Record Information
Version 1.0
Update Date 1/22/2018 12:54:53 PM
Metabolite IDPAMDB000148
Identification
Name: Adenosine triphosphate
Description:Adenosine-5'-triphosphate (ATP) is a multifunctional nucleotide that plays an important role in cell biology as a coenzyme, that is, the "molecular unit of currency" of intracellular energy transfer. ATP transports chemical energy within cells for metabolism. It is an energy source produced during photosynthesis and cellular respiration and consumed by many enzymes and a multitude of cellular processes, including biosynthetic reactions, motility, and cell division.ATP is made from adenosine diphosphate (ADP) or adenosine monophosphate (AMP) and its use in metabolism converts it back into these precursors. ATP is therefore continuously recycled in organisms. ATP is used as a substrate in signal transduction pathways by kinases that phosphorylate proteins and lipids, as well as by adenylate cyclase, which uses ATP to produce the second messenger molecule cyclic AMP. The ratio between ATP and AMP is used as a way for a cell to sense how much energy is available and control the metabolic pathways that produce and consume ATP. Apart from its roles in energy metabolism and signaling, ATP is also incorporated into nucleic acids by polymerases in the processes of DNA replication and transcription. (Wikipedia)
Structure
Thumb
Synonyms:
  • 5'-(Tetrahydrogen triphosphate) Adenosine
  • 5'-(Tetrahydrogen triphosphoric acid) adenosine
  • 5'-ATP
  • Adenosine 5'-triphosphate
  • Adenosine 5'-triphosphorate
  • Adenosine 5'-triphosphoric acid
  • Adenosine triphosphate
  • Adenosine triphosphoric acid
  • Adenosine-5'-triphosphate
  • Adenosine-5'-triphosphoric acid
  • Adenosine-triphosphate
  • Adenosine-triphosphoric acid
  • Adenylpyrophosphate
  • Adenylpyrophosphorate
  • Adenylpyrophosphoric acid
  • Adephos
  • Adetol
  • Adynol
  • Atipi
  • ATP
  • Atriphos
  • Cardenosine
  • Fosfobion
  • Glucobasin
  • Myotriphos
  • Phosphobion
  • Striadyne
  • Triadenyl
  • Triphosphaden
  • Triphosphate adenosine ester
  • Triphosphorate adenosine ester
  • Triphosphoric acid adenosine ester
Chemical Formula: C10H16N5O13P3
Average Molecular Weight: 507.181
Monoisotopic Molecular Weight: 506.995745159
InChI Key: ZKHQWZAMYRWXGA-KQYNXXCUSA-N
InChI:InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1
CAS number: 56-65-5
IUPAC Name:({[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid
Traditional IUPAC Name: adenosine triphosphate
SMILES:NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
Chemical Taxonomy
Taxonomy DescriptionThis compound belongs to the class of organic compounds known as purine ribonucleoside triphosphates. These are purine ribobucleotides with a triphosphate group linked to the ribose moiety.
Kingdom Organic compounds
Super ClassNucleosides, nucleotides, and analogues
Class Purine nucleotides
Sub ClassPurine ribonucleotides
Direct Parent Purine ribonucleoside triphosphates
Alternative Parents
Substituents
  • Purine ribonucleoside triphosphate
  • N-glycosyl compound
  • Glycosyl compound
  • Organic pyrophosphate
  • Monosaccharide phosphate
  • 6-aminopurine
  • Purine
  • Imidazopyrimidine
  • Monoalkyl phosphate
  • Aminopyrimidine
  • Imidolactam
  • Alkyl phosphate
  • Pyrimidine
  • Primary aromatic amine
  • Phosphoric acid ester
  • Organic phosphoric acid derivative
  • Organic phosphate
  • N-substituted imidazole
  • Monosaccharide
  • Saccharide
  • Heteroaromatic compound
  • Oxolane
  • Imidazole
  • Azole
  • Secondary alcohol
  • 1,2-diol
  • Oxacycle
  • Azacycle
  • Organoheterocyclic compound
  • Hydrocarbon derivative
  • Primary amine
  • Organooxygen compound
  • Organonitrogen compound
  • Amine
  • Alcohol
  • Aromatic heteropolycyclic compound
Molecular Framework Aromatic heteropolycyclic compounds
External Descriptors
Physical Properties
State: Solid
Charge:-3
Melting point: Not Available
Experimental Properties:
PropertyValueSource
Water Solubility:1000.0 mg/mL [MERCK INDEX [1996)]; 862 mg/mL (Magnesium salt, HMP experimental]PhysProp
Predicted Properties
PropertyValueSource
Water Solubility4.49 mg/mLALOGPS
logP-0.84ALOGPS
logP-6ChemAxon
logS-2ALOGPS
pKa (Strongest Acidic)0.9ChemAxon
pKa (Strongest Basic)5ChemAxon
Physiological Charge-3ChemAxon
Hydrogen Acceptor Count14ChemAxon
Hydrogen Donor Count7ChemAxon
Polar Surface Area279.13 Å2ChemAxon
Rotatable Bond Count8ChemAxon
Refractivity95.81 m3·mol-1ChemAxon
Polarizability38.92 Å3ChemAxon
Number of Rings3ChemAxon
Bioavailability0ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations: Cytoplasm
Reactions:
Adenosine triphosphate + Water + Isethionic acid > ADP + Hydrogen ion + Isethionic acid + Phosphate
Adenosine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dATP +2 flavodoxin semi oxidized + Water
Adenosine triphosphate + Water + Potassium > ADP + Hydrogen ion + Potassium + Phosphate
Adenosine triphosphate + Water + Molybdate > ADP + Hydrogen ion + Molybdate + Phosphate
Adenosine triphosphate + Water + Putrescine > ADP + Hydrogen ion + Phosphate + Putrescine
Adenosine triphosphate + Water + Butanesulfonate > ADP + Butanesulfonate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Spermidine > ADP + Hydrogen ion + Phosphate + Spermidine
Adenosine triphosphate + Water + D-Alanyl-D-alanine > ADP + D-Alanyl-D-alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + D-Galactose > ADP + D-Galactose + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Arginine > ADP + L-Arginine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sulfate > ADP + Hydrogen ion + Phosphate + Sulfate
Adenosine triphosphate + Water + Thiosulfate > ADP + Hydrogen ion + Phosphate + Thiosulfate
Adenosine triphosphate + Water + L-Leucine > ADP + Hydrogen ion + L-Leucine + Phosphate
Adenosine triphosphate + Water + Nickel > ADP + Hydrogen ion + Nickel + Phosphate
Adenosine triphosphate + Water + Ribose > ADP + Hydrogen ion + Phosphate + Ribose
L-Aspartic acid + Adenosine triphosphate <> L-Aspartyl-4-phosphate + ADP
2 Adenosine triphosphate + L-Glutamine + Water + Hydrogen carbonate >2 ADP + Carbamoylphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
Adenosine triphosphate + D-Xylulose <> ADP + Hydrogen ion + Xylulose 5-phosphate
Adenosine triphosphate + L-Threo-2-pentulose <> ADP + Hydrogen ion + L-Xylulose 5-phosphate
Adenosine triphosphate + Water + Thiamine > ADP + Hydrogen ion + Phosphate + Thiamine
Adenosine triphosphate + Water + Ferric coprogen > ADP + Ferric coprogen + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Aerobactin > ADP + Aerobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferrichrome > ADP + Ferrichrome + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Ferroxamine > ADP + Ferroxamine + Hydrogen ion + Phosphate
Acetyl-CoA + Adenosine triphosphate + Hydrogen carbonate <> ADP + Hydrogen ion + Malonyl-CoA + Phosphate
Adenosine triphosphate + Water + L-Methionine > ADP + Hydrogen ion + L-Methionine + Phosphate
Adenosine triphosphate + Water + D-Methionine > ADP + Hydrogen ion + D-Methionine + Phosphate
Adenosine triphosphate + Water + Taurine > ADP + Hydrogen ion + Phosphate + Taurine
2 D-Alanine + Adenosine triphosphate <> ADP + D-Alanyl-D-alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Uridine 5'-diphosphate <> ADP + Uridine triphosphate
Adenosine triphosphate + dGDP <> ADP + dGTP
Adenosine triphosphate + Guanosine diphosphate <> ADP + Guanosine triphosphate
Adenosine triphosphate + dCDP <> ADP + dCTP
Adenosine triphosphate + dTDP <> ADP + Thymidine 5'-triphosphate
Adenosine triphosphate + dADP <> ADP + dATP
Adenosine triphosphate + Carbon dioxide + Ammonium <> ADP + Carbamoylphosphate +2 Hydrogen ion
Adenosine triphosphate + Water + Ferric enterobactin > ADP + Ferric enterobactin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + ferric 2,3-dihydroxybenzoylserine > ADP + ferric 2,3-dihydroxybenzoylserine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Glutamate > ADP + L-Glutamate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Aspartic acid > ADP + L-Aspartic acid + Hydrogen ion + Phosphate
Adenosine triphosphate + Coenzyme A + Succinic acid <> ADP + Phosphate + Succinyl-CoA
Adenosine triphosphate + Water + L-Glutamine > ADP + L-Glutamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glutathione > ADP + Glutathione + Hydrogen ion + Phosphate
Adenosine triphosphate + L-Cysteine + Water > ADP + Hydrogen ion + Phosphate + L-Cysteine
Adenosine triphosphate + Uridine 5'-monophosphate <> ADP + Uridine 5'-diphosphate
Adenosine triphosphate + Water + Ethanesulfonate > ADP + Ethanesulfonate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Methanesulfonate > ADP + Hydrogen ion + Methanesulfonate + Phosphate
Adenosine triphosphate + Water + Sulfoacetate > ADP + Hydrogen ion + Phosphate + Sulfoacetate
Adenosine triphosphate + Water + L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine > L-Alanine-D-glutamate-meso-2,6-diaminoheptanedioate-D-alanine + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate > L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Pyridoxal <> ADP + Hydrogen ion + Pyridoxal 5'-phosphate
[2Fe-1S] desulfurated iron-sulfur cluster + Adenosine triphosphate + Water + SufBCD scaffold complex + SufSE with bound sulfur > ADP +5 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster + SufSE sulfur acceptor complex
Adenosine triphosphate + Coenzyme A + Dodecanoate (N-C12:0) + Hydrogen ion > Adenosine monophosphate + Lauroyl-CoA + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Palmitic acid > Adenosine monophosphate + Hydrogen ion + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecanoate (N-C18:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Stearoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + tetradecanoate (n-C14:0) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + Tetradecanoyl-CoA
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Hydrogen ion + Pyrophosphate + (2E)-Tetradecenoyl-CoA
Adenosine triphosphate + Water + Adenosylcobalamin > Adenosylcobalamin + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cob(I)alamin > ADP + Cob(I)alamin + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Cobinamide > ADP + Cobinamide + Hydrogen ion + Phosphate
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) + tRNA(Phe) <> Adenosine monophosphate + L-Phenylalanyl-tRNA(Phe) + Pyrophosphate + L-Phenylalanyl-tRNA(Phe)
Adenosine triphosphate + Coenzyme A + Decanoate (N-C10:0) + Hydrogen ion > Adenosine monophosphate + Decanoyl-CoA (N-C10:0CoA) + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Caprylic acid > Adenosine monophosphate + Hydrogen ion + Octanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Hexanoate (N-C6:0) > Adenosine monophosphate + Hydrogen ion + Hexanoyl-CoA + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Hydrogen ion + Octadecenoate (N-C18:1) > Adenosine monophosphate + Hydrogen ion + Octadecenoyl-CoA (N-C18:1CoA) + Pyrophosphate
ADP + Hydrogen ion + Phosphoenolpyruvic acid <> Adenosine triphosphate + Pyruvic acid
Adenosine triphosphate + Water + Zinc > ADP + Hydrogen ion + Phosphate + Zinc
Adenosine triphosphate + Water + L-Arabinose > ADP + L-Arabinose + Hydrogen ion + Phosphate
Adenosine triphosphate + D-Galactose + Alpha-D-Galactose <> ADP + Galactose 1-phosphate + Hydrogen ion
4-Amino-5-hydroxymethyl-2-methylpyrimidine + Adenosine triphosphate <> 4-Amino-2-methyl-5-phosphomethylpyrimidine + ADP + Hydrogen ion + 4-amino-5-phosphonooxymethyl-2-methylpyrimidine
Adenosine triphosphate + Water + Choline > ADP + Choline + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Betaine > ADP + Betaine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + D-Glucose > ADP + D-Glucose + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Heme > ADP + Hydrogen ion + Phosphate + Heme
Adenosine triphosphate + Water + L-Histidine > ADP + Hydrogen ion + L-Histidine + Phosphate
Adenosine triphosphate + Water + L-Lysine > ADP + Hydrogen ion + L-Lysine + Phosphate
Adenosine triphosphate + Water + Ornithine > ADP + Hydrogen ion + Ornithine + Phosphate
Adenosine triphosphate + dUDP <> ADP + Deoxyuridine triphosphate
Adenosine triphosphate + CDP <> ADP + Cytidine triphosphate
Adenosine triphosphate + Dehydroglycine + 1-Deoxy-D-xylulose 5-phosphate + Hydrogen ion + IscS with bound sulfur + NADPH > 4-Methyl-5-(2-phosphoethyl)-thiazole + Adenosine monophosphate + Carbon dioxide +2 Water + IscS sulfur acceptor protein + NADP + Pyrophosphate
Adenosine triphosphate + Water + Carnitine > ADP + Carnitine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Proline > ADP + Hydrogen ion + Phosphate + L-Proline
Adenosine triphosphate + Water + Crotonobetaine > ADP + Crotonobetaine + Hydrogen ion + Phosphate
Adenosine triphosphate + Guanosine triphosphate + Water + Sulfate > Adenosine phosphosulfate + Guanosine diphosphate + Phosphate + Pyrophosphate
Adenosine triphosphate + Guanosine diphosphate > Adenosine monophosphate + Hydrogen ion + Guanosine 3',5'-bis(diphosphate)
acyl carrier protein + Adenosine triphosphate + Palmitic acid > Adenosine monophosphate + Palmitoyl-ACP (n-C16:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Caprylic acid > Adenosine monophosphate + Octanoyl-ACP (n-C8:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Decanoate (N-C10:0) > Adenosine monophosphate + Decanoyl-ACP (n-C10:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Dodecanoate (N-C12:0) > Adenosine monophosphate + Dodecanoyl-ACP (n-C12:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Octadecanoate (N-C18:0) > Adenosine monophosphate + Octadecanoyl-ACP (n-C18:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Octadecenoate (N-C18:1) > Adenosine monophosphate + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + tetradecanoate (n-C14:0) > Adenosine monophosphate + Myristoyl-ACP (n-C14:0ACP) + Pyrophosphate
acyl carrier protein + Adenosine triphosphate + Tetradecenoate (N-C14:1) > Adenosine monophosphate + Pyrophosphate + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Acetic acid + Adenosine triphosphate <> Acetylphosphate + ADP
Adenosine triphosphate + Water + (enterobacterial common antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (enterobacterial common antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + (O16 antigen)x4 core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + (O16 antigen)x4 core oligosaccharide lipid A
Adenosine triphosphate + Water + cold adapted KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + cold adapted KDO(2)-lipid (A)
Adenosine triphosphate + Water + core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A
Adenosine triphosphate + Water + core oligosaccharide lipid A diphosphate > ADP + Hydrogen ion + Phosphate + core oligosaccharide lipid A diphosphate
Adenosine triphosphate + Water + KDO2-Lipid A > ADP + Hydrogen ion + Phosphate + KDO2-Lipid A
Adenosine triphosphate + Water + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A > ADP + Hydrogen ion + Phosphate + 4-Amino-4-deoxy-L-arabinose modified core oligosaccharide lipid A
Adenosine triphosphate + Water + KDO(2)-lipid IV(A) > ADP + Hydrogen ion + Phosphate + KDO(2)-lipid IV(A)
Adenosine triphosphate + Water + Phosphoethanolamine KDO(2)-lipid (A) > ADP + Hydrogen ion + Phosphate + Phosphoethanolamine KDO(2)-lipid (A)
Adenosine triphosphate + Shikimic acid <> ADP + Hydrogen ion + Shikimate 3-phosphate
Adenosine triphosphate + Water + Glycerophosphocholine > ADP + Glycerophosphocholine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerylphosphorylethanolamine > ADP + Glycerylphosphorylethanolamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 3-phosphate > ADP + Glycerol 3-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerol 2-phosphate > ADP + Glycerol 2-phosphate + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoglycerol > ADP + Glycerophosphoglycerol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Glycerophosphoserine > ADP + Glycerophosphoserine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Sn-Glycero-3-phospho-1-inositol > ADP + Sn-Glycero-3-phospho-1-inositol + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Alanine > ADP + L-Alanine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Threonine > ADP + Hydrogen ion + Phosphate + L-Threonine
Adenosine triphosphate + Water + L-Isoleucine > ADP + Hydrogen ion + L-Isoleucine + Phosphate
Adenosine triphosphate + Water + L-Valine > ADP + Hydrogen ion + Phosphate + L-Valine
Adenosine triphosphate + Water + Cysteinylglycine > ADP + Cysteinylglycine + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + L-Prolinylglycine > ADP + Hydrogen ion + Phosphate + L-Prolinylglycine
Adenosine triphosphate + Glycine + tRNA(Gly) + tRNA(Gly) <> Adenosine monophosphate + Glycyl-tRNA(Gly) + Pyrophosphate + Glycyl-tRNA(Gly)
Adenosine triphosphate + Water + D-Xylose > ADP + Hydrogen ion + Phosphate + D-Xylose
Adenosine triphosphate + Water + Phosphate > ADP + Hydrogen ion +2 Phosphate
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD scaffold complex + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with bound [2Fe-2S] cluster +2 SufSE sulfur acceptor complex
Adenosine triphosphate + FADH2 + 2 Iron + Water + SufBCD with bound [2Fe-2S] cluster + 2 SufSE with bound sulfur > ADP + FAD +7 Hydrogen ion + Phosphate + SufBCD with two bound [2Fe-2S] clusters +2 SufSE sulfur acceptor complex
Adenosine triphosphate + L-Glutamate + Ammonium > ADP + L-Glutamine + Hydrogen ion + Phosphate
Adenosine triphosphate + Fructose 6-phosphate > ADP + Fructose 1,6-bisphosphate + Hydrogen ion
Adenosine triphosphate + Water + D-Maltose > ADP + Hydrogen ion + D-Maltose + Phosphate
Adenosine triphosphate + Water + Maltotriose > ADP + Hydrogen ion + Maltotriose + Phosphate
Adenosine triphosphate + Water + Maltotetraose > ADP + Hydrogen ion + Maltotetraose + Phosphate
Adenosine triphosphate + Water + 1,4-alpha-D-glucan > 1,4-alpha-D-glucan + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Water + Maltohexaose > ADP + Hydrogen ion + Maltohexaose + Phosphate
Adenosine triphosphate + Water + Maltopentaose > ADP + Hydrogen ion + Maltopentaose + Phosphate
Adenosine triphosphate + Water + D-Allose > ADP + D-Allose + Hydrogen ion + Phosphate
Adenosine triphosphate + L-Lysine + tRNA(Lys) > Adenosine monophosphate + L-Lysine-tRNA (Lys) + Pyrophosphate
Adenosine triphosphate + Gluconic acid <> 6-Phosphogluconic acid + ADP + Hydrogen ion
Adenosine triphosphate + Water + Fe(III)dicitrate > ADP +2 Citric acid + Fe3+ + Hydrogen ion + Phosphate
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide + NMN <> NAD + Pyrophosphate
Adenosine triphosphate + L-Homoserine <> ADP + Hydrogen ion + O-Phosphohomoserine
Adenosine triphosphate + Hydrogen ion + Molybdopterin <> Adenylated molybdopterin + Pyrophosphate
Adenosine triphosphate + Riboflavin <> ADP + Flavin Mononucleotide + Hydrogen ion
Adenosine triphosphate + Flavin Mononucleotide + Hydrogen ion > FAD + Pyrophosphate
Adenosine triphosphate + L-Isoleucine + tRNA(Ile) + tRNA(Ile) <> Adenosine monophosphate + L-Isoleucyl-tRNA(Ile) + Pyrophosphate + L-Isoleucyl-tRNA(Ile)
Adenosine triphosphate + Coenzyme A + Carnitine > ADP + L-Carnitinyl-CoA + Phosphate
Adenosine triphosphate + Coenzyme A + Carnitine > ADP + D-Carnitinyl-CoA + Phosphate
Adenosine triphosphate + Coenzyme A + Crotonobetaine > ADP + Crotonobetainyl-CoA + Phosphate
Adenosine triphosphate + L-Ribulose > ADP + Hydrogen ion + L-Ribulose 5-phosphate
Diaminopimelic acid + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
D-Alanyl-D-alanine + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-6-carboxy-L-lysyl-D-alanyl-D-alanine
Adenosine triphosphate + D-Glutamic acid + UDP-N-Acetylmuramoyl-L-alanine <> ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate
L-Alanine + Adenosine triphosphate + UDP-N-Acetylmuraminate <> ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanine
beta-Alanine + Adenosine triphosphate + (R)-Pantoate <> Adenosine monophosphate + Hydrogen ion + Pantothenic acid + Pyrophosphate
6-Hydroxymethyl dihydropterin + Adenosine triphosphate > 6-Hydroxymethyl-dihydropterin pyrophosphate + Adenosine monophosphate + Hydrogen ion
Adenosine triphosphate + L-Proline + tRNA(Pro) + tRNA(Pro) <> Adenosine monophosphate + Pyrophosphate + L-Prolyl-tRNA(Pro) + L-Prolyl-tRNA(Pro)
Adenosine triphosphate + L-Glutamate > ADP + L-Glutamic acid 5-phosphate
Adenosine triphosphate + D-Fructose > ADP + Fructose 6-phosphate + Hydrogen ion
Adenosine triphosphate + Thiamine monophosphate <> ADP + Thiamine pyrophosphate
Adenosine triphosphate + 7-Deaza-7-carboxyguanine + Ammonium > ADP + Hydrogen ion + Water + Phosphate + 7-Cyano-7-carbaguanine
Adenosine + Adenosine triphosphate > ADP + Adenosine monophosphate + Hydrogen ion
Adenosine triphosphate + Deoxyadenosine monophosphate <> ADP + dADP
Adenosine triphosphate + Guanosine > ADP + Guanosine monophosphate + Hydrogen ion
Adenosine triphosphate + Inosine <> ADP + Hydrogen ion + Inosinic acid
Adenosine triphosphate + Copper + Water > ADP + Hydrogen ion + Phosphate + Copper
Adenosine triphosphate + Glyceric acid > 3-Phosphoglycerate + ADP + Hydrogen ion
5-Aminoimidazole ribonucleotide + Adenosine triphosphate + Hydrogen carbonate > 5-Phosphoribosyl-5-carboxyaminoimidazole + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + L-Cysteine + tRNA(Cys) + tRNA(Cys) <> Adenosine monophosphate + L-Cysteinyl-tRNA(Cys) + Pyrophosphate + L-Cysteinyl-tRNA(Cys)
Adenosine triphosphate + Hydrogen ion + L-Serine <> Pyrophosphate + L-Seryl-AMP
Adenosine triphosphate + Dephospho-CoA > 2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + Adenine
Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide <> Nicotinic acid adenine dinucleotide + Pyrophosphate
Adenosine triphosphate + L-Leucine + tRNA(Leu) > Adenosine monophosphate + L-Leucyl-tRNA(Leu) + Pyrophosphate
L-Aspartic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + L-Asparagine + L-Glutamate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + L-Glutamine + tRNA(Gln) > Adenosine monophosphate + L-Glutaminyl-tRNA(Gln) + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + MoaD Protein with carboxylate > MoaD Protein with bound AMP + Pyrophosphate
Adenosine triphosphate + L-Serine + tRNA(SeCys) > Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + L-Serine + tRNA(Ser) + tRNA(Ser) <> Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser) + L-Seryl-tRNA(Ser)
Adenosine triphosphate + Cytidine monophosphate <> ADP + CDP
Adenosine triphosphate + dCMP <> ADP + dCDP
Adenosine triphosphate + Water + PA(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PA(16:0/16:0)
Adenosine triphosphate + Water + PE(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PE(14:0/14:0)
Adenosine triphosphate + Water + PG(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PG(16:0/16:0)
Adenosine triphosphate + Water + PG(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PG(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PG(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PG(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + Water + PG(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PG(14:0/14:0)
Adenosine triphosphate + Water + PG(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PG(12:0/12:0)
Adenosine triphosphate + Water + PG(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PG(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PG(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PG(18:0/18:0)
Adenosine triphosphate + Water + PGP(12:0/12:0) > ADP + Hydrogen ion + Phosphate + PGP(12:0/12:0)
Adenosine triphosphate + Water + PGP(14:0/14:0) > ADP + Hydrogen ion + Phosphate + PGP(14:0/14:0)
Adenosine triphosphate + Water + PGP(14:1(7Z)/14:1(7Z)) > ADP + Hydrogen ion + Phosphate + PGP(14:1(7Z)/14:1(7Z))
Adenosine triphosphate + Water + PGP(16:0/16:0) > ADP + Hydrogen ion + Phosphate + PGP(16:0/16:0)
Adenosine triphosphate + Water + PGP(16:1(9Z)/16:1(9Z)) > ADP + Hydrogen ion + Phosphate + PGP(16:1(9Z)/16:1(9Z))
