydrogen ion
a malonyl-[acp] + a malonyl-[acp] methyl ester + Hydrogen ion > Carbon dioxide + a holo-[acyl-carrier protein] + 3-Ketoglutaryl-[acp] methyl ester
3-Ketoglutaryl-[acp] methyl ester + NADPH + Hydrogen ion + NADPH > NADP + a 3R-hydroxyglutaryl-[acp] methyl ester
3-Ketopimeloyl-[acp] methyl ester + NADPH + Hydrogen ion + NADPH > NADP + 3-Hydroxypimeloyl-[acp] methyl ester
3-oxo-cis-?5-dodecenoyl-[acp]? + Hydrogen ion + NADPH + NADPH > 3R-hydroxy cis ?9-hexadecenoyl-[acp] + NADP
a 3-oxo-cis-?7-tetradecenoyl-[acp]? + Hydrogen ion + NADPH + NADPH > a 3R-hydroxy cis ?7-tetradecenoyl-[acp] + NADP
3-oxo-cis-?9-hexadecenoyl-[acp]? + Hydrogen ion + NADPH + NADPH > NADP + 3R-hydroxy cis ?9-hexadecenoyl-[acp]
3-oxo-cis-vaccenoyl-[acp]? + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxy-cis-vaccenoyl-[acp]
3-oxoacyl-[acp]? + Hydrogen ion + NADPH + NADPH > NADP + (3R)-3-hydroxyacyl-[acyl-carrier protein]
acetoacetyl-[acp] + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxybutanoyl-[acp]
3-oxo-hexanoyl-[acp]? + Hydrogen ion + NADPH + NADPH > (R)-3-hydroxyhexanoyl-[acp] + NADP
3-oxo-octanoyl-[acp]? + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxyoctanoyl-[acp]
3-oxo-decanoyl-[acp]? + Hydrogen ion + NADPH + NADPH > NADP + an (R)-3-hydroxydecanoyl-[acp]?
3-oxo-dodecanoyl-[acp]? + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxydodecanoyl-[acp]
3-oxo-myristoyl-[acp]? + Hydrogen ion + NADPH + NADPH > NADP + (3R)-3-hydroxymyristoyl-[acp]
3-oxo-palmitoyl-[acp]? + Hydrogen ion + NADPH + NADPH > NADP + (R)-3-hydroxypalmitoyl-[acp]
3-oxo-cis-?5-dodecenoyl-[acp]? + Hydrogen ion + NADPH + NADPH > NADP + a (3R)-hydroxy cis ?5-dodecenoyl-[acp]
Glutaryl-[acp] methyl ester + NADP < NADPH + Hydrogen ion + Enoylglutaryl-[acp] methyl ester + NADPH
NADPH + Hydrogen ion + an enoylpimeloyl-[acp] methyl ester + NADPH > NADP + a pimeloyl-[acp] methyl ester
trans-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADPH + NADPH > NADP + 2,3,4-saturated fatty acyl-[acp]
NAD + 3-Hydroxy-5-methylhex-4-enoyl-CoA > NADH + Hydrogen ion + 5-Methyl-3-oxo-4-hexenoyl-CoA
(3S)-3-Hydroxyadipyl-CoA + NAD > 3-Oxoadipyl-CoA + NADH + Hydrogen ion
Dethiobiotin + 2 S-adenosyl-L-methionine + 2 Hydrogen ion + a sulfurated [sulfur carrier] > Biotin +2 L-Methionine +2 5'-Deoxyadenosine
Octanoyl-[acyl-carrier protein] + a [lipoyl-carrier protein]-L-lysine > Hydrogen ion + a holo-[acyl-carrier protein] + Protein N6-(octanoyl)lysine
(R)-lipoic acid + Adenosine triphosphate + Hydrogen ion + Lipoic acid > Pyrophosphate + Lipoyl-AMP + Lipoyl-AMP
Lipoyl-AMP + a [lipoyl-carrier protein]-L-lysine + Lipoyl-AMP > Adenosine monophosphate + Hydrogen ion + Protein N6-(lipoyl)lysine
Caprylic acid + Adenosine triphosphate + a [lipoyl-carrier protein]-L-lysine > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Protein N6-(octanoyl)lysine
L-Aspartyl-4-phosphate + NADPH + Hydrogen ion + NADPH > Phosphate + NADP + L-Aspartate-semialdehyde
L-Aspartate-semialdehyde + Pyruvic acid > Hydrogen ion + Water + (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate
(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate + Hydrogen ion + NADPH + (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADPH > Water + NADP + (S)-2,3,4,5-tetrahydrodipicolinate
Meso-2,6-Diaminoheptanedioate + Hydrogen ion > L-Lysine + Carbon dioxide + L-Lysine
L-Lysine + Hydrogen ion + L-Lysine > Cadaverine + Carbon dioxide
Dihydrofolic acid + NADP + Dihydrofolic acid > Folic acid + NADPH + Hydrogen ion + NADPH
Dihydrofolic acid + NADPH + Hydrogen ion + Dihydrofolic acid + NADPH > Tetrahydrofolic acid + NADP + Tetrahydrofolic acid
7,8-dihydrofolate monoglutamate + Hydrogen ion + NADPH + Dihydrofolic acid + NADPH > NADP + Tetrahydrofolic acid + Tetrahydrofolic acid
Folic acid + 2 NADPH + 2 Hydrogen ion + 2 NADPH > Tetrahydrofolic acid +2 NADP + Tetrahydrofolic acid
5,10-Methylene-THF + NADPH + Hydrogen ion + 5,10-Methylene-THF + NADPH > 5-Methyltetrahydrofolic acid + NADP + 5-Methyltetrahydrofolic acid
N1-(5-phospho-β-D-ribosyl)glycinamide + Adenosine triphosphate + Formic acid > 5'-Phosphoribosyl-N-formylglycinamide + Adenosine diphosphate + Phosphate + Hydrogen ion + 5'-Phosphoribosyl-N-formylglycineamide + ADP
10-Formyltetrahydrofolate + Hydrogen ion <> 5,10-Methenyltetrahydrofolic acid + Water
L-Glutamic acid + Hydrogen ion + L-Glutamate > Carbon dioxide + 4-(Glutamylamino) butanoate
Taurine + Oxoglutaric acid + Oxygen > Sulfite + Succinic acid + Carbon dioxide + Hydrogen ion + Aminoacetaldehyde + Sulfite
Isocitric acid + NAD + Isocitric acid > Oxoglutaric acid + Carbon dioxide + NADH + Hydrogen ion
Oxoglutaric acid + NAD + Coenzyme A > Succinyl-CoA + NADH + Hydrogen ion + Carbon dioxide + Succinyl-CoA
L-Malic acid + NAD + L-Malic acid <> Oxalacetic acid + NADH + Hydrogen ion
Fructose 6-phosphate + Adenosine triphosphate + Fructose 6-phosphate > Fructose 1,6-bisphosphate + Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP
D-Glyceraldehyde 3-phosphate + NAD + Phosphate + D-Glyceraldehyde 3-phosphate > Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion + Glyceric acid 1,3-biphosphate
Phosphoenolpyruvic acid + Adenosine diphosphate + Hydrogen ion + ADP > Adenosine triphosphate + Pyruvic acid
L-Aspartic acid + Oxygen + L-Aspartic acid > Hydrogen peroxide + Hydrogen ion + Iminoaspartic acid
Inosinic acid + L-Aspartic acid + Guanosine triphosphate + L-Aspartic acid > Guanosine diphosphate + Phosphate +2 Hydrogen ion + N(6)-(1,2-dicarboxyethyl)AMP + Adenylsuccinic acid
L-Glutamic acid + Acetyl-CoA + L-Glutamate > Coenzyme A + Hydrogen ion + N-Acetylglutamic acid + N-Acetylglutamic acid
N-Acetyl-L-glutamyl 5-phosphate + NADPH + Hydrogen ion + NADPH > N-acetyl-L-glutamate + Phosphate + NADP
Ornithine + Carbamoylphosphate + Ornithine > Phosphate + Hydrogen ion + Citrulline
Hydrogen carbonate + Water + L-Glutamine + 2 Adenosine triphosphate >2 Adenosine diphosphate + Phosphate + L-Glutamic acid +2 Hydrogen ion + Carbamoylphosphate +2 ADP + L-Glutamate
L-Arginine + Succinyl-CoA + Succinyl-CoA > Coenzyme A + Hydrogen ion + N2-succinyl-L-arginine + N2-succinyl-L-arginine
N2-succinyl-L-arginine + 2 Water + 2 Hydrogen ion + N2-succinyl-L-arginine > Carbon dioxide +2 Ammonium + N2-Succinyl-L-ornithine
N2-Succinyl-L-glutamic acid 5-semialdehyde + Water + NAD >2 Hydrogen ion + NADH + N2-succinylglutamate + N2-succinylglutamate
Putrescine + Adenosine triphosphate + L-Glutamic acid + L-Glutamate > Phosphate + Adenosine diphosphate + Hydrogen ion + gamma-Glutamyl-L-putrescine + ADP
4-(γ-glutamylamino)butanal + Water + NADP > 4-(Glutamylamino) butanoate +2 Hydrogen ion + NADPH + NADPH
Succinic acid semialdehyde + Water + NADP > NADPH +2 Hydrogen ion + Succinic acid + NADPH
Ornithine + Hydrogen ion + Ornithine > Putrescine + Carbon dioxide
3-Dehydro-L-gulonate + Adenosine triphosphate > 3-keto-L-gulonate 6-phosphate + Adenosine diphosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate + ADP
2,3-Diketo-L-gulonate + NADH + Hydrogen ion + 2,3-Diketo-L-gulonate > 3-Dehydro-L-gulonate + NAD
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > Xylulose 5-phosphate + Carbon dioxide + Xylulose 5-phosphate
2,3-Diketo-L-gulonate + Hydrogen ion + 2,3-Diketo-L-gulonate > Carbon dioxide + Xylulose 5-phosphate + Xylulose 5-phosphate
3-keto-L-gulonate 6-phosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate > L-xylulose -5-phosphate + Carbon dioxide + L-Xylulose 5-phosphate
L-Glutamic acid 5-phosphate + Hydrogen ion + NADPH + NADPH > L-Glutamic-gamma-semialdehyde + NADP + Phosphate
1-Pyrroline-5-carboxylic acid + Hydrogen ion + NADPH + L-D-1-Pyrroline-5-carboxylic acid + NADPH > NADP + L-Proline + L-Proline
L-Proline + Ubiquinone-1 + L-Proline > Hydrogen ion + Ubiquinol-1 + 1-Pyrroline-5-carboxylic acid + L-D-1-Pyrroline-5-carboxylic acid
L-Glutamic-gamma-semialdehyde + NAD + Water >2 Hydrogen ion + NADH + L-Glutamic acid + L-Glutamate
Tartronate semialdehyde + Hydrogen ion + NADPH + NADPH > NADP + Glyceric acid
Glyceric acid + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + 2-Phosphoglyceric acid + ADP + 2-Phosphoglyceric acid
Glyceric acid + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + 3-Phosphoglyceric acid + ADP + 3-Phosphoglycerate
cis-?3-decenoyl-ACP + Hydrogen ion + a malonyl-[acp] > Carbon dioxide + a holo-[acyl-carrier protein] + 3-oxo-cis-?5-dodecenoyl-[acp]?
cis-?5-dodecenoyl-[acp]? + Hydrogen ion + a malonyl-[acp] > a 3-oxo-cis-?7-tetradecenoyl-[acp]? + a holo-[acyl-carrier protein] + Carbon dioxide
trans-?3-cis-?7-tetradecenoyl-[acp] + Hydrogen ion + NADH > NAD + cis-?7-tetradecenoyl-[acp]?
cis-?7-tetradecenoyl-[acp]? + Hydrogen ion + a malonyl-[acp] > Carbon dioxide + a holo-[acyl-carrier protein] + 3-oxo-cis-?9-hexadecenoyl-[acp]?
2,3,4-saturated fatty acyl-[acp] + a malonyl-[acp] + Hydrogen ion > Carbon dioxide + a holo-[acyl-carrier protein] + 3-oxoacyl-[acp]?
butyryl-[acp] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-hexanoyl-[acp]?
hexanoyl-[acyl-carrier-protein] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-octanoyl-[acp]?
Octanoyl-[acyl-carrier protein] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + 3-oxo-decanoyl-[acp]? + Carbon dioxide
dodecanoyl-[acp]? + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-myristoyl-[acp]?
trans tetradec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + myristoyl-[acp]
myristoyl-[acp] + Hydrogen ion + a malonyl-[acp] > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-palmitoyl-[acp]?
a malonyl-[acp] + Hydrogen ion > Carbon dioxide + an acetyl-[acp]
a malonyl-[acp] + Hydrogen ion + an acetyl-[acp] > Carbon dioxide + a holo-[acyl-carrier protein] + acetoacetyl-[acp]
trans-?3-cis-?5-dodecenoyl-[acp] + Hydrogen ion + NADH > cis-?5-dodecenoyl-[acp]? + NAD
trans-?3-cis-?9-hexadecenoyl-[acp] + Hydrogen ion + NADH > NAD + a palmitoleoyl-[acp]?
cis-vaccen-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + a cis-vaccenoyl-[acp]
trans-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH > NAD + 2,3,4-saturated fatty acyl-[acp]
crotonyl-[acp] + Hydrogen ion + NADH > NAD + butyryl-[acp]
trans hex-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + hexanoyl-[acyl-carrier-protein]
trans oct-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + Octanoyl-[acyl-carrier protein]
a trans-?2-decenoyl-[acp]? + Hydrogen ion + NADH > NAD + decanoyl-[acp]
trans dodec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + dodecanoyl-[acp]?
