Record Information
Version 1.0
Update Date 1/22/2018 11:54:53 AM
Metabolite IDPAMDB000398
Identification
Name: NADH
Description:NADH is the reduced form of NAD+, and NAD+ is the oxidized form of NADH, A coenzyme composed of ribosylnicotinamide 5'-diphosphate coupled to adenosine 5'-phosphate by pyrophosphate linkage. It is found widely in nature and is involved in numerous enzymatic reactions in which it serves as an electron carrier by being alternately oxidized (NAD+) and reduced (NADH). It forms NADP with the addition of a phosphate group to the 2' position of the adenosyl nucleotide through an ester linkage.(Dorland, 27th ed)
Structure
Thumb
Synonyms:
  • 1,4-Dihydronicotinamide adenine dinucleotide
  • B-DPNH
  • B-NADH
  • Beta-DPNH
  • Beta-NADH
  • Dihydrocodehydrogenase I
  • Dihydrocozymase
  • Dihydrodiphosphopyridine nucleotide
  • Dihydronicotinamide adenine dinucleotide
  • Dihydronicotinamide mononucleotide
  • Diphosphopyridine nucleotide reduced
  • DPNH
  • ENADA
  • NAD-reduced
  • NADH
  • NADH+H+
  • NADH2
  • NADH2
  • Nicotinamide adenine dinucleotide reduced
  • Reduced codehydrogenase I
  • Reduced diphosphopyridine nucleotide
  • Reduced nicotinamide adenine diphosphate
  • Reduced nicotinamide adenine diphosphoric acid
  • Reduced nicotinamide-adenine dinucleotide
  • β-DPNH
  • β-NADH
Chemical Formula: C21H29N7O14P2
Average Molecular Weight: 665.441
Monoisotopic Molecular Weight: 665.124771695
InChI Key: BOPGDPNILDQYTO-NNYOXOHSSA-N
InChI:InChI=1S/C21H29N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1,3-4,7-8,10-11,13-16,20-21,29-32H,2,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1
CAS number: 58-68-4
IUPAC Name:[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(2R,3S,4R,5R)-5-(3-carbamoyl-1,4-dihydropyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy})phosphinic acid
Traditional IUPAC Name: NADH
SMILES:NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
Chemical Taxonomy
Taxonomy DescriptionThis compound belongs to the class of organic compounds known as (5'->5')-dinucleotides. These are dinucleotides where the two bases are connected via a (5'->5')-phosphodiester linkage.
Kingdom Organic compounds
Super ClassNucleosides, nucleotides, and analogues
Class (5'->5')-dinucleotides
Sub ClassNot Available
Direct Parent (5'->5')-dinucleotides
Alternative Parents
Substituents
  • (5'->5')-dinucleotide
  • Purine nucleotide sugar
  • Purine ribonucleoside diphosphate
  • Nicotinamide-nucleotide
  • N-glycosyl compound
  • Glycosyl compound
  • Organic pyrophosphate
  • N-substituted nicotinamide
  • Monosaccharide phosphate
  • 6-aminopurine
  • Purine
  • Imidazopyrimidine
  • Dihydropyridinecarboxylic acid derivative
  • Monoalkyl phosphate
  • Dihydropyridine
  • Aminopyrimidine
  • Imidolactam
  • Alkyl phosphate