Adenosine triphosphate + Water + PGP(18:0/18:0) > ADP + Hydrogen ion + Phosphate + PGP(18:0/18:0)
Adenosine triphosphate + Water + PGP(18:1(11Z)/18:1(11Z)) > ADP + Hydrogen ion + Phosphate + PGP(18:1(11Z)/18:1(11Z))
Adenosine triphosphate + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate > ADP + Hydrogen ion + 2,3,2'3'-Tetrakis(beta-hydroxymyristoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1,4'-bisphosphate
L-Asparagine + Adenosine triphosphate + tRNA(Asn) + tRNA(Asn) <> Adenosine monophosphate + L-Asparaginyl-tRNA(Asn) + Pyrophosphate + L-Asparaginyl-tRNA(Asn)
Adenosine triphosphate + Water + Nicotinic acid + Phosphoribosyl pyrophosphate > ADP + Nicotinamide ribotide + Phosphate + Pyrophosphate
Adenosine triphosphate + 5-Thymidylic acid <> ADP + dTDP
Adenosine triphosphate + Thiamine <> ADP + Hydrogen ion + Thiamine monophosphate
N-Acetyl-D-glucosamine + Adenosine triphosphate <> N-Acetyl-D-Glucosamine 6-Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Deoxyuridine > ADP + dUMP + Hydrogen ion
Adenosine triphosphate + Thymidine <> ADP + 5-Thymidylic acid + Hydrogen ion
Adenosine triphosphate + Cob(I)alamin + Hydrogen ion <> Adenosylcobalamin + Triphosphate
Adenosine triphosphate + Cobinamide + Hydrogen ion <> Adenosyl cobinamide + Triphosphate
Adenosine triphosphate + L-Glutamate + Putrescine + Ethylenediamine <> ADP + gamma-Glutamyl-L-putrescine + Hydrogen ion + Phosphate
Adenosine triphosphate + Coenzyme A + Benzeneacetic acid <> Adenosine monophosphate + Phenylacetyl-CoA + Pyrophosphate
Adenosine triphosphate + tRNA(Tyr) + L-Tyrosine + tRNA(Tyr) <> Adenosine monophosphate + Pyrophosphate + L-Tyrosyl-tRNA(Tyr) + L-Tyrosyl-tRNA(Tyr)
Adenosine triphosphate + Water + Pyruvic acid <> Adenosine monophosphate +2 Hydrogen ion + Phosphoenolpyruvic acid + Phosphate
Adenosine triphosphate + L-Threonine + tRNA(Thr) + tRNA(Thr) <> Adenosine monophosphate + Pyrophosphate + L-Threonyl-tRNA(Thr) + L-Threonyl-tRNA(Thr)
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonium > Adenosine monophosphate + Hydrogen ion + NAD + Pyrophosphate
Adenosine triphosphate + Water + Selenium > Adenosine monophosphate + Phosphate + Phosphoroselenoic acid
Adenosine triphosphate + Formic acid + Glycineamideribotide > ADP + 5'-Phosphoribosyl-N-formylglycineamide + Hydrogen ion + Phosphate
L-Aspartic acid + Adenosine triphosphate + tRNA(Asp) + tRNA(Asp) <> Adenosine monophosphate + L-Aspartyl-tRNA(Asp) + Pyrophosphate + L-Aspartyl-tRNA(Asp)
L-Arginine + Adenosine triphosphate + tRNA(Arg) + tRNA(Arg) <> Adenosine monophosphate + L-Arginyl-tRNA(Arg) + Pyrophosphate + L-Arginyl-tRNA(Arg)
Adenosyl cobinamide + Adenosine triphosphate > Adenosyl cobinamide phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Phosphoribosyl pyrophosphate <> Pyrophosphate + Phosphoribosyl-ATP
4-Amino-2-methyl-5-phosphomethylpyrimidine + Adenosine triphosphate > 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + ADP
5-(2-Hydroxyethyl)-4-methylthiazole + Adenosine triphosphate + 4-methyl-5-(2-hydroxyethyl)thiazole <> 4-Methyl-5-(2-phosphoethyl)-thiazole + ADP + Hydrogen ion
Adenosine triphosphate + L-Methionine + tRNA(Met) > Adenosine monophosphate + L-Methionyl-tRNA (Met) + Pyrophosphate
Adenosine triphosphate + Fructose 1-phosphate > ADP + Fructose 1,6-bisphosphate + Hydrogen ion
Adenosine triphosphate + Coenzyme A + 2-Succinylbenzoate <> Adenosine monophosphate + Pyrophosphate + 2-Succinylbenzoyl-CoA
Adenosine triphosphate + D-Glucose > ADP + Glucose 6-phosphate + Hydrogen ion
Adenosine triphosphate + L-Glutamate + tRNA (Glu) > Adenosine monophosphate + L-Glutamyl-tRNA(Glu) + Pyrophosphate
5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid + Adenosine triphosphate <> SAICAR + ADP + Hydrogen ion + Phosphate
Adenosine triphosphate + Phosphoribosylformylglycineamidine <> ADP + 5-Aminoimidazole ribonucleotide +2 Hydrogen ion + Phosphate
Adenosine triphosphate + Phosphate <> ADP + Pyrophosphate
Adenosine triphosphate + Pyrophosphate <> ADP + Triphosphate
Adenosine triphosphate + L-Glutamine + Water + Xanthylic acid > Adenosine monophosphate + L-Glutamate + Guanosine monophosphate +2 Hydrogen ion + Pyrophosphate
Adenosine triphosphate + L-Histidine + tRNA(His) + tRNA(His) <> Adenosine monophosphate + L-Histidyl-tRNA(His) + Pyrophosphate + L-Histidyl-tRNA(His)
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water <> ADP + Phosphoribosylformylglycineamidine + L-Glutamate + Hydrogen ion + Phosphate
Adenosine triphosphate + NAD <> ADP + Hydrogen ion + NADP
Adenosine triphosphate + L-Cysteine + L-Glutamate <> ADP + gamma-Glutamylcysteine + Hydrogen ion + Phosphate
L-Alanine + Adenosine triphosphate + tRNA(Ala) > L-Alanyl-tRNA(Ala) + Adenosine monophosphate + Pyrophosphate
Adenosine phosphosulfate + Adenosine triphosphate <> ADP + Hydrogen ion + Phosphoadenosine phosphosulfate
Adenosine triphosphate + L-Glutamine + Water + Uridine triphosphate > ADP + Cytidine triphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Guanosine triphosphate <> Adenosine monophosphate + Guanosine 3'-diphosphate 5'-triphosphate + Hydrogen ion
Adenosine triphosphate + L-Fuculose <> ADP + L-Fuculose 1-phosphate + Hydrogen ion
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C12:0) + Adenosine triphosphate + Dodecanoate (N-C12:0) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:0) + Adenosine triphosphate + tetradecanoate (n-C14:0) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C14:1) + Adenosine triphosphate + Tetradecenoate (N-C14:1) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C16:0) + Adenosine triphosphate + Palmitic acid > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:0) + Adenosine triphosphate + Octadecanoate (N-C18:0) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoethanolamine (N-C18:1) + Adenosine triphosphate + Octadecenoate (N-C18:1) > Adenosine monophosphate + PE(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (n-C12:0) + Adenosine triphosphate + Dodecanoate (N-C12:0) > Adenosine monophosphate + PG(12:0/12:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:0) + Adenosine triphosphate + tetradecanoate (n-C14:0) > Adenosine monophosphate + PG(14:0/14:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C14:1) + Adenosine triphosphate + Tetradecenoate (N-C14:1) > Adenosine monophosphate + PG(14:1(7Z)/14:1(7Z)) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C16:0) + Adenosine triphosphate + Palmitic acid > Adenosine monophosphate + PG(16:0/16:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:0) + Adenosine triphosphate + Octadecanoate (N-C18:0) > Adenosine monophosphate + PG(18:0/18:0) + Pyrophosphate
2-Acyl-sn-glycero-3-phosphoglycerol (N-C18:1) + Adenosine triphosphate + Octadecenoate (N-C18:1) > Adenosine monophosphate + PG(18:1(11Z)/18:1(11Z)) + Pyrophosphate
3-Phosphoglycerate + Adenosine triphosphate <> Glyceric acid 1,3-biphosphate + ADP
Adenosine triphosphate + Water + L-Methionine <> S-Adenosylmethionine + Phosphate + Pyrophosphate
Adenosine triphosphate + gamma-Glutamylcysteine + Glycine <> ADP + Glutathione + Hydrogen ion + Phosphate
Adenosine triphosphate + Glutathione + Spermidine <> ADP + Glutathionylspermidine + Hydrogen ion + Phosphate
Adenosine triphosphate + D-Glycero-D-manno-heptose 1-phosphate + Hydrogen ion > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
Adenosine triphosphate + Glyceric acid > 2-Phospho-D-glyceric acid + ADP + Hydrogen ion
L-Aspartic acid + Adenosine triphosphate + Citrulline <> Adenosine monophosphate + Argininosuccinic acid + Hydrogen ion + Pyrophosphate
N-Acetylmannosamine + Adenosine triphosphate > N-Acetyl-D-mannosamine 6-phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Fructoselysine > ADP + Fructoselysine-6-phosphate + Hydrogen ion
Adenosine triphosphate + tRNA(Trp) + L-Tryptophan + tRNA(Trp) <> Adenosine monophosphate + Pyrophosphate + L-Tryptophanyl-tRNA(Trp)
Adenosine triphosphate + Oxalacetic acid <> ADP + Carbon dioxide + Phosphoenolpyruvic acid
Adenosine triphosphate + Water + Iron > ADP + Iron + Hydrogen ion + Phosphate
Adenosine triphosphate + Glucose 1-phosphate + Hydrogen ion <> ADP-Glucose + Pyrophosphate
Adenosine triphosphate + Cadmium + Water > ADP + Hydrogen ion + Phosphate + Cadmium
Arsenite + Adenosine triphosphate + Water > ADP + Hydrogen ion + Phosphate + Arsenite
3-Dehydro-L-gulonate + Adenosine triphosphate > 3-Dehydro-L-gulonate 6-phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Phospho-heptosyl-phospho-heptosyl-heptosyl-kdo2-lipidA
Adenosine triphosphate + heptosyl-heptosyl-kdo2-lipidA > ADP + Hydrogen ion + Phospho-heptosyl-heptosyl-kdo2-lipidA
Adenosine triphosphate + Hydrogen ion + Pantetheine 4'-phosphate <> Dephospho-CoA + Pyrophosphate
Adenosine triphosphate + 2'-Deoxyguanosine 5'-monophosphate <> ADP + dGDP
Adenosine triphosphate + Guanosine monophosphate <> ADP + Guanosine diphosphate
L-Aspartic acid + Adenosine triphosphate + Ammonium > Adenosine monophosphate + L-Asparagine + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + Ribose <> ADP + Hydrogen ion + D-Ribose-5-phosphate
Adenosine triphosphate + L-Rhamnulose <> ADP + Hydrogen ion + L-Rhamnulose 1-phosphate
Adenosine triphosphate + D-Sedoheptulose 7-phosphate > ADP + Hydrogen ion + Sedoheptulose 1,7-bisphosphate
Adenosine triphosphate + D-Tagatose 6-phosphate > ADP + Hydrogen ion + D-Tagatose 1,6-bisphosphate
Adenosine triphosphate + Glycerol <> ADP + Glycerol 3-phosphate + Hydrogen ion
N-Acetyl-L-alanine + Adenosine triphosphate + N-Acetylglutamic acid <> N-Acetyl-L-glutamyl 5-phosphate + ADP
Adenosine triphosphate + Pantothenic acid <> D-4'-Phosphopantothenate + ADP + Hydrogen ion
Adenosine triphosphate + Glycine + 5-Phosphoribosylamine <> ADP + Glycineamideribotide + Hydrogen ion + Phosphate
1,2-Diacyl-sn-glycerol (didodecanoyl, n-C12:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dihexadec-9-enoyl, n-C16:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dihexadecanoyl, n-C16:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (dioctadec-11-enoyl, n-C18:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (ditetradec-7-enoyl, n-C14:1) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Adenosine triphosphate > ADP + Hydrogen ion + PA(16:0/16:0)
Acetic acid + Adenosine triphosphate + Coenzyme A <> Acetyl-CoA + Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + Coenzyme A + Propionic acid > ADP + Phosphate + Propionyl-CoA
D-Allose + Adenosine triphosphate > ADP + D-Allose 6-phosphate + Hydrogen ion
Adenosine triphosphate + Ribose 1,5-bisphosphate <> ADP + Phosphoribosyl pyrophosphate
2 Adenosine triphosphate + Hydrogen ion > Diadenosine tetraphosphate + Pyrophosphate
L-alanine-D-glutamate-meso-2,6-diaminoheptanedioate + Adenosine triphosphate + UDP-N-Acetylmuraminate > ADP + Hydrogen ion + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
Adenosine triphosphate + Water + Magnesium > ADP + Hydrogen ion + Magnesium + Phosphate
Adenosine triphosphate + tRNA(Val) + L-Valine + tRNA(Val) <> Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val) + L-Valyl-tRNA(Val)
Adenosine triphosphate + Lipoic acid > Lipoyl-AMP + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Caprylic acid > Adenosine monophosphate + octanoate (protein bound) + Pyrophosphate
Adenosine triphosphate + Hydrogen ion + Water > Inosine triphosphate + Ammonium
Adenosine triphosphate + Water <> ADP + Phosphate
Adenosine triphosphate + Water <> Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate <> Cyclic AMP + Pyrophosphate
Adenosine triphosphate + NAD <> ADP + NADP
Adenosine triphosphate + Adenosine monophosphate <>2 ADP
Adenosine triphosphate + Dephospho-CoA <> ADP + Coenzyme A
Adenosine triphosphate + Nicotinamide ribotide <> Pyrophosphate + NAD
Adenosine triphosphate + Ammonia + Carbon dioxide <> ADP + Carbamoylphosphate
Adenosine triphosphate + Flavin Mononucleotide <> Pyrophosphate + FAD
Adenosine triphosphate + Pyridoxal <> ADP + Pyridoxal 5'-phosphate
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + Ammonia <> Adenosine monophosphate + Pyrophosphate + NAD
Adenosine triphosphate + Pyruvic acid + Water <> Adenosine monophosphate + Phosphoenolpyruvic acid + Phosphate
Adenosine triphosphate + Pyruvic acid <> ADP + Phosphoenolpyruvic acid
Adenosine triphosphate + L-Glutamate <> ADP + L-Glutamyl 5-phosphate + L-Glutamic acid 5-phosphate
Adenosine triphosphate + L-Glutamate + Ammonia <> ADP + Phosphate + L-Glutamine
Adenosine triphosphate + Guanosine triphosphate <> Adenosine monophosphate + Guanosine 3'-diphosphate 5'-triphosphate
Adenosine triphosphate + RNA + RNA <> Pyrophosphate + RNA
Adenosine triphosphate + L-Aspartic acid + Ammonia <> Adenosine monophosphate + Pyrophosphate + L-Asparagine
Adenosine triphosphate + gamma-Glutamylcysteine + Glycine <> ADP + Phosphate + Glutathione
Adenosine triphosphate + Adenosine phosphosulfate <> ADP + Phosphoadenosine phosphosulfate
Adenosine triphosphate + Cytidine <> ADP + Cytidine monophosphate
Adenosine triphosphate + Sulfate <> Pyrophosphate + Adenosine phosphosulfate
Adenosine triphosphate + Riboflavin <> ADP + Flavin Mononucleotide
Adenosine triphosphate + Uridine triphosphate + Ammonia <> ADP + Phosphate + Cytidine triphosphate
Adenosine triphosphate + Uridine triphosphate + L-Glutamine + Water <> ADP + Phosphate + Cytidine triphosphate + L-Glutamate
2 Adenosine triphosphate + L-Glutamine + Hydrogen carbonate + Water <>2 ADP + Phosphate + L-Glutamate + Carbamoylphosphate
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water <> Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Adenosine triphosphate + IDP <> ADP + Inosine triphosphate
Adenosine triphosphate + Acetyl-CoA + Hydrogen carbonate <> ADP + Phosphate + Malonyl-CoA
Adenosine triphosphate + Glycerol <> ADP + Glycerol 3-phosphate
Adenosine triphosphate + D-Fructose <> ADP + beta-D-Fructose 6-phosphate
Adenosine triphosphate + L-Glutamate + L-Cysteine <> ADP + Phosphate + gamma-Glutamylcysteine
Adenosine triphosphate + Tetrahydrofolic acid + L-Glutamate <> ADP + Phosphate + Tetrahydrofolyl-[Glu](2)
Adenosine triphosphate + Glucose 1-phosphate <> Pyrophosphate + ADP-Glucose
Adenosine triphosphate + Uridine <> ADP + Uridine 5'-monophosphate
Adenosine triphosphate + Dihydroxyacetone <> ADP + Dihydroxyacetone phosphate
Adenosine triphosphate + D-Ribose-5-phosphate <> Adenosine monophosphate + Phosphoribosyl pyrophosphate
Adenosine triphosphate + Ribose <> ADP + D-Ribose-5-phosphate
Adenosine triphosphate + Biotin <> Pyrophosphate + Biotinyl-5'-AMP
Adenosine triphosphate + D-Galactose <> ADP + Galactose 1-phosphate
Adenosine triphosphate + Inosine <> ADP + Inosinic acid
Adenosine triphosphate + 2 D-Alanine <> ADP + Phosphate + D-Alanyl-D-alanine
Adenosine triphosphate + N-Acetyl-D-glucosamine <> ADP + N-Acetyl-D-Glucosamine 6-Phosphate
Adenosine triphosphate + Guanosine <> ADP + Guanosine monophosphate
Adenosine triphosphate + Xanthylic acid + Ammonia <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Adenosine triphosphate + Palmitic acid + Coenzyme A <> Adenosine monophosphate + Palmityl-CoA + Pyrophosphate
Adenosine triphosphate + Carbamic acid <> ADP + Carbamoylphosphate
Adenosine triphosphate + Long-chain fatty acid + Acyl-carrier protein <> Adenosine monophosphate + Pyrophosphate + Acyl-[acyl-carrier protein]
Adenosine triphosphate + Cob(I)alamin <> Triphosphate + Adenosylcobalamin
Adenosine triphosphate + 3-Phospho-D-glycerate <> ADP + Glyceric acid 1,3-biphosphate + 3-phospho-D-glyceroyl phosphate
Adenosine triphosphate + Glyceric acid <> ADP + 3-Phospho-D-glycerate
Adenosine triphosphate + D-Ribulose 5-phosphate + D-Ribulose 5-phosphate <> ADP + D-Ribulose 1,5-bisphosphate
Adenosine triphosphate + D-Ribulose <> ADP + D-Ribulose 5-phosphate
Adenosine triphosphate + 2-Keto-3-deoxy-D-gluconic acid <> ADP + 2-Keto-3-deoxy-6-phosphogluconic acid
Adenosine triphosphate + Thymidine <> ADP + 5-Thymidylic acid
Adenosine triphosphate + b-D-Glucose <> ADP + beta-D-Glucose 6-phosphate
Adenosine triphosphate + D-Xylulose <> ADP + Xylulose 5-phosphate
Adenosine triphosphate + Gluconic acid <> ADP + 6-Phosphogluconic acid
Adenosine triphosphate + L-Homoserine <> ADP + O-Phosphohomoserine
Adenosine triphosphate + alpha-D-Glucose <> ADP + Glucose 6-phosphate
Adenosine triphosphate + dGDP <> ADP + dGTP
Adenosine triphosphate + L-Threo-2-pentulose <> ADP + L-Xylulose 5-phosphate
Adenosine triphosphate + Pyridoxine <> ADP + Pyridoxine 5'-phosphate
Adenosine triphosphate + Glutathione + Spermidine <> ADP + Phosphate + Glutathionylspermidine
Adenosine triphosphate + Citrulline + L-Aspartic acid <> Adenosine monophosphate + Pyrophosphate + Argininosuccinic acid
dATP + Thioredoxin disulfide + Water <> Adenosine triphosphate + Thioredoxin
Adenosine triphosphate + Fructose 1-phosphate <> ADP + beta-D-Fructose 1,6-bisphosphate
Adenosine triphosphate + 2'-Deoxyguanosine 5'-monophosphate <> ADP + dGDP
Adenosine triphosphate + dUMP <> ADP + dUDP
Adenosine triphosphate + Deoxyuridine <> ADP + dUMP
Adenosine triphosphate + Thiamine <> ADP + Thiamine monophosphate
Adenosine triphosphate + 7,8-Dihydropteroic acid + L-Glutamate <> ADP + Phosphate + Dihydrofolic acid
Adenosine triphosphate + 1,2-Diacyl-sn-glycerol + 1,2-Diacyl-sn-glycerol <> ADP + PA(16:0/16:0)
Adenosine triphosphate + dUDP <> ADP + Deoxyuridine triphosphate
Adenosine triphosphate + Shikimic acid <> ADP + Shikimate 3-phosphate
Adenosine triphosphate + L-Ribulose <> ADP + L-Ribulose 5-phosphate
Adenosine triphosphate + (R)-Pantoate + beta-Alanine <> Adenosine monophosphate + Pyrophosphate + Pantothenic acid
Adenosine triphosphate + Pyridoxamine <> ADP + Pyridoxamine 5'-phosphate
Adenosine triphosphate + N-Acetyl-L-alanine <> ADP + N-Acetyl-L-glutamyl 5-phosphate
Adenosine triphosphate + N-Acetylmannosamine <> ADP + N-Acetyl-D-mannosamine 6-phosphate
Deoxyribose 5-phosphate + ADP <> Deoxyribose + Adenosine triphosphate
Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanine + D-Glutamic acid <> ADP + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate
Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate + Meso-2,6-Diaminoheptanedioate <> ADP + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate
Adenosine triphosphate + L-Tyrosine + tRNA(Tyr) <> Adenosine monophosphate + Pyrophosphate + L-Tyrosyl-tRNA(Tyr)
Adenosine triphosphate + Pantetheine <> ADP + Pantetheine 4'-phosphate
Adenosine triphosphate + Nicotinamide ribotide <> Pyrophosphate + Nicotinic acid adenine dinucleotide
Adenosine triphosphate + L-Rhamnulose <> ADP + L-Rhamnulose 1-phosphate
Adenosine triphosphate + Pantothenic acid <> ADP + D-4'-Phosphopantothenate
Adenosine triphosphate + Pantetheine 4'-phosphate <> Pyrophosphate + Dephospho-CoA
Adenosine triphosphate + L-Alanine + tRNA(Ala) + tRNA(Ala) <> Adenosine monophosphate + Pyrophosphate + L-Alanyl-tRNA + L-Alanyl-tRNA
Adenosine triphosphate + 7,8-Diaminononanoate + Carbon dioxide <> ADP + Phosphate + Dethiobiotin
Adenosine triphosphate + UDP-N-Acetylmuraminate + L-Alanine <> ADP + Phosphate + UDP-N-Acetylmuramoyl-L-alanine
D-Tagatose 6-phosphate + Adenosine triphosphate <> D-Tagatose 1,6-bisphosphate + ADP
Adenosine triphosphate + L-Fuculose <> ADP + L-Fuculose 1-phosphate
Adenosine triphosphate + 2-Dehydro-3-deoxy-D-galactonate <> ADP + 2-Dehydro-3-deoxy-D-galactonate-6-phosphate
Adenosine triphosphate + 4-Amino-5-hydroxymethyl-2-methylpyrimidine <> ADP + 4-Amino-2-methyl-5-phosphomethylpyrimidine
Adenosine triphosphate + DIDP <> ADP + 2'-Deoxyinosine triphosphate
Adenosine triphosphate + Hydrogen selenide + Water <> Adenosine monophosphate + Phosphoroselenoic acid + Phosphate
Adenosine triphosphate + L-Arginine + tRNA(Arg) <> Adenosine monophosphate + Pyrophosphate + L-Arginyl-tRNA(Arg)
Adenosine triphosphate + L-Asparagine + tRNA(Asn) <> Adenosine monophosphate + Pyrophosphate + L-Asparaginyl-tRNA(Asn)
Adenosine triphosphate + L-Cysteine + tRNA(Cys) <> Adenosine monophosphate + Pyrophosphate + L-Cysteinyl-tRNA(Cys)
Adenosine triphosphate + L-Glutamine + tRNA(Gln) + tRNA(Gln) <> Adenosine monophosphate + Pyrophosphate + Glutaminyl-tRNA + Glutaminyl-tRNA
Adenosine triphosphate + Glycine + tRNA(Gly) <> Adenosine monophosphate + Pyrophosphate + Glycyl-tRNA(Gly)
Adenosine triphosphate + L-Histidine + tRNA(His) <> Adenosine monophosphate + Pyrophosphate + L-Histidyl-tRNA(His)
Adenosine triphosphate + L-Isoleucine + tRNA(Ile) <> Adenosine monophosphate + Pyrophosphate + L-Isoleucyl-tRNA(Ile)
Adenosine triphosphate + L-Leucine + tRNA(Leu) + tRNA(Leu) <> Adenosine monophosphate + Pyrophosphate + L-Leucyl-tRNA + L-Leucyl-tRNA
Adenosine triphosphate + L-Lysine + tRNA(Lys) + tRNA(Lys) <> Adenosine monophosphate + Pyrophosphate + L-Lysyl-tRNA + L-Lysyl-tRNA
Adenosine triphosphate + L-Methionine + tRNA(Met) + tRNA(Met) <> Adenosine monophosphate + Pyrophosphate + L-Methionyl-tRNA + L-Methionyl-tRNA
Adenosine triphosphate + L-Phenylalanine + tRNA(Phe) <> Adenosine monophosphate + Pyrophosphate + L-Phenylalanyl-tRNA(Phe)
Adenosine triphosphate + L-Proline + tRNA(Pro) <> Adenosine monophosphate + Pyrophosphate + L-Prolyl-tRNA(Pro)
Adenosine triphosphate + L-Serine + tRNA(Ser) <> Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser)
Adenosine triphosphate + L-Threonine + tRNA(Thr) <> Adenosine monophosphate + Pyrophosphate + L-Threonyl-tRNA(Thr)
Adenosine triphosphate + L-Tryptophan + tRNA(Trp) <> Adenosine monophosphate + Pyrophosphate + L-Tryptophanyl-tRNA(Trp)
Adenosine triphosphate + L-Valine + tRNA(Val) <> Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val)
Adenosine triphosphate + beta-D-Fructose <> ADP + beta-D-Fructose 6-phosphate
Adenosine triphosphate + 5-Phosphoribosylamine + Glycine <> ADP + Phosphate + Glycineamideribotide
Adenosine triphosphate + Phosphoribosylformylglycineamidine <> ADP + Phosphate + 5-Aminoimidazole ribonucleotide
Adenosine triphosphate + D-4'-Phosphopantothenate + L-Cysteine <> Adenosine monophosphate + Pyrophosphate + 4-Phosphopantothenoylcysteine
Adenosine triphosphate + Holo-[carboxylase] + Hydrogen carbonate + Holo-[carboxylase] <> ADP + Phosphate + Carboxybiotin-carboxyl-carrier protein + Carboxybiotin-carboxyl-carrier protein
Adenosine triphosphate + D-Pantothenoyl-L-cysteine <> ADP + 4-Phosphopantothenoylcysteine
Adenosine triphosphate + 5-(2-Hydroxyethyl)-4-methylthiazole <> ADP + 4-Methyl-5-(2-phosphoethyl)-thiazole
Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide + L-Glutamine + Water <> ADP + Phosphate + Phosphoribosylformylglycineamidine + L-Glutamate
Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-gamma-D-glutamyl-L-lysine + D-Alanyl-D-alanine <> ADP + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine
Adenosine triphosphate + 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid <> ADP + Phosphate + SAICAR
Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + D-Alanyl-D-alanine <> ADP + Phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-6-carboxy-L-lysyl-D-alanyl-D-alanine
Adenosine triphosphate + 2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate <> ADP + 2,3,2'3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1,4'-bisphosphate
Adenosine triphosphate + beta-D-Fructose 6-phosphate <> ADP + beta-D-Fructose 1,6-bisphosphate
Adenosine triphosphate + Adenylylselenate <> ADP + 3'-Phosphoadenylylselenate
Adenosine triphosphate + Selenate <> Pyrophosphate + Adenylylselenate
Adenosine triphosphate + Nitrogen + 6 Reduced flavodoxin + Water <> Phosphate + ADP +6 Oxidized flavodoxin +2 Ammonia
Cob(I)yrinate a,c diamide + Adenosine triphosphate <> Adenosyl cobyrinate a,c diamide + Triphosphate
Adenosyl cobinamide + Adenosine triphosphate <> Adenosyl cobinamide phosphate + ADP
tRNA(Asp) + L-Aspartic acid + Adenosine triphosphate <> L-Aspartyl-tRNA(Asp) + Pyrophosphate + Adenosine monophosphate
tRNA(Glu) + L-Glutamate + Adenosine triphosphate + tRNA(Glu) <> L-Glutamyl-tRNA(Glu) + Pyrophosphate + Adenosine monophosphate + L-Glutamyl-tRNA(Glu)
4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate <> 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP
Adenosine triphosphate + D-Glycero-D-manno-heptose 1-phosphate <> Pyrophosphate + ADP-D-Glycero-D-manno-heptose
Adenosine triphosphate + D-glycero-beta-D-manno-Heptose 7-phosphate + D-glycero-beta-D-manno-heptose 7-phosphate <> ADP + D-Glycero-D-manno-heptose 1,7-bisphosphate
3-Dehydro-L-gulonate + Adenosine triphosphate <> 3-Dehydro-L-gulonate 6-phosphate + ADP
Adenosine triphosphate + Cobinamide <> Triphosphate + Adenosyl cobinamide
Adenosine triphosphate + 5-Aminoimidazole ribonucleotide + Hydrogen carbonate <> ADP + Phosphate + 5-Carboxyamino-1-(5-phospho-D-ribosyl)imidazole + 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole
Adenosine triphosphate + L-Glutamate + Putrescine <> ADP + Phosphate + gamma-Glutamyl-L-putrescine
C15810 + Adenosine triphosphate <> C15813 + Pyrophosphate
Fructoselysine + Adenosine triphosphate <> Fructoselysine 6-phosphate + ADP
Adenosine triphosphate + L-Serine + tRNA(Sec) <> Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Sec)
5-Fluorouridine + Adenosine triphosphate <> 5-Fluorouridine monophosphate + ADP
5-Fluorodeoxyuridine + Adenosine triphosphate <> 5-Fluorodeoxyuridine monophosphate + ADP
6-Thioxanthine 5'-monophosphate + Adenosine triphosphate + L-Glutamine + Water <> 6-Thioguanosine monophosphate + Adenosine monophosphate + Pyrophosphate + L-Glutamate
tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate <> tRNA with a 3' CCA end +3 Pyrophosphate
tRNA with a 3' CC end + Adenosine triphosphate <> tRNA with a 3' CCA end + Pyrophosphate
[tRNA(Ile2)]-cytidine34 + L-Lysine + Adenosine triphosphate <> [tRNA(Ile2)]-lysidine34 + Adenosine monophosphate + Pyrophosphate + Water
Adenosine triphosphate + Molybdopterin <> Pyrophosphate + Adenylated molybdopterin
Adenosine triphosphate + an aliphatic sulfonate + Water > an aliphatic sulfonate + ADP + Phosphate + Hydrogen ion
D-Ribulose + Adenosine triphosphate > Hydrogen ion + D-Ribulose-1-phosphate + ADP
Adenosine triphosphate + L-Serine <> Pyrophosphate + L-Seryl-AMP
Hydrogen ion + L-Glutamate + Adenosine triphosphate + NADPH > ADP + L-Glutamic-gamma-semialdehyde + NADP + Phosphate
Ribose-1-phosphate + Adenosine triphosphate > Hydrogen ion + Ribose 1,5-bisphosphate + ADP
a tRNA uridine<sup>34</sup> + a [TusE sulfur carrier protein]-<i>S</i>-sulfanylcysteine + Adenosine triphosphate > a tRNA 2-thiouridine<sup>34</sup> + a [TusE sulfur carrier protein]-L-cysteine + Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate ADP + Phosphate
an L-1-phosphatidyl-glycerol + Adenosine triphosphate > an L-1-phosphatidylglycerol-phosphate + ADP + Hydrogen ion
Methylphosphonate + Adenosine triphosphate > &alpha;-D-ribose-1-methylphosphonate-5-triphosphate + Adenine
&beta;-D-galactofuranose + Adenosine triphosphate + Water > &beta;-D-galactofuranose + ADP + Phosphate + Hydrogen ion
a lipopolysaccharide + Water + Adenosine triphosphate > a lipopolysaccharide + Phosphate + ADP + Hydrogen ion
Hydrogen ion + Water + Adenosine triphosphate <> Hydrogen ion + Phosphate + ADP
Water + a macrolide antibiotic + Adenosine triphosphate > a macrolide antibiotic + Phosphate + ADP
4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate > Hydrogen ion + 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP
Adenosine triphosphate + a [protein]-L-tyrosine > ADP + a protein-L-tyrosine phosphate + Hydrogen ion
Hydrogen ion + Nicotinamide ribotide + Adenosine triphosphate <> NAD + Pyrophosphate
Hydrogen ion + Dephospho-CoA + Adenosine triphosphate > 2'-(5-Triphosphoribosyl)-3'-dephospho-CoA + Adenine
Water + Selenium + Adenosine triphosphate > Phosphate + Selenophosphate + Adenosine monophosphate
Adenosine triphosphate + DNA<sub><i>n</i></sub> ADP + Phosphate
N5-Formyl-H4F + Adenosine triphosphate > 5,10-Methenyltetrahydrofolate + ADP + Phosphate
Ni<SUP>2+</SUP> + Adenosine triphosphate + Water > Ni<SUP>2+</SUP> + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + Water + an alkylphosphonate > ADP + Phosphate + an alkylphosphonate + Hydrogen ion
Adenosine triphosphate + beta-D-Ribopyranose + Water > ADP + Phosphate + beta-D-Ribopyranose + Hydrogen ion
Adenosine triphosphate + a dipeptide + Water > ADP + Phosphate + a dipeptide + Hydrogen ion
Adenosine triphosphate + Fe(III)dicitrate + Water > ADP + Phosphate + Fe(III)dicitrate + Hydrogen ion
<i>N</i>-acetyl-L-glutamate + Adenosine triphosphate > N-Acetyl-L-glutamyl 5-phosphate + ADP
a 2,3,4-saturated fatty acid + Coenzyme A + Adenosine triphosphate > a 2,3,4-saturated fatty acyl CoA + Pyrophosphate + Adenosine monophosphate
L-Aspartic acid + Citrulline + Adenosine triphosphate > Hydrogen ion + L-arginino-succinate + Pyrophosphate + Adenosine monophosphate
Cob(I)yrinate a,c diamide + Adenosine triphosphate > Adenosyl cobinamide + Triphosphate
Ammonia + Carbon dioxide + Adenosine triphosphate < Hydrogen ion + Carbamoylphosphate + ADP
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate > Hydrogen ion + 2-Dehydro-3-deoxy-D-galactonate-6-phosphate + ADP
2-Keto-3-deoxy-D-gluconic acid + Adenosine triphosphate > Hydrogen ion + 2-Keto-3-deoxy-6-phosphogluconic acid + ADP
Dephospho-CoA + Adenosine triphosphate > Hydrogen ion + Coenzyme A + ADP
Carbon dioxide + 7,8-Diaminononanoate + Adenosine triphosphate > Hydrogen ion + Dethiobiotin + Phosphate + ADP
Hydrogen ion + Adenosine triphosphate + 2-Pyrocatechuic acid > Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
Adenosine triphosphate + a 1,2-diacylglycerol <> Hydrogen ion + PA(16:0/16:0) + ADP
L-Glutamate + 7,8-Dihydropteroic acid + Adenosine triphosphate > Hydrogen ion + Dihydrofolic acid + Phosphate + ADP
Adenosine triphosphate + L-Serine + 2-Pyrocatechuic acid > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Enterochelin
a tetrahydrofolate-glutamate + L-Glutamate + Adenosine triphosphate > a tetrahydrofolate-glutamate + Phosphate + ADP
Adenosine triphosphate + Formic acid + Tetrahydrofolic acid > ADP + Phosphate + N10-Formyl-THF
an <i>N</i><sup>10</sup>-formyl-tetrahydrofolate + L-Glutamate + Adenosine triphosphate > an <i>N</i><sup>10</sup>-formyl-tetrahydrofolate + ADP + Phosphate
D-Galactose + Adenosine triphosphate > Hydrogen ion + Galactose 1-phosphate + ADP
Adenosine triphosphate + Guanosine diphosphate > Adenosine monophosphate + Guanosine 3',5'-bis(diphosphate)
b-D-Glucose + Adenosine triphosphate > Hydrogen ion + Glucose 6-phosphate + ADP
Adenosine triphosphate + Xanthylic acid + Ammonia > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate
Coenzyme A + Carnitine + Adenosine triphosphate > L-Carnitinyl-CoA + Adenosine monophosphate + Pyrophosphate
L-xylulose + Adenosine triphosphate > Hydrogen ion + L-Xylulose 5-phosphate + ADP
D-Mannose + Adenosine triphosphate > Hydrogen ion + Mannose 6-phosphate + ADP
Adenosine triphosphate + Nicotinic acid adenine dinucleotide + L-Glutamine + Water > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD + L-Glutamate
a ribonucleoside diphosphate + Adenosine triphosphate > a ribonucleoside triphosphate + ADP
Adenosine triphosphate + 4-Amino-5-hydroxymethyl-2-methylpyrimidine <> Hydrogen ion + ADP + 4-Amino-2-methyl-5-phosphomethylpyrimidine
Coenzyme A + phenylacetate + Adenosine triphosphate > Phenylacetyl-CoA + Pyrophosphate + Adenosine monophosphate
Adenosine triphosphate + Pyridoxine > Hydrogen ion + ADP + Pyridoxine 5'-phosphate
Adenosine triphosphate + long chain polyphosphate <> ADP + long chain polyphosphate
Coenzyme A + Propionic acid + Adenosine triphosphate > Propionyl-CoA + Pyrophosphate + Adenosine monophosphate
Adenosine triphosphate + Hydrogen carbonate + Propionyl-CoA > Hydrogen ion + ADP + Phosphate + (S)-Methylmalonyl-CoA
Adenosine triphosphate + Propionic acid <> ADP + Propanoyl phosphate
Adenosine triphosphate + D-Ribose-5-phosphate <> Hydrogen ion + Phosphoribosyl pyrophosphate + Adenosine monophosphate
Pseudouridine + Adenosine triphosphate > Hydrogen ion + Pseudouridine 5'-phosphate + ADP
Adenosine triphosphate + Pyridoxamine <> Hydrogen ion + ADP + Pyridoxamine 5'-phosphate
D-ribose + Adenosine triphosphate > Hydrogen ion + D-Ribose-5-phosphate + ADP
Nicotinamide riboside + Adenosine triphosphate > Hydrogen ion + Nicotinamide ribotide + ADP
7-carboxy-7-deazaguanine + Ammonia + Adenosine triphosphate > 7-Cyano-7-carbaguanine + ADP + Phosphate + Water
Adenosine triphosphate + Hydrogen carbonate + Ammonia > ADP + Phosphate + Carbamoylphosphate + Hydrogen ion
a quaternary amine + Water + Adenosine triphosphate > a quaternary amine + Phosphate + ADP + Hydrogen ion
Hydrogen ion + Lipoic acid + Adenosine triphosphate > Lipoyl-AMP + Pyrophosphate
UDP-N-Acetylmuraminate + L-Ala-D-Glu-meso-A2pm + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + ADP + Phosphate
a 5,10-methylene-tetrahydrofolate + L-Glutamate + Adenosine triphosphate > a 5,10-methylene-tetrahydrofolate + Phosphate + ADP
Adenosine triphosphate + 1-Deoxy-D-xylulose > Hydrogen ion + 1-Deoxy-D-xylulose 5-phosphate + ADP
Putrescine + L-Glutamate + Adenosine triphosphate > Hydrogen ion + gamma-Glutamyl-L-putrescine + ADP + Phosphate
D-Glycero-D-manno-heptose 7-phosphate + Adenosine triphosphate > Hydrogen ion + D-Glycero-D-manno-heptose 1,7-bisphosphate + ADP
Hydrogen ion + D-<i>glycero</i>-&beta;-D-<i>manno</i>-heptose 1-phosphate + Adenosine triphosphate > ADP-D-Glycero-D-manno-heptose + Pyrophosphate
1,6-Anhydro-N-acetylmuramate + Adenosine triphosphate + Water > Hydrogen ion + N-Acetylmuramic acid 6-phosphate + ADP
Glucosyl-heptosyl2-KDO2-lipid A + Adenosine triphosphate > Hydrogen ion + Glucosyl-heptosyl2-KDO2-lipid A-phosphate + ADP
Glucosyl-heptosyl3-KDO2-lipid A-phosphate + Adenosine triphosphate > Hydrogen ion + Glucosyl-heptosyl3-KDO2-lipid A-bisphosphate + ADP
Hydrogen ion + Adenosine triphosphate + Adenosine triphosphate Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + Adenosine triphosphate Diadenosine tetraphosphate + Pyrophosphate
Hydrogen ion + Adenosine triphosphate + ADP > Diadenosine triphosphate + Pyrophosphate
4-Hydroxy-L-threonine + Adenosine triphosphate > Hydrogen ion + O-Phospho-4-hydroxy-L-threonine + ADP
a [protein] &alpha;-L-glutamate + L-Glutamate + Adenosine triphosphate a [protein] &alpha;-L-glu-&alpha;-L-glu + ADP + Phosphate
5-Aminoimidazole ribonucleotide + Adenosine triphosphate + Hydrogen carbonate > Hydrogen ion + N5-Carboxyaminoimidazole ribonucleotide + ADP + Phosphate
Hydrogen ion + Sulfate + Adenosine triphosphate > Adenosine phosphosulfate + Pyrophosphate
2,3,2',3'-Tetrakis(3-hydroxytetradecanoyl)-D-glucosaminyl-1,6-beta-D-glucosamine 1-phosphate + Adenosine triphosphate <> Hydrogen ion + lipid IV<sub>A</sub> + ADP
Adenosine triphosphate + 5-(2-Hydroxyethyl)-4-methylthiazole > Hydrogen ion + ADP + 4-Methyl-5-(2-phosphoethyl)-thiazole
Adenosine triphosphate + Arsenate + Water > ADP + Arsenate + Phosphate + Hydrogen ion
Cu<SUP>+</SUP> + Water + Adenosine triphosphate > Cu<SUP>+</SUP> + Phosphate + ADP + Hydrogen ion
Adenosine triphosphate + Water + N-Acetyl-D-glucosamine > N-Acetyl-D-glucosamine + ADP + Phosphate + Hydrogen ion
Adenosine triphosphate + L-Ala-D-Glu-meso-A2pm + Water > L-Ala-D-Glu-meso-A2pm + ADP + Phosphate + Hydrogen ion
(2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine triphosphate + Water > (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran + ADP + Phosphate + Hydrogen ion
selenate + Water + Adenosine triphosphate > selenate + ADP + Phosphate + Hydrogen ion
Selenite + Water + Adenosine triphosphate > Selenite + ADP + Phosphate + Hydrogen ion
&alpha;-D-galactofuranose + Adenosine triphosphate + Water > &alpha;-D-galactofuranose + Phosphate + ADP + Hydrogen ion
<i>meso</i>-diaminopimelate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate + Adenosine triphosphate > Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminoheptanedioate + Phosphate + ADP
Adenosine triphosphate + an acid + [acyl-carrier-protein] > Adenosine monophosphate + Pyrophosphate + acyl-[acyl-carrier-protein]
Adenosine triphosphate + Acetyl-CoA + Carbonic acid > ADP + Inorganic phosphate + Malonyl-CoA
Adenosine triphosphate + biotin-[carboxyl-carrier-protein] + Carbon dioxide > ADP + Inorganic phosphate + carboxy-biotin-[carboxyl-carrier-protein]
Adenosine triphosphate + [isocitrate dehydrogenase (NADP(+))] > ADP + [isocitrate dehydrogenase (NADP(+))] phosphate
Adenosine triphosphate + Water + monosaccharide(Out) > ADP + Inorganic phosphate + monosaccharide(In)
Adenosine triphosphate + D-Allose > ADP + D-Allose 6-phosphate
Adenosine triphosphate + 1,6-Anhydro-N-acetyl-beta-muramate + Water > ADP + N-Acetylmuramic acid 6-phosphate
Adenosine triphosphate + L(or D)-ribulose > ADP + L(or D)-ribulose 5-phosphate
Adenosine triphosphate + protein L-histidine > ADP + protein N-phospho-L-histidine
Adenosine triphosphate + Water + K(+)(Out) > ADP + Inorganic phosphate + K(+)(In)
Adenosine triphosphate + Water + Mg(2+)(Out) > ADP + Inorganic phosphate + Mg(2+)(In)
Adenosine triphosphate + Water + H(+)(In) > ADP + Inorganic phosphate + H(+)(Out)
Adenosine triphosphate + Water + Cd(2+)(In) > ADP + Inorganic phosphate + Cd(2+)(Out)
Adenosine triphosphate + Water + Zn(2+)(In) > ADP + Inorganic phosphate + Zn(2+)(Out)
Adenosine triphosphate + 7,8-Diaminononanoate + Carbon dioxide > ADP + Inorganic phosphate + Dethiobiotin
Adenosine triphosphate + Biotin + apo-[acetyl-CoA:carbon-dioxide ligase (ADP-forming)] > Adenosine monophosphate + Pyrophosphate + [acetyl-CoA:carbon-dioxide ligase (ADP-forming)]
Adenosine triphosphate + Water + vitamin B12(Out) > ADP + Inorganic phosphate + vitamin B12(In)
Adenosine triphosphate + Cob(I)yrinate a,c diamide > Triphosphate + Adenosylcob(III)yrinic acid a,c-diamide
2 Adenosine triphosphate + L-Glutamine + Carbonic acid + Water >2 ADP + Inorganic phosphate + L-Glutamate + Carbamoylphosphate
A tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate > a tRNA with a 3' CCA end +3 Pyrophosphate
Adenosine triphosphate + Water + heme(In) > ADP + Inorganic phosphate + heme(Out)
Adenosine triphosphate + Acetic acid + [citrate (pro-3S)-lyase](thiol form) > Adenosine monophosphate + Pyrophosphate + [citrate (pro-3S)-lyase](acetyl form)
Adenosine triphosphate + pantotheine 4'-phosphate > Pyrophosphate + 3'-dephospho-CoA
Adenosine triphosphate + Water + Cu(+)(In) > ADP + Inorganic phosphate + Cu(+)(Out)
Adenosine triphosphate + Water + sulfate(Out) > ADP + Inorganic phosphate + sulfate(In)
Adenosine triphosphate + Water > ADP + Inorganic phosphate
Adenosine triphosphate + 2 D-Alanine > ADP + Inorganic phosphate + D-Alanyl-D-alanine
Adenosine triphosphate + 2-Dehydro-3-deoxy-D-galactonate > ADP + 2-Dehydro-3-deoxy-D-galactonate 6-phosphate
Adenosine triphosphate + 2-Pyrocatechuic acid > Pyrophosphate + (2,3-Dihydroxybenzoyl)adenylic acid
Adenosine triphosphate + a [protein]-L-tyrosine > ADP + a [protein]-L-tyrosine phosphate
Adenosine triphosphate + Water + Fe(3+)(Out) > ADP + Inorganic phosphate + Fe(3+)(In)
Adenosine triphosphate + Water + iron chelate(Out) > ADP + Inorganic phosphate + iron chelate(In)
Adenosine triphosphate + [protein] > Pyrophosphate + [protein]-AMP
Adenosine triphosphate + tetrahydropteroyl-(gamma-Glu)(n) + L-Glutamate > ADP + Inorganic phosphate + tetrahydropteroyl-(gamma-Glu)(n+1)
Adenosine triphosphate + 7,8-Dihydropteroic acid + L-Glutamate > ADP + Inorganic phosphate + Dihydrofolic acid
Adenosine triphosphate + Fructoselysine > ADP + Fructoselysine-6-phosphate
Adenosine triphosphate + D-Glucose > ADP + Glucose 6-phosphate
Adenosine triphosphate + L-Glutamate + Ammonia > ADP + Inorganic phosphate + L-Glutamine
Adenosine triphosphate + [L-glutamate:ammonia ligase (ADP-forming)] > Pyrophosphate + adenylyl-[L-glutamate:ammonia ligase (ADP-forming)]
Adenosine triphosphate + Glyceric acid > ADP + 2-Phospho-D-glyceric acid
Adenosine triphosphate + L-Glutamate + L-Cysteine > ADP + Inorganic phosphate + gamma-Glutamylcysteine
Adenosine triphosphate + gamma-Glutamylcysteine + Glycine > ADP + Inorganic phosphate + Glutathione
Glutathione + Spermidine + Adenosine triphosphate > Glutathionylspermidine + ADP + Inorganic phosphate
Adenosine triphosphate + a protein > ADP + a phosphoprotein
Adenosine triphosphate + Fructose 1-phosphate > ADP + Fructose 1,6-bisphosphate
Adenosine triphosphate + Fructose 6-phosphate > ADP + Fructose 1,6-bisphosphate
Adenosine triphosphate + 1,2-diacylglycerol > ADP + 1,2-diacyl-sn-glycerol 3-phosphate
Adenosine triphosphate + D-Ribulose 5-phosphate > ADP + D-Ribulose 1,5-bisphosphate
Adenosine triphosphate + lipoate > Pyrophosphate + Lipoyl-AMP
Adenosine triphosphate + D-Fructose > ADP + Fructose 6-phosphate
Adenosine triphosphate + Water + D-Maltose > ADP + Inorganic phosphate + D-Maltose
Adenosine triphosphate + Water + xenobiotic(In) > ADP + Inorganic phosphate + xenobiotic(Out)
Adenosine triphosphate + Water + Molybdate > ADP + Inorganic phosphate + Molybdate
Adenosine triphosphate + [molybdopterin-synthase sulfur-carrier protein]-Gly-Gly > Pyrophosphate + [molybdopterin-synthase sulfur-carrier protein]-Gly-Gly-AMP
Adenosine triphosphate + UDP-N-Acetylmuraminate + L-Alanine > ADP + Inorganic phosphate + UDP-N-Acetylmuramoyl-L-alanine
Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-gamma-D-glutamyl-L-lysine + D-Alanyl-D-alanine > ADP + Inorganic phosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-D-alanyl-D-alanine
Adenosine triphosphate + NMN > Pyrophosphate + NAD
Adenosine triphosphate + Nicotinamide riboside > ADP + NMN
Adenosine triphosphate + N-Acetylglucosamine > ADP + N-Acetyl-D-Glucosamine 6-Phosphate
Adenosine triphosphate + nucleoside diphosphate > ADP + nucleoside triphosphate
Adenosine triphosphate + Water + Ni(2+)(Out) > ADP + Inorganic phosphate + Ni(2+)(In)
Adenosine triphosphate + Water + Nickel > ADP + Inorganic phosphate + Nickel
Adenosine triphosphate + RNA(n) > Pyrophosphate + RNA(n+1)
Adenosine triphosphate + 3-Phospho-D-glycerate > ADP + 3-phospho-D-glyceroyl phosphate
Adenosine triphosphate + Water + phosphonate(Out) > ADP + Inorganic phosphate + phosphonate(In)
Adenosine triphosphate + Water + polyamine(Out) > ADP + Inorganic phosphate + polyamine(In)
Adenosine triphosphate + (phosphate)(n) > ADP + (phosphate)(n+1)
Adenosine triphosphate + Pyruvic acid + Water > Adenosine monophosphate + Phosphoenolpyruvic acid + Inorganic phosphate
Adenosine triphosphate + Water + phosphate(Out) > ADP + Inorganic phosphate + phosphate(In)
Adenosine triphosphate + Pseudouridine > ADP + Pseudouridine 5'-phosphate
Adenosine triphosphate + 5-Phosphoribosylamine + Glycine > ADP + Inorganic phosphate + 5'-Phospho-ribosylglycinamide
Adenosine triphosphate + 2-(Formamido)-N(1)-(5-phospho-D-ribosyl)acetamidine > ADP + Inorganic phosphate + 5-Aminoimidazole ribonucleotide
Adenosine triphosphate + 5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid > ADP + Inorganic phosphate + SAICAR
Adenosine triphosphate + 5-Aminoimidazole ribonucleotide + Carbonic acid > ADP + Inorganic phosphate + 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole
Formic acid + Adenosine triphosphate + 5'-Phospho-ribosylglycinamide > 5'-Phosphoribosyl-N-formylglycineamide + ADP + Pyrophosphate
Adenosine triphosphate + L-Glutamate + Putrescine > ADP + Inorganic phosphate + gamma-Glutamyl-L-putrescine
Adenosine triphosphate + Uridine triphosphate + Ammonia > ADP + Inorganic phosphate + Cytidine triphosphate
7-Deaza-7-carboxyguanine + Ammonia + Adenosine triphosphate > 7-Cyano-7-carbaguanine + ADP + Inorganic phosphate + Water
Adenosine triphosphate + RNA 3'-terminal-phosphate > Adenosine monophosphate + Pyrophosphate + RNA terminal-2',3'-cyclic-phosphate
Adenosine triphosphate + Hydrogen selenide + Water > Adenosine monophosphate + Phosphoroselenoic acid + Inorganic phosphate
Adenosine triphosphate + L-Glutamate + tRNA(Glu) > Adenosine monophosphate + Pyrophosphate + L-glutamyl-tRNA(Glu)
Adenosine triphosphate + L-Lysine + tRNA(Lys) > Adenosine monophosphate + Pyrophosphate + L-lysyl-tRNA(Lys)
Adenosine triphosphate + L-Methionine + tRNA(Met) > Adenosine monophosphate + Pyrophosphate + L-methionyl-tRNA(Met)
Adenosine triphosphate + L-Tryptophan + tRNA(Trp) > Adenosine monophosphate + Pyrophosphate + L-tryptophyl-tRNA(Trp)
Adenosine triphosphate + Water + Taurine > ADP + Inorganic phosphate + Taurine
Adenosine triphosphate + [ThiS] > Pyrophosphate + adenylyl-[ThiS]
(tRNA(Ile2))-cytidine(34) + L-Lysine + Adenosine triphosphate > (tRNA(Ile2))-lysidine(34) + Adenosine monophosphate + Pyrophosphate + Water
Adenosine triphosphate + Water + Glycerol 3-phosphate > ADP + Inorganic phosphate + Glycerol 3-phosphate
Adenosine triphosphate + Uridine triphosphate + L-Glutamine + Water + Ammonia <> ADP + Phosphate + Cytidine triphosphate + L-Glutamate
2 Adenosine triphosphate + L-Glutamine + Hydrogen carbonate + Water + Ammonia + Carbamic acid + Carboxyphosphate <>2 ADP + Phosphate + L-Glutamate + Carbamoylphosphate
Adenosine triphosphate + dCMP + Uridine 5'-monophosphate <> ADP + dCDP + Uridine 5'-diphosphate
Adenosine triphosphate + Polyphosphate <> ADP
tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate + tRNA with a 3' cytidine + tRNA with a 3' CC end <> tRNA with a 3' CCA end +3 Pyrophosphate
Adenosine triphosphate + [Isocitrate dehydrogenase (NADP+)] <> ADP + [Isocitrate dehydrogenase (NADP+)] phosphate
Adenosine triphosphate + L-Ribulose + D-Ribulose <> ADP + L-Ribulose 5-phosphate + D-Ribulose 5-phosphate
7-Deaza-7-carboxyguanine + Ammonia + Adenosine triphosphate <> 7-Cyano-7-carbaguanine + ADP + Phosphate + Water
Adenosine triphosphate + Acetic acid + Citrate (pro-3S)-lyase (thiol form) <> Adenosine monophosphate + Pyrophosphate + Citrate (pro-3S)-lyase (acetyl form)
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water + Ammonia <> Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamate
Adenosine triphosphate + Cob(I)yrinate a,c diamide + Cobinamide <> Triphosphate + Adenosyl cobyrinate a,c diamide + Adenosyl cobinamide
Adenosine triphosphate + Protein <> ADP + Phosphoprotein
Adenosine triphosphate + Long-chain fatty acid + Coenzyme A <> Adenosine monophosphate + Pyrophosphate + Acyl-CoA
Adenosine triphosphate + Guanosine triphosphate + Adenosyl cobinamide <> Adenosyl cobinamide phosphate + ADP + Guanosine diphosphate
Adenosine triphosphate + Xanthylic acid + L-Glutamine + Water + Ammonia <> Adenosine monophosphate + Pyrophosphate + Guanosine monophosphate + L-Glutamate
Adenosine triphosphate + NDP <> ADP + Nucleoside triphosphate
Adenosine triphosphate <> Pyrophosphate
Adenosine triphosphate + N-Acyl-D-mannosamine <> ADP + N-Acyl-D-mannosamine 6-phosphate
L-Threonine + Adenosine triphosphate + Hydrogen carbonate <> L-Threonylcarbamoyladenylate + Pyrophosphate + Water
Adenosine triphosphate + RNA <> Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + Methylphosphonate <> alpha-D-Ribose 1-methylphosphonate 5-triphosphate + Adenine
Adenosine triphosphate + lipoate + Lipoyl-AMP + Apoprotein <> Pyrophosphate + Protein N6-(lipoyl)lysine + Adenosine monophosphate
Adenosine triphosphate + THF-polyglutamate + L-Glutamate <> ADP + Phosphate
Pyridoxine + Adenosine triphosphate > Pyridoxine 5'-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
Pyridoxal + Adenosine triphosphate > Pyridoxal 5'-phosphate + Adenosine diphosphate + ADP
Pyridoxamine + Adenosine triphosphate > Pyridoxamine 5'-phosphate + Adenosine diphosphate + ADP
Thiamine monophosphate + Adenosine triphosphate + Thiamine monophosphate > Thiamine pyrophosphate + Adenosine diphosphate + ADP
Ammonia + L-Glutamic acid + Adenosine triphosphate + Oxoglutaric acid + L-Glutamate <> Phosphate + L-Glutamine + Adenosine diphosphate + ADP
L-Glutamic acid + Adenosine triphosphate + Ammonium + L-Glutamate > L-Glutamine + Hydrogen ion + Adenosine diphosphate + Phosphate + ADP
Palmitic acid + Adenosine triphosphate + Coenzyme A > Palmityl-CoA + Adenosine monophosphate + Pyrophosphate
Adenosine triphosphate + Biotin > Biotinyl-5'-AMP + Pyrophosphate
7,8-Diaminononanoate + Adenosine triphosphate + Carbon dioxide + 7,8-Diaminononanoate > Dethiobiotin + Adenosine diphosphate + Phosphate + ADP