Hydrogen ion + NADH + trans hexadecenoyl-[acp] > NAD + palmitoyl-[acp]
Water + a palmitoleoyl-[acp]? > a holo-[acyl-carrier protein] + Hydrogen ion + Hexadecenoate (n-C16:1)
a cis-vaccenoyl-[acp] + Water > Hydrogen ion + a holo-[acyl-carrier protein] + Vaccenic acid
a palmitoleoyl-[acp]? + a malonyl-[acp] + Hydrogen ion > a holo-[acyl-carrier protein] + Carbon dioxide + 3-oxo-cis-vaccenoyl-[acp]?
Acetyl-CoA + Hydrogen carbonate + Adenosine triphosphate > Adenosine diphosphate + Phosphate + Hydrogen ion + Malonyl-CoA + ADP + Malonyl-CoA
a malonyl-[acp] + Hydrogen ion + Acetyl-CoA > Carbon dioxide + Coenzyme A + acetoacetyl-[acp]
L-Arginine + tRNA(Arg) + Adenosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosine monophosphate + L-arginyl-tRNA(Arg)
L-Cysteine + tRNA(Cys) + Adenosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosine monophosphate + L-cysteinyl-tRNA(Cys)
L-Glutamic acid + Adenosine triphosphate + Hydrogen ion + tRNA(Glu) + L-Glutamate > Pyrophosphate + Adenosine monophosphate + L-glutamyl-tRNA(Glu)
8 L-Glutamic acid + 8 Hydrogen ion + 8 Adenosine triphosphate + 8 tRNA(Glu) + 8 L-Glutamate >8 Adenosine monophosphate +8 Pyrophosphate +8 L-glutamyl-tRNA(Glu)
L-Alanine + Adenosine triphosphate + Hydrogen ion + tRNA(Ala) + L-Alanine > Pyrophosphate + Adenosine monophosphate + L-alanyl-tRNA(Ala)
Glycine + Adenosine triphosphate + Hydrogen ion + tRNA(gly) > Adenosine monophosphate + Pyrophosphate + Glycyl-tRNA(Gly)
L-Threonine + Adenosine triphosphate + Hydrogen ion + tRNA(Thr) + L-Threonine > Pyrophosphate + Adenosine monophosphate + L-Threonyl-tRNA(Thr)
L-Serine + Adenosine triphosphate + Hydrogen ion + tRNA(Ser) + L-Serine > Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser)
L-Leucine + Adenosine triphosphate + Hydrogen ion + tRNA(Leu) > Adenosine monophosphate + Pyrophosphate + L-Leucyl-tRNA(Leu)
L-Valine + Adenosine triphosphate + Hydrogen ion + tRNA(Val) + L-Valine > Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val)
L-Isoleucine + Adenosine triphosphate + Hydrogen ion + tRNA(Ile) + L-Isoleucine > L-Isoleucyl-tRNA(Ile) + Adenosine monophosphate + Pyrophosphate
L-Glutamine + Adenosine triphosphate + Hydrogen ion + tRNA(Gln) > Adenosine diphosphate + Pyrophosphate + L-Glutaminyl-tRNA(Gln) + ADP
L-Aspartic acid + Adenosine triphosphate + Hydrogen ion + tRNA(Asp) + L-Aspartic acid > Pyrophosphate + Adenosine monophosphate + L-aspartyl-tRNA(Asp)
L-Tyrosine + Adenosine triphosphate + Hydrogen ion + tRNA(Tyr) + L-Tyrosine > Adenosine monophosphate + Pyrophosphate + L-tyrosyl-tRNA(Tyr)
L-Tryptophan + Adenosine triphosphate + Hydrogen ion + tRNA(Trp) > Adenosine monophosphate + Pyrophosphate + L-tryptophyl-tRNA(Trp)
L-Phenylalanine + Adenosine triphosphate + Hydrogen ion + tRNA(Phe) + L-Phenylalanine > Adenosine monophosphate + Pyrophosphate + L-phenylalanyl-tRNA(Phe)
L-Asparagine + Adenosine triphosphate + Hydrogen ion + tRNA(Asn) + L-Asparagine > Pyrophosphate + Adenosine monophosphate + L-asparaginyl-tRNA(Asn)
L-Histidine + Adenosine triphosphate + Hydrogen ion + tRNA(His) + L-Histidine > Adenosine monophosphate + Pyrophosphate + L-histidyl-tRNA(His)
L-Lysine + Adenosine triphosphate + Hydrogen ion + tRNA(Lys) + L-Lysine > Adenosine monophosphate + Pyrophosphate + L-Lysyl-tRNA
L-Methionine + Adenosine triphosphate + Hydrogen ion + tRNA(Met) > Adenosine monophosphate + Pyrophosphate + L-methionyl-tRNA(Met)
L-Proline + Adenosine triphosphate + Hydrogen ion + tRNA(Pro) + L-Proline > Adenosine monophosphate + Pyrophosphate + L-prolyl-tRNA(Pro)
3-Phosphoglyceric acid + NAD + 3-Phosphoglycerate > NADH + Hydrogen ion + Phosphohydroxypyruvic acid
O-Acetylserine > Hydrogen ion + Acetic acid + L-Cysteine
L-Cysteine > Hydrogen ion + Hydrogen sulfide + 2-Aminoacrylic acid
3 NADPH + 5 Hydrogen ion + Sulfite + 3 NADPH + Sulfite > Hydrogen sulfide +3 Water +3 NADP
Phosphoadenosine phosphosulfate + reduced thioredoxin > Sulfite +2 Hydrogen ion + Adenosine 3',5'-diphosphate +2 oxidized thioredoxin + Sulfite + Adenosine 3',5'-diphosphate
Phosphoadenosine phosphosulfate + reduced thioredoxin > Sulfite + oxidized thioredoxin + Hydrogen ion + Adenosine 3',5'-diphosphate + Sulfite + Adenosine 3',5'-diphosphate
Adenosine phosphosulfate + Adenosine triphosphate > Phosphoadenosine phosphosulfate + Adenosine diphosphate + Hydrogen ion + ADP
Adenosine triphosphate + Hydrogen ion + Sulfate + Sulfate > Adenosine phosphosulfate + Pyrophosphate
Phosphoribosyl pyrophosphate + Hydrogen ion > Pyrophosphate + Phosphoribosyl-ATP + Phosphoribosyl-ATP
Phosphoribosyl-ATP + Water + Phosphoribosyl-ATP > Hydrogen ion + Pyrophosphate + Phosphoribosyl-AMP
Phosphoribulosylformimino-AICAR-P + L-Glutamine > L-Glutamic acid + Hydrogen ion + 5-Amino-4-imidazolecarboxyamide + D-Erythro-imidazole-glycerol-phosphate + L-Glutamate
Water + NAD + Histidinal >2 Hydrogen ion + NADH + L-Histidine + L-Histidine
3-Methyl-2-oxovaleric acid + Water + Acetyl-CoA + 3-Methyl-2-oxovaleric acid > Coenzyme A + Hydrogen ion + 2-Isopropylmalic acid
(R)-2,3-Dihydroxy-isovalerate + Hydrogen ion + NADPH + NADPH > NADP + (R) 2,3-Dihydroxy-3-methylvalerate
2-Aceto-2-hydroxy-butyrate + NADPH + Hydrogen ion + NADPH > NADP + (R) 2,3-Dihydroxy-3-methylvalerate
2-dehydropantoate + NADPH + Hydrogen ion + 2-Dehydropantoate + NADPH > NADP + (R)-pantoate + (R)-Pantoate
(S)-2-Acetolactate + Hydrogen ion + NADPH + NADPH > NADP + (R)-2,3-Dihydroxy-isovalerate
L-Aspartic acid + Water + Adenosine triphosphate + L-Glutamine + L-Aspartic acid > L-Asparagine + Hydrogen ion + Adenosine monophosphate + L-Glutamic acid + Pyrophosphate + L-Asparagine + L-Glutamate
L-Aspartic acid + Adenosine triphosphate + Ammonium + L-Aspartic acid > L-Asparagine + Adenosine monophosphate + Pyrophosphate + Hydrogen ion + L-Asparagine
L-Cystathionine > Hydrogen ion + Homocysteine + 2-aminoprop-2-enoate + Homocysteine
Chorismate + L-Glutamine > L-Glutamic acid + Pyruvic acid + Hydrogen ion + 2-Aminobenzoic acid + L-Glutamate
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + Hydrogen ion + 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate > Water + Carbon dioxide
1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate + Hydrogen ion + 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate > Water + Carbon dioxide + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
L-Tryptophan > Hydrogen ion + Indole + 2-Aminoacrylic acid
3-dehydroshikimate + Hydrogen ion + NADPH + 3-Dehydro-shikimate + NADPH > NADP + Shikimic acid
Shikimic acid + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + shikimate 3-phosphate + ADP + Shikimate 3-phosphate
L-Aspartate-semialdehyde + Hydrogen ion + NADPH + NADPH > NADP + L-Homoserine + L-Homoserine
L-Homoserine + Adenosine triphosphate + L-Homoserine > Adenosine diphosphate + Hydrogen ion + O-Phosphohomoserine + ADP
L-Threonine + L-Threonine > Hydrogen ion + Water + (2Z)-2-aminobut-2-enoate
2-dehydro-3-deoxy-D-galactonate + Adenosine triphosphate + 2-Dehydro-3-deoxy-D-galactonate > Adenosine diphosphate + Hydrogen ion + 2-dehydro-3-deoxy-D-galactonate 6-phosphate + ADP + 2-Dehydro-3-deoxy-D-galactonate 6-phosphate
Galactose 1-phosphate + NAD + Galactose 1-phosphate > NADH + Hydrogen ion + D-tagatofuranose 6-phosphate
D-tagatofuranose 6-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + D-tagatofuranose 1,6-bisphosphate + ADP
Glucose 1-phosphate + Uridine triphosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + UDP-Glucose
β-D-glucose 1-phosphate + Uridine triphosphate + Hydrogen ion + Uridine triphosphate > UDP-Glucose + Pyrophosphate
Alpha-D-glucose 1-phosphate + Uridine triphosphate + Hydrogen ion + Uridine triphosphate > Pyrophosphate + UDP-Glucose
Alpha-D-Galactose + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + Galactose 1-phosphate + ADP + Galactose 1-phosphate
D-Mannose 1-phosphate + Guanosine triphosphate + Hydrogen ion > Pyrophosphate + Guanosine diphosphate mannose
α-D-mannose 1-phosphate + Guanosine triphosphate + Hydrogen ion > Guanosine diphosphate mannose + Pyrophosphate
GDP-4-Dehydro-6-deoxy-D-mannose + NADPH + Hydrogen ion + NADPH > GDP-L-Fucose + NADP
GDP-4-dehydro-6-deoxy-α-D-mannose + NADPH + Hydrogen ion + NADPH > NADP + GDP-β-L-fucose
D-allopyranose + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + aldehydo-D-allose 6-phosphate + ADP + aldehydo-D-allose 6-phosphate
L-rhamnulofuranose + Adenosine triphosphate + L-rhamnulofuranose > Adenosine diphosphate + Hydrogen ion + L-rhamnulose 1-phosphate + ADP + L-Rhamnulose 1-phosphate
Adenosine triphosphate + keto-L-rhamnulose > L-fuculose 1-phosphate + Adenosine diphosphate + Hydrogen ion + L-Fuculose 1-phosphate + ADP
D-Ribulose + Adenosine triphosphate + D-Ribulose > Adenosine diphosphate + Hydrogen ion + D-Ribulose-1-phosphate + ADP
NAD + Water + (S)-lactaldehyde + Lactaldehyde > NADH +2 Hydrogen ion + L-Lactic acid + L-Lactic acid
(S)-lactaldehyde + NADH + Hydrogen ion + Lactaldehyde > NAD + Propylene glycol
Glyoxylic acid + Water + Acetyl-CoA > Coenzyme A + Hydrogen ion + L-Malic acid + L-Malic acid
Allantoic acid + Water + 2 Hydrogen ion > Carbon dioxide + Ammonium + S-ureidoglycine
L-Aspartic acid + Hydrogen ion + L-Aspartic acid Carbon dioxide + beta-Alanine
beta-Alanine + Adenosine triphosphate + (R)-pantoate + (R)-Pantoate > Adenosine monophosphate + Pyrophosphate + Hydrogen ion + Pantothenic acid + Pantothenic acid
beta-Alanine + Adenosine triphosphate > Adenosine monophosphate + Pyrophosphate + Hydrogen ion
Pantothenic acid + Adenosine triphosphate + Pantothenic acid > Adenosine diphosphate + Hydrogen ion + D-4'-Phosphopantothenate + ADP + D-4'-Phosphopantothenate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine + D-4'-Phosphopantothenate > Cytidine monophosphate + Pyrophosphate + Hydrogen ion + 4-Phosphopantothenoylcysteine + Cytidine monophosphate
4-Phosphopantothenoylcysteine + Hydrogen ion > Carbon dioxide + 4'-phosphopantetheine + 4'-phosphopantetheine
4'-phosphopantetheine + Adenosine triphosphate + Hydrogen ion + 4'-phosphopantetheine > Pyrophosphate + Dephospho-CoA
Dephospho-CoA + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + Coenzyme A + ADP
Quinolinic acid + Hydrogen ion + Phosphoribosyl pyrophosphate > Carbon dioxide + Pyrophosphate + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide
nicotinate beta-D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Nicotinic acid adenine dinucleotide + Water + L-Glutamine + Adenosine triphosphate > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + L-Glutamic acid + NAD + L-Glutamate
Nicotinic acid adenine dinucleotide + Adenosine triphosphate + Ammonium > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD
Nicotinamide riboside + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + beta-nicotinamide D-ribonucleotide + ADP + NMN
beta-nicotinamide D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + NMN > Pyrophosphate + NAD
UDP-3-O-(3-Hydroxytetradecanoyl)-D-glucosamine + (3R)-3-hydroxymyristoyl-[acp] > Hydrogen ion + a holo-[acyl-carrier protein] + UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine
UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine + Water > Uridine 5'-monophosphate + Hydrogen ion + 2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate
2,3-bis[(3R)-3-hydroxymyristoyl]-α-D-glucosaminyl 1-phosphate + UDP-2-N,3-O-bis[(3R)-3-hydroxytetradecanoyl]-α-D-glucosamine > Uridine 5'-diphosphate + Hydrogen ion + (2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate)
(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + (2-N,3-O-bis(3-Hydroxytetradecanoyl)-4-O-phosphono-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) + ADP
CMP-3-Deoxy-D-manno-octulosonate + (2-N,3-O-bis(3-Hydroxytetradecanoyl)-4-O-phosphono-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) > Cytidine monophosphate + Hydrogen ion + alpha-Kdo-(2??)-lipid IVA + Cytidine monophosphate
alpha-Kdo-(2??)-lipid IVA + CMP-3-Deoxy-D-manno-octulosonate > Cytidine monophosphate + Hydrogen ion + a-Kdo-(2->4)-a-Kdo-(2->6)-lipid IVA + Cytidine monophosphate + a-Kdo-(2->4)-a-Kdo-(2->6)-lipid IVA