  • Pyrimidine
  • Primary aromatic amine
  • Phosphoric acid ester
  • Organic phosphoric acid derivative
  • Organic phosphate
  • N-substituted imidazole
  • Monosaccharide
  • Hydropyridine
  • Saccharide
  • Heteroaromatic compound
  • Oxolane
  • Imidazole
  • Azole
  • Tertiary amine
  • Secondary alcohol
  • 1,2-diol
  • Oxacycle
  • Azacycle
  • Organoheterocyclic compound
  • Enamine
  • Carboximidic acid derivative
  • Carboximidic acid
  • Hydrocarbon derivative
  • Primary amine
  • Organooxygen compound
  • Organonitrogen compound
  • Amine
  • Alcohol
  • Aromatic heteropolycyclic compound
Molecular Framework Aromatic heteropolycyclic compounds
External Descriptors
Physical Properties
State: Solid
Charge:-2
Melting point: 140.0-142.0°C
Experimental Properties:
PropertyValueSource
Predicted Properties
PropertyValueSource
Water Solubility2.95 mg/mLALOGPS
logP-1.4ALOGPS
logP-6.5ChemAxon
logS-2.4ALOGPS
pKa (Strongest Acidic)-7ChemAxon
pKa (Strongest Basic)5ChemAxon
Physiological Charge-2ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count8ChemAxon
Polar Surface Area317.62 Å2ChemAxon
Rotatable Bond Count11ChemAxon
Refractivity143 m3·mol-1ChemAxon
Polarizability57.65 Å3ChemAxon
Number of Rings5ChemAxon
Bioavailability0ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations: Cytoplasm
Reactions:
1-Deoxy-D-xylulose 5-phosphate + NAD + O-Phospho-4-hydroxy-L-threonine > Carbon dioxide + Hydrogen ion +2 Water + NADH + Pyridoxine 5'-phosphate + Phosphate
Coenzyme A + NAD + Pyruvic acid > Acetyl-CoA + Carbon dioxide + NADH
alpha-Ketoglutarate + Coenzyme A + NAD > Carbon dioxide + NADH + Succinyl-CoA
Acetaldehyde + Coenzyme A + NAD <> Acetyl-CoA + Hydrogen ion + NADH
Tartronate semialdehyde + Hydrogen ion + NADH <> Glyceric acid + NAD
Flavin Mononucleotide + Hydrogen ion + NADH > FMNH + NAD
Hydrogen ion + NADH + Oxygen + Uracil > NAD + Ureidoacrylate peracid
Hydrogen ion + Hydroxypyruvic acid + NADH > Glyceric acid + NAD
Ethanol + NAD <> Acetaldehyde + Hydrogen ion + NADH
NADH + NADP + 2 Hydrogen ion >2 Hydrogen ion + NAD + NADPH
D-Lactic acid + NAD <> Hydrogen ion + NADH + Pyruvic acid
Dihydrouracil + NAD <> Hydrogen ion + NADH + Uracil
2-Demethylmenaquinone 8 + 4 Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD +3 Hydrogen ion
4 Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8 +3 Hydrogen ion
4 Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD +3 Hydrogen ion
IscS with bound sulfur + MoaD Protein with bound AMP + NADH > Adenosine monophosphate + IscS sulfur acceptor protein + MoaD Protein with thiocarboxylate + NAD
trans-Cinnamic acid + Hydrogen ion + NADH + Oxygen > cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
Hydrogen ion + NADH + Oxygen + Hydrocinnamic acid > Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD
Hydrogen ion + NADH + 2 Nitric oxide > Water + Nitrous oxide + NAD
Water + Hypoxanthine + NAD > Hydrogen ion + NADH + Xanthine
Water + NAD + Xanthine <> Hydrogen ion + NADH + Uric acid
Glycine + NAD + Tetrahydrofolic acid > Carbon dioxide + 5,10-Methylene-THF + NADH + Ammonium
D-Erythrose 4-phosphate + Water + NAD <> 4-Phospho-D-erythronate +2 Hydrogen ion + NADH
5 Hydrogen ion + 3 NADH + Nitrite >2 Water +3 NAD + Ammonium
Glyoxylic acid + Hydrogen ion + NADH > Glycolic acid + NAD
Acetoacetyl-CoA + Hydrogen ion + NADH <> 3-Hydroxybutyryl-CoA + NAD
3-Oxotetradecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxytetradecanoyl-CoA + NAD
3-Oxododecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxydodecanoyl-CoA + NAD
3-Oxodecanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxydecanoyl-CoA + NAD
3-Oxooctanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxyoctanoyl-CoA + NAD
3-Oxohexanoyl-CoA + Hydrogen ion + NADH <> (S)-Hydroxyhexanoyl-CoA + NAD
3-Oxohexadecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxyhexadecanoyl-CoA + NAD
3-Oxooctadecanoyl-CoA + Hydrogen ion + NADH <> (S)-3-Hydroxyoctadecanoyl-CoA + NAD
NAD + NADPH <> NADH + NADP
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Water + Isopentenyl pyrophosphate + NAD
Hydrogen ion + 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH > Dimethylallylpyrophosphate + Water + NAD
Choline + NAD > Betaine aldehyde + Hydrogen ion + NADH
Betaine aldehyde + Water + NAD <> Betaine +2 Hydrogen ion + NADH
3-(3-Hydroxyphenyl)propanoic acid + Hydrogen ion + NADH + Oxygen > 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > Trans-2,3-Dihydroxycinnamate + Water + NAD
D-Glyceraldehyde + Hydrogen ion + NADH <> Glycerol + NAD
S-(Hydroxymethyl)glutathione + NAD <> S-Formylglutathione + Hydrogen ion + NADH
NAD + (S)-Ureidoglycolic acid <> Hydrogen ion + NADH + Oxalureate
6,7-Dihydropteridine + 3 Hydrogen ion + NADH <> NAD + Tetrahydropteridine
(2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate + NAD + 2,3-Dihydro-2,3-dihydroxybenzoic acid <> 2-Pyrocatechuic acid + Hydrogen ion + NADH
[4Fe-4S] iron-sulfur cluster + 2 S-Adenosylmethionine + Hydrogen ion + NAD + octanoate (protein bound) > [2Fe-2S] iron-sulfur cluster +2 5'-Deoxyadenosine +2 Iron + lipoate (protein bound) +2 L-Methionine + NADH
NADH + Peroxyaminoacrylate > 3-Aminoacrylate + Water + NAD
L-D-1-Pyrroline-5-carboxylic acid + 2 Water + NAD > L-Glutamate + Hydrogen ion + NADH
2-Demethylmenaquinone 8 + Hydrogen ion + NADH > 2-Demethylmenaquinol 8 + NAD
Hydrogen ion + NADH + Ubiquinone-8 > NAD + Ubiquinol-8
Hydrogen ion + Menaquinone 8 + NADH > Menaquinol 8 + NAD
But-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH > Butyryl-ACP (n-C4:0ACP) + NAD
Hydrogen ion + NADH + trans-3-cis-11-vacceoyl-[acyl-carrier protein] > NAD + cis-octadec-11-enoyl-[acyl-carrier protein] (n-C18:1)