Biotin + Adenosine triphosphate > diphosphate + Biotinyl-5'-AMP + Pyrophosphate
2 D-Alanine + Adenosine triphosphate > D-Alanyl-D-alanine + Adenosine diphosphate + Phosphate + ADP
UDP-N-acetylmuraminate + Adenosine triphosphate + L-Alanine + UDP-N-Acetylmuraminate + L-Alanine > UDP-N-Acetylmuramoyl-L-alanine + Adenosine diphosphate + Phosphate + ADP
UDP-N-Acetylmuramoyl-L-alanine + Adenosine triphosphate + D-Glutamic acid > Adenosine diphosphate + Phosphate + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate + ADP + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate
lipoate + Adenosine triphosphate > Lipoyl-AMP + Pyrophosphate + Lipoyl-AMP
(R)-lipoic acid + Adenosine triphosphate + Hydrogen ion + Lipoic acid > Pyrophosphate + Lipoyl-AMP + Lipoyl-AMP
Caprylic acid + Adenosine triphosphate + a [lipoyl-carrier protein]-L-lysine > Hydrogen ion + Pyrophosphate + Adenosine monophosphate + Protein N6-(octanoyl)lysine
L-Aspartic acid + Adenosine triphosphate + L-Aspartic acid > Adenosine diphosphate + L-Aspartyl-4-phosphate + ADP
N1-(5-phospho-β-D-ribosyl)glycinamide + Adenosine triphosphate + Formic acid > 5'-Phosphoribosyl-N-formylglycinamide + Adenosine diphosphate + Phosphate + Hydrogen ion + 5'-Phosphoribosyl-N-formylglycineamide + ADP
Adenosine triphosphate + Itaconic acid + Coenzyme A > Adenosine diphosphate + Phosphate + Itaconyl-CoA + ADP
Adenosine triphosphate + Pyruvic acid + Hydrogen carbonate > Adenosine diphosphate + Phosphate + Oxalacetic acid + ADP
Adenosine triphosphate + L-Alanine + tRNA(Ala) + L-Alanine > Adenosine monophosphate + Pyrophosphate + L-alanyl-tRNA(Ala)
Succinyl-CoA + Adenosine diphosphate + Phosphate + Succinyl-CoA + ADP > Adenosine triphosphate + Coenzyme A + Succinic acid
Fructose 6-phosphate + Adenosine triphosphate + Fructose 6-phosphate > Fructose 1,6-bisphosphate + Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP
Glyceric acid 1,3-biphosphate + Adenosine diphosphate + Glyceric acid 1,3-biphosphate + ADP > Adenosine triphosphate + 3-Phosphoglyceric acid + 3-Phosphoglycerate
3-Phosphoglyceric acid + Adenosine triphosphate + 3-Phosphoglycerate > 3-phospho-D-glyceroyl phosphate + Adenosine diphosphate + ADP
Phosphoenolpyruvic acid + Adenosine diphosphate + Hydrogen ion + ADP > Adenosine triphosphate + Pyruvic acid
Adenosine triphosphate + L-Aspartic acid + Ammonia + L-Aspartic acid > Adenosine monophosphate + L-Asparagine + Pyrophosphate + L-Asparagine
Adenosine triphosphate + L-Aspartic acid + L-Glutamine + Water + L-Aspartic acid > Adenosine monophosphate + Pyrophosphate + L-Asparagine + L-Glutamic acid + L-Asparagine + L-Glutamate
Adenosine triphosphate + Citrulline + L-Aspartic acid + L-Aspartic acid > Pyrophosphate + Adenosine monophosphate + Argininosuccinic acid
N-Acetylglutamic acid + Adenosine triphosphate + N-Acetylglutamic acid > Adenosine diphosphate + N-Acetyl-L-glutamyl 5-phosphate + ADP
Hydrogen carbonate + Water + L-Glutamine + 2 Adenosine triphosphate >2 Adenosine diphosphate + Phosphate + L-Glutamic acid +2 Hydrogen ion + Carbamoylphosphate +2 ADP + L-Glutamate
Putrescine + Adenosine triphosphate + L-Glutamic acid + L-Glutamate > Phosphate + Adenosine diphosphate + Hydrogen ion + gamma-Glutamyl-L-putrescine + ADP
3-Dehydro-L-gulonate + Adenosine triphosphate > 3-keto-L-gulonate 6-phosphate + Adenosine diphosphate + Hydrogen ion + 3-Keto-L-gulonate 6-phosphate + ADP
L-Threo-2-pentulose + Adenosine triphosphate + L-Threo-2-pentulose > Xylulose 5-phosphate + Adenosine diphosphate + Xylulose 5-phosphate + ADP
L-Glutamic acid + Adenosine triphosphate + L-Glutamate > Adenosine diphosphate + γ-L-glutamyl 5-phosphate + ADP
Glyceric acid + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + 2-Phosphoglyceric acid + ADP + 2-Phosphoglyceric acid
Glyceric acid + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + 3-Phosphoglyceric acid + ADP + 3-Phosphoglycerate
Acetyl-CoA + Hydrogen carbonate + Adenosine triphosphate > Adenosine diphosphate + Phosphate + Hydrogen ion + Malonyl-CoA + ADP + Malonyl-CoA
L-Arginine + tRNA(Arg) + Adenosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosine monophosphate + L-arginyl-tRNA(Arg)
L-Cysteine + tRNA(Cys) + Adenosine triphosphate + Hydrogen ion > Pyrophosphate + Adenosine monophosphate + L-cysteinyl-tRNA(Cys)
L-Glutamic acid + Adenosine triphosphate + Hydrogen ion + tRNA(Glu) + L-Glutamate > Pyrophosphate + Adenosine monophosphate + L-glutamyl-tRNA(Glu)
8 L-Glutamic acid + 8 Hydrogen ion + 8 Adenosine triphosphate + 8 tRNA(Glu) + 8 L-Glutamate >8 Adenosine monophosphate +8 Pyrophosphate +8 L-glutamyl-tRNA(Glu)
L-Alanine + Adenosine triphosphate + Hydrogen ion + tRNA(Ala) + L-Alanine > Pyrophosphate + Adenosine monophosphate + L-alanyl-tRNA(Ala)
Glycine + Adenosine triphosphate + Hydrogen ion + tRNA(gly) > Adenosine monophosphate + Pyrophosphate + Glycyl-tRNA(Gly)
L-Threonine + Adenosine triphosphate + Hydrogen ion + tRNA(Thr) + L-Threonine > Pyrophosphate + Adenosine monophosphate + L-Threonyl-tRNA(Thr)
L-Serine + Adenosine triphosphate + Hydrogen ion + tRNA(Ser) + L-Serine > Adenosine monophosphate + Pyrophosphate + L-Seryl-tRNA(Ser)
L-Leucine + Adenosine triphosphate + Hydrogen ion + tRNA(Leu) > Adenosine monophosphate + Pyrophosphate + L-Leucyl-tRNA(Leu)
L-Valine + Adenosine triphosphate + Hydrogen ion + tRNA(Val) + L-Valine > Adenosine monophosphate + Pyrophosphate + L-Valyl-tRNA(Val)
L-Isoleucine + Adenosine triphosphate + Hydrogen ion + tRNA(Ile) + L-Isoleucine > L-Isoleucyl-tRNA(Ile) + Adenosine monophosphate + Pyrophosphate
L-Glutamine + Adenosine triphosphate + Hydrogen ion + tRNA(Gln) > Adenosine diphosphate + Pyrophosphate + L-Glutaminyl-tRNA(Gln) + ADP
L-Aspartic acid + Adenosine triphosphate + Hydrogen ion + tRNA(Asp) + L-Aspartic acid > Pyrophosphate + Adenosine monophosphate + L-aspartyl-tRNA(Asp)
L-Tyrosine + Adenosine triphosphate + Hydrogen ion + tRNA(Tyr) + L-Tyrosine > Adenosine monophosphate + Pyrophosphate + L-tyrosyl-tRNA(Tyr)
L-Tryptophan + Adenosine triphosphate + Hydrogen ion + tRNA(Trp) > Adenosine monophosphate + Pyrophosphate + L-tryptophyl-tRNA(Trp)
L-Phenylalanine + Adenosine triphosphate + Hydrogen ion + tRNA(Phe) + L-Phenylalanine > Adenosine monophosphate + Pyrophosphate + L-phenylalanyl-tRNA(Phe)
L-Asparagine + Adenosine triphosphate + Hydrogen ion + tRNA(Asn) + L-Asparagine > Pyrophosphate + Adenosine monophosphate + L-asparaginyl-tRNA(Asn)
L-Histidine + Adenosine triphosphate + Hydrogen ion + tRNA(His) + L-Histidine > Adenosine monophosphate + Pyrophosphate + L-histidyl-tRNA(His)
L-Lysine + Adenosine triphosphate + Hydrogen ion + tRNA(Lys) + L-Lysine > Adenosine monophosphate + Pyrophosphate + L-Lysyl-tRNA
L-Methionine + Adenosine triphosphate + Hydrogen ion + tRNA(Met) > Adenosine monophosphate + Pyrophosphate + L-methionyl-tRNA(Met)
L-Proline + Adenosine triphosphate + Hydrogen ion + tRNA(Pro) + L-Proline > Adenosine monophosphate + Pyrophosphate + L-prolyl-tRNA(Pro)
Adenosine phosphosulfate + Adenosine triphosphate > Phosphoadenosine phosphosulfate + Adenosine diphosphate + Hydrogen ion + ADP
Adenosine triphosphate + Hydrogen ion + Sulfate + Sulfate > Adenosine phosphosulfate + Pyrophosphate
L-Aspartic acid + Water + Adenosine triphosphate + L-Glutamine + L-Aspartic acid > L-Asparagine + Hydrogen ion + Adenosine monophosphate + L-Glutamic acid + Pyrophosphate + L-Asparagine + L-Glutamate
L-Aspartic acid + Adenosine triphosphate + Ammonium + L-Aspartic acid > L-Asparagine + Adenosine monophosphate + Pyrophosphate + Hydrogen ion + L-Asparagine
Coenzyme A + a 2,3,4- saturated fatty acid + Adenosine triphosphate > Adenosine monophosphate + Pyrophosphate + a 2,3,4-saturated fatty acyl CoA?
Butyric acid + Coenzyme A + Adenosine triphosphate > Adenosine triphosphate + Butyryl-CoA + Butyryl-CoA
Butyric acid + Coenzyme A + Adenosine triphosphate > Adenosine triphosphate + Butyryl-CoA + Butyryl-CoA
Adenosine triphosphate + Coenzyme A + Capric acid > Adenosine monophosphate + Decanoyl-CoA (n-C10:0CoA) + Decanoyl-CoA (N-C10:0CoA)
Adenosine triphosphate + Coenzyme A + Caproic acid > Adenosine monophosphate + Hexanyl-CoA
Dodecanoic acid + Coenzyme A + Adenosine triphosphate > Adenosine monophosphate + Lauroyl-CoA
Myristic acid + Coenzyme A + Adenosine triphosphate > Adenosine monophosphate + Tetradecanoyl-CoA
Caprylic acid + Adenosine triphosphate + Coenzyme A > Adenosine monophosphate + Octanoyl-CoA + Octanoyl-CoA
Palmitic acid + Coenzyme A + Adenosine triphosphate > Adenosine monophosphate + Palmityl-CoA
Stearic acid + Adenosine triphosphate + Coenzyme A > Adenosine monophosphate + Stearoyl-CoA + Stearoyl-CoA
Shikimic acid + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + shikimate 3-phosphate + ADP + Shikimate 3-phosphate
L-Homoserine + Adenosine triphosphate + L-Homoserine > Adenosine diphosphate + Hydrogen ion + O-Phosphohomoserine + ADP
Oxalacetic acid + Adenosine triphosphate > Adenosine diphosphate + Carbon dioxide + Phosphoenolpyruvic acid + ADP
2-dehydro-3-deoxy-D-galactonate + Adenosine triphosphate + 2-Dehydro-3-deoxy-D-galactonate > Adenosine diphosphate + Hydrogen ion + 2-dehydro-3-deoxy-D-galactonate 6-phosphate + ADP + 2-Dehydro-3-deoxy-D-galactonate 6-phosphate
D-tagatofuranose 6-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + D-tagatofuranose 1,6-bisphosphate + ADP
Alpha-D-Galactose + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + Galactose 1-phosphate + ADP + Galactose 1-phosphate
D-allopyranose + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + aldehydo-D-allose 6-phosphate + ADP + aldehydo-D-allose 6-phosphate
L-rhamnulofuranose + Adenosine triphosphate + L-rhamnulofuranose > Adenosine diphosphate + Hydrogen ion + L-rhamnulose 1-phosphate + ADP + L-Rhamnulose 1-phosphate
Adenosine triphosphate + keto-L-rhamnulose > L-fuculose 1-phosphate + Adenosine diphosphate + Hydrogen ion + L-Fuculose 1-phosphate + ADP
D-Ribulose + Adenosine triphosphate + D-Ribulose > Adenosine diphosphate + Hydrogen ion + D-Ribulose-1-phosphate + ADP
Pantothenic acid + Adenosine triphosphate + Pantothenic acid > D-4'-Phosphopantothenate + Adenosine diphosphate + D-4'-Phosphopantothenate + ADP
Pantetheine + Adenosine triphosphate + Pantetheine > Pantetheine 4'-phosphate + Adenosine diphosphate + pantotheine 4'-phosphate + ADP
Adenosine triphosphate + D-Pantothenoyl-L-cysteine > Adenosine diphosphate + 4-Phosphopantothenoylcysteine + ADP
Pantetheine 4'-phosphate + Adenosine triphosphate + pantotheine 4'-phosphate > Dephospho-CoA + Pyrophosphate
Adenosine triphosphate + Dephospho-CoA > Adenosine diphosphate + Coenzyme A + ADP
beta-Alanine + Adenosine triphosphate + (R)-pantoate + (R)-Pantoate > Adenosine monophosphate + Pyrophosphate + Hydrogen ion + Pantothenic acid + Pantothenic acid
beta-Alanine + Adenosine triphosphate > Adenosine monophosphate + Pyrophosphate + Hydrogen ion
Pantothenic acid + Adenosine triphosphate + Pantothenic acid > Adenosine diphosphate + Hydrogen ion + D-4'-Phosphopantothenate + ADP + D-4'-Phosphopantothenate
4'-phosphopantetheine + Adenosine triphosphate + Hydrogen ion + 4'-phosphopantetheine > Pyrophosphate + Dephospho-CoA
Dephospho-CoA + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + Coenzyme A + ADP
nicotinate beta-D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + Nicotinamide ribotide > Pyrophosphate + Nicotinic acid adenine dinucleotide
Nicotinic acid adenine dinucleotide + Water + L-Glutamine + Adenosine triphosphate > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + L-Glutamic acid + NAD + L-Glutamate
Nicotinic acid adenine dinucleotide + Adenosine triphosphate + Ammonium > Hydrogen ion + Adenosine monophosphate + Pyrophosphate + NAD
Nicotinic acid + Water + Adenosine triphosphate + Phosphoribosyl pyrophosphate > Phosphate + Adenosine diphosphate + Pyrophosphate + nicotinate beta-D-ribonucleotide + ADP + Nicotinamide ribotide
Nicotinamide riboside + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + beta-nicotinamide D-ribonucleotide + ADP + NMN
beta-nicotinamide D-ribonucleotide + Adenosine triphosphate + Hydrogen ion + NMN > Pyrophosphate + NAD
(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + (2-N,3-O-bis(3-Hydroxytetradecanoyl)-4-O-phosphono-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) + ADP
glucosyl-(heptosyl)2-Kdo2-lipid A + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)2-Kdo2-lipid A-phosphate + ADP
glucosyl-(heptosyl)3-Kdo2-lipid A-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + glucosyl-(heptosyl)3-Kdo2-lipid A-bisphosphate + ADP
L-Glutamic acid + Adenosine triphosphate + L-Cysteine + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + gamma-Glutamylcysteine + ADP
gamma-Glutamylcysteine + Glycine + Adenosine triphosphate > Hydrogen ion + Phosphate + Adenosine diphosphate + Glutathione + ADP
2-Dehydro-3-deoxy-D-galactonate + Adenosine triphosphate + 2-Keto-3-deoxy-D-gluconic acid > Hydrogen ion + 2-Keto-3-deoxy-6-phosphogluconic acid + Adenosine diphosphate + ADP
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran + Adenosine triphosphate + (2R,4S)-2-Methyl-2,3,3,4-tetrahydroxytetrahydrofuran > Adenosine diphosphate + Hydrogen ion + (4S)-4-hydroxy-2,3-pentanedione 5-phosphate + ADP + (4S)-4-hydroxy-2,3-pentanedione 5-phosphate
L-Methionine + Water + Adenosine triphosphate > Phosphate + Pyrophosphate
L-Methionine + Water + Adenosine triphosphate > Phosphate + Pyrophosphate + S-adenosyl-L-methionine
Beta-D-Glucose + Adenosine triphosphate + b-D-Glucose > Hydrogen ion + Adenosine diphosphate + beta-D-Glucose 6-phosphate + ADP
D-Glucose + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + beta-D-Glucose 6-phosphate + ADP
β-D-fructofuranose + Adenosine triphosphate + D-Fructose > Adenosine diphosphate + Hydrogen ion + D-tagatofuranose 6-phosphate + ADP
D-Fructose + Adenosine triphosphate + D-Fructose > D-tagatofuranose 6-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
N-Acetyl-D-glucosamine + Adenosine triphosphate + N-Acetylglucosamine > N-Acetyl-D-Glucosamine 6-Phosphate + Adenosine diphosphate + Hydrogen ion + N-Acetyl-D-Glucosamine 6-Phosphate + ADP
Alpha-D-glucose 1-phosphate + Adenosine triphosphate > ADP-Glucose + Pyrophosphate
Alpha-D-glucose 1-phosphate + Adenosine triphosphate + Hydrogen ion > ADP-Glucose + Pyrophosphate
6 Adenosine triphosphate + 3 L-Serine + 3 2,3-Dihydroxybenzoic acid + 3 L-Serine >6 Adenosine monophosphate + enterobactin +6 Pyrophosphate +3 Hydrogen ion
7,8-Dihydropteroic acid + Adenosine triphosphate + L-Glutamic acid + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + 7,8-dihydrofolate monoglutamate + ADP + Dihydrofolic acid
Ribose 1,5-bisphosphate + Adenosine triphosphate + Ribose 1,5-bisphosphate > Adenosine diphosphate + Phosphoribosyl pyrophosphate + ADP
5-Phosphoribosylamine + Glycine + Adenosine triphosphate + 5-Phosphoribosylamine > N1-(5-phospho-β-D-ribosyl)glycinamide + Phosphate + Adenosine diphosphate + Hydrogen ion + ADP
5'-Phosphoribosyl-N-formylglycinamide + Water + L-Glutamine + Adenosine triphosphate + 5'-Phosphoribosyl-N-formylglycineamide > 2-(Formamido)-N1-(5-phospho-D-ribosyl)acetamidine + L-Glutamic acid + Phosphate + Adenosine diphosphate + Hydrogen ion + L-Glutamate + ADP
2-(Formamido)-N1-(5-phospho-D-ribosyl)acetamidine + Adenosine triphosphate > 5-Aminoimidazole ribonucleotide + Phosphate + Adenosine diphosphate + Hydrogen ion + ADP
5-Aminoimidazole ribonucleotide + Hydrogen carbonate + Adenosine triphosphate > N5-Carboxyaminoimidazole ribonucleotide + Adenosine diphosphate + Phosphate +2 Hydrogen ion + N5-Carboxyaminoimidazole ribonucleotide + ADP
5-Amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-Aspartic acid + Adenosine triphosphate + L-Aspartic acid > SAICAR + Phosphate + Adenosine diphosphate + Hydrogen ion + SAICAR + ADP
Adenosine monophosphate > Adenosine triphosphate + Adenosine diphosphate + ADP
Xanthylic acid + Adenosine triphosphate + L-Glutamine + Water > Adenosine monophosphate + Pyrophosphate + L-Glutamic acid +2 Hydrogen ion + Guanosine monophosphate + L-Glutamate
Guanosine monophosphate + Adenosine triphosphate > Adenosine diphosphate + Guanosine diphosphate + ADP
Guanosine diphosphate + Adenosine triphosphate > Adenosine diphosphate + Guanosine triphosphate + ADP
dGDP + Adenosine triphosphate + dGDP > Adenosine diphosphate + dGTP + ADP
dADP + Adenosine triphosphate + dADP > Adenosine diphosphate + dATP + ADP + dATP
Uridine 5'-diphosphate + Adenosine triphosphate + Uridine 5'-diphosphate > Uridine triphosphate + Adenosine diphosphate + Uridine triphosphate + ADP
dCDP + Adenosine triphosphate > Adenosine diphosphate + dCTP + ADP
dUDP + Adenosine triphosphate + dUDP > Adenosine diphosphate + Deoxyuridine triphosphate + ADP
Adenosine triphosphate + dTDP > Adenosine diphosphate + Thymidine 5'-triphosphate + ADP
Adenosine triphosphate + a reduced flavodoxin > an oxidized flavodoxin + Water + dATP + dATP
Adenosine diphosphate + Phosphate + 4 Hydrogen ion + ADP <> Water +3 Hydrogen ion + Adenosine triphosphate
β-D-fructofuranose 1-phosphate + Adenosine triphosphate > Adenosine diphosphate + Hydrogen ion + Fructose 1,6-bisphosphate + ADP + Fructose 1,6-bisphosphate
Glycerol + Adenosine triphosphate > Hydrogen ion + Adenosine diphosphate + Glycerol 3-phosphate + ADP
UDP-N-acetyl-α-D-muramate + L-Alanine + Adenosine triphosphate + L-Alanine > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanine + ADP
UDP-N-acetylmuramoyl-L-alanyl-D-glutamate + Meso-2,6-Diaminoheptanedioate + Adenosine triphosphate + UDP-N-Acetylmuramoyl-L-alanyl-D-glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + ADP
UDP-N-Acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diaminopimelate + D-Alanyl-D-alanine + Adenosine triphosphate > Adenosine diphosphate + Phosphate + Hydrogen ion + UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine + ADP
Adenosine diphosphate + propanoyl phosphate + ADP + Propanoyl phosphate > Adenosine triphosphate + Propionic acid
Propionic acid + Adenosine triphosphate + Coenzyme A > Propionyl-CoA + Adenosine monophosphate + Pyrophosphate + Propionyl-CoA
Uridine 5'-monophosphate + Adenosine triphosphate > Adenosine diphosphate + Uridine 5'-diphosphate + ADP + Uridine 5'-diphosphate
Uridine triphosphate + L-Glutamine + Water + Adenosine triphosphate + Uridine triphosphate > Adenosine diphosphate + Hydrogen ion + Phosphate + L-Glutamic acid + Cytidine triphosphate + ADP + L-Glutamate
Caprylic acid + a holo-[acyl-carrier protein] + Adenosine triphosphate > Octanoyl-[acyl-carrier protein] + Adenosine monophosphate + Pyrophosphate
4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Adenosine triphosphate + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol > Adenosine diphosphate + Hydrogen ion + 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + ADP + 2-Phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
a [protein]-(L-serine/L-threonine) + Adenosine triphosphate > a [protein]-(L-serine/L-threonine) phosphate + Adenosine diphosphate + Hydrogen ion + ADP
Cobinamide + Adenosine triphosphate + Cobinamide > Adenosyl cobinamide + Triphosphate + Adenosyl cobinamide + Triphosphate
Cobalamin + Adenosine triphosphate + vitamin B12 > coenzyme B12 + Triphosphate + Polyphosphate
Adenosine triphosphate + Cobalamin + vitamin B12 > Triphosphate + Adenosylcobalamin + Triphosphate
Adenosyl cobinamide + Adenosine triphosphate + Adenosyl cobinamide > Adenosine diphosphate + Hydrogen ion + adenosylcobinamide phosphate + ADP
Pseudouridine + Adenosine triphosphate + Pseudouridine > Pseudouridine 5'-phosphate + Adenosine diphosphate + Hydrogen ion + ADP
Molybdopterin + Adenosine triphosphate + Hydrogen ion + Molybdopterin > Pyrophosphate + Adenylyl-molybdopterin + Adenylyl-molybdopterin
Adenosine triphosphate + Nitrogen + 6 a reduced flavodoxin + Water <> Phosphate + Adenosine diphosphate + an oxidized flavodoxin +2 Ammonia + ADP
7-Deaza-7-carboxyguanine + Adenosine triphosphate + Ammonium > Water + Phosphate + Adenosine diphosphate + Hydrogen ion + 7-Cyano-7-carbaguanine + ADP
2-succinylbenzoate + Coenzyme A + Adenosine triphosphate + 2-Succinylbenzoate > 2-Succinylbenzoyl-CoA + Pyrophosphate + Adenosine monophosphate
Adenosine triphosphate + 2,3-Dihydroxybenzoic acid <> (2,3-Dihydroxybenzoyl)adenylic acid + Pyrophosphate
L-Arginine + Adenosine triphosphate + Water > L-Arginine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamic acid + Adenosine triphosphate + Water + L-Glutamate > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamic acid + ADP
L-Leucine + Adenosine triphosphate + Water > L-Leucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Valine + Adenosine triphosphate + Water + L-Valine > L-Valine + Adenosine diphosphate + Pyrophosphate + Hydrogen ion + ADP
L-Isoleucine + Adenosine triphosphate + Water + L-Isoleucine > L-Isoleucine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
L-Glutamine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Glutamine + ADP
L-Aspartic acid + Adenosine triphosphate + Water + L-Aspartic acid > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Aspartic acid + ADP
L-Histidine + Adenosine triphosphate + Water + L-Histidine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Histidine + ADP
L-Lysine + Adenosine triphosphate + Water + L-Lysine > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Lysine + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + L-Methionine + ADP
L-Proline + Adenosine triphosphate + Water + L-Proline > L-Proline + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
D-allopyranose + Adenosine triphosphate + Water > D-allopyranose + Adenosine diphosphate + Hydrogen ion + Phosphate + ADP
Lipid A-core + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Lipid A-core + ADP
L-Methionine + Adenosine triphosphate + Water > Adenosine diphosphate + Pyrophosphate + Hydrogen ion + L-Methionine + ADP
Ferric enterobactin + Adenosine triphosphate + Water Ferric enterobactin + Adenosine diphosphate + Hydrogen ion + ADP
Adenosine triphosphate + Water + Sulfate + Sulfate > Adenosine diphosphate + Phosphate + Hydrogen ion + Sulfate + ADP
Alkyl Sulfate + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Alkyl Sulfate + ADP
Adenosine triphosphate + Water + Butanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + Butanesulfonate + ADP
Adenosine triphosphate + Water + 3-(N-morpholino)propanesulfonate > Phosphate + Hydrogen ion + Adenosine diphosphate + 3-(N-morpholino)propanesulfonate + ADP
Adenosine triphosphate + Water + ethanesulfonate > Hydrogen ion + Phosphate + Adenosine diphosphate + ethanesulfonate + ADP
Adenosine triphosphate + Water + isethionate > Adenosine diphosphate + Hydrogen ion + Phosphate + isethionate + ADP
Adenosine triphosphate + Water + methanesulfonate + Methanesulfonate > Adenosine diphosphate + Phosphate + Hydrogen ion + methanesulfonate + ADP
Maltotetraose + Adenosine triphosphate + Water > Maltotetraose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Maltotriose + Adenosine triphosphate + Water > Adenosine diphosphate + Phosphate + Hydrogen ion + Maltotriose + ADP
D-Maltose + Adenosine triphosphate + Water > D-Maltose + Phosphate + Hydrogen ion + Adenosine diphosphate + ADP
Adenosine triphosphate + Water + DL-O-Phosphoserine > Hydrogen ion + Phosphate + Adenosine diphosphate + DL-O-Phosphoserine + ADP
Taurine + Adenosine triphosphate + Water > Taurine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cysteine-S-sulfate + Adenosine triphosphate + Water > Cysteine-S-sulfate + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Homocarnosine + Adenosine triphosphate + Water + Homocarnosine > Homocarnosine + Adenosine diphosphate + Phosphate + Hydrogen ion + ADP
Cobinamide + Adenosine triphosphate + Water + Cobinamide > Adenosine diphosphate + Phosphate + Hydrogen ion + Cobinamide + ADP
Cyanocobalamin + Adenosine triphosphate + Water + Cyanocobalamin > Adenosine diphosphate + Phosphate + Hydrogen ion + Cyanocobalamin + ADP
Adenosine triphosphate + Water + 1,6-Anhydro-N-acetylmuramate <> Adenosine diphosphate + MurNAc-6-P + ADP
More...