(KDO)2-lipid A + ADP-L-glycero-beta-D-manno-heptose > Hydrogen ion + Adenosine diphosphate + heptosyl-Kdo2-lipid A + ADP + Heptosyl-KDO2-lipid A
heptosyl-Kdo2-lipid A + ADP-L-glycero-beta-D-manno-heptose + Heptosyl-KDO2-lipid A > Adenosine diphosphate + Hydrogen ion + (heptosyl)2-Kdo2-lipid A + ADP
(heptosyl)2-Kdo2-lipid A + UDP-Glucose > Uridine 5'-diphosphate + Hydrogen ion + glucosyl-(heptosyl)2-Kdo2-lipid A
glucosyl-(heptosyl)2-Kdo2-lipid A + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate + ADP
glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate + ADP-L-glycero-beta-D-manno-heptose > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate + ADP
glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + ADP
glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + UDP-α-D-galactose > galactosyl-glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + Uridine 5'-diphosphate + Hydrogen ion
galactosyl-glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + UDP-Glucose > Uridine 5'-diphosphate + Hydrogen ion + galactosyl-(glucosyl)2-(heptosyl)3-Kdo2-lipid A-bisphosphate
galactosyl-(glucosyl)2-(heptosyl)3-Kdo2-lipid A-bisphosphate + UDP-Glucose > Uridine 5'-diphosphate + Hydrogen ion + galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate
galactosyl-(glucosyl)3-(heptosyl)3-Kdo2-lipid A-bisphosphate + ADP-L-glycero-beta-D-manno-heptose > Hydrogen ion + Adenosine diphosphate + Lipid A-core + ADP
L-Glutamic acid + Adenosine triphosphate + L-Cysteine + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + gamma-Glutamylcysteine + ADP
gamma-Glutamylcysteine + Glycine + Adenosine triphosphate > Hydrogen ion + Phosphate + Adenosine diphosphate + Glutathione + ADP
Oxidized glutathione + Hydrogen ion + NADPH + Glutathione disulfide + NADPH > NADP +2 Glutathione
D-Fructuronate + NADH + Hydrogen ion > NAD + D-altronate
D-tagaturonate + NADH + Hydrogen ion + D-Tagaturonate > NAD + D-altronate + D-altronate
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate + 2-Keto-3-deoxy-D-gluconic acid > Hydrogen ion + 2-Keto-3-deoxy-6-phosphogluconic acid + Adenosine diphosphate + ADP
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine triphosphate + (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran > Adenosine diphosphate + Hydrogen ion + (4S)-4-hydroxy-2,3-pentanedione 5-phosphate + ADP + (4S)-4-hydroxy-2,3-pentanedione 5-phosphate
Dihydroxyacetone phosphate + Hydrogen ion + NADPH + NADPH > NADP + Glycerol 3-phosphate
Cytidine triphosphate + Hydrogen ion + PA(18:0/18:0) > Pyrophosphate + CDP-1,2-Dioctadecanoylglycerol
DG(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(11Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + Pyrophosphate + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))
DG(19:1(9Z)/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > Pyrophosphate + CDP-DG(19:1(9Z)/18:1(9Z))
DG(18:1(9Z)/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(18:1(9Z)/18:1(9Z)/0:0) > Pyrophosphate + CDP-DG(18:1(9Z)/18:0) + CDP-DG(18:1(9Z)/18:0)
DG(16:0/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/10:0) + Pyrophosphate
DG(10:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/10:0) + Pyrophosphate
DG(16:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/12:0) + Pyrophosphate
DG(16:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:0/15:0/0:0) > CDP-DG(16:0/15:0) + Pyrophosphate
Hydrogen ion + Cytidine triphosphate + CDP-DG(10:0/12:0) > Pyrophosphate + DG(10:0/12:0/0:0)
1-hexadecanoyl-2-octadecanoyl-sn-glycerol + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/18:0) + Pyrophosphate + CDP-DG(16:0/18:0)
DG(10:0/14:0/0:0) + Hydrogen ion + Cytidine triphosphate CDP-DG(10:0/14:0) + Pyrophosphate
DG(10:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/15:0) + Pyrophosphate
DG(10:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/16:0) + Pyrophosphate
DG(16:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/19:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/10:0) + Pyrophosphate
DG(10:0/16:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/16:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/12:0) + Pyrophosphate
DG(10:0/18:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/18:0) + Pyrophosphate
DG(16:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:1(9Z)/15:0/0:0) > CDP-DG(16:1(9Z)/15:0) + Pyrophosphate
DG(16:1(9Z)/18:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(16:1(9Z)/18:0/0:0) > CDP-DG(16:1(9Z)/18:0) + Pyrophosphate
DG(16:1(9Z)/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:1(9Z)/18:1(9Z)/0:0) > CDP-DG(16:1(9Z)/18:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(18:0/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/10:0) + Pyrophosphate
DG(10:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/18:1(9Z)) + Pyrophosphate
DG(18:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/12:0) + Pyrophosphate
DG(18:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/14:0/0:0) > CDP-DG(18:0/14:0) + Pyrophosphate
DG(10:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/19:1(9Z)) + Pyrophosphate
DG(18:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/15:0/0:0) > CDP-DG(18:0/15:0) + Pyrophosphate
DG(12:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/10:0) + Pyrophosphate
DG(18:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/16:0/0:0) > CDP-DG(18:0/16:0) + Pyrophosphate + CDP-DG(18:0/16:0)
DG(12:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/14:0) + Pyrophosphate
DG(12:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/15:0) + Pyrophosphate
DG(18:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/16:1(9Z)/0:0) > CDP-DG(18:0/16:1(9Z)) + Pyrophosphate
1,2-Diacyl-sn-glycerol (dioctadecanoyl, n-C18:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/18:0) + Pyrophosphate + CDP-DG(18:0/18:0)
DG(12:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/16:0) + Pyrophosphate
DG(12:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/16:1(9Z)) + Pyrophosphate
DG(18:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/18:1(9Z)/0:0) > CDP-DG(18:0/18:1(9Z)) + Pyrophosphate + CDP-DG(18:0/18:1(9Z))
DG(12:0/18:0/0:0) + Cytidine triphosphate + Hydrogen ion CDP-DG(12:0/18:0) + Pyrophosphate
DG(18:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/19:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/10:0) + Pyrophosphate
DG(18:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/12:0) + Pyrophosphate
DG(18:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/14:0/0:0) > CDP-DG(18:1(9Z)/14:0) + Pyrophosphate
DG(12:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/18:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/15:0/0:0) > CDP-DG(18:1(9Z)/15:0) + Pyrophosphate
DG(18:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/16:0/0:0) > CDP-DG(18:1(9Z)/16:0) + Pyrophosphate + CDP-DG(18:1(9Z)/16:0)
DG(18:1(9Z)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/16:1(9Z)/0:0) > CDP-DG(18:1(9Z)/16:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(19:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/10:0) + Pyrophosphate
DG(19:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/12:0) + Pyrophosphate
DG(19:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/14:0) + Pyrophosphate
DG(19:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/15:0) + Pyrophosphate
DG(19:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/16:0) + Pyrophosphate
DG(19:1(9Z)/18:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/18:0) + Pyrophosphate
DG(12:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/19:1(9Z)) + Pyrophosphate
DG(19:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(14:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/10:0) + Pyrophosphate
DG(14:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/12:0) + Pyrophosphate
DG(14:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(14:0/15:0/0:0) > CDP-DG(14:0/15:0) + Pyrophosphate
Hydrogen ion + Cytidine triphosphate + DG(14:0/18:0/0:0) + DG(14:0/18:0/0:0) > CDP-DG(14:0/18:0) + Pyrophosphate
DG(14:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(14:0/18:1(9Z)/0:0) > CDP-DG(14:0/18:1(9Z)) + Pyrophosphate
DG(14:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/19:1(9Z)) + Pyrophosphate
DG(15:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/10:0) + Pyrophosphate
DG(15:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/12:0) + Pyrophosphate
DG(15:0/14:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/14:0/0:0) > CDP-DG(15:0/14:0) + Pyrophosphate
DG(15:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/15:0/0:0) > CDP-DG(15:0/15:0) + Pyrophosphate
DG(15:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/16:0/0:0) > CDP-DG(15:0/16:0) + Pyrophosphate
DG(15:0/16:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/16:1(9Z)/0:0) > CDP-DG(15:0/16:1(9Z)) + Pyrophosphate
DG(15:0/18:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/18:0/0:0) > CDP-DG(15:0/18:0) + Pyrophosphate
DG(15:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/18:1(9Z)/0:0) > Pyrophosphate + CDP-DG(15:0/18:1(9Z))
DG(15:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/19:1(9Z)) + Pyrophosphate
DG(17:0cycw7c/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/17:0cycw7c) + Pyrophosphate
2 DG(18:1(9Z)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/19:0cycv8c) + Carbon dioxide
2 DG(19:0cycv8c/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/15:0cyclo) + Pyrophosphate
DG(19:0cycv8c/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/14:0) + Pyrophosphate
DG(19:0cycv8c/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/16:0) + Pyrophosphate
DG(14:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(14:0/16:0/0:0) > CDP-DG(14:0/16:0) + Pyrophosphate
DG(17:0cycw7c/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/19:0cycv8c) + Pyrophosphate
DG(19:0cycv8c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/16:1(9Z)) + Pyrophosphate
DG(17:0cycw7c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/16:1(9Z)) + Pyrophosphate
DG(19:0cycv8c/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/17:0cycw7c) + Pyrophosphate
2 DG(14:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0/17:0cycw7c) + Pyrophosphate
2 DG(19:0cycv8c/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/18:1(9Z)) + Pyrophosphate
DG(19:0cycv8c/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/19:0cycv8c) + Pyrophosphate
2 DG(14:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(14:0/16:0/0:0) >2 CDP-DG(14:0/16:0) + Pyrophosphate
CDP-DG(16:0/14:0) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/14:0) + Cytidine monophosphate
CDP-DG(16:0/16:0) + L-Serine + CDP-DG(16:0/16:0) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:0/16:0) + Cytidine monophosphate
L-Serine + CDP-DG(16:0/16:1(9Z)) + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(16:0/16:1(9Z)) + Cytidine monophosphate
CDP-DG(16:0/18:1(11Z)) + L-Serine + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:0/18:1(11Z)) + Cytidine monophosphate
CDP-DG(16:1(9Z)/14:0) + L-Serine + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:1(9Z)/14:0) + Cytidine monophosphate
L-Serine + CDP-DG(16:1(9Z)/16:0) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(16:1(9Z)/16:0) + Cytidine monophosphate
Hydrogen ion + PS(17:0/19:0) > Carbon dioxide + PE(17:0/19:0)
CDP-DG(18:1(11Z)/16:0) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(18:1(11Z)/16:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/18:1(11Z)) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate
Hydrogen ion + PS(19:0/17:0) > Carbon dioxide + PE(19:0/17:0)
L-Serine + CDP-1,2-Dioctadecanoylglycerol + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(18:0/18:0) + Cytidine monophosphate
L-Serine + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + L-Serine + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) > Hydrogen ion + Cytidine monophosphate + PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) + Cytidine monophosphate