Hydrogen ion + NADH + trans-3-cis-5-dodecenoyl-[acyl-carrier protein] > cis-dodec-5-enoyl-[acyl-carrier protein] (n-C12:1) + NAD
Hydrogen ion + NADH + trans-3-cis-7-myristoleoyl-[acyl-carrier protein] > NAD + cis-tetradec-7-enoyl-[acyl-carrier protein] (n-C14:1)
Hydrogen ion + NADH + trans-3-cis-9-palmitoleoyl-[acyl-carrier protein] > cis-hexadec-9-enoyl-[acyl-carrier protein] (n-C16:1) + NAD
Hydrogen ion + NADH + trans-Dec-2-enoyl-[acyl-carrier protein] > Decanoyl-ACP (n-C10:0ACP) + NAD
Hydrogen ion + NADH + trans-Dodec-2-enoyl-[acyl-carrier protein] > Dodecanoyl-ACP (n-C12:0ACP) + NAD
Hydrogen ion + NADH + trans-Hex-2-enoyl-[acyl-carrier protein] > Hexanoyl-ACP (n-C6:0ACP) + NAD
Hydrogen ion + NADH + trans-Hexadec-2-enoyl-[acyl-carrier protein] > NAD + Palmitoyl-ACP (n-C16:0ACP)
Hydrogen ion + NADH + trans-Oct-2-enoyl-[acyl-carrier protein] > NAD + Octanoyl-ACP (n-C8:0ACP)
Hydrogen ion + NADH + trans-octadec-2-enoyl-[acyl-carrier protein] > NAD + Octadecanoyl-ACP (n-C18:0ACP)
Hydrogen ion + NADH + trans-Tetradec-2-enoyl-[acyl-carrier protein] > Myristoyl-ACP (n-C14:0ACP) + NAD
Acetaldehyde + Water + NAD > Acetic acid +2 Hydrogen ion + NADH
Water + NAD + Phenylacetaldehyde <>2 Hydrogen ion + NADH + Benzeneacetic acid
(3S)-3-Hydroxyadipyl-CoA + NAD <> Hydrogen ion + NADH + 3-Oxoadipyl-CoA
Water + Lactaldehyde + NAD + (S)-Lactaldehyde <>2 Hydrogen ion + L-Lactic acid + NADH
Glycolaldehyde + Water + NAD > Glycolic acid +2 Hydrogen ion + NADH
4-Aminobutyraldehyde + Water + NAD <> gamma-Aminobutyric acid +2 Hydrogen ion + NADH
L-Malic acid + NAD > Carbon dioxide + NADH + Pyruvic acid
D-Altronate + NAD <> Hydrogen ion + NADH + 5-Keto-D-gluconate + D-Tagaturonate
Water + NAD + Succinic acid semialdehyde >2 Hydrogen ion + NADH + Succinic acid
NAD + Quinate <> 3-Dehydroquinate +2 Hydrogen ion + NADH
Water + NAD + N2-Succinyl-L-glutamic acid 5-semialdehyde <>2 Hydrogen ion + NADH + N-Succinyl-L-glutamate
D-Glyceraldehyde 3-phosphate + NAD + Phosphate <> Glyceric acid 1,3-biphosphate + Hydrogen ion + NADH + 3-phospho-D-glyceroyl phosphate
(R)-Malate + NAD <> Carbon dioxide + NADH + Pyruvic acid
Water + L-Histidinol + 2 NAD >3 Hydrogen ion + L-Histidine +2 NADH
Water + 2 NAD + UDP-Glucose <>3 Hydrogen ion +2 NADH + Uridine diphosphate glucuronic acid + UDP-Glucuronic acid
Galactitol 1-phosphate + NAD <> Hydrogen ion + NADH + D-Tagatose 6-phosphate
NAD + Uridine diphosphate glucuronic acid > Carbon dioxide + NADH + UDP-4-Keto-pyranose
4-Phospho-D-erythronate + NAD <> Hydrogen ion + NADH + 2-Oxo-3-hydroxy-4-phosphobutanoic acid
Water + Inosinic acid + NAD <> Hydrogen ion + NADH + Xanthylic acid
cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD > Trans-2,3-Dihydroxycinnamate + Hydrogen ion + NADH
Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol + NAD > 3-(2,3-Dihydroxyphenyl)propionic acid + Hydrogen ion + NADH
NADH + 2 Nitric oxide + 2 Oxygen > Hydrogen ion + NAD +2 Nitrate
Hydrogen ion + Lactaldehyde + NADH <> (S)-Propane-1,2-diol + NAD
3-Phosphoglycerate + NAD > Phosphohydroxypyruvic acid + Hydrogen ion + NADH
L-Malic acid + NAD <> Hydrogen ion + NADH + Oxalacetic acid
Precorrin 2 + NAD > Hydrogen ion + NADH + Sirohydrochlorin
D-Biotin D-sulfoxide + Hydrogen ion + NADH > Biotin + Water + NAD
2 -Dehydro-L-gulonate + Hydrogen ion + NADH > Gluconic acid + NAD
2 -Dehydro-L-gulonate + Hydrogen ion + NADH > D-Galactonate + NAD
2,5-Diketo-D-gluconate + Hydrogen ion + NADH > 5-Keto-D-gluconate + NAD
2,3-Diketo-L-gulonate + Hydrogen ion + NADH > 3-Dehydro-L-gulonate + NAD
Sorbitol-6-phosphate + NAD <> Fructose 6-phosphate + Hydrogen ion + NADH
NAD + L-Threonine <> L-2-Amino-3-oxobutanoic acid + Hydrogen ion + NADH
Water + 2 NAD + UDP-N-Acetyl-D-mannosamine <>3 Hydrogen ion +2 NADH + UDP-N-Acetyl-D-mannosaminouronate
FAD + Hydrogen ion + NADH > FADH2 + NAD
Hydrogen ion + NADH + Riboflavin > NAD + Reduced riboflavin
Hydrogen ion + NADH + Succinic acid semialdehyde <> gamma-Hydroxybutyrate + NAD
2 Hydrogen ion + 5,10-Methylene-THF + NADH > 5-Methyltetrahydrofolic acid + NAD
Acetol + Hydrogen ion + NADH > (R)-Propane-1,2-diol + NAD
Glycerol + NAD <> Dihydroxyacetone + Hydrogen ion + NADH
Aminoacetone + Hydrogen ion + NADH <> 1-Amino-2-propanol + NAD
Hydrogen ion + Pyruvaldehyde + NADH > D-Lactaldehyde + NAD
5-Aminoimidazole ribonucleotide + Water + NAD > 4-Amino-2-methyl-5-phosphomethylpyrimidine +2 Formic acid +3 Hydrogen ion + NADH
5-Keto-D-gluconate + Hydrogen ion + NADH <> D-Galactonate + NAD
D-Mannonate + NAD <> D-Fructuronate + Hydrogen ion + NADH
2 L-Glutamate + NAD <> L-Glutamine + alpha-Ketoglutarate + NADH + Hydrogen ion
2 Glutathione + NAD <> Glutathione disulfide + NADH + Hydrogen ion
NAD + 2 Cob(II)alamin + 2 Water + Hydrogen ion <> NADH +2 Aquacobalamin
Pyruvaldehyde + NAD + Water <> Pyruvic acid + NADH + Hydrogen ion
L-Malic acid + NAD <> Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion
(R)-Malate + NAD <> Pyruvic acid + Carbon dioxide + NADH + Hydrogen ion
L-Glutamate + NAD + Water <> alpha-Ketoglutarate + Ammonia + NADH + Hydrogen ion
L-Glutamic-gamma-semialdehyde + NAD + Water <> L-Glutamate + NADH + Hydrogen ion
UDP-Glucose + Water + 2 NAD <> Uridine diphosphate glucuronic acid +2 NADH +2 Hydrogen ion
Formic acid + NAD <> Hydrogen ion + Carbon dioxide + NADH
Primary alcohol + NAD <> Aldehyde + NADH + Hydrogen ion
Glycerol 3-phosphate + NAD <> Dihydroxyacetone phosphate + NADH + Hydrogen ion
Tetrahydrofolic acid + NAD <> Dihydrofolic acid + NADH + Hydrogen ion
Tetrahydrofolic acid + 2 NAD <> Folic acid +2 NADH +2 Hydrogen ion