Pathways:
Spectra
Spectra:
Spectrum TypeDescriptionSplash Key
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientific ) , Negativesplash10-0a4i-0131190000-316dbdca27f38ad8ee57View in MoNA
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientific ) , Negativesplash10-004i-0000900000-f5ffc4694dfd302fd52dView in MoNA
LC-MS/MSLC-MS/MS Spectrum - LC-ESI-ITFT (LTQ Orbitrap XL, Thermo Scientific ) , Negativesplash10-0a4i-0000900000-e9a09b9360491c310280View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, PositiveNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, PositiveNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, PositiveNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, NegativeNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, NegativeNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, NegativeNot Available
1D NMR13C NMR SpectrumNot Available
1D NMR1H NMR SpectrumNot Available
2D NMR[1H,13C] 2D NMR SpectrumNot Available
References
References:
  • Bar-Meir M, Elpeleg ON, Saada A: Effect of various agents on adenosine triphosphate synthesis in mitochondrial complex I deficiency. J Pediatr. 2001 Dec;139(6):868-70. Pubmed: 11743516
  • Bennett, B. D., Kimball, E. H., Gao, M., Osterhout, R., Van Dien, S. J., Rabinowitz, J. D. (2009). "Absolute metabolite concentrations and implied enzyme active site occupancy in Escherichia coli." Nat Chem Biol 5:593-599. Pubmed: 19561621
  • Buchholz, A., Takors, R., Wandrey, C. (2001). "Quantification of intracellular metabolites in Escherichia coli K12 using liquid chromatographic-electrospray ionization tandem mass spectrometric techniques." Anal Biochem 295:129-137. Pubmed: 11488613
  • Di Virgilio F, Chiozzi P, Ferrari D, Falzoni S, Sanz JM, Morelli A, Torboli M, Bolognesi G, Baricordi OR: Nucleotide receptors: an emerging family of regulatory molecules in blood cells. Blood. 2001 Feb 1;97(3):587-600. Pubmed: 11157473
  • Gartland A, Buckley KA, Hipskind RA, Bowler WB, Gallagher JA: P2 receptors in bone--modulation of osteoclast formation and activity via P2X7 activation. Crit Rev Eukaryot Gene Expr. 2003;13(2-4):237-42. Pubmed: 14696970
  • Gottlieb C, Svanborg K, Eneroth P, Bygdeman M: Effect of prostaglandins on human sperm function in vitro and seminal adenosine triphosphate content. Fertil Steril. 1988 Feb;49(2):322-7. Pubmed: 3338588
  • Holzer AM, Granstein RD: Role of extracellular adenosine triphosphate in human skin. J Cutan Med Surg. 2004 Mar-Apr;8(2):90-6. Epub 2004 May 3. Pubmed: 15129319
  • Ishii, N., Nakahigashi, K., Baba, T., Robert, M., Soga, T., Kanai, A., Hirasawa, T., Naba, M., Hirai, K., Hoque, A., Ho, P. Y., Kakazu, Y., Sugawara, K., Igarashi, S., Harada, S., Masuda, T., Sugiyama, N., Togashi, T., Hasegawa, M., Takai, Y., Yugi, K., Arakawa, K., Iwata, N., Toya, Y., Nakayama, Y., Nishioka, T., Shimizu, K., Mori, H., Tomita, M. (2007). "Multiple high-throughput analyses monitor the response of E. coli to perturbations." Science 316:593-597. Pubmed: 17379776
  • Kadmon M, Klunemann C, Bohme M, Ishikawa T, Gorgas K, Otto G, Herfarth C, Keppler D: Inhibition by cyclosporin A of adenosine triphosphate-dependent transport from the hepatocyte into bile. Gastroenterology. 1993 May;104(5):1507-14. Pubmed: 7683296
  • Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114. Pubmed: 22080510
  • Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590. Pubmed: 21097882
  • Livingston JH, Brown JK, Harkness RA, McCreanor GM: Cerebrospinal fluid nucleotide metabolites following non-convulsive status epilepticus. Dev Med Child Neurol. 1989 Apr;31(2):168-73. Pubmed: 2737369
  • Mahmoud AM, Comhaire FH, Vermeulen L, Andreou E: Comparison of the resazurin test, adenosine triphosphate in semen, and various sperm parameters. Hum Reprod. 1994 Sep;9(9):1688-93. Pubmed: 7836519
  • Mannucci L, Pastore A, Rizzo C, Piemonte F, Rizzoni G, Emma F: Impaired activity of the gamma-glutamyl cycle in nephropathic cystinosis fibroblasts. Pediatr Res. 2006 Feb;59(2):332-5. Pubmed: 16439602
  • Myburgh KH: Can any metabolites partially alleviate fatigue manifestations at the cross-bridge? Med Sci Sports Exerc. 2004 Jan;36(1):20-7. Pubmed: 14707763
  • Nakayama Y, Kinoshita A, Tomita M: Dynamic simulation of red blood cell metabolism and its application to the analysis of a pathological condition. Theor Biol Med Model. 2005 May 9;2(1):18. Pubmed: 15882454
  • Rutkowski B, Swierczynski J, Slominska E, Szolkiewicz M, Smolenski RT, Marlewski M, Butto B, Rutkowski P: Disturbances of purine nucleotide metabolism in uremia. Semin Nephrol. 2004 Sep;24(5):479-83. Pubmed: 15490415
  • Ryan LM, Rachow JW, McCarty BA, McCarty DJ: Adenosine triphosphate levels in human plasma. J Rheumatol. 1996 Feb;23(2):214-9. Pubmed: 8882021
  • Sun Y, MaLossi J, Jacobs SC, Chai TC: Effect of doxazosin on stretch-activated adenosine triphosphate release in bladder urothelial cells from patients with benign prostatic hyperplasia. Urology. 2002 Aug;60(2):351-6. Pubmed: 12137852
  • van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25. Pubmed: 17765195
  • Winder, C. L., Dunn, W. B., Schuler, S., Broadhurst, D., Jarvis, R., Stephens, G. M., Goodacre, R. (2008). "Global metabolic profiling of Escherichia coli cultures: an evaluation of methods for quenching and extraction of intracellular metabolites." Anal Chem 80:2939-2948. Pubmed: 18331064
  • Yoshida M, Miyamae K, Iwashita H, Otani M, Inadome A: Management of detrusor dysfunction in the elderly: changes in acetylcholine and adenosine triphosphate release during aging. Urology. 2004 Mar;63(3 Suppl 1):17-23. Pubmed: 15013648
Synthesis Reference: Clark, V. M.; Kirby, G. W.; Todd, Alexander. Phosphorylation. XV. Use of phosphoramidic esters in acylation-new preparation of adenosine 5'-pyrophosphate and adenosine 5'-triphosphate. Journal of the Chemical Society (1957), 1497-1501.
Material Safety Data Sheet (MSDS) Not Available
External Links:
ResourceLink
CHEBI ID15422
HMDB IDHMDB00538
Pubchem Compound ID5957
Kegg IDC00002
ChemSpider ID5742
WikipediaAdenosine triphosphate
BioCyc IDATP
EcoCyc IDATP
Ligand ExpoATP

Enzymes

General function:
Involved in ATP binding
Specific function:
Catalyzes the ATP-dependent phosphorylation of L- homoserine to L-homoserine phosphate. Is also able to phosphorylate the hydroxy group on gamma-carbon of L-homoserine analogs when the functional group at the alpha-position is a carboxyl, an ester, or even a hydroxymethyl group. Neither L- threonine nor L-serine are substrates of the enzyme
Gene Name:
thrB
Locus Tag:
PA5495
Molecular weight:
35.4 kDa
Reactions
ATP + L-homoserine = ADP + O-phospho-L-homoserine.
General function:
Involved in adenylate cyclase activity
Specific function:
ATP = 3',5'-cyclic AMP + diphosphate
Gene Name:
cyaA
Locus Tag:
PA5272
Molecular weight:
108.7 kDa
Reactions
ATP = 3',5'-cyclic AMP + diphosphate.
General function:
Involved in nucleotide binding
Specific function:
ATP + L-tryptophan + tRNA(Trp) = AMP + diphosphate + L-tryptophyl-tRNA(Trp)
Gene Name:
trpS
Locus Tag:
PA4439
Molecular weight:
49 kDa
Reactions
ATP + L-tryptophan + tRNA(Trp) = AMP + diphosphate + L-tryptophyl-tRNA(Trp).
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of isoleucine to tRNA(Ile). As IleRS can inadvertently accommodate and process structurally similar amino acids such as valine, to avoid such errors it has two additional distinct tRNA(Ile)-dependent editing activities. One activity is designated as 'pretransfer' editing and involves the hydrolysis of activated Val-AMP. The other activity is designated 'posttransfer' editing and involves deacylation of mischarged Val-tRNA(Ile)
Gene Name:
ileS
Locus Tag:
PA4560
Molecular weight:
105.5 kDa
Reactions
ATP + L-isoleucine + tRNA(Ile) = AMP + diphosphate + L-isoleucyl-tRNA(Ile).
General function:
Involved in nucleotide binding
Specific function:
Edits incorrectly charged Ser-tRNA(Ala) and Gly- tRNA(Ala) but not incorrectly charged Ser-tRNA(Thr)
Gene Name:
alaS
Locus Tag:
PA0903
Molecular weight:
94.7 kDa
Reactions
ATP + L-alanine + tRNA(Ala) = AMP + diphosphate + L-alanyl-tRNA(Ala).
General function:
Involved in nucleotide binding
Specific function:
Is required not only for elongation of protein synthesis but also for the initiation of all mRNA translation through initiator tRNA(fMet) aminoacylation
Gene Name:
metG
Locus Tag:
PA3482
Molecular weight:
74.9 kDa
Reactions
ATP + L-methionine + tRNA(Met) = AMP + diphosphate + L-methionyl-tRNA(Met).
General function:
Involved in nucleotide binding
Specific function:
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly)
Gene Name:
glyQ
Locus Tag:
PA0009
Molecular weight:
36.1 kDa
Reactions
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly).
General function:
Involved in arginine-tRNA ligase activity
Specific function:
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly)
Gene Name:
glyS
Locus Tag:
PA0008
Molecular weight:
74 kDa
Reactions
ATP + glycine + tRNA(Gly) = AMP + diphosphate + glycyl-tRNA(Gly).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-glutamine + tRNA(Gln) = AMP + diphosphate + L-glutaminyl-tRNA(Gln)
Gene Name:
glnS
Locus Tag:
PA1794
Molecular weight:
62.9 kDa
Reactions
ATP + L-glutamine + tRNA(Gln) = AMP + diphosphate + L-glutaminyl-tRNA(Gln).
General function:
Involved in ATP binding
Specific function:
2 ATP + L-glutamine + HCO(3)(-) + H(2)O = 2 ADP + phosphate + L-glutamate + carbamoyl phosphate
Gene Name:
carB
Locus Tag:
PA4756
Molecular weight:
117.3 kDa
Reactions
2 ATP + L-glutamine + HCO(3)(-) + H(2)O = 2 ADP + phosphate + L-glutamate + carbamoyl phosphate.
General function:
Involved in potassium-transporting ATPase activity
Specific function:
One of the components of the high-affinity ATP-driven potassium transport (or KDP) system, which catalyzes the hydrolysis of ATP coupled with the exchange of hydrogen and potassium ions
Gene Name:
kdpA
Locus Tag:
PA1633
Molecular weight:
59.9 kDa
Reactions
ATP + H(2)O + K(+)(Out) = ADP + phosphate + K(+)(In).
General function:
Involved in nucleotide binding
Specific function:
One of the components of the high-affinity ATP-driven potassium transport (or KDP) system, which catalyzes the hydrolysis of ATP coupled with the exchange of hydrogen and potassium ions
Gene Name:
kdpB
Locus Tag:
PA1634
Molecular weight:
73 kDa
Reactions
ATP + H(2)O + K(+)(Out) = ADP + phosphate + K(+)(In).
General function:
Involved in potassium-transporting ATPase activity
Specific function:
One of the components of the high-affinity ATP-driven potassium transport (or KDP) system, which catalyzes the hydrolysis of ATP coupled with the exchange of hydrogen and potassium ions. The C subunit may be involved in assembly of the KDP complex
Gene Name:
kdpC
Locus Tag:
PA1635
Molecular weight:
19.3 kDa
Reactions
ATP + H(2)O + K(+)(Out) = ADP + phosphate + K(+)(In).
General function:
Involved in GMP synthase (glutamine-hydrolyzing) activity
Specific function:
Catalyzes the synthesis of GMP from XMP
Gene Name:
guaA
Locus Tag:
PA3769
Molecular weight:
58 kDa
Reactions
ATP + xanthosine 5'-phosphate + L-glutamine + H(2)O = AMP + diphosphate + GMP + L-glutamate.
General function:
Involved in ATP binding
Specific function:
ATP + gamma-L-glutamyl-L-cysteine + glycine = ADP + phosphate + glutathione
Gene Name:
gshB
Locus Tag:
PA0407
Molecular weight:
35.7 kDa
Reactions
ATP + gamma-L-glutamyl-L-cysteine + glycine = ADP + phosphate + glutathione.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of glutamate to tRNA(Glu) in a two-step reaction:glutamate is first activated by ATP to form Glu-AMP and then transferred to the acceptor end of tRNA(Glu)
Gene Name:
gltX
Locus Tag:
PA3134
Molecular weight:
56.7 kDa
Reactions
ATP + L-glutamate + tRNA(Glu) = AMP + diphosphate + L-glutamyl-tRNA(Glu).
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex RbsABCD involved in ribose import. Responsible for energy coupling to the transport system
Gene Name:
rbsA
Locus Tag:
PA1947
Molecular weight:
55.8 kDa
Reactions
ATP + H(2)O + monosaccharide(Out) = ADP + phosphate + monosaccharide(In).
General function:
Involved in bis(5'-nucleosyl)-tetraphosphatase (symmetrical) activity
Specific function:
Hydrolyzes diadenosine 5',5'''-P1,P4-tetraphosphate to yield ADP
Gene Name:
apaH
Locus Tag:
PA0590
Molecular weight:
32 kDa
Reactions
P(1),P(4)-bis(5'-adenosyl) tetraphosphate + H(2)O = 2 ADP.
General function:
Involved in biotin-[acetyl-CoA-carboxylase] ligase activity
Specific function:
BirA acts both as a biotin-operon repressor and as the enzyme that synthesizes the corepressor, acetyl-CoA:carbon-dioxide ligase. This protein also activates biotin to form biotinyl-5'- adenylate and transfers the biotin moiety to biotin-accepting proteins
Gene Name:
birA
Locus Tag:
PA4280
Molecular weight:
34 kDa
Reactions
ATP + biotin + apo-[acetyl-CoA:carbon-dioxide ligase (ADP-forming)] = AMP + diphosphate + [acetyl-CoA:carbon-dioxide ligase (ADP-forming)].
General function:
Involved in RNA binding
Specific function:
Catalyzes the addition and repair of the essential 3'- terminal CCA sequence in tRNAs without using a nucleic acid template. Adds these three nucleotides in the order of C, C, and A to the tRNA nucleotide-73, using CTP and ATP as substrates and producing inorganic pyrophosphate. Also shows highest phosphatase activity in the presence of Ni(2+) and hydrolyzes pyrophosphate, canonical 5'-nucleoside tri- and diphosphates, NADP, and 2'-AMP with the production of Pi. Displays a metal-independent phosphodiesterase activity toward 2',3'-cAMP, 2',3'-cGMP, and 2',3'-cCMP. Without metal or in the presence of Mg(2+), this protein hydrolyzes 2',3'-cyclic substrates with the formation of 2'-nucleotides, whereas in the presence of Ni(2+), it also produces some 3'-nucleotides. These phosphohydrolase activities are probably involved in the repair of the tRNA 3'-CCA terminus degraded by intracellular RNases
Gene Name:
cca
Locus Tag:
PA0584
Molecular weight:
45.6 kDa
Reactions
A tRNA precursor + 2 CTP + ATP = a tRNA with a 3' CCA end + 3 diphosphate.
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for histidine. Probably responsible for energy coupling to the transport system
Gene Name:
hisP
Locus Tag:
PA2926
Molecular weight:
28.5 kDa
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of valine to tRNA(Val). As ValRS can inadvertently accommodate and process structurally similar amino acids such as threonine, to avoid such errors, it has a "posttransfer" editing activity that hydrolyzes mischarged Thr-tRNA(Val) in a tRNA-dependent manner
Gene Name:
valS
Locus Tag:
PA3834
Molecular weight:
107.7 kDa
Reactions
ATP + L-valine + tRNA(Val) = AMP + diphosphate + L-valyl-tRNA(Val).
General function:
Involved in RNA binding
Specific function:
ATP + L-phenylalanine + tRNA(Phe) = AMP + diphosphate + L-phenylalanyl-tRNA(Phe)
Gene Name:
pheT
Locus Tag:
PA2739
Molecular weight:
86.8 kDa
Reactions
ATP + L-phenylalanine + tRNA(Phe) = AMP + diphosphate + L-phenylalanyl-tRNA(Phe).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-leucine + tRNA(Leu) = AMP + diphosphate + L-leucyl-tRNA(Leu)
Gene Name:
leuS
Locus Tag:
PA3987
Molecular weight:
97.6 kDa
Reactions
ATP + L-leucine + tRNA(Leu) = AMP + diphosphate + L-leucyl-tRNA(Leu).
General function:
Involved in ATP binding
Specific function:
Cell wall formation
Gene Name:
ddlB
Locus Tag:
PA4410
Molecular weight:
34.4 kDa
Reactions
ATP + 2 D-alanine = ADP + phosphate + D-alanyl-D-alanine.
General function:
Involved in catalytic activity
Specific function:
ATP + 2-(formamido)-N(1)-(5-phospho-D- ribosyl)acetamidine = ADP + phosphate + 5-amino-1-(5-phospho-D- ribosyl)imidazole
Gene Name:
purM
Locus Tag:
PA0945
Molecular weight:
37.1 kDa
Reactions
ATP + 2-(formamido)-N(1)-(5-phospho-D-ribosyl)acetamidine = ADP + phosphate + 5-amino-1-(5-phospho-D-ribosyl)imidazole.
General function:
Involved in tetrahydrofolylpolyglutamate synthase activity
Specific function:
Conversion of folates to polyglutamate derivatives
Gene Name:
folC
Locus Tag:
PA3111
Molecular weight:
46.5 kDa
Reactions
ATP + tetrahydropteroyl-(gamma-Glu)(n) + L-glutamate = ADP + phosphate + tetrahydropteroyl-(gamma-Glu)(n+1).
ATP + 7,8-dihydropteroate + L-glutamate = ADP + phosphate + 7,8-dihydropteroylglutamate.
General function:
Involved in nucleotide binding
Specific function:
ATP + L-phenylalanine + tRNA(Phe) = AMP + diphosphate + L-phenylalanyl-tRNA(Phe)
Gene Name:
pheS
Locus Tag:
PA2740
Molecular weight:
38.1 kDa
Reactions
ATP + L-phenylalanine + tRNA(Phe) = AMP + diphosphate + L-phenylalanyl-tRNA(Phe).
General function:
Involved in amino acid binding
Specific function:
ATP + L-aspartate = ADP + 4-phospho-L- aspartate
Gene Name:
lysC
Locus Tag:
PA0904
Molecular weight:
44.4 kDa
Reactions
ATP + L-aspartate = ADP + 4-phospho-L-aspartate.
General function:
Involved in phosphoribosylaminoimidazole carboxylase activity
Specific function:
Possesses an ATPase activity that is dependent on the presence of AIR (aminoimidazole ribonucleotide). The association of purK and purE produces an enzyme complex capable of converting AIR to CAIR efficiently under physiological condition
Gene Name:
purK
Locus Tag:
PA5425
Molecular weight:
38.5 kDa
Reactions
ATP + 5-amino-1-(5-phospho-D-ribosyl)imidazole + HCO(3)(-) = ADP + phosphate + 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole.
General function:
Involved in kinase activity
Specific function:
Involved in the activation of acetate to acetyl CoA and the secretion of acetate. During anaerobic growth of the organism, this enzyme is also involved in the synthesis of most of the ATP formed catabolically
Gene Name:
ackA
Locus Tag:
PA0836
Molecular weight:
42.4 kDa
Reactions
ATP + acetate = ADP + acetyl phosphate.
ATP + propanoate = ADP + propanoyl phosphate.
General function:
Involved in metabolic process
Specific function:
Catalyzes the removal of elemental sulfur and selenium atoms from cysteine and selenocysteine to produce alanine. Functions as a sulfur delivery protein for NAD, biotin and Fe-S cluster synthesis. Transfers sulfur on 'Cys-456' of thiI in a transpersulfidation reaction. Transfers sulfur on 'Cys-19' of tusA in a transpersulfidation reaction. Functions also as a selenium delivery protein in the pathway for the biosynthesis of selenophosphate
Gene Name:
iscS
Locus Tag:
PA3814
Molecular weight:
44.7 kDa
Reactions
L-cysteine + acceptor = L-alanine + S-sulfanyl-acceptor.
General function:
Involved in acetylglutamate kinase activity
Specific function:
ATP + N-acetyl-L-glutamate = ADP + N-acetyl-L- glutamate 5-phosphate
Gene Name:
argB
Locus Tag:
PA5323
Molecular weight:
31.8 kDa
Reactions
ATP + N-acetyl-L-glutamate = ADP + N-acetyl-L-glutamate 5-phosphate.
General function:
Involved in shikimate kinase activity
Specific function:
Catalyzes the specific phosphorylation of the 3-hydroxyl group of shikimic acid using ATP as a cosubstrate
Gene Name:
aroK
Locus Tag:
PA5039
Molecular weight:
19.2 kDa
Reactions
ATP + shikimate = ADP + shikimate 3-phosphate.
General function:
Involved in argininosuccinate synthase activity
Specific function:
ATP + L-citrulline + L-aspartate = AMP + diphosphate + N(omega)-(L-arginino)succinate
Gene Name:
argG
Locus Tag:
PA3525
Molecular weight:
45.3 kDa
Reactions
ATP + L-citrulline + L-aspartate = AMP + diphosphate + N(omega)-(L-arginino)succinate.
General function:
Involved in hydrogen ion transporting ATP synthase activity, rotational mechanism
Specific function:
Produces ATP from ADP in the presence of a proton gradient across the membrane
Gene Name:
atpC
Locus Tag:
PA5553
Molecular weight:
14.7 kDa
General function:
Involved in glutamine catabolic process
Specific function:
2 ATP + L-glutamine + HCO(3)(-) + H(2)O = 2 ADP + phosphate + L-glutamate + carbamoyl phosphate
Gene Name:
carA
Locus Tag:
PA4758
Molecular weight:
40.8 kDa
Reactions
2 ATP + L-glutamine + HCO(3)(-) + H(2)O = 2 ADP + phosphate + L-glutamate + carbamoyl phosphate.
General function:
Involved in phosphotransferase activity, alcohol group as acceptor
Specific function:
Key enzyme in the regulation of glycerol uptake and metabolism
Gene Name:
glpK
Locus Tag:
PA3582
Molecular weight:
56 kDa
Reactions
ATP + glycerol = ADP + sn-glycerol 3-phosphate.
General function:
Involved in cytidylate kinase activity
Specific function:
ATP, dATP, and GTP are equally effective as phosphate donors. CMP and dCMP are the best phosphate acceptors
Gene Name:
cmk
Locus Tag:
PA3163
Molecular weight:
24.6 kDa
Reactions
ATP + (d)CMP = ADP + (d)CDP.
General function:
Involved in catalytic activity
Specific function:
Reversibly transfers an adenylyl group from ATP to 4'- phosphopantetheine, yielding dephospho-CoA (dPCoA) and pyrophosphate
Gene Name:
coaD
Locus Tag:
PA0363
Molecular weight:
17.8 kDa
Reactions
ATP + pantetheine 4'-phosphate = diphosphate + 3'-dephospho-CoA.
General function:
Involved in dephospho-CoA kinase activity
Specific function:
Catalyzes the phosphorylation of the 3'-hydroxyl group of dephosphocoenzyme A to form coenzyme A
Gene Name:
coaE
Locus Tag:
PA4529
Molecular weight:
22.8 kDa
Reactions
ATP + 3'-dephospho-CoA = ADP + CoA.
General function:
Involved in adenylylsulfate kinase activity
Specific function:
Catalyzes the synthesis of activated sulfate
Gene Name:
cysC
Locus Tag:
PA1393
Molecular weight:
22.1 kDa
Reactions
ATP + adenylyl sulfate = ADP + 3'-phosphoadenylyl sulfate.
General function:
Involved in ATP binding
Specific function:
Cell wall formation
Gene Name:
ddlA
Locus Tag:
PA4201
Molecular weight:
36.5 kDa
Reactions
ATP + 2 D-alanine = ADP + phosphate + D-alanyl-D-alanine.