L-Serine + CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(19:iso/18:1(9Z)) + Cytidine monophosphate
CDP-DG(18:1(9Z)/18:0) + L-Serine + CDP-DG(18:1(9Z)/18:0) + L-Serine > Hydrogen ion + Cytidine monophosphate + PS(18:1(9Z)/18:0) + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(16:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(17:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(17:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(19:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > Cytidine monophosphate + Hydrogen ion + PS(19:0/17:0) + Cytidine monophosphate
CDP-DG(16:0/10:0) + L-Serine + L-Serine > PS(16:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/12:0) + L-Serine + L-Serine > PS(16:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/18:0) + L-Serine + CDP-DG(16:0/18:0) + L-Serine > PS(16:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/10:0) + L-Serine + L-Serine > PS(16:1(9Z)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/12:0) + L-Serine + L-Serine > PS(16:1(9Z)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/18:0) + L-Serine + L-Serine > PS(16:1(9Z)/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(16:1(9Z)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/14:0) + L-Serine + L-Serine > PS(18:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/16:0) + L-Serine + CDP-DG(18:0/16:0) + L-Serine > PS(18:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/16:1(9Z)) + L-Serine + L-Serine > PS(18:0/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/18:0) + L-Serine + CDP-DG(18:0/18:0) + L-Serine > PS(18:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:0/18:1(9Z)) + L-Serine + CDP-DG(18:0/18:1(9Z)) + L-Serine > PS(18:0/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/10:0) + L-Serine + L-Serine > PS(18:1(9Z)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/14:0) + L-Serine + L-Serine > PS(18:1(9Z)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/16:0) + L-Serine + CDP-DG(18:1(9Z)/16:0) + L-Serine > PS(18:1(9Z)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/16:1(9Z)) + L-Serine + L-Serine > PS(18:1(9Z)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/19:1(9Z)) + L-Serine + L-Serine > PS(16:1(9Z)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/10:0) + L-Serine + L-Serine > PS(19:iso/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/19:1(9Z)) + L-Serine + L-Serine > PS(16:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/15:0) + L-Serine + L-Serine > PS(19:iso/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(9Z)/12:0) + L-Serine + L-Serine > PS(18:1(9Z)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/12:0) + L-Serine + L-Serine > PS(19:iso/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/10:0) + L-Serine + L-Serine > PS(10:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/10:0) + L-Serine + L-Serine > PS(10:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/10:0) + L-Serine + L-Serine > PS(10:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/12:0) + L-Serine + L-Serine > PS(10:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/12:0) + L-Serine + L-Serine > PS(10:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/12:0) + L-Serine + L-Serine > PS(10:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/14:0) + L-Serine + L-Serine > PS(10:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/14:0) + L-Serine + L-Serine > PS(10:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/14:0) + L-Serine + L-Serine > PS(10:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/15:0) + L-Serine + L-Serine > PS(10:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/15:0) + L-Serine + L-Serine > PS(10:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/16:0) + L-Serine + L-Serine > PS(10:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/16:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/18:0) + L-Serine + L-Serine > PS(10:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/18:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/19:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/19:1(9Z)) + L-Serine + L-Serine > PS(10:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/19:1(9Z)) + L-Serine + L-Serine > PS(10:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/10:0) + L-Serine + L-Serine > PS(12:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/10:0) + L-Serine + L-Serine > PS(12:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/14:0) + L-Serine + L-Serine > PS(12:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/14:0) + L-Serine + L-Serine > PS(12:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/15:0) + L-Serine + L-Serine > PS(12:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/14:0) + L-Serine + L-Serine > PS(12:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/15:0) + L-Serine + L-Serine > PS(12:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/16:0) + L-Serine + L-Serine > PS(12:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/16:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/18:0) + L-Serine + L-Serine > PS(12:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/18:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/19:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/10:0) + L-Serine + L-Serine > PS(12:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/19:1(9Z)) + L-Serine + L-Serine > PS(12:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/19:1(9Z)) + L-Serine + L-Serine > PS(12:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/10:0) + L-Serine + L-Serine > PS(14:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/10:0) + L-Serine + L-Serine > PS(14:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/10:0) + L-Serine + L-Serine > PS(14:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/12:0) + L-Serine + L-Serine > PS(14:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/12:0) + L-Serine + L-Serine > PS(14:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/12:0) + L-Serine + L-Serine > PS(14:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/15:0) + L-Serine + L-Serine > PS(14:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/15:0) + L-Serine + L-Serine > PS(14:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/19:1(9Z)) + L-Serine + L-Serine > PS(14:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/19:1(9Z)) + L-Serine + L-Serine > PS(14:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/10:0) + L-Serine + L-Serine > PS(15:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/10:0) + L-Serine + L-Serine > PS(15:0cyclo/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/12:0) + L-Serine + L-Serine > PS(15:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/12:0) + L-Serine + L-Serine > PS(15:0cyclo/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/12:0) + L-Serine + L-Serine > PS(16:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/17:0cycw7c) + L-Serine + L-Serine > PS(17:0cycw7c/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/18:1(9Z)) + L-Serine + L-Serine > PS(14:0/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/14:0) + L-Serine + L-Serine > PS(19:0cycv8c/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/16:0) + L-Serine + L-Serine > PS(19:0cycv8c/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/16:0) + L-Serine + L-Serine > PS(14:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/19:0cycv8c) + L-Serine + L-Serine > PS(17:0cycw7c/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/16:1(9Z)) + L-Serine + L-Serine > PS(19:0cycv8c/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/16:1(9Z)) + L-Serine + L-Serine > PS(17:0cycw7c/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/17:0cycw7c) + L-Serine + L-Serine > PS(19:0cycv8c/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycv8c/19:0cycv8c) + L-Serine + L-Serine > PS(19:0cycv8c/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/18:1(9Z)) + L-Serine + L-Serine > PS(17:0cycw7c/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
an L-1-phosphatidylserine + Hydrogen ion > Carbon dioxide + an L-1-phosphatidylethanolamine
PS(14:0/14:0) + Hydrogen ion > PE(14:0/14:0) + Carbon dioxide
PS(14:0/16:0) + Hydrogen ion > Carbon dioxide + PE(14:0/16:0)
PS(14:0/16:1(9Z)) + Hydrogen ion > Carbon dioxide + PE(14:0/16:1(9Z))
PS(14:0/17:0) + Hydrogen ion > Carbon dioxide + PE(14:0/17:0)
PS(14:0/18:1(11Z)) + Hydrogen ion > Carbon dioxide + PE(14:0/18:1(11Z))
PS(14:0/19:0) + Hydrogen ion > Carbon dioxide + PE(14:0/19:0)
PS(16:0/14:0) + Hydrogen ion > PE(16:0/14:0) + Carbon dioxide
PS(16:0/16:0) + Hydrogen ion > PE(16:0/16:0) + Carbon dioxide
PS(16:0/16:1(9Z)) + Hydrogen ion > Carbon dioxide + PE(16:0/16:1(9Z))
PS(16:0/17:0) + Hydrogen ion > Carbon dioxide + PE(16:0/17:0)
PS(16:0/18:1(11Z)) + Hydrogen ion > Carbon dioxide + PE(16:0/18:1(11Z))
PS(16:0/19:0) + Hydrogen ion > Carbon dioxide + PE(16:0/19:0)
PS(16:1(9Z)/14:0) + Hydrogen ion > Carbon dioxide + PE(16:1(9Z)/14:0)
PS(16:1(9Z)/16:0) + Hydrogen ion > Carbon dioxide + PE(16:1(9Z)/16:0)
PS(16:1(9Z)/16:1(9Z)) + Hydrogen ion > PE(16:1(9Z)/16:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/18:1(11Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(11Z)) + Carbon dioxide
PS(17:0/14:0) + Hydrogen ion > PE(17:0/14:0) + Carbon dioxide
PS(17:0/16:0) + Hydrogen ion > PE(17:0/16:0) + Carbon dioxide
PS(17:0/17:0) + Hydrogen ion > Carbon dioxide + PE(17:0/17:0)
PS(18:1(11Z)/14:0) + Hydrogen ion > Carbon dioxide + PE(18:1(11Z)/14:0)
PS(18:1(11Z)/16:0) + Hydrogen ion > PE(18:1(11Z)/16:0) + Carbon dioxide
PS(18:1(11Z)/16:1(9Z)) + Hydrogen ion > Carbon dioxide + PE(18:1(11Z)/16:1(9Z))
Hydrogen ion + PS(18:1(11Z)/18:1(11Z)) > Carbon dioxide + PE(18:1(11Z)/18:1(11Z))
Hydrogen ion + PS(19:0/14:0) > Carbon dioxide + PE(19:0/14:0)
Hydrogen ion + PS(19:0/16:0) > Carbon dioxide + PE(19:0/16:0)
Hydrogen ion + PS(19:0/19:0) > Carbon dioxide + PE(19:0/19:0)
Hydrogen ion + PS(18:0/18:0) > PE(18:0/18:0) + Carbon dioxide
PS(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z)) + Hydrogen ion > Carbon dioxide + PE(22:5(7Z,10Z,13Z,16Z,19Z)/18:2(9Z,12Z))
PS(19:iso/18:1(9Z)) + Hydrogen ion > PE(18:1(9Z)/18:0) + Carbon dioxide
PS(18:1(9Z)/18:0) + Hydrogen ion > Carbon dioxide + PE(18:1(11Z)/17:0)
PS(14:0/18:0) + Hydrogen ion > Carbon dioxide + PE(14:0/17:0cycw7c)
PS(15:0/19:iso) + Hydrogen ion > PE(15:0/17:0cycw7c) + Coenzyme A
PS(14:0/17:0) + Hydrogen ion > PE(14:0/16:0) + Carbon dioxide
PS(14:0/17:0) + Hydrogen ion > PE(14:0/16:1(9Z)) + Carbon dioxide
PS(14:0/19:0) + Hydrogen ion > PE(14:0/18:1(9Z)) + Carbon dioxide
PS(16:0/19:iso) + Hydrogen ion > PE(16:0/19:0cycw8c) + Carbon dioxide
PS(14:0/18:1(9Z)) + Hydrogen ion > PE(14:0/18:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/18:1(9Z)) + Hydrogen ion > PE(16:1(9Z)/18:1(9Z)) + Carbon dioxide
PS(16:1(9Z)/19:iso) + Hydrogen ion > PE(16:1(9Z)/19:iso) + Carbon dioxide
PS(17:0/18:1(11Z)) + Hydrogen ion > PE(17:0/18:1(11Z)) + Carbon dioxide
PS(18:1(9Z)/18:1(9Z)) + Hydrogen ion > PE(18:1(9Z)/18:1(9Z)) + Carbon dioxide
PS(18:1(9Z)/19:iso) + Hydrogen ion > PE(18:1(9Z)/19:iso) + Carbon dioxide
PS(17:0cycw7c/19:iso) + Hydrogen ion > PE(17:0cycw7c/19:iso) + Carbon dioxide
Hydrogen ion + PS(19:0cycv8c/19:iso) > Carbon dioxide + PE(19:0cycv8c/19:iso)
PS(15:0cyclo/19:iso) + Hydrogen ion > PE(15:0cyclo/19:iso) + Carbon dioxide
PS(15:0cyclo/14:0(3-OH)) + Hydrogen ion > PE(15:0cyclo/14:0(3-OH)) + Carbon dioxide
PS(14:0/17:0) + Hydrogen ion > PE(14:0/17:0cycw7c) + Carbon dioxide
PS(17:0/17:0) + Hydrogen ion > PE(17:0cycw7c/17:0cycw7c) + Carbon dioxide
Hydrogen ion + PS(18:1(9Z)/16:0) > Carbon dioxide + PE(18:1(9Z)/15:0)
Hydrogen ion + PS(19:iso/15:0cyclo) > PE(19:iso/15:0cyclo) + Carbon dioxide
PS(16:0/16:0) + Hydrogen ion > PE(16:0/15:0) + Carbon dioxide
PS(16:0/14:1(9Z)) + Hydrogen ion > PE(15:0/15:0) + Carbon dioxide