2-Ketobutyric acid + Carbon dioxide + NADH + Hydrogen ion <> D-Erythro-3-Methylmalate + NAD
D-Glyceraldehyde 3-phosphate + Phosphate + NAD <> Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion
L-Histidinal + Water + NAD <> L-Histidine + NADH + Hydrogen ion
Butanal + Coenzyme A + NAD <> Butanoyl-CoA + NADH + Hydrogen ion
Glycine + Tetrahydrofolic acid + NAD <> 5,10-Methylene-THF + Ammonia + Carbon dioxide + NADH + Hydrogen ion
L-Proline + NAD <> L-D-1-Pyrroline-5-carboxylic acid + NADH + Hydrogen ion
Lactaldehyde + NAD + Water <> L-Lactic acid + NADH + Hydrogen ion
3-Phospho-D-glycerate + NAD <> Phosphohydroxypyruvic acid + NADH + Hydrogen ion
2-Keto-3-deoxy-D-gluconic acid + NAD <> (4S)-4,6-Dihydroxy-2,5-dioxohexanoate + NADH + Hydrogen ion
Dihydrolipoamide + NAD <> Lipoamide + NADH + Hydrogen ion
Prephenate + NAD <> 4-Hydroxyphenylpyruvic acid + Carbon dioxide + NADH + Hydrogen ion
L-Homoserine + NAD <> L-Aspartate-semialdehyde + NADH + Hydrogen ion
Ethylene glycol + NAD <> Glycolaldehyde + NADH + Hydrogen ion
Oxoadipic acid + Coenzyme A + NAD <> Glutaryl-CoA + Carbon dioxide + NADH + Hydrogen ion
(S)-3-Hydroxybutanoyl-CoA + NAD <> Acetoacetyl-CoA + NADH + Hydrogen ion
2 Reduced rubredoxin + NAD <>2 Oxidized rubredoxin + NADH + Hydrogen ion
Retinol + NAD <> Retinal + NADH + Hydrogen ion
Dihydrofolic acid + NAD <> Folic acid + NADH + Hydrogen ion
Propylene glycol + NAD <> Lactaldehyde + NADH + Hydrogen ion
Meso-Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
D-Altronate + NAD <> 5-Keto-D-gluconate + NADH + Hydrogen ion
Sorbitol-6-phosphate + NAD <> beta-D-Fructose 6-phosphate + NADH + Hydrogen ion
L-Histidinol + NAD <> L-Histidinal + NADH + Hydrogen ion
UDP-N-Acetylmuraminate + NAD <> UDP-N-Acetyl-3-(1-carboxyvinyl)-D-glucosamine + NADH + Hydrogen ion
Hydroxyproline + NAD <> Pyrroline hydroxycarboxylic acid + NADH + Hydrogen ion
Dihydrolipoylprotein + NAD <> Lipoylprotein + NADH + Hydrogen ion
Tetrahydrodipicolinate + NAD <> 2,3-Dihydrodipicolinic acid + NADH + Hydrogen ion
Butyryl-[acp] + NAD <> But-2-enoyl-[acyl-carrier protein] + NADH + Hydrogen ion
Pyrroline hydroxycarboxylic acid + NAD + 2 Water <> L-erythro-4-Hydroxyglutamate + NADH + Hydrogen ion
Dodecanoyl-[acyl-carrier protein] + NAD <> trans-Dodec-2-enoyl-[acp] + NADH + Hydrogen ion
(S)-3-Hydroxytetradecanoyl-CoA + NAD <> 3-Oxotetradecanoyl-CoA + NADH
Hexanoyl-[acp] + NAD <> trans-Hex-2-enoyl-[acp] + NADH + Hydrogen ion
Octanoyl-[acp] + NAD <> trans-Oct-2-enoyl-[acp] + NADH + Hydrogen ion
Decanoyl-[acp] + NAD <> trans-Dec-2-enoyl-[acp] + NADH + Hydrogen ion
Tetradecanoyl-[acp] + NAD <> trans-Tetradec-2-enoyl-[acp] + NADH + Hydrogen ion
Hexadecanoyl-[acp] + NAD <> trans-Hexadec-2-enoyl-[acp] + NADH + Hydrogen ion
(S)-3-Hydroxyisobutyrate + NAD <> (S)-Methylmalonic acid semialdehyde + NADH + Hydrogen ion