General function:
Involved in glucokinase activity
Specific function:
Not highly important in Pseudomonas aeruginosa as glucose is transported into the cell by the PTS system already as glucose 6-phosphate
Gene Name:
glk
Locus Tag:
PA3193
Molecular weight:
34.6 kDa
Reactions
ATP + D-glucose = ADP + D-glucose 6-phosphate.
General function:
Involved in glutamate-cysteine ligase activity
Specific function:
ATP + L-glutamate + L-cysteine = ADP + phosphate + gamma-L-glutamyl-L-cysteine
Gene Name:
gshA
Locus Tag:
PA5203
Molecular weight:
59.2 kDa
Reactions
ATP + L-glutamate + L-cysteine = ADP + phosphate + gamma-L-glutamyl-L-cysteine.
General function:
Involved in magnesium ion binding
Specific function:
ATP + D-ribose 5-phosphate = AMP + 5-phospho- alpha-D-ribose 1-diphosphate
Gene Name:
prs
Locus Tag:
PA4670
Molecular weight:
34 kDa
Reactions
ATP + D-ribose 5-phosphate = AMP + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in thymidylate kinase activity
Specific function:
Catalyzes the reversible phosphorylation of deoxythymidine monophosphate (dTMP) to deoxythymidine diphosphate (dTDP), using ATP as its preferred phosphoryl donor. Situated at the junction of both de novo and salvage pathways of deoxythymidine triphosphate (dTTP) synthesis, is essential for DNA synthesis and cellular growth
Gene Name:
tmk
Locus Tag:
PA2962
Molecular weight:
23.1 kDa
Reactions
ATP + dTMP = ADP + dTDP.
General function:
Involved in catalytic activity
Specific function:
Catalyzes the reversible adenylation of nicotinate mononucleotide (NaMN) to nicotinic acid adenine dinucleotide (NaAD)
Gene Name:
nadD
Locus Tag:
PA4006
Molecular weight:
23.8 kDa
Reactions
ATP + beta-nicotinate-D-ribonucleotide = diphosphate + deamido-NAD(+).
General function:
Involved in nucleoside diphosphate kinase activity
Specific function:
Major role in the synthesis of nucleoside triphosphates other than ATP. The ATP gamma phosphate is transferred to the NDP beta phosphate via a ping-pong mechanism, using a phosphorylated active-site intermediate
Gene Name:
ndk
Locus Tag:
PA3807
Molecular weight:
15.6 kDa
Reactions
ATP + nucleoside diphosphate = ADP + nucleoside triphosphate.
General function:
Involved in phosphoglycerate kinase activity
Specific function:
ATP + 3-phospho-D-glycerate = ADP + 3-phospho- D-glyceroyl phosphate
Gene Name:
pgk
Locus Tag:
PA0552
Molecular weight:
40.4 kDa
Reactions
ATP + 3-phospho-D-glycerate = ADP + 3-phospho-D-glyceroyl phosphate.
General function:
Involved in catalytic activity
Specific function:
Catalyzes the reversible transfer of the terminal phosphate of ATP to form a long-chain polyphosphate (polyP). Can form linear polymers of orthophosphate with chain lengths up to 1000 or more. Can also act in the reverse direction to form ATP in the presence of excess ADP. Can also use GTP instead of ATP; but the efficiency of GTP is 5% that of ATP
Gene Name:
ppk
Locus Tag:
PA5242
Molecular weight:
83.2 kDa
Reactions
ATP + (phosphate)(n) = ADP + (phosphate)(n+1).
General function:
Involved in cellular amino acid biosynthetic process
Specific function:
Catalyzes the transfer of a phosphate group to glutamate to form glutamate 5-phosphate which rapidly cyclizes to 5- oxoproline
Gene Name:
proB
Locus Tag:
PA4565
Molecular weight:
39.8 kDa
Reactions
ATP + L-glutamate = ADP + L-glutamate 5-phosphate.
General function:
Involved in ATP binding
Specific function:
ATP + 5-amino-1-(5-phospho-D- ribosyl)imidazole-4-carboxylate + L-aspartate = ADP + phosphate + (S)-2-(5-amino-1-(5-phospho-D-ribosyl)imidazole-4- carboxamido)succinate
Gene Name:
purC
Locus Tag:
PA1013
Molecular weight:
26.8 kDa
Reactions
ATP + 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxylate + L-aspartate = ADP + phosphate + (S)-2-(5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamido)succinate.
General function:
Involved in CTP synthase activity
Specific function:
Catalyzes the ATP-dependent amination of UTP to CTP with either L-glutamine or ammonia as the source of nitrogen
Gene Name:
pyrG
Locus Tag:
PA3637
Molecular weight:
59.6 kDa
Reactions
ATP + UTP + NH(3) = ADP + phosphate + CTP.
General function:
Involved in cellular amino acid biosynthetic process
Specific function:
Catalyzes the reversible phosphorylation of UMP to UDP, with ATP as the most efficient phosphate donor
Gene Name:
pyrH
Locus Tag:
PA3654
Molecular weight:
26.3 kDa
Reactions
ATP + UMP = ADP + UDP.
General function:
Involved in DNA-directed RNA polymerase activity
Specific function:
DNA-dependent RNA polymerase catalyzes the transcription of DNA into RNA using the four ribonucleoside triphosphates as substrates. This subunit plays an important role in subunit assembly since its dimerization is the first step in the sequential assembly of subunits to form the holoenzyme
Gene Name:
rpoA
Locus Tag:
PA4238
Molecular weight:
36.6 kDa
Reactions
Nucleoside triphosphate + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in DNA-directed RNA polymerase activity
Specific function:
Promotes RNA polymerase assembly. Latches the N- and C- terminal regions of the beta' subunit thereby facilitating its interaction with the beta and alpha subunits
Gene Name:
rpoZ
Locus Tag:
PA5337
Molecular weight:
9.8 kDa
Reactions
Nucleoside triphosphate + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in methionine adenosyltransferase activity
Specific function:
Catalyzes the formation of S-adenosylmethionine from methionine and ATP. The overall synthetic reaction is composed of two sequential steps, AdoMet formation and the subsequent tripolyphosphate hydrolysis which occurs prior to release of AdoMet from the enzyme. Is essential for growth
Gene Name:
metK
Locus Tag:
PA0546
Molecular weight:
42.7 kDa
Reactions
ATP + L-methionine + H(2)O = phosphate + diphosphate + S-adenosyl-L-methionine.
General function:
Involved in ATP binding
Specific function:
ATP + succinate + CoA = ADP + phosphate + succinyl-CoA
Gene Name:
sucC
Locus Tag:
PA1588
Molecular weight:
41.5 kDa
Reactions
ATP + succinate + CoA = ADP + phosphate + succinyl-CoA.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of serine to tRNA(Ser). Is also able to aminoacylate tRNA(Sec) with serine, to form the misacylated tRNA L-seryl-tRNA(Sec), which will be further converted into selenocysteinyl-tRNA(Sec)
Gene Name:
serS
Locus Tag:
PA2612
Molecular weight:
47.2 kDa
Reactions
ATP + L-serine + tRNA(Ser) = AMP + diphosphate + L-seryl-tRNA(Ser).
ATP + L-serine + tRNA(Sec) = AMP + diphosphate + L-seryl-tRNA(Sec).
General function:
Involved in nucleotide binding
Specific function:
ThrS is also a translational repressor protein, it controls the translation of its own gene by binding to its mRNA
Gene Name:
thrS
Locus Tag:
PA2744
Molecular weight:
73.1 kDa
Reactions
ATP + L-threonine + tRNA(Thr) = AMP + diphosphate + L-threonyl-tRNA(Thr).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-lysine + tRNA(Lys) = AMP + diphosphate + L-lysyl-tRNA(Lys)
Gene Name:
lysS
Locus Tag:
PA3700
Molecular weight:
57.3 kDa
Reactions
ATP + L-lysine + tRNA(Lys) = AMP + diphosphate + L-lysyl-tRNA(Lys).
General function:
Involved in nucleotide binding
Specific function:
With YjeK might be involved in the post-translational modification of elongation factor P (EF-P)
Gene Name:
poxA
Locus Tag:
PA5513
Molecular weight:
32.4 kDa
General function:
Involved in DNA binding
Specific function:
DNA-dependent RNA polymerase catalyzes the transcription of DNA into RNA using the four ribonucleoside triphosphates as substrates
Gene Name:
rpoC
Locus Tag:
PA4269
Molecular weight:
154.4 kDa
Reactions
Nucleoside triphosphate + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in DNA binding
Specific function:
DNA-dependent RNA polymerase catalyzes the transcription of DNA into RNA using the four ribonucleoside triphosphates as substrates
Gene Name:
rpoB
Locus Tag:
PA4270
Molecular weight:
150.8 kDa
Reactions
Nucleoside triphosphate + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in glutamate-ammonia ligase activity
Specific function:
ATP + L-glutamate + NH(3) = ADP + phosphate + L-glutamine
Gene Name:
glnA
Locus Tag:
PA5119
Molecular weight:
51.9 kDa
Reactions
ATP + L-glutamate + NH(3) = ADP + phosphate + L-glutamine.
General function:
Involved in phosphotransferase activity, alcohol group as acceptor
Specific function:
ATP + D-ribose = ADP + D-ribose 5-phosphate
Gene Name:
rbsK
Locus Tag:
PA1950
Molecular weight:
31.8 kDa
Reactions
ATP + D-ribose = ADP + D-ribose 5-phosphate.
General function:
Involved in [formate-C-acetyltransferase]-activating enzyme activity
Specific function:
Activation of anaerobic ribonucleoside-triphosphate reductase under anaerobic conditions by generation of an organic free radical, using S-adenosylmethionine and reduced flavodoxin as cosubstrates to produce 5'-deoxy-adenosine
Gene Name:
nrdG
Locus Tag:
PA1919
Molecular weight:
25.7 kDa
General function:
Involved in acetyl-CoA carboxylase activity
Specific function:
Controls translation of mRNA for both itself and the alpha-subunit (accA) by binding to a probable hairpin in the 5' of the mRNA. Binding to mRNA inhibits translation; this is partially relieved by acetyl-CoA. Increasing amounts of mRNA also inhibit enzyme activity
Gene Name:
accD
Locus Tag:
PA3112
Molecular weight:
31.8 kDa
Reactions
ATP + acetyl-CoA + HCO(3)(-) = ADP + phosphate + malonyl-CoA.
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex pstSACB involved in phosphate import. Responsible for energy coupling to the transport system
Gene Name:
pstB
Locus Tag:
PA5366
Molecular weight:
31 kDa
Reactions
ATP + H(2)O + phosphate(Out) = ADP + phosphate + phosphate(In).
General function:
Involved in hydrogen ion transmembrane transporter activity
Specific function:
Key component of the proton channel; it plays a direct role in the translocation of protons across the membrane
Gene Name:
atpB
Locus Tag:
PA5560
Molecular weight:
31.9 kDa
General function:
Involved in hydrogen ion transmembrane transporter activity
Specific function:
Component of the F(0) channel, it forms part of the peripheral stalk, linking F(1) to F(0)
Gene Name:
atpF
Locus Tag:
PA5558
Molecular weight:
16.9 kDa
General function:
Involved in hydrogen ion transporting ATP synthase activity, rotational mechanism
Specific function:
This protein is part of the stalk that links CF(0) to CF(1). It either transmits conformational changes from CF(0) to CF(1) or is implicated in proton conduction
Gene Name:
atpH
Locus Tag:
PA5557
Molecular weight:
19.3 kDa
General function:
Involved in hydrogen ion transporting ATP synthase activity, rotational mechanism
Specific function:
Produces ATP from ADP in the presence of a proton gradient across the membrane. The gamma chain is believed to be important in regulating ATPase activity and the flow of protons through the CF(0) complex
Gene Name:
atpG
Locus Tag:
PA5555
Molecular weight:
31.6 kDa
General function:
Involved in ATP binding
Specific function:
Produces ATP from ADP in the presence of a proton gradient across the membrane. The alpha chain is a regulatory subunit
Gene Name:
atpA
Locus Tag:
PA5556
Molecular weight:
55.4 kDa
Reactions
ATP + H(2)O + H(+)(In) = ADP + phosphate + H(+)(Out).
General function:
Involved in nucleotide binding
Specific function:
Produces ATP from ADP in the presence of a proton gradient across the membrane. The catalytic sites are hosted primarily by the beta subunits
Gene Name:
atpD
Locus Tag:
PA5554
Molecular weight:
49.5 kDa
Reactions
ATP + H(2)O + H(+)(In) = ADP + phosphate + H(+)(Out).
General function:
Involved in hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances
Specific function:
Mediates magnesium influx to the cytosol
Gene Name:
mgtA
Locus Tag:
PA4825
Molecular weight:
100.1 kDa
Reactions
ATP + H(2)O + Mg(2+)(Out) = ADP + phosphate + Mg(2+)(In).
General function:
Involved in acetyl-CoA carboxylase activity
Specific function:
Component of the acetyl coenzyme A carboxylase (ACC) complex. First, biotin carboxylase catalyzes the carboxylation of biotin on its carrier protein (BCCP) and then the CO(2) group is transferred by the carboxyltransferase to acetyl-CoA to form malonyl-CoA
Gene Name:
accA
Locus Tag:
PA3639
Molecular weight:
34.9 kDa
Reactions
ATP + acetyl-CoA + HCO(3)(-) = ADP + phosphate + malonyl-CoA.
General function:
Involved in acetyl-CoA carboxylase activity
Specific function:
This protein is a component of the acetyl coenzyme A carboxylase complex; first, biotin carboxylase catalyzes the carboxylation of the carrier protein and then the transcarboxylase transfers the carboxyl group to form malonyl-CoA
Gene Name:
accB
Locus Tag:
PA4847
Molecular weight:
16.5 kDa
General function:
Involved in RNA binding
Specific function:
Polymerase that creates the 3' poly(A) tail found in some mRNA's. Seems to be involved in plasmid copy number control
Gene Name:
pcnB
Locus Tag:
PA4727
Molecular weight:
53.3 kDa
Reactions
ATP + RNA(n) = diphosphate + RNA(n+1).
General function:
Involved in diacylglycerol kinase activity
Specific function:
Recycling of diacylglycerol produced during the turnover of membrane phospholipid
Gene Name:
dgkA
Locus Tag:
PA3603
Molecular weight:
13.1 kDa
Reactions
ATP + 1,2-diacylglycerol = ADP + 1,2-diacyl-sn-glycerol 3-phosphate.
General function:
Involved in phosphopantothenate--cysteine ligase activity
Specific function:
Catalyzes two steps in the biosynthesis of coenzyme A. In the first step cysteine is conjugated to 4'-phosphopantothenate to form 4-phosphopantothenoylcysteine, in the latter compound is decarboxylated to form 4'-phosphopantotheine
Gene Name:
coaBC
Locus Tag:
PA5320
Molecular weight:
43.1 kDa
Reactions
N-((R)-4'-phosphopantothenoyl)-L-cysteine = pantotheine 4'-phosphate + CO(2).
CTP + (R)-4'-phosphopantothenate + L-cysteine = CMP + diphosphate + N-((R)-4'-phosphopantothenoyl)-L-cysteine.
General function:
Involved in magnesium ion binding
Specific function:
ATP + pyruvate = ADP + phosphoenolpyruvate
Gene Name:
pykF
Locus Tag:
PA1498
Molecular weight:
51.5 kDa
Reactions
ATP + pyruvate = ADP + phosphoenolpyruvate.
General function:
Involved in nucleotide binding
Specific function:
ATP-dependent phosphorylation of adenosylcobinamide and adds GMP to adenosylcobinamide phosphate
Gene Name:
cobU
Locus Tag:
PA1279
Molecular weight:
36.5 kDa
Reactions
ATP or GTP + adenosylcobinamide = adenosylcobinamide phosphate + ADP or GDP.
GTP + adenosylcobinamide phosphate = diphosphate + adenosylcobinamide-GDP.
General function:
Involved in 1-phosphofructokinase activity
Specific function:
ATP + D-fructose 1-phosphate = ADP + D- fructose 1,6-bisphosphate
Gene Name:
fruK
Locus Tag:
PA3561
Molecular weight:
33.4 kDa
Reactions
ATP + D-fructose 1-phosphate = ADP + D-fructose 1,6-bisphosphate.
General function:
Involved in nucleoside-triphosphate diphosphatase activity
Specific function:
Specific function unknown
Gene Name:
mazG
Locus Tag:
PA0935
Molecular weight:
31.2 kDa
Reactions
ATP + H(2)O = AMP + diphosphate.
General function:
Involved in amino acid binding
Specific function:
In eubacteria ppGpp (guanosine 3'-diphosphate 5-' diphosphate) is a mediator of the stringent response that coordinates a variety of cellular activities in response to changes in nutritional abundance. This enzyme catalyzes the formation of pppGpp which is then hydrolyzed to form ppGpp
Gene Name:
relA
Locus Tag:
PA0934
Molecular weight:
83.8 kDa
Reactions
ATP + GTP = AMP + guanosine 3'-diphosphate 5'-triphosphate.
General function:
Involved in catalytic activity
Specific function:
In eubacteria ppGpp (guanosine 3'-diphosphate 5-' diphosphate) is a mediator of the stringent response that coordinates a variety of cellular activities in response to changes in nutritional abundance. This enzyme catalyzes both the synthesis and degradation of ppGpp. The second messengers ppGpp and c-di-GMP together control biofilm formation in response to translational stress; ppGpp represses biofilm formation while c- di-GMP induces it
Gene Name:
spoT
Locus Tag:
PA5338
Molecular weight:
78.9 kDa
Reactions
ATP + GTP = AMP + guanosine 3'-diphosphate 5'-triphosphate.
Guanosine 3',5'-bis(diphosphate) + H(2)O = guanosine 5'-diphosphate + diphosphate.
General function:
Involved in FMN adenylyltransferase activity
Specific function:
ATP + riboflavin = ADP + FMN
Gene Name:
ribF
Locus Tag:
PA4561
Molecular weight:
34.3 kDa
Reactions
ATP + riboflavin = ADP + FMN.
ATP + FMN = diphosphate + FAD.
General function:
Involved in catalytic activity
Specific function:
ATP + succinate + CoA = ADP + phosphate + succinyl-CoA
Gene Name:
sucD
Locus Tag:
PA1589
Molecular weight:
30.3 kDa
Reactions
ATP + succinate + CoA = ADP + phosphate + succinyl-CoA.
General function:
Involved in catalytic activity
Specific function:
ATP + thiamine phosphate = ADP + thiamine diphosphate
Gene Name:
thiL
Locus Tag:
PA4051
Molecular weight:
32.9 kDa
Reactions
ATP + thiamine phosphate = ADP + thiamine diphosphate.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of tyrosine to tRNA(Tyr) in a two-step reaction:tyrosine is first activated by ATP to form Tyr- AMP and then transferred to the acceptor end of tRNA(Tyr)
Gene Name:
tyrS
Locus Tag:
PA4138
Molecular weight:
45.1 kDa
Reactions
ATP + L-tyrosine + tRNA(Tyr) = AMP + diphosphate + L-tyrosyl-tRNA(Tyr).
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex UgpABCE involved in sn-glycerol-3-phosphate import. Responsible for energy coupling to the transport system (Probable). Can also transport glycerophosphoryl diesters
Gene Name:
ugpC
Locus Tag:
PA3187
Molecular weight:
42.2 kDa
Reactions
ATP + H(2)O + glycerol-3-phosphate(Out) = ADP + phosphate + glycerol-3-phosphate(In).
General function:
Involved in [isocitrate dehydrogenase (NADP+)] kinase activity
Specific function:
Bifunctional enzyme which can phosphorylate or dephosphorylate isocitrate dehydrogenase (IDH) on a specific serine residue. This is a regulatory mechanism which enables bacteria to bypass the Krebs cycle via the glyoxylate shunt in response to the source of carbon. When bacteria are grown on glucose, IDH is fully active and unphosphorylated, but when grown on acetate or ethanol, the activity of IDH declines drastically concomitant with its phosphorylation
Gene Name:
aceK
Locus Tag:
PA1376
Molecular weight:
66.8 kDa
Reactions
ATP + [isocitrate dehydrogenase (NADP(+))] = ADP + [isocitrate dehydrogenase (NADP(+))] phosphate.
General function:
Involved in nucleotide binding
Specific function:
ATP + L-arginine + tRNA(Arg) = AMP + diphosphate + L-arginyl-tRNA(Arg)
Gene Name:
argS
Locus Tag:
PA5051
Molecular weight:
65.2 kDa
Reactions
ATP + L-arginine + tRNA(Arg) = AMP + diphosphate + L-arginyl-tRNA(Arg).
General function:
Involved in ATP binding
Specific function:
Involved in cell wall formation. Catalyzes the final step in the synthesis of UDP-N-acetylmuramoyl-pentapeptide, the precursor of murein
Gene Name:
murF
Locus Tag:
PA4416
Molecular weight:
47.4 kDa
Reactions
ATP + UDP-N-acetylmuramoyl-L-alanyl-gamma-D-glutamyl-L-lysine + D-alanyl-D-alanine = ADP + phosphate + UDP-N-acetylmuramoyl-L-alanyl-gamma-D-glutamyl-L-lysyl-D-alanyl-D-alanine.
General function:
Involved in magnesium ion binding
Specific function:
ATP + 7,8-diaminononanoate + CO(2) = ADP + phosphate + dethiobiotin
Gene Name:
bioD
Locus Tag:
PA0504
Molecular weight:
23.3 kDa
Reactions
ATP + 7,8-diaminononanoate + CO(2) = ADP + phosphate + dethiobiotin.
General function:
Involved in nucleotide binding
Specific function:
Involved in a multicomponent binding-protein-dependent transport system for glycine betaine/L-proline
Gene Name:
proV
Locus Tag:
PA5094
Molecular weight:
30.7 kDa
General function:
Involved in ATP binding
Specific function:
Cell wall formation. Catalyzes the addition of glutamate to the nucleotide precursor UDP-N-acetylmuramoyl-L-alanine (UMA)
Gene Name:
murD
Locus Tag:
PA4414
Molecular weight:
48.1 kDa
Reactions
ATP + UDP-N-acetylmuramoyl-L-alanine + glutamate = ADP + phosphate + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate.
General function:
Involved in catalytic activity
Specific function:
ATP + N(2)-formyl-N(1)-(5-phospho-D- ribosyl)glycinamide + L-glutamine + H(2)O = ADP + phosphate + 2- (formamido)-N(1)-(5-phospho-D-ribosyl)acetamidine + L-glutamate
Gene Name:
purL
Locus Tag:
PA3763
Molecular weight:
140.6 kDa
Reactions
ATP + N(2)-formyl-N(1)-(5-phospho-D-ribosyl)glycinamide + L-glutamine + H(2)O = ADP + phosphate + 2-(formamido)-N(1)-(5-phospho-D-ribosyl)acetamidine + L-glutamate.
General function:
Involved in ATP binding
Specific function:
ATP + 5-phospho-D-ribosylamine + glycine = ADP + phosphate + N(1)-(5-phospho-D-ribosyl)glycinamide
Gene Name:
purD
Locus Tag:
PA4855
Molecular weight:
45.2 kDa
Reactions
ATP + 5-phospho-D-ribosylamine + glycine = ADP + phosphate + N(1)-(5-phospho-D-ribosyl)glycinamide.
General function:
Involved in catalytic activity
Specific function:
Synthesizes selenophosphate from selenide and ATP
Gene Name:
selD
Locus Tag:
PA1642
Molecular weight:
36.4 kDa
Reactions
ATP + selenide + H(2)O = AMP + selenophosphate + phosphate.
General function:
Involved in nucleotide binding
Specific function:
Catalyzes the attachment of proline to tRNA(Pro) in a two-step reaction:proline is first activated by ATP to form Pro- AMP and then transferred to the acceptor end of tRNA(Pro). As ProRS can inadvertently accommodate and process non-cognate amino acids such as alanine and cysteine, to avoid such errors it has two additional distinct editing activities against alanine. One activity is designated as 'pretransfer' editing and involves the tRNA(Pro)-independent hydrolysis of activated Ala-AMP. The other activity is designated 'posttransfer' editing and involves deacylation of mischarged Ala-tRNA(Pro). Misacylated Cys-tRNA(Pro) is not edited by ProRS, but instead may be edited in trans by ybaK
Gene Name:
proS
Locus Tag:
PA0956
Molecular weight:
63.1 kDa
Reactions
ATP + L-proline + tRNA(Pro) = AMP + diphosphate + L-prolyl-tRNA(Pro).
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex cysAWTP involved in sulfate/thiosulfate import. Responsible for energy coupling to the transport system
Gene Name:
cysA
Locus Tag:
PA0280
Molecular weight:
36.8 kDa
Reactions
ATP + H(2)O + sulfate(Out) = ADP + phosphate + sulfate(In).
General function:
Involved in ATP binding
Specific function:
Cell wall formation
Gene Name:
murC
Locus Tag:
PA4411
Molecular weight:
51.9 kDa
Reactions
ATP + UDP-N-acetylmuramate + L-alanine = ADP + phosphate + UDP-N-acetylmuramoyl-L-alanine.
General function:
Involved in nicotinate phosphoribosyltransferase activity
Specific function:
Nicotinate D-ribonucleotide + diphosphate = nicotinate + 5-phospho-alpha-D-ribose 1-diphosphate
Gene Name:
pncB
Locus Tag:
PA4919
Molecular weight:
46.1 kDa
Reactions
Beta-nicotinate D-ribonucleotide + diphosphate = nicotinate + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in NAD+ synthase (glutamine-hydrolyzing) activity
Specific function:
Catalyzes a key step in NAD biosynthesis, transforming deamido-NAD into NAD by a two-step reaction
Gene Name:
nadE
Locus Tag:
PA4920
Molecular weight:
29.7 kDa
Reactions
ATP + deamido-NAD(+) + NH(3) = AMP + diphosphate + NAD(+).
General function:
Involved in catalytic activity
Specific function:
ATP + sulfate = diphosphate + adenylyl sulfate
Gene Name:
cysD
Locus Tag:
PA4443
Molecular weight:
35.5 kDa
Reactions
ATP + sulfate = diphosphate + adenylyl sulfate.
General function:
Involved in magnesium ion binding
Specific function:
ATP + pyruvate = ADP + phosphoenolpyruvate
Gene Name:
pykA
Locus Tag:
PA4329
Molecular weight:
52.3 kDa
Reactions
ATP + pyruvate = ADP + phosphoenolpyruvate.
General function:
Involved in cysteine-tRNA ligase activity
Specific function:
ATP + L-cysteine + tRNA(Cys) = AMP + diphosphate + L-cysteinyl-tRNA(Cys)
Gene Name:
cysS
Locus Tag:
PA1795
Molecular weight:
51.2 kDa
Reactions
ATP + L-cysteine + tRNA(Cys) = AMP + diphosphate + L-cysteinyl-tRNA(Cys).
General function:
Involved in nucleotide binding
Specific function:
ATP + L-aspartate + tRNA(Asp) = AMP + diphosphate + L-aspartyl-tRNA(Asp)
Gene Name:
aspS
Locus Tag:
PA0963
Molecular weight:
66.2 kDa
Reactions
ATP + L-aspartate + tRNA(Asp) = AMP + diphosphate + L-aspartyl-tRNA(Asp).