PS(17:0/16:0) + Hydrogen ion > PE(15:0/17:0cycw7c) + Carbon dioxide
PS(15:0/19:iso) + Hydrogen ion > PE(15:0/19:iso) + Carbon dioxide
PS(15:0/19:iso) + Hydrogen ion > PE(15:0/18:1(9Z)) + Carbon dioxide
PS(16:0/16:0) + Hydrogen ion > PE(15:0/16:0) + Carbon dioxide
PS(16:0/16:1(9Z)) + Hydrogen ion > PE(15:0/16:1(9Z)) + Carbon dioxide
PS(14:0/16:0) + Hydrogen ion > PE(15:0/14:0) + Carbon dioxide
PS(19:iso/15:0) + Hydrogen ion > PE(19:iso/15:0) + Carbon dioxide
PS(18:0/14:0) + Hydrogen ion > PE(18:0/16:0) + Carbon dioxide
PS(16:0/18:0) + Hydrogen ion > PE(16:0/18:0) + Carbon dioxide
PS(16:0/18:0) + Hydrogen ion > PE(14:0/20:0) + Carbon dioxide
PS(16:0/18:1(9Z)) + Hydrogen ion > PE(16:0/18:1(9Z)) + Carbon dioxide
PS(14:0/19:iso) + Hydrogen ion > PE(14:0/19:iso) + Carbon dioxide
PS(16:0/17:0) + Hydrogen ion > PE(15:0/17:0cycw7c) + Carbon dioxide
PS(16:1(9Z)/17:0) + Hydrogen ion > PE(16:1(9Z)/17:0) + Carbon dioxide
PS(18:0/18:0) + Hydrogen ion > PE(18:0/17:0cycw7c) + Carbon dioxide
PS(18:0/20:0) + Hydrogen ion > PE(19:iso/19:0cycv8c) + Carbon dioxide
PS(14:0/14:1(9Z)) + Hydrogen ion > PE(14:0/15:0) + Carbon dioxide
PS(16:0/10:0(3-OH)) + Hydrogen ion > PE(16:0/10:0(3-OH)) + Carbon dioxide
PS(16:0/12:0(3-OH)) + Hydrogen ion > PE(16:0/12:0(3-OH)) + Carbon dioxide
PS(16:1(9Z)/10:0(3-OH)) + Hydrogen ion > PE(16:1(9Z)/10:0(3-OH)) + Carbon dioxide
PS(16:1(9Z)/12:0(3-OH)) + Hydrogen ion > PE(16:1(9Z)/12:0(3-OH)) + Carbon dioxide
PS(16:1(9Z)/18:0) + Hydrogen ion > PE(16:1(9Z)/18:0) + Carbon dioxide
PS(18:0/14:0) + Hydrogen ion > PE(18:0/14:0) + Carbon dioxide
PS(18:0/16:0) + Hydrogen ion > PE(18:0/16:0) + Carbon dioxide
PS(18:0/16:1(9Z)) + Hydrogen ion > PE(18:0/16:1(9Z)) + Carbon dioxide
PS(18:0/18:1(9Z)) + Hydrogen ion > PE(18:0/18:1(9Z)) + Carbon dioxide
PS(18:1(9Z)/10:0(3-OH)) + Hydrogen ion > PE(18:1(9Z)/10:0(3-OH)) + Carbon dioxide
PS(18:1(9Z)/14:0) + Hydrogen ion > PE(18:1(9Z)/14:0) + Carbon dioxide
PS(18:1(9Z)/16:0) + Hydrogen ion > PE(18:1(9Z)/16:0) + Carbon dioxide
PS(18:1(9Z)/16:1(9Z)) + Hydrogen ion > PE(18:1(9Z)/16:1(9Z)) + Carbon dioxide
PS(19:iso/10:0) + Hydrogen ion > PE(19:iso/10:0) + Carbon dioxide
PS(16:0/19:iso) + Hydrogen ion > PE(16:0/19:iso) + Carbon dioxide
PS(18:1(9Z)/12:0(3-OH)) + Hydrogen ion > PE(18:1(9Z)/12:0(3-OH)) + Carbon dioxide
PS(19:iso/12:0) + Hydrogen ion > PE(19:iso/12:0) + Carbon dioxide
PS(10:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(10:0(3-OH)/10:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/10:0) + Hydrogen ion > PE(10:0(3-OH)/10:0) + Carbon dioxide
PS(10:0(3-OH)/10:0) + Hydrogen ion > Carbon dioxide + PE(10:0/10:0)
PS(10:0/10:0(3-OH)) + Hydrogen ion > PE(10:0/10:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/12:0(3-OH)) + Hydrogen ion > PE(10:0(3-OH)/12:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/12:0) + Hydrogen ion > PE(10:0(3-OH)/12:0) + Carbon dioxide
PS(10:0(3-OH)/12:0) + Hydrogen ion > PE(10:0/12:0) + Carbon dioxide
PS(10:0/12:0(3-OH)) + Hydrogen ion > PE(10:0/12:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/14:0(3-OH)) + Hydrogen ion > PE(10:0(3-OH)/14:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/14:0) + Hydrogen ion > PE(10:0(3-OH)/14:0) + Carbon dioxide
PS(10:0(3-OH)/14:0) + Hydrogen ion > PE(10:0/14:0) + Carbon dioxide
PS(10:0/14:0(3-OH)) + Hydrogen ion > PE(10:0/14:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/15:0) + Hydrogen ion > PE(10:0(3-OH)/15:0) + Carbon dioxide
PS(10:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(10:0(3-OH)/15:0cyclo) + Carbon dioxide
PS(10:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(10:0/15:0) + Carbon dioxide
PS(10:0(3-OH)/16:0) + Hydrogen ion > PE(10:0(3-OH)/16:0) + Carbon dioxide
PS(10:0(3-OH)/16:0) + Hydrogen ion > PE(10:0/16:0) + Carbon dioxide
PS(10:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(10:0(3-OH)/16:1(9Z)) + Carbon dioxide
PS(10:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(10:0/16:1(9Z)) + Carbon dioxide
PS(10:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(10:0/18:0) + Carbon dioxide
PS(10:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(10:0/18:0) + Carbon dioxide
PS(10:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(10:0(3-OH)/18:1(9Z)) + Carbon dioxide
PS(10:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(10:0(3-OH)/19:0cycv8c) + Carbon dioxide
PS(19:iso/17:0cycw7c) + Hydrogen ion > PE(19:0cycw8c/17:0cycw7c) + Carbon dioxide
PS(10:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(10:0/19:0cycw8c) + Carbon dioxide
PS(10:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(10:0/19:1(12Z)) + Carbon dioxide
PS(19:0cycv8c/14:0(3-OH)) + Hydrogen ion > PE(19:0cycv8c/14:0(3-OH)) + Carbon dioxide
PS(10:0(3-OH)/19:iso) + Hydrogen ion > PE(10:0(3-OH)/19:iso) + Carbon dioxide
PS(10:0/19:iso) + Hydrogen ion > PE(10:0/19:iso) + Carbon dioxide
PS(10:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(10:0/18:1(11Z)) + Carbon dioxide
PS(12:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(12:0(3-OH)/10:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(12:0/10:0) + Carbon dioxide
PS(12:0(3-OH)/10:0) + Hydrogen ion > PE(12:0(3-OH)/10:0) + Carbon dioxide
PS(12:0(3-OH)/14:0(3-OH)) + Hydrogen ion > PE(12:0(3-OH)/14:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/14:0) + Hydrogen ion > PE(12:0(3-OH)/14:0) + Carbon dioxide
PS(12:0(3-OH)/14:0) + Hydrogen ion > PE(12:0/14:0) + Carbon dioxide
PS(12:0(3-OH)/15:0) + Hydrogen ion > PE(12:0(3-OH)/15:0) + Carbon dioxide
PS(12:0(3-OH)/15:0) + Hydrogen ion > PE(12:0/15:0) + Carbon dioxide
PS(12:0/14:0(3-OH)) + Hydrogen ion > PE(12:0/14:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(12:0(3-OH)/15:0cyclo) + Carbon dioxide
PS(12:0(3-OH)/16:0) + Hydrogen ion > PE(12:0(3-OH)/16:0) + Carbon dioxide
PS(12:0(3-OH)/16:0) + Hydrogen ion > PE(12:0/16:0) + Carbon dioxide
PS(12:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(12:0(3-OH)/16:1(9Z)) + Carbon dioxide
PS(12:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(12:0/16:1(9Z)) + Carbon dioxide
PS(12:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(12:0/18:0) + Carbon dioxide
PS(12:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(12:0(3-OH)/18:1(9Z)) + Carbon dioxide
PS(12:0(3-OH)/18:1(9Z)) + Hydrogen ion > PE(12:0/18:1(11Z)) + Carbon dioxide
PS(14:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(14:0(3-OH)/19:0cycv8c) + Carbon dioxide
PS(12:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(12:0(3-OH)/19:0cycv8c) + Carbon dioxide
PS(12:0/10:0(3-OH)) + Hydrogen ion > PE(12:0/10:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/19:iso) + Hydrogen ion > PE(12:0(3-OH)/19:iso) + Carbon dioxide
PS(12:0/19:iso) + Hydrogen ion > PE(12:0/19:iso) + Carbon dioxide
PS(17:0cycw7c/14:0(3-OH)) + Hydrogen ion > PE(17:0cycw7c/14:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/19:0cycv8c) + Hydrogen ion > PE(12:0/19:0cycw8c) + Carbon dioxide
PS(12:0/19:iso) + Hydrogen ion > PE(12:0/19:1(12Z)) + Carbon dioxide
PS(14:0(3-OH)/10:0(3-OH)) + Hydrogen ion > PE(14:0(3-OH)/10:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/10:0) + Hydrogen ion > PE(14:0(3-OH)/10:0) + Carbon dioxide
PS(14:0/10:0(3-OH)) + Hydrogen ion > PE(14:0/10:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/10:0) + Hydrogen ion > PE(14:0/10:0) + Carbon dioxide
PS(14:0(3-OH)/12:0(3-OH)) + Hydrogen ion > PE(14:0(3-OH)/12:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/12:0) + Hydrogen ion > PE(14:0(3-OH)/12:0) + Carbon dioxide
PS(14:0/12:0(3-OH)) + Hydrogen ion > PE(14:0/12:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/12:0) + Hydrogen ion > PE(14:0/12:0) + Carbon dioxide
PS(14:0(3-OH)/15:0) + Hydrogen ion > PE(14:0(3-OH)/15:0) + Carbon dioxide
PS(14:0(3-OH)/17:0cycw7c) + Hydrogen ion > PE(14:0/17:0cycw7c) + Carbon dioxide
PS(14:0(3-OH)/15:0cyclo) + Hydrogen ion > PE(14:0(3-OH)/15:0cyclo) + Carbon dioxide
PS(14:0(3-OH)/19:iso) + Hydrogen ion > PE(14:0(3-OH)/19:iso) + Carbon dioxide
PS(15:0/10:0(3-OH)) + Hydrogen ion > PE(15:0/10:0(3-OH)) + Carbon dioxide
PS(15:0cyclo/10:0(3-OH)) + Hydrogen ion > PE(15:0cyclo/10:0(3-OH)) + Carbon dioxide
PS(15:0/10:0(3-OH)) + Hydrogen ion > PE(15:0/10:0) + Carbon dioxide
PS(15:0/12:0(3-OH)) + Hydrogen ion > PE(15:0/12:0(3-OH)) + Carbon dioxide
PS(15:0cyclo/12:0(3-OH)) + Hydrogen ion > PE(15:0cyclo/12:0(3-OH)) + Carbon dioxide
PS(15:0/12:0(3-OH)) + Hydrogen ion > PE(15:0/12:0) + Carbon dioxide
PS(16:0/10:0(3-OH)) + Hydrogen ion > PE(16:0/10:0) + Carbon dioxide
PS(19:iso/16:0) + Hydrogen ion > PE(19:iso/16:0) + Carbon dioxide
PS(19:iso/16:1(9Z)) + Hydrogen ion > PE(19:iso/16:1(9Z)) + Carbon dioxide
PS(19:iso/18:1(9Z)) + Hydrogen ion > PE(19:iso/18:1(9Z)) + Carbon dioxide
PS(17:0cycw7c/17:0cycw7c) + Hydrogen ion > PE(17:0cycw7c/17:0cycw7c) + Carbon dioxide
PS(19:0cycv8c/14:0) + Hydrogen ion > PE(19:0cycv8c/14:0) + Carbon dioxide
PS(19:0cycv8c/16:0) + Hydrogen ion > PE(19:0cycv8c/16:0) + Carbon dioxide
PS(17:0cycw7c/19:0cycv8c) + Hydrogen ion > PE(17:0cycw7c/19:0cycv8c) + Carbon dioxide
PS(19:0cycv8c/16:1(9Z)) + Hydrogen ion > PE(19:0cycv8c/16:1(9Z)) + Carbon dioxide
PS(17:0cycw7c/16:1(9Z)) + Hydrogen ion > PE(17:0cycw7c/16:1(9Z)) + Carbon dioxide
PS(19:0cycv8c/17:0cycw7c) + Hydrogen ion > PE(19:0cycv8c/17:0cycw7c) + Carbon dioxide
PS(19:0cycv8c/19:0cycv8c) + Hydrogen ion > PE(19:0cycv8c/19:0cycv8c) + Carbon dioxide
PS(17:0cycw7c/18:1(9Z)) + Hydrogen ion > PE(17:0cycw7c/18:1(9Z)) + Carbon dioxide
CDP-DG(16:0/16:0) + Glycerol 3-phosphate + CDP-DG(16:0/16:0) > Cytidine monophosphate + Hydrogen ion + PGP(16:0/16:0) + Cytidine monophosphate
Glycerol 3-phosphate + CDP-DG(16:0/16:1(9Z)) > Hydrogen ion + PGP(16:0/16:1(9Z)) + Cytidine monophosphate + Cytidine monophosphate
CDP-DG(16:0/18:1(11Z)) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:0/18:1(11Z)) + Cytidine monophosphate
CDP-DG(16:1(9Z)/16:0) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(16:1(9Z)/16:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/16:0) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:1(11Z)/16:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/18:1(11Z)) + Glycerol 3-phosphate > Cytidine monophosphate + Hydrogen ion + PGP(18:1(11Z)/18:1(11Z)) + Cytidine monophosphate
Glycerol 3-phosphate + CDP-1,2-Dioctadecanoylglycerol > Hydrogen ion + Cytidine monophosphate + PGP(18:0/18:0) + Cytidine monophosphate
CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + Glycerol 3-phosphate + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) > PGP(18:2(9Z,12Z)/18:2(9Z,12Z)) + Hydrogen ion + Cytidine monophosphate + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > Hydrogen ion + Cytidine monophosphate + PGP(18:1(9Z)/18:1(9Z)) + Cytidine monophosphate
CDP-DG(18:1(9Z)/18:0) + Glycerol 3-phosphate + CDP-DG(18:1(9Z)/18:0) > Hydrogen ion + Cytidine monophosphate + PGP(18:1(9Z)/18:1(9Z)) + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > PGP(16:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + L-Serine + L-Serine > PS(18:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > PGP(16:0/18:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:1(9Z)/18:1(9Z)) + Glycerol 3-phosphate > PGP(14:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(18:1(9Z)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/15:0cyclo) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/16:0) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(14:0/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0/16:0) + Glycerol 3-phosphate >2 PGP(14:0/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/14:0) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
PS(19:iso/19:iso) + Hydrogen ion > PE(19:iso/19:iso) + Carbon dioxide
Beta-D-Glucose + Adenosine triphosphate + b-D-Glucose > Hydrogen ion + Adenosine diphosphate + beta-D-Glucose 6-phosphate + ADP
D-Glucose + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + beta-D-Glucose 6-phosphate + ADP
β-D-fructofuranose + Adenosine triphosphate + D-Fructose > Adenosine diphosphate + Hydrogen ion + D-tagatofuranose 6-phosphate + ADP