trans-3-Chloro-2-propene-1-ol + NAD <> trans-3-Chloroallyl aldehyde + NADH + Hydrogen ion
cis-3-Chloro-2-propene-1-ol + NAD <> cis-3-Chloroallyl aldehyde + NADH + Hydrogen ion
4-Chlorobiphenyl + Oxygen + NADH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxy-4'-chlorobiphenyl + NAD
Biphenyl + Oxygen + NADH + Hydrogen ion <> cis-2,3-Dihydro-2,3-dihydroxybiphenyl + NAD
Ethylbenzene + Oxygen + NADH + Hydrogen ion <> cis-1,2-Dihydro-3-ethylcatechol + NAD
O-Phospho-4-hydroxy-L-threonine + NAD <> 2-Amino-3-oxo-4-phosphonooxybutyrate + NADH + Hydrogen ion
Tartaric acid + NAD <> 2-Hydroxy-3-oxosuccinate + NADH + Hydrogen ion
Hydrocinnamic acid + Oxygen + NADH + Hydrogen ion <> cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD <> 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion
Shikimic acid + NAD <> 3-Dehydro-shikimate + NADH + Hydrogen ion
Bisphenol A + NADH + Hydrogen ion + Oxygen <> 1,2-Bis(4-hydroxyphenyl)-2-propanol + NAD + Water
2,2-Bis(4-hydroxyphenyl)-1-propanol + NADH + Hydrogen ion + Oxygen <> 2,3-Bis(4-hydroxyphenyl)-1,2-propanediol + NAD + Water
(2-Naphthyl)methanol + NAD <> 2-Naphthaldehyde + NADH + Hydrogen ion
Chloral hydrate + NADH + Hydrogen ion <> Trichloroethanol + NAD + Water
gamma-Glutamyl-gamma-butyraldehyde + NAD + Water <> 4-(Glutamylamino) butanoate + NADH + Hydrogen ion
Enzyme N6-(dihydrolipoyl)lysine + NAD <> Enzyme N6-(lipoyl)lysine + NADH + Hydrogen ion
Uridine diphosphate glucuronic acid + NAD <> UDP-4-Keto-pyranose + Carbon dioxide + NADH + Hydrogen ion
(2E)-Octadecenoyl-[acp] + NADH + Hydrogen ion <> Octadecanoyl-[acyl-carrier protein] + NAD
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 4-Hydroxylamino-2,6-dinitrotoluene +2 NAD + Water
Trinitrotoluene + 2 NADH + 2 Hydrogen ion <> 2-Hydroxylamino-4,6-dinitrotoluene +2 NAD + Water
3-Hydroxy-5-methylhex-4-enoyl-CoA + NAD <> 5-Methyl-3-oxo-4-hexenoyl-CoA + NADH + Hydrogen ion
6-Thioinosine-5'-monophosphate + NAD + Water <> 6-Thioxanthine 5'-monophosphate + NADH + Hydrogen ion
2-Phenyl-1,3-propanediol monocarbamate + NAD <> 3-Carbamoyl-2-phenylpropionaldehyde + NADH + Hydrogen ion
4-Hydroxy-5-phenyltetrahydro-1,3-oxazin-2-one + NAD <> 5-Phenyl-1,3-oxazinane-2,4-dione + NADH + Hydrogen ion
Oxoglutaric acid + Coenzyme A + NAD > Succinyl-CoA + Carbon dioxide + NADH
4,6-Dideoxy-4-oxo-dTDP-D-glucose + NADH + Hydrogen ion <> Deoxythymidine diphosphate-L-rhamnose + NAD
NADH + Water > (<i>S</i>)-NADHX
NADH + Water > (<i>R</i>)-NADHX
Propylene glycol + NAD <> acetol + NADH + Hydrogen ion
L-Galactonate + NAD > Hydrogen ion + D-tagaturonate + NADH
Ureidoacrylate peracid + NADH > 3-ureidoacrylate + NAD + Water
D-Galactose + NAD 3-keto-&beta;-D-galactose + NADH + Hydrogen ion
3-Isopropylmalate + NAD <> 2-Isopropyl-3-oxosuccinate + NADH + Hydrogen ion
a primary alcohol + NAD <> an aldehyde + NADH + Hydrogen ion