General function:
Involved in ATP binding
Specific function:
Catalyzes the addition of meso-diaminopimelic acid to the nucleotide precursor UDP-N-acetylmuramoyl-L-alanyl-D-glutamate (UMAG) in the biosynthesis of bacterial cell-wall peptidoglycan. Is also able to use many meso-diaminopimelate analogs as substrates, although much less efficiently, but not L-lysine
Gene Name:
murE
Locus Tag:
PA4417
Molecular weight:
51.3 kDa
Reactions
ATP + UDP-N-acetylmuramoyl-L-alanyl-D-glutamate + meso-2,6-diaminoheptanedioate = ADP + phosphate + UDP-N-acetylmuramoyl-L-alanyl-D-gamma-glutamyl-meso-2,6-diamino-heptanedioate.
General function:
Involved in phosphoenolpyruvate carboxykinase (ATP) activity
Specific function:
ATP + oxaloacetate = ADP + phosphoenolpyruvate + CO(2)
Gene Name:
pckA
Locus Tag:
PA5192
Molecular weight:
55.7 kDa
Reactions
ATP + oxaloacetate = ADP + phosphoenolpyruvate + CO(2).
General function:
Involved in glycerate kinase activity
Specific function:
ATP + (R)-glycerate = ADP + 3-phospho-(R)- glycerate
Gene Name:
garK
Locus Tag:
PA1052
Molecular weight:
38.6 kDa
Reactions
ATP + (R)-glycerate = ADP + 3-phospho-(R)-glycerate.
General function:
Involved in catalytic activity
Specific function:
Catalyzes the phosphorylation of pyruvate to phosphoenolpyruvate
Gene Name:
ppsA
Locus Tag:
PA1770
Molecular weight:
85.8 kDa
Reactions
ATP + pyruvate + H(2)O = AMP + phosphoenolpyruvate + phosphate.
General function:
Involved in ATP binding
Specific function:
Member of the two-component regulatory system phoQ/phoP involved in adaptation to low Mg(2+) environments and the control of acid resistance genes. In presence of low periplasmic Mg(2+) concentrations, phoQ functions as a membrane-associated protein kinase that undergoes autophosphorylation and subsequently transfers the phosphate to phoP, which results in the expression of phoP-activated genes (PAG) and repression of phoP-repressed genes (PRG). In presence of high periplasmic Mg(2+) concentrations, acts as a protein phosphatase that dephosphorylates phospho-phoP, which results in the repression of phoP-activated genes and may lead to expression of some phoP- repressed genes. Mediates magnesium influx to the cytosol by activation of mgtA. Promotes expression of the two- component regulatory system rstA/rstB and transcription of the hemL, mgrB, nagA, slyB, vboR and yrbL genes
Gene Name:
phoQ
Locus Tag:
PA1180
Molecular weight:
50.2 kDa
Reactions
ATP + protein L-histidine = ADP + protein N-phospho-L-histidine.
General function:
Involved in GTPase activity
Specific function:
May be the GTPase, regulating ATP sulfurylase activity
Gene Name:
cysN
Locus Tag:
PA4442
Molecular weight:
69.3 kDa
Reactions
ATP + sulfate = diphosphate + adenylyl sulfate.
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for ferric enterobactin. Probably responsible for energy coupling to the transport system
Gene Name:
fepC
Locus Tag:
PA4158
Molecular weight:
28.6 kDa
General function:
Involved in ligase activity
Specific function:
This protein is a component of the acetyl coenzyme A carboxylase complex; first, biotin carboxylase catalyzes the carboxylation of the carrier protein and then the transcarboxylase transfers the carboxyl group to form malonyl-CoA
Gene Name:
accC
Locus Tag:
PA4848
Molecular weight:
48.9 kDa
Reactions
ATP + biotin-[carboxyl-carrier-protein] + CO(2) = ADP + phosphate + carboxy-biotin-[carboxyl-carrier-protein].
ATP + acetyl-CoA + HCO(3)(-) = ADP + phosphate + malonyl-CoA.
General function:
Involved in sulfurtransferase activity
Specific function:
Catalyzes the 2-thiolation of uridine at the wobble position (U34) of tRNA(Lys), tRNA(Glu) and tRNA(Gln), leading to the formation of s(2)U34, the first step of tRNA-mnm(5)s(2)U34 synthesis. Sulfur is provided by iscS, via a sulfur-relay system. Binds ATP and its substrate tRNAs
Gene Name:
mnmA
Locus Tag:
PA2626
Molecular weight:
41.9 kDa
General function:
Involved in 2-amino-4-hydroxy-6-hydroxymethyldihydropteridine diphosphokinase activity
Specific function:
ATP + 2-amino-4-hydroxy-6-hydroxymethyl-7,8- dihydropteridine = AMP + (2-amino-4-hydroxy-7,8-dihydropteridin-6- yl)methyl diphosphate
Gene Name:
folK
Locus Tag:
PA4728
Molecular weight:
18 kDa
Reactions
ATP + 2-amino-4-hydroxy-6-hydroxymethyl-7,8-dihydropteridine = AMP + (2-amino-4-hydroxy-7,8-dihydropteridin-6-yl)methyl diphosphate.
General function:
Involved in ATP binding
Specific function:
Transfers the gamma-phosphate of ATP to the 4'-position of a tetraacyldisaccharide 1-phosphate intermediate (termed DS-1- P) to form tetraacyldisaccharide 1,4'-bis-phosphate (lipid IVA)
Gene Name:
lpxK
Locus Tag:
PA2981
Molecular weight:
36.7 kDa
Reactions
ATP + (2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate) = ADP + (2-N,3-O-bis(3-hydroxytetradecanoyl)-4-O-phosphono-beta-D-glucosaminyl)-(1->6)-(2-N,3-O-bis(3-hydroxytetradecanoyl)-beta-D-glucosaminyl phosphate).
General function:
Involved in acetate-CoA ligase activity
Specific function:
Enables the cell to use acetate during aerobic growth to generate energy via the TCA cycle, and biosynthetic compounds via the glyoxylate shunt. Acetylates CheY, the response regulator involved in flagellar movement and chemotaxis
Gene Name:
acs
Locus Tag:
PA0887
Molecular weight:
71.8 kDa
Reactions
ATP + acetate + CoA = AMP + diphosphate + acetyl-CoA.
General function:
Involved in catalytic activity
Specific function:
2'-deoxyribonucleoside triphosphate + thioredoxin disulfide + H(2)O = ribonucleoside triphosphate + thioredoxin
Gene Name:
nrdD
Locus Tag:
PA1920
Molecular weight:
76.1 kDa
Reactions
2'-deoxyribonucleoside triphosphate + thioredoxin disulfide + H(2)O = ribonucleoside triphosphate + thioredoxin.
General function:
Involved in [glutamate-ammonia-ligase] adenylyltransferase activity
Specific function:
Adenylation and deadenylation of glutamate--ammonia ligase
Gene Name:
glnE
Locus Tag:
PA5014
Molecular weight:
110.1 kDa
Reactions
ATP + [L-glutamate:ammonia ligase (ADP-forming)] = diphosphate + adenylyl-[L-glutamate:ammonia ligase (ADP-forming)].
General function:
Involved in catalytic activity
Specific function:
Catalyzes the condensation of pantoate with beta-alanine in an ATP-dependent reaction via a pantoyl-adenylate intermediate
Gene Name:
panC
Locus Tag:
PA4730
Molecular weight:
30.8 kDa
Reactions
ATP + (R)-pantoate + beta-alanine = AMP + diphosphate + (R)-pantothenate.
General function:
Involved in ATP binding
Specific function:
Catalyzes two reactions:the first one is the production of beta-formyl glycinamide ribonucleotide (GAR) from formate, ATP and beta GAR; the second, a side reaction, is the production of acetyl phosphate and ADP from acetate and ATP
Gene Name:
purT
Locus Tag:
PA3751
Molecular weight:
42.3 kDa
Reactions
Formate + ATP + 5'-phospho-ribosylglycinamide = 5'-phosphoribosyl-N-formylglycinamide + ADP + diphosphate.
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex CcmAB involved in the biogenesis of c-type cytochromes; once thought to export heme, this seems not to be the case, but its exact role is uncertain. Responsible for energy coupling to the transport system
Gene Name:
ccmA
Locus Tag:
PA1475
Molecular weight:
25 kDa
Reactions
ATP + H(2)O + heme(In) = ADP + phosphate + heme(Out).
General function:
Involved in cellular amino acid biosynthetic process
Specific function:
ATP + NH(3) + CO(2) = ADP + carbamoyl phosphate
Gene Name:
arcC
Locus Tag:
PA5173
Molecular weight:
33.1 kDa
Reactions
ATP + NH(3) + CO(2) = ADP + carbamoyl phosphate.
General function:
Involved in RNA processing
Specific function:
Catalyzes the conversion of 3'-phosphate to a 2',3'- cyclic phosphodiester at the end of RNA. The mechanism of action of the enzyme occurs in 3 steps:(A) adenylation of the enzyme by ATP; (B) the enzyme acts on RNA-N3'P to produce RNA-N3'PP5'A; (C) a non catalytic nucleophilic attack by the adjacent 2'hydroxyl on the phosphorus in the diester linkage to produce the cyclic end product. The biological role of this enzyme is unknown but it is likely to function in some aspects of cellular RNA processing
Gene Name:
rtcA
Locus Tag:
PA4585
Molecular weight:
36.6 kDa
Reactions
ATP + RNA 3'-terminal-phosphate = AMP + diphosphate + RNA terminal-2',3'-cyclic-phosphate.
General function:
Involved in nucleotide binding
Specific function:
Probable catalytic subunit of a protein translocase for flagellum-specific export, or a proton translocase involved in local circuits at the flagellum. May be involved in a specialized protein export pathway that proceeds without signal peptide cleavage
Gene Name:
fliI
Locus Tag:
PA1104
Molecular weight:
48.6 kDa
Reactions
ATP + H(2)O + H(+)(In) = ADP + phosphate + H(+)(Out).
General function:
Involved in protein binding
Specific function:
Essential for recycling GMP and indirectly, cGMP
Gene Name:
gmk
Locus Tag:
PA5336
Molecular weight:
23.1 kDa
Reactions
ATP + GMP = ADP + GDP.
General function:
Involved in ATP phosphoribosyltransferase activity
Specific function:
Catalyzes the condensation of ATP and 5-phosphoribose 1- diphosphate to form N'-(5'-phosphoribosyl)-ATP (PR-ATP). Has a crucial role in the pathway because the rate of histidine biosynthesis seems to be controlled primarily by regulation of hisG enzymatic activity
Gene Name:
hisG
Locus Tag:
PA4449
Molecular weight:
22.8 kDa
Reactions
1-(5-phospho-D-ribosyl)-ATP + diphosphate = ATP + 5-phospho-alpha-D-ribose 1-diphosphate.
General function:
Involved in nucleotide binding
Specific function:
ATP + L-histidine + tRNA(His) = AMP + diphosphate + L-histidyl-tRNA(His)
Gene Name:
hisS
Locus Tag:
PA3802
Molecular weight:
47.5 kDa
Reactions
ATP + L-histidine + tRNA(His) = AMP + diphosphate + L-histidyl-tRNA(His).
General function:
Involved in ATP binding
Specific function:
Catalyzes the phosphorylation of the position 2 hydroxy group of 4-diphosphocytidyl-2C-methyl-D-erythritol. Phosphorylates isopentenyl phosphate at low rates. Also acts on isopentenol, and, much less efficiently, dimethylallyl alcohol. Dimethylallyl monophosphate does not serve as a substrate
Gene Name:
ispE
Locus Tag:
PA4669
Molecular weight:
30.8 kDa
Reactions
ATP + 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol = ADP + 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol.
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex MalEFGK involved in maltose/maltodextrin import. Responsible for energy coupling to the transport system
Gene Name:
malK
Locus Tag:
PA2341
Molecular weight:
40.2 kDa
Reactions
ATP + H(2)O + maltose(Out) = ADP + phosphate + maltose(In).
General function:
Involved in hydrogen ion transmembrane transporter activity
Specific function:
Key component of the F(0) channel; it plays a direct role in translocation across the membrane. A homomeric c-ring of 10 subunits forms the central stalk rotor element with the F(1) delta and epsilon subunits
Gene Name:
atpE
Locus Tag:
PA5559
Molecular weight:
8.6 kDa
General function:
Involved in ATP binding
Specific function:
Catalyzes the reversible transfer of the terminal phosphate group between ATP and AMP. This small ubiquitous enzyme involved in the energy metabolism and nucleotide synthesis, is essential for maintenance and cell growth
Gene Name:
adk
Locus Tag:
PA3686
Molecular weight:
23.1 kDa
Reactions
ATP + AMP = 2 ADP.
General function:
Involved in catalytic activity
Specific function:
Catalyzes the esterification, concomitant with transport, of exogenous long-chain fatty acids into metabolically active CoA thioesters for subsequent degradation or incorporation into phospholipids
Gene Name:
fadD
Locus Tag:
PA3299
Molecular weight:
61.7 kDa
Reactions
ATP + a long-chain fatty acid + CoA = AMP + diphosphate + an acyl-CoA.
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex PotABCD involved in spermidine/putrescine import. Responsible for energy coupling to the transport system
Gene Name:
potA
Locus Tag:
PA3607
Molecular weight:
40 kDa
Reactions
ATP + H(2)O + polyamine(Out) = ADP + phosphate + polyamine(In).
General function:
Involved in phosphomethylpyrimidine kinase activity
Specific function:
Catalyzes the phosphorylation of hydroxymethylpyrimidine phosphate (HMP-P) to HMP-PP, and of HMP to HMP-P. Shows no activity with pyridoxal, pyridoxamine or pyridoxine
Gene Name:
thiD
Locus Tag:
PA3975
Molecular weight:
28 kDa
Reactions
ATP + 4-amino-5-hydroxymethyl-2-methylpyrimidine = ADP + 4-amino-5-phosphonooxymethyl-2-methylpyrimidine.
ATP + 4-amino-2-methyl-5-phosphomethylpyrimidine = ADP + 4-amino-2-methyl-5-diphosphomethylpyrimidine.
General function:
Involved in pyridoxal kinase activity
Specific function:
Phosphorylates B6 vitamers; functions in a salvage pathway. Uses pyridoxamine, but has negligible activity toward pyridoxal and pyridoxine as substrates
Gene Name:
pdxY
Locus Tag:
PA5516
Molecular weight:
31.3 kDa
Reactions
ATP + pyridoxal = ADP + pyridoxal 5'-phosphate.
General function:
Involved in transferase activity, transferring phosphorus-containing groups
Specific function:
Catalyzes the phosphorylation of heptose(I) of the outer membrane lipopolysaccharide core
Gene Name:
rfaP
Locus Tag:
PA5009
Molecular weight:
31.3 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for phosphate; probably responsible for the translocation of the substrate across the membrane
Gene Name:
pstA
Locus Tag:
PA5367
Molecular weight:
61.2 kDa
General function:
Involved in lipopolysaccharide transport
Specific function:
Part of the ABC transporter complex lptBFG involved in the translocation of lipopolysaccharide (LPS) from the inner membrane to the outer membrane
Gene Name:
lptG
Locus Tag:
PA3827
Molecular weight:
39.2 kDa
General function:
Involved in transporter activity
Specific function:
Part of the ABC transporter complex cysAWTP (TC 3.A.1.6.1) involved in sulfate/thiosulfate import. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
cysW
Locus Tag:
PA0281
Molecular weight:
31.3 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for dipeptides; probably responsible for the translocation of the substrate across the membrane
Gene Name:
dppB
Locus Tag:
PA4503
Molecular weight:
37 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for dipeptides; probably responsible for the translocation of the substrate across the membrane
Gene Name:
dppC
Locus Tag:
PA4504
Molecular weight:
32.4 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for aspartate/glutamate; probably responsible for the translocation of the substrate across the membrane
Gene Name:
gltJ
Locus Tag:
PA1341
Molecular weight:
27.6 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for aspartate/glutamate; probably responsible for the translocation of the substrate across the membrane
Gene Name:
gltK
Locus Tag:
PA1340
Molecular weight:
24.6 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for histidine; probably responsible for the translocation of the substrate across the membrane
Gene Name:
hisM
Locus Tag:
PA2925
Molecular weight:
26.7 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for branched-chain amino acids. Probably responsible for the translocation of the substrates across the membrane
Gene Name:
livH
Locus Tag:
PA1073
Molecular weight:
32.5 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for molybdenum; probably responsible for the translocation of the substrate across the membrane
Gene Name:
modB
Locus Tag:
PA1862
Molecular weight:
24.4 kDa
General function:
Involved in lipopolysaccharide-transporting ATPase acti
Specific function:
Part of the ABC transporter complex lptBFG involved in the translocation of lipopolysaccharide (LPS) from the inner membrane to the outer membrane
Gene Name:
lptF
Locus Tag:
PA3828
Molecular weight:
41.3 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine and spermidine
Gene Name:
potB
Locus Tag:
PA3608
Molecular weight:
32.7 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine and spermidine
Gene Name:
potC
Locus Tag:
PA3609
Molecular weight:
27.7 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine
Gene Name:
potI
Locus Tag:
PA0304
Molecular weight:
31.9 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for phosphate; probably responsible for the translocation of the substrate across the membrane
Gene Name:
pstC
Locus Tag:
PA5368
Molecular weight:
73.8 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for ribose. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
rbsC
Locus Tag:
PA1948
Molecular weight:
34 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for branched-chain amino acids. Probably responsible for the translocation of the substrates across the membrane
Gene Name:
livM
Locus Tag:
PA1072
Molecular weight:
45.6 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for ferric enterobactin. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
fepD
Locus Tag:
PA4160
Molecular weight:
34.6 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for ferric enterobactin. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
fepG
Locus Tag:
PA4161
Molecular weight:
34.8 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine
Gene Name:
potH
Locus Tag:
PA0303
Molecular weight:
32.4 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for histidine; probably responsible for the translocation of the substrate across the membrane
Gene Name:
hisQ
Locus Tag:
PA2924
Molecular weight:
24.5 kDa
General function:
Involved in nucleotide binding
Specific function:
Involved in lipid A export and possibly also in glycerophospholipid export and for biogenesis of the outer membrane. Transmembrane domains (TMD) form a pore in the inner membrane and the ATP-binding domain (NBD) is responsible for energy generation
Gene Name:
msbA
Locus Tag:
PA4997
Molecular weight:
66.4 kDa
General function:
Involved in transporter activity
Specific function:
Part of a binding-protein-dependent transport system for aliphatic sulfonates. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
ssuC
Locus Tag:
PA3443
Molecular weight:
28.5 kDa
General function:
Involved in transporter activity
Specific function:
Part of a binding-protein-dependent transport system for taurine. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
tauC
Locus Tag:
PA3936
Molecular weight:
29.4 kDa
General function:
Involved in phosphotransferase activity, alcohol group as acceptor
Specific function:
Catalyzes the ADP transfer to D-glycero-D-manno-heptose 1-phosphate, yielding ADP-D,D-heptose
Gene Name:
hldE
Locus Tag:
PA4996
Molecular weight:
50.3 kDa
Reactions
ATP + D-glycero-beta-D-manno-heptose 7-phosphate = ADP + D-glycero-beta-D-manno-heptose 1,7-bisphosphate.
ATP + D-glycero-beta-D-manno-heptose 1-phosphate = diphosphate + ADP-D-glycero-beta-D-manno-heptose.
General function:
Involved in transporter activity
Specific function:
This protein specifically binds sulfate and is involved in its transmembrane transport
Gene Name:
sbp
Locus Tag:
PA0283
Molecular weight:
36.4 kDa
General function:
Involved in GTP binding
Specific function:
GTP-driven Fe(2+) uptake system
Gene Name:
feoB
Locus Tag:
PA4358
Molecular weight:
82.5 kDa
General function:
Involved in binding
Specific function:
Binds ferrienterobactin; part of the binding-protein- dependent transport system for uptake of ferrienterobactin
Gene Name:
fepB
Locus Tag:
PA4159
Molecular weight:
32.1 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex ZnuABC involved in zinc import. Responsible for energy coupling to the transport system
Gene Name:
znuC
Locus Tag:
PA5500
Molecular weight:
29.2 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for dipeptides. Probably responsible for energy coupling to the transport system
Gene Name:
dppD
Locus Tag:
PA4505
Molecular weight:
35.4 kDa
General function:
Involved in RNA binding
Specific function:
Catalyzes the ATP-dependent transfer of a sulfur to tRNA to produce 4-thiouridine in position 8 of tRNAs, which functions as a near-UV photosensor. Also catalyzes the transfer of sulfur to the sulfur carrier protein ThiS, forming ThiS-thiocarboxylate. This is a step in the synthesis of thiazole, in the thiamine biosynthesis pathway. The sulfur is donated as persulfide by iscS
Gene Name:
thiI
Locus Tag:
PA5118
Molecular weight:
54.8 kDa
Reactions
L-cysteine + 'activated' tRNA = L-serine + tRNA containing a thionucleotide.
[IscS]-SSH + [ThiS]-COAMP = [IscS]-SH + [ThiS]-COSH + AMP.
General function:
Involved in protein complex assembly
Specific function:
Required for the export of heme to the periplasm for the biogenesis of c-type cytochromes
Gene Name:
ccmC
Locus Tag:
PA1477
Molecular weight:
28.3 kDa
General function:
Involved in transporter activity
Specific function:
Part of the ABC transporter complex cysAWTP (TC 3.A.1.6.1) involved in sulfate/thiosulfate import. This protein specifically binds thiosulfate and is involved in its transmembrane transport
Gene Name:
cysP
Locus Tag:
PA1493
Molecular weight:
36.5 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex lptBFG involved in the translocation of lipopolysaccharide (LPS) from the inner membrane to the outer membrane. Probably responsible for energy coupling to the transport system
Gene Name:
lptB
Locus Tag:
PA4461
Molecular weight:
26.5 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for dipeptides. Probably responsible for energy coupling to the transport system
Gene Name:
dppF
Locus Tag:
PA4506
Molecular weight:
36.3 kDa
General function:
Involved in phosphate ion binding
Specific function:
Part of the ABC transporter complex pstSACB involved in phosphate import
Gene Name:
pstS
Locus Tag:
PA5369
Molecular weight:
34.5 kDa
General function:
Involved in heme transporter activity
Specific function:
Required for the export of heme to the periplasm for the biogenesis of c-type cytochromes
Gene Name:
ccmB
Locus Tag:
PA1476
Molecular weight:
23.4 kDa
General function:
Involved in lipopolysaccharide transmembrane transporter activity
Specific function:
Required for the translocation of lipopolysaccharide (LPS) from the inner membrane to the outer membrane
Gene Name:
lptC
Locus Tag:
PA4459
Molecular weight:
21.4 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for glutamate and aspartate. Probably responsible for energy coupling to the transport system
Gene Name:
gltL
Locus Tag:
PA1339
Molecular weight:
26.9 kDa
General function:
Involved in lipopolysaccharide binding
Specific function:
Required for the translocation of lipopolysaccharide (LPS) from the inner membrane to the outer membrane. May act as a chaperone that facilitates LPS transfer across the aquaeous environment of the periplasm. Interacts specifically with the lipid A domain of LPS
Gene Name:
lptA
Locus Tag:
PA0005
Molecular weight:
28.7 kDa
General function:
Carbohydrate transport and metabolism
Specific function:
Involved in the high-affinity D-ribose membrane transport system and also serves as the primary chemoreceptor for chemotaxis
Gene Name:
rbsB
Locus Tag:
PA1946
Molecular weight:
33.9 kDa
General function:
Involved in nucleotide binding
Specific function:
Component of the leucine-specific transport system
Gene Name:
livG
Locus Tag:
PA1071
Molecular weight:
28.3 kDa
General function:
Involved in transporter activity
Specific function:
Component of the high-affinity histidine permease, a binding-protein-dependent transport system. The other components are proteins hisQ, hisM, and hisP
Gene Name:
hisJ
Locus Tag:
PA2923
Molecular weight:
28.2 kDa
General function:
Energy production and conversion
Specific function:
A possible function for this protein is to guide the assembly of the membrane sector of the ATPase enzyme complex
Gene Name:
atpI
Locus Tag:
PA5561
Molecular weight:
13.7 kDa
General function:
Involved in arsenite transmembrane transporter activity
Specific function:
Involved in arsenical resistance. Thought to form the channel of an arsenite pump
Gene Name:
arsB
Locus Tag:
PA2278
Molecular weight:
45.1 kDa
General function:
Involved in ATP binding
Specific function:
Involved in the high-affinity zinc uptake transport system
Gene Name:
znuB
Locus Tag:
PA5501
Molecular weight:
27.3 kDa
General function:
Involved in protein-heme linkage
Specific function:
Heme chaperone required for the biogenesis of c-type cytochromes. Transiently binds heme delivered by CcmC and transfers the heme to apo-cytochromes in a process facilitated by CcmF and CcmH
Gene Name:
ccmE
Locus Tag:
PA1479
Molecular weight:
17.2 kDa
General function:
Involved in nucleotide binding
Specific function:
Component of the leucine-specific transport system
Gene Name:
livF
Locus Tag:
PA1070
Molecular weight:
25.6 kDa
General function:
Involved in Mo-molybdopterin cofactor biosynthetic process
Specific function:
Catalyzes the adenylation by ATP of the carboxyl group of the C-terminal glycine of sulfur carrier protein moaD
Gene Name:
moeB
Locus Tag:
PA4663
Molecular weight:
26.7 kDa
Reactions
ATP + [molybdopterin-synthase sulfur-carrier protein]-Gly-Gly = diphosphate + [molybdopterin-synthase sulfur-carrier protein]-Gly-Gly-AMP.
General function:
Involved in transporter activity
Specific function:
Dipeptide-binding protein of a transport system that can be subject to osmotic shock. DppA is also required for peptide chemotaxis
Gene Name:
dppA
Locus Tag:
PA4496
Molecular weight:
60.1 kDa
General function:
Not Available
Specific function:
Specific function unknown
Gene Name:
kdpF
Locus Tag:
PA1632
Molecular weight:
3.2 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex TauABC involved in taurine import. Responsible for energy coupling to the transport system
Gene Name:
tauB
Locus Tag:
PA3937
Molecular weight:
28.8 kDa
Reactions
ATP + H(2)O + taurine(Out) = ADP + phosphate + taurine(In).
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex ModABC involved in molybdenum import. Responsible for energy coupling to the transport system
Gene Name:
modC
Locus Tag:
PA1861
Molecular weight:
39.8 kDa
Reactions
ATP + H(2)O + molybdate(Out) = ADP + phosphate + molybdate(In).