D-Fructose + Adenosine triphosphate + D-Fructose > D-tagatofuranose 6-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
N-Acetyl-D-glucosamine + Adenosine triphosphate + N-Acetylglucosamine > N-Acetyl-D-Glucosamine 6-Phosphate + Adenosine diphosphate + Hydrogen ion + N-Acetyl-D-Glucosamine 6-Phosphate + ADP
Glucosamine-1P + Acetyl-CoA + Glucosamine-1P > N-Acetyl-glucosamine 1-phosphate + Coenzyme A + Hydrogen ion + N-Acetyl-glucosamine 1-phosphate
N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate + Hydrogen ion + N-Acetyl-glucosamine 1-phosphate + Uridine triphosphate > Uridine diphosphate-N-acetylglucosamine + Pyrophosphate
UDP-N-acetyl-D-mannosamine + 2 NAD + Water + UDP-N-Acetyl-D-mannosamine > UDP-N-acetyl-α-D-mannosaminuronate +2 NADH +3 Hydrogen ion
UDP-N-acetyl-α-D-glucosamine-enolpyruvate + NADPH + Hydrogen ion + NADPH > NADP + UDP-N-acetyl-α-D-muramate
Alpha-D-glucose 1-phosphate + Adenosine triphosphate + Hydrogen ion > ADP-Glucose + Pyrophosphate
UDP-Glucose + 2 NAD + Water > UDP-Glucuronic acid +2 NADH +3 Hydrogen ion
Uridine 5''-diphospho-{beta}-4-deoxy-4-amino-L-arabinose + an N10-formyl-tetrahydrofolate + N10-Formyl-THF > UDP-4-Deoxy-4-formamido-beta-L-arabinose + Hydrogen ion + a tetrahydrofolate + Tetrahydrofolic acid
6 Adenosine triphosphate + 3 L-Serine + 3 2,3-Dihydroxybenzoic acid + 3 L-Serine >6 Adenosine monophosphate + enterobactin +6 Pyrophosphate +3 Hydrogen ion
Guanosine triphosphate + Water > Formic acid + Hydrogen ion + 7,8-dihydroneopterin 3'-triphosphate
7,8-dihydroneopterin 3'-triphosphate + Water > Pyrophosphate + Hydrogen ion + Dihydroneopterin monophosphate
4-amino-4-deoxychorismate + 4-Amino-4-deoxychorismate > Pyruvic acid + Hydrogen ion + p-Aminobenzoic acid
7,8-Dihydropteroic acid + Adenosine triphosphate + L-Glutamic acid + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + 7,8-dihydrofolate monoglutamate + ADP + Dihydrofolic acid
5-Phosphoribosylamine + Glycine + Adenosine triphosphate + 5-Phosphoribosylamine > N1-(5-phospho-β-D-ribosyl)glycinamide + Phosphate + Adenosine diphosphate + Hydrogen ion + ADP
5'-Phosphoribosyl-N-formylglycinamide + Water + L-Glutamine + Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide > 2-(Formamido)-N1-(5-phospho-D-ribosyl)acetamidine + L-Glutamic acid + Phosphate + Adenosine diphosphate + Hydrogen ion + L-Glutamate + ADP
2-(Formamido)-N1-(5-phospho-D-ribosyl)acetamidine + Adenosine triphosphate > 5-Aminoimidazole ribonucleotide + Phosphate + Adenosine diphosphate + Hydrogen ion + ADP
5-Aminoimidazole ribonucleotide + Hydrogen carbonate + Adenosine triphosphate > N5-Carboxyaminoimidazole ribonucleotide + Adenosine diphosphate + Phosphate +2 Hydrogen ion + N5-Carboxyaminoimidazole ribonucleotide + ADP
5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid + Adenosine triphosphate + L-Aspartic acid > SAICAR + Phosphate + Adenosine diphosphate + Hydrogen ion + SAICAR + ADP
Xanthylic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + L-Glutamic acid +2 Hydrogen ion + Guanosine monophosphate + L-Glutamate
Adenosine diphosphate + Phosphate + 4 Hydrogen ion + ADP <> Water +3 Hydrogen ion + Adenosine triphosphate
Adenosine diphosphate + Phosphate + 4 Hydrogen ion + ADP <> Water +3 Hydrogen ion + Adenosine triphosphate
β-D-fructofuranose 1-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP + Fructose 1,6-bisphosphate
a glycerophosphodiester + Water > Hydrogen ion + Alcohol + Glycerol 3-phosphate
sn-glycero-3-phosphocholine + Water > Hydrogen ion + Benzyl alcohol + Glycerol 3-phosphate
sn-glycero-3-phosphoethanolamine + Water > Benzyl alcohol + Hydrogen ion + Glycerol 3-phosphate
Glycerophosphoglycerol + Water > Benzyl alcohol + Hydrogen ion + Glycerol 3-phosphate
glycerophosphoserine + Water > Hydrogen ion + Benzyl alcohol + Glycerol 3-phosphate
Glycerol + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + Glycerol 3-phosphate + ADP
UDP-N-acetyl-α-D-muramate + L-Alanine + Adenosine triphosphate + L-Alanine > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanine + ADP
UDP-N-acetylmuramoyl-L-alanyl-D-glutamate + Meso-2,6-Diaminoheptanedioate + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + ADP
UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + D-Alanyl-D-alanine + Adenosine triphosphate > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + ADP
Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + Uridine diphosphate-N-acetylglucosamine + Undecaprenyl-diphospho-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine > Uridine 5'-diphosphate + Hydrogen ion + lipid II(A) + Uridine 5'-diphosphate
2 lipid II(A) > Undecaprenyl diphosphate + Hydrogen ion + a peptidoglycan dimer (meso-diaminopimelate containing)
alkylsulfonate + FMNH2 + Oxygen > Betaine aldehyde + Sulfite + Flavin Mononucleotide + Water +2 Hydrogen ion + Sulfite
Butanesulfonate + Oxygen + FMNH2 > Hydrogen ion + Water + Sulfite + Flavin Mononucleotide + Betaine aldehyde + Sulfite
Oxygen + FMNH2 + 3-(N-morpholino)propanesulfonate > Sulfite + Water + Hydrogen ion + Flavin Mononucleotide + Betaine aldehyde + Sulfite
ethanesulfonate + Oxygen + FMNH2 > Hydrogen ion + Water + Flavin Mononucleotide + Sulfite + Betaine aldehyde + Sulfite
isethionate + Oxygen + FMNH2 > Betaine aldehyde + Flavin Mononucleotide + Hydrogen ion + Water + Sulfite + Sulfite
Oxygen + methanesulfonate + FMNH2 + Methanesulfonate > Hydrogen ion + Water + Flavin Mononucleotide + Sulfite + Betaine aldehyde + Sulfite
Cyanide + Thiosulfate + Cyanide + Thiosulfate > Thiocyanate + Sulfite + Hydrogen ion + Thiocyanate + Sulfite
Protoporphyrin IX + Iron >2 Hydrogen ion + ferroheme b
Uroporphyrinogen III + S-adenosyl-L-methionine > Hydrogen ion + S-Adenosylhomocysteine + Precorrin-1
Precorrin-2 + NAD > NADH + Hydrogen ion + Sirohydrochlorin
Propionyl-CoA + Water + Oxalacetic acid + Propionyl-CoA > Coenzyme A + Hydrogen ion + 2-Methylcitric acid + Methylcitric acid
Methylmalonyl-CoA + Hydrogen ion > Carbon dioxide + Propionyl-CoA + Propionyl-CoA
UDP-Glucose + Alpha-D-glucose 6-phosphate > Uridine 5'-diphosphate + Trehalose 6-phosphate + Hydrogen ion + Uridine 5'-diphosphate
Carbamoylphosphate + L-Aspartic acid + L-Aspartic acid > Phosphate + Hydrogen ion + N-carbamoyl-L-aspartate
N-carbamoyl-L-aspartate + Hydrogen ion > Water + 4,5-Dihydroorotic acid + 4,5-Dihydroorotic acid
Uridine triphosphate + L-Glutamine + Water + Adenosine triphosphate + Uridine triphosphate > Adenosine diphosphate + Hydrogen ion + Phosphate + L-Glutamic acid + Cytidine triphosphate + ADP + L-Glutamate
Deoxyuridine triphosphate + Water > Phosphate + Hydrogen ion + dUMP
L-Serine + L-Serine > Water + Hydrogen ion + 2-Aminoacrylic acid
NADPH + Hydrogen ion + 1-Deoxy-D-xylulose 5-phosphate + NADPH + 1-Deoxy-D-xylulose 5-phosphate > NADP + 2-C-methyl-D-erythritol 4-phosphate
2-C-methyl-D-erythritol 4-phosphate + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol
D-Ribulose 5-phosphate > 1-Deoxy-L-glycero-tetrulose 4-phosphate + Formic acid + Hydrogen ion
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol > Adenosine diphosphate + Hydrogen ion + 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP + 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
2-C-Methyl-D-erythritol-2,4-cyclodiphosphate + a reduced flavodoxin > Water + Hydrogen ion + an oxidized flavodoxin + 1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate
1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate + Hydrogen ion + NADPH + NADPH > Water + NADPH + Isopentenyl pyrophosphate + Isopentenyl pyrophosphate
1-Hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate + Hydrogen ion + NADPH + NADPH > NADP + Water + Dimethylallylpyrophosphate + Dimethylallylpyrophosphate
N-acetyl-α-D-glucosaminyl-diphospho-ditrans,octacis-undecaprenol + UDP-ManNAcA > Uridine 5'-diphosphate + Hydrogen ion + Undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate pyrophosphate + Uridine 5'-diphosphate + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate
Undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate pyrophosphate + TDP-Fuc4NAc + Undecaprenyl-diphospho-N-acetylglucosamine-N-acetylmannosaminuronate > Hydrogen ion + dTDP + Undecaprenyl N-acetyl-glucosaminyl-N-acetyl-mannosaminuronate-4-acetamido-4,6-dideoxy-D-galactose pyrophosphate + Undecaprenyl-diphospho N-acetylglucosamine-N-acetylmannosaminuronate-N-acetamido-4,6-dideoxy-D-galactose
Acetyl-CoA + dTDP-thomosamine > TDP-Fuc4NAc + Coenzyme A + Hydrogen ion
Thymidine 5'-triphosphate + Hydrogen ion + Glucose 1-phosphate > Pyrophosphate + dTDP-D-Glucose
2-Octaprenylphenol + Hydrogen ion + NADPH + Oxygen + NADPH > NADP + Water + 2-Octaprenyl-6-hydroxyphenol + 2-Octaprenyl-6-hydroxyphenol
2-Octaprenyl-6-hydroxyphenol + S-adenosyl-L-methionine + 2-Octaprenyl-6-hydroxyphenol > Hydrogen ion + S-Adenosylhomocysteine + 2-methoxy-6-(all-trans-octaprenyl)phenol
3-demethylubiquinol-8 + S-adenosyl-L-methionine > Hydrogen ion + S-Adenosylhomocysteine + Ubiquinol 8 + Ubiquinol-8
Hydrogen ion + NADPH + Oxygen + 2-methoxy-6-(all-trans-octaprenyl)phenol + NADPH > Water + NADP + 2-Octaprenyl-6-methoxy-1,4-benzoquinol
2-Octaprenyl-6-methoxy-1,4-benzoquinol + S-adenosyl-L-methionine > S-Adenosylhomocysteine + Hydrogen ion + 6-Methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
2-Demethylmenaquinol 8 + S-adenosyl-L-methionine > Hydrogen ion + S-Adenosylhomocysteine + Menaquinol 8
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > NAD + Water + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
trans-Octadec-2-enoyl-CoA + Water + Trans-Octadec-2-enoyl-CoA > Coenzyme A + Hydrogen ion + Elaidic acid
a [protein]-(L-serine/L-threonine) + Adenosine triphosphate > a [protein]-(L-serine/L-threonine) phosphate + Adenosine diphosphate + Hydrogen ion + ADP
Adenosyl cobinamide + Adenosine triphosphate + Adenosyl cobinamide > Adenosine diphosphate + Hydrogen ion + adenosylcobinamide phosphate + ADP
adenosylcobinamide phosphate + Guanosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosylcobinamide-GDP + Adenosylcobinamide-GDP
Dimethylbenzimidazole + nicotinate beta-D-ribonucleotide + Nicotinamide ribotide > Hydrogen ion + Nicotinic acid + N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole
N1-(5-Phospho-a-D-ribosyl)-5,6-dimethylbenzimidazole + Adenosylcobinamide-GDP + Adenosylcobinamide-GDP > Hydrogen ion + GMP + Adenosylcobalamin 5'-phosphate
Fructose 6-phosphate + NADH + Hydrogen ion + Fructose 6-phosphate <> NAD + Mannitol 1-phosphate
Acetyl-CoA + L-Glutamic acid + L-Glutamate <> N-Acetyl-L-alanine + Coenzyme A + Hydrogen ion + N-Acetylglutamic acid + N-Acetyl-L-alanine + N-Acetylglutamic acid
Pseudouridine + Adenosine triphosphate + Pseudouridine > Pseudouridine 5'-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
Cyclic pyranopterin monophosphate + Water + thiocarboxylated small subunit of molybdopterin synthase >4 Hydrogen ion +2 thiocarboxylated small subunit of molybdopterin synthase + Molybdopterin + Molybdopterin
Molybdopterin + Adenosine triphosphate + Hydrogen ion + Molybdopterin > Pyrophosphate + Adenylyl-molybdopterin + Adenylyl-molybdopterin
NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol > NADH + Hydrogen ion + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + Oxygen + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid > Hydrogen ion + 2-Hydroxy-6-ketononatrienedioate
2-Hydroxy-6-ketononatrienedioate + Water > Hydrogen ion + Fumaric acid + 2-Hydroxy-2,4-pentadienoate + 2-Hydroxy-2,4-pentadienoate
S-adenosyl-L-methionine + Hydrogen ion > Carbon dioxide + S-Adenosylmethioninamine
Putrescine + S-Adenosylmethioninamine > Spermidine + Hydrogen ion + 5'-S-methyl-5'-thioadenosine
L-Threonine + NAD + L-Threonine > Hydrogen ion + NADH + L-2-Amino-3-oxobutanoic acid
L-Tyrosine + NADPH + S-adenosyl-L-methionine + L-Tyrosine + NADPH > Hydrogen ion + NADP + L-Methionine + 5'-Deoxyadenosine + p-Cresol + 2-iminoacetate
7,8-dihydroneopterin 3'-triphosphate + Water > Acetaldehyde + Triphosphate +2 Hydrogen ion + 6-Carboxy-5,6,7,8-tetrahydropterin + Triphosphate
7-Deaza-7-carboxyguanine + Adenosine triphosphate + Ammonium > Water + Phosphate + Adenosine diphosphate + Hydrogen ion + 7-Cyano-7-carbaguanine + ADP
7-Cyano-7-carbaguanine + 3 Hydrogen ion + 2 NADPH + 2 NADPH >2 NADP + 7-Aminomethyl-7-carbaguanine
7-Cyano-7-carbaguanine + 3 Hydrogen ion + 2 NADPH + 2 NADPH > Queuine +2 NADP + Queuine
7-aminomethyl-7-deazaguanosine34 in tRNA + S-adenosyl-L-methionine > Hydrogen ion + L-Methionine + Adenine + epoxyqueuosine
Curcumin + Hydrogen ion + NADPH + curcumin + NADPH > NADP + Dihydrocurcumin + Dihydrocurcumin
Dihydrocurcumin + Hydrogen ion + NADPH + Dihydrocurcumin + NADPH > Tetrahydrocurcumin + NADP
isochorismate + Oxoglutaric acid + Hydrogen ion + Isochorismate > Carbon dioxide + 2-Succinyl-5-enolpyruvyl-6-hydroxy-3-cyclohexene-1-carboxylate
2-Succinylbenzoyl-CoA + Hydrogen ion > Water + 1,4-dihydroxy-2-naphthoyl-CoA + 1,4-Dihydroxy-2-naphthoyl-CoA
1,4-dihydroxy-2-naphthoyl-CoA + Water + 1,4-Dihydroxy-2-naphthoyl-CoA > Coenzyme A + Hydrogen ion + 1,4-dihydroxy-2-naphthoate
1,4-dihydroxy-2-naphthoate + Hydrogen ion + Farnesylfarnesylgeranyl-PP + 1,4-Dihydroxy-2-naphthoyl-CoA > Carbon dioxide + Pyrophosphate + 2-Demethylmenaquinol 8
Octaprenyl diphosphate + 1,4-dihydroxy-2-naphthoate + Hydrogen ion + Octaprenyl diphosphate + 1,4-Dihydroxy-2-naphthoyl-CoA > Carbon dioxide + Pyrophosphate + 2-Demethylmenaquinol 8
L-Arginine + Adenosine triphosphate + Water > L-Arginine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamic acid + Adenosine triphosphate + Water + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamic acid + ADP
L-Leucine + Adenosine triphosphate + Water > L-Leucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Valine + Adenosine triphosphate + Water + L-Valine > L-Valine + Adenosine diphosphate + Pyrophosphate + Hydrogen ion + ADP
L-Isoleucine + Adenosine triphosphate + Water + L-Isoleucine > L-Isoleucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamine + ADP
L-Aspartic acid + Adenosine triphosphate + Water + L-Aspartic acid > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Aspartic acid + ADP
L-Histidine + Adenosine triphosphate + Water + L-Histidine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Histidine + ADP
L-Lysine + Adenosine triphosphate + Water + L-Lysine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Lysine + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Methionine + ADP
L-Proline + Adenosine triphosphate + Water + L-Proline > L-Proline + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
D-allopyranose + Adenosine triphosphate + Water > D-allopyranose + Adenosine diphosphate + Hydrogen ion + Phosphate + ADP
Lipid A-core + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Lipid A-core + ADP
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Phosphoribosyl-ATP + Water + (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Phosphoribosyl-ATP > (2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine diphosphate + Hydrogen ion + Pyrophosphate + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Pyrophosphate + Hydrogen ion + L-Methionine + ADP
Ferric enterobactin + Adenosine triphosphate + Water Ferric enterobactin + Adenosine diphosphate + Hydrogen ion + ADP
2 Ubiquinol-1 + Oxygen + 4 Hydrogen ion >2 Ubiquinone-1 +2 Water +4 Hydrogen ion
2 Ubiquinol-1 + Oxygen + 4 Hydrogen ion >2 Ubiquinone-1 +2 Water +4 Hydrogen ion
-->-->-->-->NADH + 5 Hydrogen ion + Ubiquinone-1 > Hydrogen ion + NAD + Ubiquinol-1
NADH + 5 Hydrogen ion + Ubiquinone-1 > Hydrogen ion + NAD + Ubiquinol-1
Adenosine triphosphate + Water + Sulfate + Sulfate > Adenosine diphosphate + Phosphate + Hydrogen ion + Sulfate + ADP
Alkyl Sulfate + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Alkyl Sulfate + ADP
Adenosine triphosphate + Water + Butanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + Butanesulfonate + ADP
Adenosine triphosphate + Water + 3-(N-morpholino)propanesulfonate > Phosphate + Hydrogen ion + Adenosine diphosphate + 3-(N-morpholino)propanesulfonate + ADP
Adenosine triphosphate + Water + ethanesulfonate > Hydrogen ion + Phosphate + Adenosine diphosphate + ethanesulfonate + ADP
Adenosine triphosphate + Water + isethionate > Adenosine diphosphate + Hydrogen ion + Phosphate + isethionate + ADP
Adenosine triphosphate + Water + methanesulfonate + Methanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + methanesulfonate + ADP
Maltotetraose + Adenosine triphosphate + Water > Maltotetraose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Maltotriose + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Maltotriose + ADP
D-Maltose + Adenosine triphosphate + Water > D-Maltose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Adenosine triphosphate + Water + DL-O-Phosphoserine > Hydrogen ion + Phosphate + Adenosine diphosphate + DL-O-Phosphoserine + ADP
Taurine + Adenosine triphosphate + Water > Taurine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cysteine-S-sulfate + Adenosine triphosphate + Water > Cysteine-S-sulfate + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Homocarnosine + Adenosine triphosphate + Water + Homocarnosine > Homocarnosine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cobinamide + Adenosine triphosphate + Water + Cobinamide > Adenosine diphosphate + Phosphate + Hydrogen ion + Cobinamide + ADP
Cyanocobalamin + Adenosine triphosphate + Water + Cyanocobalamin > Adenosine diphosphate + Phosphate + Hydrogen ion + Cyanocobalamin + ADP
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
Trimethylamine N-Oxide + 3 Hydrogen ion + Menaquinol 8 + 2 Electron > Trimethylamine + Water +2 Hydrogen ion + menaquinone-8
Trimethylamine N-Oxide + 3 Hydrogen ion + Menaquinol 8 + 2 Electron > Trimethylamine + Water +2 Hydrogen ion + menaquinone-8
Hydrogen ion + Electron + 2 Hydrogen ion + menaquinone-8 > Menaquinol 8 + Hydrogen ion
Hydrogen ion + Electron + 2 Hydrogen ion + menaquinone-8 > Menaquinol 8 + Hydrogen ion
Hydrogen ion + Electron + 2 Hydrogen ion + menaquinone-8 > Menaquinol 8 + Hydrogen ion
Formic acid + menaquinone-8 + Electron + Hydrogen ion > Carbon dioxide + Hydrogen ion + Menaquinol 8
Formic acid + menaquinone-8 + Electron + Hydrogen ion > Carbon dioxide + Hydrogen ion + Menaquinol 8
Menaquinol 8 + Dimethyl sulfoxide + 2 Hydrogen ion + 2 Electron > menaquinone-8 + Dimethyl sulfide + Water +2 Hydrogen ion
Menaquinol 8 + Dimethyl sulfoxide + 2 Hydrogen ion + 2 Electron > menaquinone-8 + Dimethyl sulfide + Water +2 Hydrogen ion
1-(2-Carboxyphenylamino)-1'-deoxyribulose-5'-phosphate + Hydrogen ion > Carbon dioxide + Water + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate + (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
DG(17:0cycw7c/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/18:1(9Z)) + Pyrophosphate
2 DG(10:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion 2 CDP-DG(10:0(3-OH)/10:0) + Pyrophosphate
2 DG(10:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(10:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/12:0) + Pyrophosphate
2 DG(10:0(3-OH)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/15:0cyclo) + Pyrophosphate
2 DG(10:0(3-OH)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/16:0) + Pyrophosphate
2 DG(10:0(3-OH)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/16:1(9Z)) + Pyrophosphate
2 DG(10:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/17:0cycw7c) + Pyrophosphate
1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Cytidine triphosphate + Hydrogen ion > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
2 DG(10:0(3-OH)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/19:0cycv8c) + Pyrophosphate
2 DG(10:0(3-OH)/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0(3-OH)/19:iso) + Pyrophosphate
2 DG(10:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0/10:0(3-OH)) + Pyrophosphate
2 DG(10:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0/12:0(3-OH)) + Pyrophosphate
DG(10:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/17:0cycw7c) + Pyrophosphate
2 DG(12:0(3-OH)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/10:0(3-OH)) + Pyrophosphate
2 DG(12:0(3-OH)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/10:0) + Pyrophosphate
DG(12:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(12:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-1,2-didodecanoylglycerol + Pyrophosphate
DG(12:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/12:0) + Pyrophosphate
2 DG(12:0(3-OH)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/14:0(3-OH)) + Pyrophosphate
2 DG(12:0(3-OH)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/14:0) + Pyrophosphate
2 DG(12:0(3-OH)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/15:0) + Pyrophosphate
2 DG(12:0(3-OH)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/15:0cyclo) + Pyrophosphate
2 DG(12:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/17:0cycw7c) + Pyrophosphate
2 DG(12:0(3-OH)/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/18:1(9Z)) + Pyrophosphate
2 DG(12:0(3-OH)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/19:0cycv8c) + Pyrophosphate
2 DG(12:0(3-OH)/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/19:iso) + Pyrophosphate
2 DG(12:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/10:0(3-OH)) + Pyrophosphate
DG(12:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/12:0(3-OH)) + Pyrophosphate
2 DG(12:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/14:0(3-OH)) + Pyrophosphate
DG(12:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/17:0cycw7c) + Pyrophosphate
2 DG(12:0/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/19:iso) + Pyrophosphate
2 DG(14:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(14:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/12:0) + Pyrophosphate
DG(14:0(3-OH)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/14:0(3-OH)) + Pyrophosphate
DG(14:0(3-OH)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/14:0) + Pyrophosphate
DG(14:0(3-OH)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/16:0) + Pyrophosphate
2 DG(14:0(3-OH)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/16:1(9Z)) + Pyrophosphate
2 DG(14:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/17:0cycw7c) + Pyrophosphate
2 DG(14:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0/12:0(3-OH)) + Pyrophosphate
DG(14:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/14:0(3-OH)) + Pyrophosphate
2 DG(15:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0/10:0(3-OH)) + Pyrophosphate
2 DG(15:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0/12:0(3-OH)) + Pyrophosphate
DG(15:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + CDP-DG(15:0/14:0(3-OH))
2 DG(15:0cyclo/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/10:0(3-OH)) + Pyrophosphate
2 DG(16:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/10:0(3-OH)) + Pyrophosphate
2 DG(16:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/14:0(3-OH)) + Pyrophosphate
2 DG(16:1(9Z)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:1(9Z)/14:0(3-OH)) + Pyrophosphate
2 DG(16:1(9Z)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:1(9Z)/17:0cycw7c) + Pyrophosphate
DG(16:1(9Z)/0:0/19:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0) + Pyrophosphate
DG(17:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0/16:1(9Z)) + Pyrophosphate
2 DG(17:0cycw7c/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/10:0(3-OH)) + Pyrophosphate
DG(17:0cycw7c/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/10:0) + Pyrophosphate
2 DG(17:0cycw7c/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/12:0(3-OH)) + Pyrophosphate