General function:
Involved in metal ion binding
Specific function:
Involved in the high-affinity zinc uptake transport system
Gene Name:
znuA
Locus Tag:
PA5498
Molecular weight:
33.6 kDa
General function:
Amino acid transport and metabolism
Specific function:
Part of the binding-protein-dependent transport system for putrescine. Probably responsible for energy coupling to the transport system
Gene Name:
potG
Locus Tag:
PA0302
Molecular weight:
42.8 kDa
General function:
Involved in transporter activity
Specific function:
Part of a binding-protein-dependent transport system for taurine
Gene Name:
tauA
Locus Tag:
PA3938
Molecular weight:
35.9 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex SsuABC involved in aliphatic sulfonates import. Responsible for energy coupling to the transport system (Probable)
Gene Name:
ssuB
Locus Tag:
PA3442
Molecular weight:
29.8 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for glutamate and aspartate. Binds to both aspartate and glutamate
Gene Name:
gltI
Locus Tag:
PA1342
Molecular weight:
33.1 kDa
General function:
Involved in amino acid transport
Specific function:
This protein is a component of the leucine-specific transport system, which is one of the two periplasmic binding protein-dependent transport systems of the high-affinity transport of the branched-chain amino acids in Pseudomonas aeruginosa
Gene Name:
livK
Locus Tag:
PA1074
Molecular weight:
39.8 kDa
General function:
Involved in fatty acid biosynthetic process
Specific function:
Carrier of the growing fatty acid chain in fatty acid biosynthesis
Gene Name:
acpP
Locus Tag:
PA2966
Molecular weight:
8.7 kDa
General function:
Involved in ATP binding
Specific function:
Reutilizes the intact tripeptide L-alanyl-gamma-D- glutamyl-meso-diaminopimelate by linking it to UDP-N-acetylmuramic acid
Gene Name:
mpl
Locus Tag:
PA4020
Molecular weight:
48.5 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine. Polyamine binding protein
Gene Name:
potF
Locus Tag:
PA1410
Molecular weight:
40.5 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine and spermidine. Polyamine binding protein
Gene Name:
potD
Locus Tag:
PA3610
Molecular weight:
39.3 kDa
General function:
Involved in molybdate transmembrane-transporting ATPase activity
Specific function:
Involved in the transport of molybdenum into the cell. Binds molybdate with high specificity and affinity
Gene Name:
modA
Locus Tag:
PA1863
Molecular weight:
26.4 kDa
General function:
Signal transduction mechanisms
Specific function:
Member of the two-component regulatory system ArcB/ArcA. Sensor-regulator protein for anaerobic repression of the arc modulon. Activates ArcA via a four-step phosphorelay. ArcB can also dephosphorylate ArcA by a reverse phosphorelay involving His- 717 and Asp-576
Gene Name:
arcB
Locus Tag:
PA5172
Molecular weight:
38.1 kDa
Reactions
ATP + protein L-histidine = ADP + protein N-phospho-L-histidine.
General function:
Cell motility
Specific function:
Involved in the transmission of sensory signals from the chemoreceptors to the flagellar motors. CheA is autophosphorylated; it can transfer its phosphate group to either CheB or CheY
Gene Name:
cheA
Locus Tag:
PA0178
Molecular weight:
68.9 kDa
Reactions
ATP + protein L-histidine = ADP + protein N-phospho-L-histidine.
General function:
Signal transduction mechanisms
Specific function:
Member of the two-component regulatory system creC/creB involved in catabolic regulation. CreC may function as a membrane- associated protein kinase that phosphorylates creB in response to environmental signals. CreC can also phosphorylate phoB
Gene Name:
creC
Locus Tag:
PA0464
Molecular weight:
52.3 kDa
Reactions
ATP + protein L-histidine = ADP + protein N-phospho-L-histidine.
General function:
Replication, recombination and repair
Specific function:
Has a helix-destabilizing activity, which is not coupled to the ATPase activity. Can unwind the 23S rRNA as well as 16S rRNA. Exhibits an RNA-dependent ATPase activity, specifically stimulated by bacterial 23S rRNA. Could play a major role in ribosome assembly, specifically in the assembly process of the active center of 50S ribosomal subunits
Gene Name:
dbpA
Locus Tag:
PA0455
Molecular weight:
49.8 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
Replication, recombination and repair
Specific function:
Participates in initiation and elongation during chromosome replication; it exhibits DNA-dependent ATPase activity and contains distinct active sites for ATP binding, DNA binding, and interaction with dnaC protein, primase, and other prepriming proteins
Gene Name:
dnaB
Locus Tag:
PA4931
Molecular weight:
51.6 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
Signal transduction mechanisms
Specific function:
Member of the two-component regulatory system kdpD/kdpE involved in the regulation of the kdp operon. KdpD may function as a membrane-associated protein kinase that phosphorylates kdpE in response to environmental signals
Gene Name:
kdpD
Locus Tag:
PA1636
Molecular weight:
97 kDa
Reactions
ATP + protein L-histidine = ADP + protein N-phospho-L-histidine.
General function:
Signal transduction mechanisms
Specific function:
Acts as a sensor for nitrate/nitrite and transduces signal of nitrate availability to the narL protein and of both nitrate/nitrite to the narP protein. NarX probably activates narL and narP by phosphorylation in the presence of nitrate. NarX also plays a negative role in controlling narL activity, probably through dephosphorylation in the absence of nitrate
Gene Name:
narX
Locus Tag:
PA3878
Molecular weight:
69.3 kDa
Reactions
ATP + protein L-histidine = ADP + protein N-phospho-L-histidine.
General function:
Inorganic ion transport and metabolism
Specific function:
Part of the ABC transporter complex PhnCDE involved in phosphonates, phosphate esters, phosphite and phosphate import. Responsible for energy coupling to the transport system
Gene Name:
phnC
Locus Tag:
PA3384
Molecular weight:
30.3 kDa
Reactions
ATP + H(2)O + phosphonate(Out) = ADP + phosphate + phosphonate(In).
General function:
Signal transduction mechanisms
Specific function:
Member of the two-component regulatory system phoR/phoB involved in the phosphate regulon genes expression. PhoR may function as a membrane-associated protein kinase that phosphorylates phoB in response to environmental signals
Gene Name:
phoR
Locus Tag:
PA5361
Molecular weight:
50.1 kDa
Reactions
ATP + protein L-histidine = ADP + protein N-phospho-L-histidine.
General function:
Replication, recombination and repair
Specific function:
Critical role in recombination and DNA repair. Help process Holliday junction intermediates to mature products by catalyzing branch migration. Has a DNA unwinding activity characteristic of a DNA helicase with a 3' to 5' polarity. recG unwind branched duplex DNA (Y-DNA). Has a role in constitutive stable DNA replication (csdR) and R-loop formation
Gene Name:
recG
Locus Tag:
PA5345
Molecular weight:
76.2 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
Replication, recombination and repair
Specific function:
Involved in the recF recombination pathway; its gene expression is under the regulation of the SOS system. It is a DNA helicase
Gene Name:
recQ
Locus Tag:
PA3344
Molecular weight:
79.4 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
Replication, recombination and repair
Specific function:
Rep helicase is a single-stranded DNA-dependent ATPase involved in DNA replication; it can initiate unwinding at a nick in the DNA. It binds to the single-stranded DNA and acts in a progressive fashion along the DNA in the 3' to 5' direction
Gene Name:
rep
Locus Tag:
PA5296
Molecular weight:
77 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
Replication, recombination and repair
Specific function:
Can carry out ATP-dependent unwinding of double stranded RNA. Has a role in RNA decay. Involved in the RNA degradosome, a multi-enzyme complex important in RNA processing and messenger RNA degradation
Gene Name:
rhlB
Locus Tag:
PA3478
Molecular weight:
47.1 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
Replication, recombination and repair
Specific function:
Acts as an ATP-dependent RNA helicase, able to unwind ds-RNA
Gene Name:
rhlE
Locus Tag:
PA0428
Molecular weight:
70.1 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
Replication, recombination and repair
Specific function:
The ruvA-ruvB complex in the presence of ATP renatures cruciform structure in supercoiled DNA with palindromic sequence, indicating that it may promote strand exchange reactions in homologous recombination. RuvAB is an helicase that mediates the Holliday junction migration by localized denaturation and reannealing. RuvA stimulates, in the presence of DNA, the weak ATPase activity of ruvB. Binds both single- and double-stranded DNA (dsDNA). Binds preferentially to supercoiled rather than to relaxed dsDNA
Gene Name:
ruvA
Locus Tag:
PA0966
Molecular weight:
21.9 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
Replication, recombination and repair
Specific function:
The ruvA-ruvB complex in the presence of ATP renatures cruciform structure in supercoiled DNA with palindromic sequence, indicating that it may promote strand exchange reactions in homologous recombination. RuvAB is an helicase that mediates the Holliday junction migration by localized denaturation and reannealing
Gene Name:
ruvB
Locus Tag:
PA0967
Molecular weight:
38.9 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
Replication, recombination and repair
Specific function:
Has both ATPase and helicase activities. Unwinds DNA duplexes with 3' to 5' polarity with respect to the bound strand and initiates unwinding most effectively when a single-stranded region is present. Involved in the post-incision events of nucleotide excision repair and methyl-directed mismatch repair
Gene Name:
uvrD
Locus Tag:
PA5443
Molecular weight:
81.5 kDa
Reactions
ATP + H(2)O = ADP + phosphate.
General function:
threonylcarbamoyladenosine biosynthetic process
Specific function:
Required for the formation of a threonylcarbamoyl group on adenosine at position 37 (t(6)A37) in tRNAs that read codons beginning with adenine. Catalyzes the conversion of L-threonine, bicarbonate/CO(2) and ATP to give threonylcarbamoyl-AMP (TC-AMP) as the acyladenylate intermediate, with the release of pyrophosphate. Is also able to catalyze the reverse reaction in vitro, i.e. the formation of ATP from TC-AMP and PPi. Shows higher affinity for the full-length tRNA(Thr) lacking only the t(6)A37 modification than for its fully modified counterpart. Could also be required for the maturation of 16S rRNA. Binds to double-stranded RNA but does not interact tightly with either of the ribosomal subunits, or the 70S particles.
Gene Name:
tsaC
Locus Tag:
PA0022
Molecular weight:
20.4 kDa
Reactions
L-threonine + ATP + bicarbonate = L-threonylcarbamoyladenylate + diphosphate + H(2)O
General function:
organic phosphonate catabolic process
Specific function:
Together with PhnG, PhnH and PhnI is required for the transfer of the ribose triphosphate moiety from ATP to methyl phosphonate.
Gene Name:
phnL
Locus Tag:
PA3375
Molecular weight:
26.2 kDa
Reactions
ATP + methylphosphonate = alpha-D-ribose 1-methylphosphonate 5-triphosphate + adenine
General function:
organic phosphonate catabolic process
Specific function:
Together with PhnG, PhnH and PhnL is required for the transfer of the ribose triphosphate moiety from ATP to methyl phosphonate. PhnI alone has nucleosidase activity, catalyzing the hydrolysis of ATP or GTP forming alpha-D-ribose 5-triphosphate and adenine or guanine, respectively.
Gene Name:
phnI
Locus Tag:
PA3378
Molecular weight:
40.6 kDa
Reactions
ATP + methylphosphonate = alpha-D-ribose 1-methylphosphonate 5-triphosphate + adenine

Transporters

General function:
Involved in potassium-transporting ATPase activity
Specific function:
One of the components of the high-affinity ATP-driven potassium transport (or KDP) system, which catalyzes the hydrolysis of ATP coupled with the exchange of hydrogen and potassium ions
Gene Name:
kdpA
Locus Tag:
PA1633
Molecular weight:
59.9 kDa
Reactions
ATP + H(2)O + K(+)(Out) = ADP + phosphate + K(+)(In).
General function:
Involved in nucleotide binding
Specific function:
One of the components of the high-affinity ATP-driven potassium transport (or KDP) system, which catalyzes the hydrolysis of ATP coupled with the exchange of hydrogen and potassium ions
Gene Name:
kdpB
Locus Tag:
PA1634
Molecular weight:
73 kDa
Reactions
ATP + H(2)O + K(+)(Out) = ADP + phosphate + K(+)(In).
General function:
Involved in potassium-transporting ATPase activity
Specific function:
One of the components of the high-affinity ATP-driven potassium transport (or KDP) system, which catalyzes the hydrolysis of ATP coupled with the exchange of hydrogen and potassium ions. The C subunit may be involved in assembly of the KDP complex
Gene Name:
kdpC
Locus Tag:
PA1635
Molecular weight:
19.3 kDa
Reactions
ATP + H(2)O + K(+)(Out) = ADP + phosphate + K(+)(In).
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex RbsABCD involved in ribose import. Responsible for energy coupling to the transport system
Gene Name:
rbsA
Locus Tag:
PA1947
Molecular weight:
55.8 kDa
Reactions
ATP + H(2)O + monosaccharide(Out) = ADP + phosphate + monosaccharide(In).
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for histidine. Probably responsible for energy coupling to the transport system
Gene Name:
hisP
Locus Tag:
PA2926
Molecular weight:
28.5 kDa
General function:
Involved in hydrogen ion transporting ATP synthase activity, rotational mechanism
Specific function:
Produces ATP from ADP in the presence of a proton gradient across the membrane
Gene Name:
atpC
Locus Tag:
PA5553
Molecular weight:
14.7 kDa
General function:
Involved in nucleoside diphosphate kinase activity
Specific function:
Major role in the synthesis of nucleoside triphosphates other than ATP. The ATP gamma phosphate is transferred to the NDP beta phosphate via a ping-pong mechanism, using a phosphorylated active-site intermediate
Gene Name:
ndk
Locus Tag:
PA3807
Molecular weight:
15.6 kDa
Reactions
ATP + nucleoside diphosphate = ADP + nucleoside triphosphate.
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex pstSACB involved in phosphate import. Responsible for energy coupling to the transport system
Gene Name:
pstB
Locus Tag:
PA5366
Molecular weight:
31 kDa
Reactions
ATP + H(2)O + phosphate(Out) = ADP + phosphate + phosphate(In).
General function:
Involved in hydrogen ion transmembrane transporter activity
Specific function:
Key component of the proton channel; it plays a direct role in the translocation of protons across the membrane
Gene Name:
atpB
Locus Tag:
PA5560
Molecular weight:
31.9 kDa
General function:
Involved in hydrogen ion transmembrane transporter activity
Specific function:
Component of the F(0) channel, it forms part of the peripheral stalk, linking F(1) to F(0)
Gene Name:
atpF
Locus Tag:
PA5558
Molecular weight:
16.9 kDa
General function:
Involved in hydrogen ion transporting ATP synthase activity, rotational mechanism
Specific function:
This protein is part of the stalk that links CF(0) to CF(1). It either transmits conformational changes from CF(0) to CF(1) or is implicated in proton conduction
Gene Name:
atpH
Locus Tag:
PA5557
Molecular weight:
19.3 kDa
General function:
Involved in hydrogen ion transporting ATP synthase activity, rotational mechanism
Specific function:
Produces ATP from ADP in the presence of a proton gradient across the membrane. The gamma chain is believed to be important in regulating ATPase activity and the flow of protons through the CF(0) complex
Gene Name:
atpG
Locus Tag:
PA5555
Molecular weight:
31.6 kDa
General function:
Involved in ATP binding
Specific function:
Produces ATP from ADP in the presence of a proton gradient across the membrane. The alpha chain is a regulatory subunit
Gene Name:
atpA
Locus Tag:
PA5556
Molecular weight:
55.4 kDa
Reactions
ATP + H(2)O + H(+)(In) = ADP + phosphate + H(+)(Out).
General function:
Involved in nucleotide binding
Specific function:
Produces ATP from ADP in the presence of a proton gradient across the membrane. The catalytic sites are hosted primarily by the beta subunits
Gene Name:
atpD
Locus Tag:
PA5554
Molecular weight:
49.5 kDa
Reactions
ATP + H(2)O + H(+)(In) = ADP + phosphate + H(+)(Out).
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex UgpABCE involved in sn-glycerol-3-phosphate import. Responsible for energy coupling to the transport system (Probable). Can also transport glycerophosphoryl diesters
Gene Name:
ugpC
Locus Tag:
PA3187
Molecular weight:
42.2 kDa
Reactions
ATP + H(2)O + glycerol-3-phosphate(Out) = ADP + phosphate + glycerol-3-phosphate(In).
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex cysAWTP involved in sulfate/thiosulfate import. Responsible for energy coupling to the transport system
Gene Name:
cysA
Locus Tag:
PA0280
Molecular weight:
36.8 kDa
Reactions
ATP + H(2)O + sulfate(Out) = ADP + phosphate + sulfate(In).
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for ferric enterobactin. Probably responsible for energy coupling to the transport system
Gene Name:
fepC
Locus Tag:
PA4158
Molecular weight:
28.6 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex MalEFGK involved in maltose/maltodextrin import. Responsible for energy coupling to the transport system
Gene Name:
malK
Locus Tag:
PA2341
Molecular weight:
40.2 kDa
Reactions
ATP + H(2)O + maltose(Out) = ADP + phosphate + maltose(In).
General function:
Involved in hydrogen ion transmembrane transporter activity
Specific function:
Key component of the F(0) channel; it plays a direct role in translocation across the membrane. A homomeric c-ring of 10 subunits forms the central stalk rotor element with the F(1) delta and epsilon subunits
Gene Name:
atpE
Locus Tag:
PA5559
Molecular weight:
8.6 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex PotABCD involved in spermidine/putrescine import. Responsible for energy coupling to the transport system
Gene Name:
potA
Locus Tag:
PA3607
Molecular weight:
40 kDa
Reactions
ATP + H(2)O + polyamine(Out) = ADP + phosphate + polyamine(In).
General function:
Involved in nucleotide binding
Specific function:
Probably part of a binding-protein-dependent transport system yecCS for an amino acid. Probably responsible for energy coupling to the transport system
Gene Name:
yecC
Locus Tag:
PA5152
Molecular weight:
28.4 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for phosphate; probably responsible for the translocation of the substrate across the membrane
Gene Name:
pstA
Locus Tag:
PA5367
Molecular weight:
61.2 kDa
General function:
Involved in lipopolysaccharide transport
Specific function:
Part of the ABC transporter complex lptBFG involved in the translocation of lipopolysaccharide (LPS) from the inner membrane to the outer membrane
Gene Name:
lptG
Locus Tag:
PA3827
Molecular weight:
39.2 kDa
General function:
Involved in transporter activity
Specific function:
Part of the ABC transporter complex cysAWTP (TC 3.A.1.6.1) involved in sulfate/thiosulfate import. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
cysW
Locus Tag:
PA0281
Molecular weight:
31.3 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for dipeptides; probably responsible for the translocation of the substrate across the membrane
Gene Name:
dppB
Locus Tag:
PA4503
Molecular weight:
37 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for dipeptides; probably responsible for the translocation of the substrate across the membrane
Gene Name:
dppC
Locus Tag:
PA4504
Molecular weight:
32.4 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for aspartate/glutamate; probably responsible for the translocation of the substrate across the membrane
Gene Name:
gltJ
Locus Tag:
PA1341
Molecular weight:
27.6 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for aspartate/glutamate; probably responsible for the translocation of the substrate across the membrane
Gene Name:
gltK
Locus Tag:
PA1340
Molecular weight:
24.6 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for histidine; probably responsible for the translocation of the substrate across the membrane
Gene Name:
hisM
Locus Tag:
PA2925
Molecular weight:
26.7 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for branched-chain amino acids. Probably responsible for the translocation of the substrates across the membrane
Gene Name:
livH
Locus Tag:
PA1073
Molecular weight:
32.5 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for molybdenum; probably responsible for the translocation of the substrate across the membrane
Gene Name:
modB
Locus Tag:
PA1862
Molecular weight:
24.4 kDa
General function:
Involved in lipopolysaccharide-transporting ATPase acti
Specific function:
Part of the ABC transporter complex lptBFG involved in the translocation of lipopolysaccharide (LPS) from the inner membrane to the outer membrane
Gene Name:
lptF
Locus Tag:
PA3828
Molecular weight:
41.3 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine and spermidine
Gene Name:
potB
Locus Tag:
PA3608
Molecular weight:
32.7 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine and spermidine
Gene Name:
potC
Locus Tag:
PA3609
Molecular weight:
27.7 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine
Gene Name:
potI
Locus Tag:
PA0304
Molecular weight:
31.9 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for phosphate; probably responsible for the translocation of the substrate across the membrane
Gene Name:
pstC
Locus Tag:
PA5368
Molecular weight:
73.8 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for ribose. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
rbsC
Locus Tag:
PA1948
Molecular weight:
34 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for phosphonates; probably responsible for the translocation of the substrate across the membrane
Gene Name:
phnE
Locus Tag:
PA3382
Molecular weight:
28.4 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for branched-chain amino acids. Probably responsible for the translocation of the substrates across the membrane
Gene Name:
livM
Locus Tag:
PA1072
Molecular weight:
45.6 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for ferric enterobactin. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
fepD
Locus Tag:
PA4160
Molecular weight:
34.6 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for ferric enterobactin. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
fepG
Locus Tag:
PA4161
Molecular weight:
34.8 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine
Gene Name:
potH
Locus Tag:
PA0303
Molecular weight:
32.4 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for histidine; probably responsible for the translocation of the substrate across the membrane
Gene Name:
hisQ
Locus Tag:
PA2924
Molecular weight:
24.5 kDa
General function:
Involved in nucleotide binding
Specific function:
Involved in lipid A export and possibly also in glycerophospholipid export and for biogenesis of the outer membrane. Transmembrane domains (TMD) form a pore in the inner membrane and the ATP-binding domain (NBD) is responsible for energy generation
Gene Name:
msbA
Locus Tag:
PA4997
Molecular weight:
66.4 kDa
General function:
Involved in transporter activity
Specific function:
Part of a binding-protein-dependent transport system for aliphatic sulfonates. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
ssuC
Locus Tag:
PA3443
Molecular weight:
28.5 kDa
General function:
Involved in transporter activity
Specific function:
Part of a binding-protein-dependent transport system for taurine. Probably responsible for the translocation of the substrate across the membrane
Gene Name:
tauC
Locus Tag:
PA3936
Molecular weight:
29.4 kDa
General function:
Involved in transporter activity
Specific function:
This protein specifically binds sulfate and is involved in its transmembrane transport
Gene Name:
sbp
Locus Tag:
PA0283
Molecular weight:
36.4 kDa
General function:
Involved in GTP binding
Specific function:
GTP-driven Fe(2+) uptake system
Gene Name:
feoB
Locus Tag:
PA4358
Molecular weight:
82.5 kDa
General function:
Involved in binding
Specific function:
Binds ferrienterobactin; part of the binding-protein- dependent transport system for uptake of ferrienterobactin
Gene Name:
fepB
Locus Tag:
PA4159
Molecular weight:
32.1 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex ZnuABC involved in zinc import. Responsible for energy coupling to the transport system
Gene Name:
znuC
Locus Tag:
PA5500
Molecular weight:
29.2 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for dipeptides. Probably responsible for energy coupling to the transport system
Gene Name:
dppD
Locus Tag:
PA4505
Molecular weight:
35.4 kDa
General function:
Involved in transporter activity
Specific function:
Part of the ABC transporter complex cysAWTP (TC 3.A.1.6.1) involved in sulfate/thiosulfate import. This protein specifically binds thiosulfate and is involved in its transmembrane transport
Gene Name:
cysP
Locus Tag:
PA1493
Molecular weight:
36.5 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for dipeptides. Probably responsible for energy coupling to the transport system
Gene Name:
dppF
Locus Tag:
PA4506
Molecular weight:
36.3 kDa
General function:
Involved in phosphate ion binding
Specific function:
Part of the ABC transporter complex pstSACB involved in phosphate import
Gene Name:
pstS
Locus Tag:
PA5369
Molecular weight:
34.5 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the binding-protein-dependent transport system for glutamate and aspartate. Probably responsible for energy coupling to the transport system
Gene Name:
gltL
Locus Tag:
PA1339
Molecular weight:
26.9 kDa
General function:
Carbohydrate transport and metabolism
Specific function:
Involved in the high-affinity D-ribose membrane transport system and also serves as the primary chemoreceptor for chemotaxis
Gene Name:
rbsB
Locus Tag:
PA1946
Molecular weight:
33.9 kDa
General function:
Involved in nucleotide binding
Specific function:
Component of the leucine-specific transport system
Gene Name:
livG
Locus Tag:
PA1071
Molecular weight:
28.3 kDa
General function:
Involved in transporter activity
Specific function:
Component of the high-affinity histidine permease, a binding-protein-dependent transport system. The other components are proteins hisQ, hisM, and hisP
Gene Name:
hisJ
Locus Tag:
PA2923
Molecular weight:
28.2 kDa
General function:
Involved in ATP binding
Specific function:
Involved in the high-affinity zinc uptake transport system
Gene Name:
znuB
Locus Tag:
PA5501
Molecular weight:
27.3 kDa
General function:
Involved in nucleotide binding
Specific function:
Component of the leucine-specific transport system
Gene Name:
livF
Locus Tag:
PA1070
Molecular weight:
25.6 kDa
General function:
Involved in transporter activity
Specific function:
Dipeptide-binding protein of a transport system that can be subject to osmotic shock. DppA is also required for peptide chemotaxis
Gene Name:
dppA
Locus Tag:
PA4496
Molecular weight:
60.1 kDa
General function:
Not Available
Specific function:
Specific function unknown
Gene Name:
kdpF
Locus Tag:
PA1632
Molecular weight:
3.2 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex TauABC involved in taurine import. Responsible for energy coupling to the transport system
Gene Name:
tauB
Locus Tag:
PA3937
Molecular weight:
28.8 kDa
Reactions
ATP + H(2)O + taurine(Out) = ADP + phosphate + taurine(In).
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex ModABC involved in molybdenum import. Responsible for energy coupling to the transport system
Gene Name:
modC
Locus Tag:
PA1861
Molecular weight:
39.8 kDa
Reactions
ATP + H(2)O + molybdate(Out) = ADP + phosphate + molybdate(In).
General function:
Involved in metal ion binding
Specific function:
Involved in the high-affinity zinc uptake transport system
Gene Name:
znuA
Locus Tag:
PA5498
Molecular weight:
33.6 kDa
General function:
Amino acid transport and metabolism
Specific function:
Part of the binding-protein-dependent transport system for putrescine. Probably responsible for energy coupling to the transport system
Gene Name:
potG
Locus Tag:
PA0302
Molecular weight:
42.8 kDa
General function:
Involved in transporter activity
Specific function:
Part of a binding-protein-dependent transport system for taurine
Gene Name:
tauA
Locus Tag:
PA3938
Molecular weight:
35.9 kDa
General function:
Involved in nucleotide binding
Specific function:
Part of the ABC transporter complex SsuABC involved in aliphatic sulfonates import. Responsible for energy coupling to the transport system (Probable)
Gene Name:
ssuB
Locus Tag:
PA3442
Molecular weight:
29.8 kDa
General function:
Involved in transporter activity
Specific function:
Part of the binding-protein-dependent transport system for glutamate and aspartate. Binds to both aspartate and glutamate
Gene Name:
gltI
Locus Tag:
PA1342
Molecular weight:
33.1 kDa
General function:
Involved in amino acid transport
Specific function:
This protein is a component of the leucine-specific transport system, which is one of the two periplasmic binding protein-dependent transport systems of the high-affinity transport of the branched-chain amino acids in Pseudomonas aeruginosa
Gene Name:
livK
Locus Tag:
PA1074
Molecular weight:
39.8 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine. Polyamine binding protein
Gene Name:
potF
Locus Tag:
PA1410
Molecular weight:
40.5 kDa
General function:
Involved in transporter activity
Specific function:
Required for the activity of the bacterial periplasmic transport system of putrescine and spermidine. Polyamine binding protein
Gene Name:
potD
Locus Tag:
PA3610
Molecular weight:
39.3 kDa
General function:
Involved in molybdate transmembrane-transporting ATPase activity
Specific function:
Involved in the transport of molybdenum into the cell. Binds molybdate with high specificity and affinity
Gene Name:
modA
Locus Tag:
PA1863
Molecular weight:
26.4 kDa
General function:
Inorganic ion transport and metabolism
Specific function:
Part of the ABC transporter complex PhnCDE involved in phosphonates, phosphate esters, phosphite and phosphate import. Responsible for energy coupling to the transport system
Gene Name:
phnC
Locus Tag:
PA3384
Molecular weight:
30.3 kDa
Reactions
ATP + H(2)O + phosphonate(Out) = ADP + phosphate + phosphonate(In).
General function:
alkylphosphonate transport
Specific function:
Phosphonate binding protein that is part of the phosphonate uptake system. Exhibits high affinity for 2-aminoethylphosphonate, and somewhat less affinity to ethylphosphonate, methylphosphonate, phosphonoacetate and phenylphosphonate.
Gene Name:
phnD
Locus Tag:
PA3383
Molecular weight:
37 kDa