CDP-1,2-ditetradecanoylglycerol + L-Serine + L-Serine > PS(14:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(10:0/17:0cycw7c) + L-Serine + L-Serine > PS(10:0/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0(3-OH)/12:0(3-OH)) + L-Serine + L-Serine > PS(12:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0(3-OH)/12:0) + L-Serine + L-Serine > PS(12:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0(3-OH)/17:0cycw7c) + L-Serine + L-Serine > PS(12:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/12:0(3-OH)) + L-Serine + L-Serine > PS(12:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(12:0/17:0cycw7c) + L-Serine + L-Serine > PS(12:0/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/14:0(3-OH)) + L-Serine + L-Serine > PS(14:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/14:0) + L-Serine + L-Serine > PS(14:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/16:0) + L-Serine + L-Serine > PS(14:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0(3-OH)/16:1(9Z)) + L-Serine + L-Serine > PS(14:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(14:0/14:0(3-OH)) + L-Serine + L-Serine > PS(14:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(15:0/14:0(3-OH)) + L-Serine + L-Serine > PS(15:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:0/12:0) + L-Serine + L-Serine > PS(16:0/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/14:0(3-OH)) + L-Serine + L-Serine > PS(16:1(9Z)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(16:1(9Z)/19:0) + L-Serine + L-Serine > PS(16:1(9Z)/19:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0/16:1(9Z)) + L-Serine + L-Serine > PS(17:0/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(17:0cycw7c/10:0(3-OH)) + L-Serine + L-Serine > PS(17:0cycw7c/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
PS(10:0/17:0cycw7c) + Hydrogen ion > PE(10:0/17:0cycw7c) + Carbon dioxide
PS(12:0(3-OH)/12:0(3-OH)) + Hydrogen ion > PE(12:0(3-OH)/12:0(3-OH)) + Carbon dioxide
PS(12:0(3-OH)/12:0) + Hydrogen ion > PE(12:0(3-OH)/12:0) + Carbon dioxide
PS(12:0(3-OH)/17:0cycw7c) + Hydrogen ion > PE(12:0(3-OH)/17:0cycw7c) + Carbon dioxide
PS(12:0/12:0(3-OH)) + Hydrogen ion > PE(12:0/12:0(3-OH)) + Carbon dioxide
PS(12:0/17:0cycw7c) + Hydrogen ion > PE(12:0/17:0cycw7c) + Carbon dioxide
PS(14:0(3-OH)/14:0(3-OH)) + Hydrogen ion > PE(14:0(3-OH)/14:0(3-OH)) + Carbon dioxide
PS(14:0(3-OH)/14:0) + Hydrogen ion > PE(14:0(3-OH)/14:0) + Carbon dioxide
PS(14:0(3-OH)/16:0) + Hydrogen ion PE(14:0(3-OH)/16:0) + Carbon dioxide
PS(14:0(3-OH)/16:1(9Z)) + Hydrogen ion > PE(14:0(3-OH)/16:1(9Z)) + Carbon dioxide
PS(14:0/14:0(3-OH)) + Hydrogen ion > PE(14:0/14:0(3-OH)) + Carbon dioxide
PS(15:0/14:0(3-OH)) + Hydrogen ion > PE(15:0/14:0(3-OH)) + Carbon dioxide
PS(16:0/12:0) + Hydrogen ion > PE(16:0/12:0) + Carbon dioxide
PS(16:1(9Z)/10:0) + Hydrogen ion > PE(16:1(9Z)/10:0) + Carbon dioxide
PS(16:1(9Z)/12:0) + Hydrogen ion > PE(16:1(9Z)/12:0) + Carbon dioxide
PS(16:1(9Z)/14:0(3-OH)) + Hydrogen ion > PE(16:1(9Z)/14:0(3-OH)) + Carbon dioxide
PS(14:0/17:0cycw7c) + Hydrogen ion PE(14:0(3-OH)/17:0cycw7c) + Carbon dioxide
PS(16:1(9Z)/19:0) + Hydrogen ion > PE(16:1(9Z)/19:0) + Carbon dioxide
PS(17:0/16:1(9Z)) + Hydrogen ion > PE(17:0/16:1(9Z)) + Carbon dioxide
PS(17:0cycw7c/10:0(3-OH)) + Hydrogen ion > PE(17:0cycw7c/10:0(3-OH)) + Carbon dioxide
PS(12:0/12:0) + Hydrogen ion > PE(12:0/12:0) + Carbon dioxide
2 CDP-DG(10:0(3-OH)/10:0) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/12:0) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/15:0cyclo) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/16:0) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/16:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/16:1(9Z)) + Glycerol 3-phosphate > PGP(10:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0(3-OH)/19:iso) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/19:iso) + Cytidine triphosphate + Hydrogen ion
2 CDP-DG(10:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(10:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(10:0/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(10:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-1,2-ditetradecanoylglycerol + Glycerol 3-phosphate >2 PGP(14:0/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/10:0) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-1,2-didodecanoylglycerol + Glycerol 3-phosphate >2 PGP(12:0/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/14:0) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/14:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/15:0) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/15:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/15:0cyclo) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/15:0cyclo) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/18:1(9Z)) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/18:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/19:0cycv8c) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/19:0cycv8c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0(3-OH)/19:iso) + Glycerol 3-phosphate >2 PGP(12:0(3-OH)/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(12:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(12:0/19:iso) + Glycerol 3-phosphate >2 PGP(12:0/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/12:0) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0(3-OH)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(14:0(3-OH)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(14:0/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(14:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(15:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(15:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(15:0/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(15:0/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(15:0cyclo/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(15:0cyclo/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:0/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(16:0/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:0/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(16:0/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:1(9Z)/14:0(3-OH)) + Glycerol 3-phosphate >2 PGP(16:1(9Z)/14:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(16:1(9Z)/17:0cycw7c) + Glycerol 3-phosphate >2 PGP(16:1(9Z)/17:0cycw7c) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(17:0cycw7c/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(17:0cycw7c/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(17:0cycw7c/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(17:0cycw7c/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
Guanosine triphosphate + 3 Water > Formic acid + Pyrophosphate +2 Hydrogen ion + 2,5-Diamino-6-(5'-phosphoribosylamino)-4-pyrimidineone
1-Amino-2-propanol + NAD + 4,5-Dihydro-4-hydroxy-5-S-glutathionyl-benzo[a]pyrene < NADH + Hydrogen ion + Aminoacetone
DG(17:0cycw7c/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/12:0) + Pyrophosphate
2 DG(17:0cycw7c/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/19:iso) + Pyrophosphate
DG(18:1(11Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/10:0) + Pyrophosphate
DG(18:1(11Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/12:0) + Pyrophosphate
DG(18:1(11Z)/17:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/17:0) + Pyrophosphate
2 DG(18:1(11Z)/19:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(11Z)/19:0) + Pyrophosphate
2 CDP-DG(18:1(11Z)/19:0) + Cytidine triphosphate + Hydrogen ion >2 PGP(18:1(11Z)/19:0) + Pyrophosphate
2 DG(18:1(9Z)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/12:0(3-OH)) + Pyrophosphate
2 DG(19:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0/16:1(9Z)) + Pyrophosphate
2 DG(19:0/18:1(11Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0/18:1(11Z)) + Pyrophosphate
2 DG(19:0cycv8c/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/10:0(3-OH)) + Pyrophosphate
2 DG(19:0cycv8c/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/12:0(3-OH)) + Pyrophosphate
DG(19:0cycw8c/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycw8c/10:0) + Pyrophosphate
2 DG(19:1(9Z)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:1(9Z)/16:1(9Z)) + Pyrophosphate
2 DG(19:iso/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/10:0(3-OH)) + Pyrophosphate
2 DG(19:iso/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/10:0) + Pyrophosphate
2 DG(19:iso/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/12:0(3-OH)) + Pyrophosphate
2 DG(19:iso/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/12:0) + Pyrophosphate
2 DG(19:iso/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/14:0(3-OH)) + Pyrophosphate
2 DG(19:iso/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/14:0) + Pyrophosphate
2 DG(19:iso/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/17:0cycw7c) + Pyrophosphate
2 DG(19:iso/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/19:0cycv8c) + Pyrophosphate
2 DG(19:iso/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/19:iso) + Pyrophosphate
CDP-DG(17:0cycw7c/12:0) + L-Serine + L-Serine > PS(17:0cycw7c/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(11Z)/10:0) + L-Serine + L-Serine > PS(18:1(11Z)/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(11Z)/12:0) + L-Serine + L-Serine > PS(18:1(11Z)/12:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(18:1(11Z)/17:0) + L-Serine + L-Serine > PS(18:1(11Z)/17:0) + Cytidine triphosphate + Hydrogen ion
CDP-DG(18:1(11Z)/19:0) + L-Serine + L-Serine > PS(18:1(11Z)/19:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
CDP-DG(19:0cycw8c/10:0) + L-Serine + L-Serine > PS(19:0cycw8c/10:0) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
PS(17:0cycw7c/12:0) + Hydrogen ion > PE(17:0cycw7c/12:0) + Carbon dioxide
PS(18:0/10:0) + Hydrogen ion > PE(18:0/10:0) + Carbon dioxide
PS(18:0/12:0) + Hydrogen ion > PE(18:0/12:0) + Carbon dioxide
PS(18:1(11Z)/10:0) + Hydrogen ion > PE(18:1(11Z)/10:0) + Carbon dioxide
PS(18:1(11Z)/12:0) + Hydrogen ion > PE(18:1(11Z)/12:0) + Carbon dioxide
PS(18:1(11Z)/17:0) + Hydrogen ion > PE(18:1(11Z)/17:0) + Carbon dioxide
PS(18:1(11Z)/19:0) + Hydrogen ion > PE(18:1(11Z)/19:0) + Carbon dioxide
PS(19:0cycw8c/10:0) + Hydrogen ion > PE(19:0cycw8c/10:0) + Carbon dioxide
2 CDP-DG(17:0cycw7c/19:iso) + Glycerol 3-phosphate >2 PGP(17:0cycw7c/19:iso) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(18:1(9Z)/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(18:1(9Z)/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:0/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0/18:1(11Z)) + Glycerol 3-phosphate >2 PGP(19:0/18:1(11Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/10:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/10:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:0cycv8c/12:0(3-OH)) + Glycerol 3-phosphate >2 PGP(19:0cycv8c/12:0(3-OH)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
2 CDP-DG(19:1(9Z)/16:1(9Z)) + Glycerol 3-phosphate >2 PGP(19:1(9Z)/16:1(9Z)) + Cytidine monophosphate + Hydrogen ion + Cytidine monophosphate
More...

Pathways:
Spectra
Spectra:
Spectrum TypeDescriptionSplash Key
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Positivesplash10-0udi-9000000000-1d1de5a5c37fe86ebc2fView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Positivesplash10-0udi-9000000000-1d1de5a5c37fe86ebc2fView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Positivesplash10-0udi-9000000000-1d1de5a5c37fe86ebc2fView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Negativesplash10-0udi-9000000000-cb753f988e32a89d6a3aView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Negativesplash10-0udi-9000000000-cb753f988e32a89d6a3aView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Negativesplash10-0udi-9000000000-cb753f988e32a89d6a3aView in MoNA
References
References:
  • Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590. Pubmed: 21097882
Synthesis Reference: Not Available
Material Safety Data Sheet (MSDS) Not Available
External Links:
ResourceLink
CHEBI ID15378
HMDB IDHMDB59597
Pubchem Compound ID1038
Kegg IDC00080
ChemSpider ID1010
Wikipedia IDHydrogen ion
BioCyc IDPROTON
EcoCyc IDPROTON