NAD + D-Altronate <> Hydrogen ion + NADH + D-tagaturonate
NAD + (2S,3S)-2,3-Dihydro-2,3-dihydroxybenzoate > Hydrogen ion + NADH + 2-Pyrocatechuic acid
histidinal + NAD + Water > Hydrogen ion + L-Histidine + NADH
L-Histidinol + NAD > Hydrogen ion + histidinal + NADH
NAD + 2-Deoxygluconate <> Hydrogen ion + NADH + 3-Dehydro-2-deoxy-D-gluconate
Hydrogen ion + 3-(3-Hydroxyphenyl)propionate + NADH + Oxygen > Water + 3-(2,3-Dihydroxyphenyl)propionic acid + NAD
Hydrogen ion + a ubiquinone + NADH <> a ubiquinol + NAD
menadione + NADH + Hydrogen ion menadiol + NAD
NAD + a (3<i>S</i>)-3-hydroxyacyl-CoA > NADH + a 3-oxoacyl-CoA + Hydrogen ion
Water + NAD + Phenylacetaldehyde <> Hydrogen ion + NADH + phenylacetate
Prephenate + NAD > 4-Hydroxyphenylpyruvic acid + Carbon dioxide + NADH
NADH + Copper Hydrogen ion + NAD + Cu<SUP>+</SUP>
an alcohol + Water + NAD < an organic hydroperoxide + NADH + Hydrogen ion
2-hydroxyglutarate + NAD <> Hydrogen ion + Oxoglutaric acid + NADH
3-Hydroxyadipyl-CoA + NAD <> Hydrogen ion + 3-Oxoadipyl-CoA + NADH
NADH + Water > Hydrogen ion + NMNH + Adenosine monophosphate
Hydrogen ion + Pyruvaldehyde + NADH acetol + NAD
NADH + Hydrogen ion + a menaquinone > a menaquinol + NAD
3-hydroxypropionaldehyde + NAD + Water > Hydrogen ion + 3-Hydroxypropanoate + NADH
Dihydrothymine + NAD <> Thymine + NADH + Hydrogen ion
a quinone + NADH NAD + a semiquinone
(<i>S</i>)-NADHX + ADP > Hydrogen ion + NADH + Adenosine monophosphate + Phosphate
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water > N<SUP>2</SUP>-succinylglutamate + NADH + Hydrogen ion
Trimethylamine N-Oxide + NADH + Hydrogen ion > Trimethylamine + NAD + Water
3-Hydroxyisobutyric acid + NAD <> 2-Aminomalonate semialdehyde + NADH
4-Aminobutyraldehyde + NAD + Water > gamma-Aminobutyric acid + NADH
An alcohol + NAD > an aldehyde or ketone + NADH
Lactaldehyde + NAD + Water > L-Lactic acid + NADH
Glycolaldehyde + NAD + Water > Glycolic acid + NADH
UDP-Glucuronic acid + NAD > UDP-beta-L-Threo-pentapyranos-4-ulose + Carbon dioxide + NADH
N2-Succinyl-L-glutamic acid 5-semialdehyde + NAD + Water > N-Succinyl-L-glutamate + NADH
Betaine aldehyde + NAD + Water > Betaine + NADH
NADH + acceptor > NAD + reduced acceptor
Protein N(6)-(dihydrolipoyl)lysine + NAD > protein N(6)-(lipoyl)lysine + NADH
D-Lactic acid + NAD > Pyruvic acid + NADH
D-Erythrose 4-phosphate + NAD + Water > 4-Phospho-D-erythronate + NADH
Acyl-[acyl-carrier-protein] + NAD > trans-2,3-dehydroacyl-[acyl-carrier-protein] + NADH
(S)-3-hydroxyacyl-CoA + NAD > 3-oxoacyl-CoA + NADH
Formic acid + NAD > Carbon dioxide + NADH
Phenylacetaldehyde + NAD + Water > Benzeneacetic acid + NADH
2 Cob(II)alamin + NAD >2 Aquacobalamin + NADH
(R)-Propane-1,2-diol + NAD > D-Lactaldehyde + NADH
(S)-Propane-1,2-diol + NAD > Lactaldehyde + NADH
D-Glyceraldehyde 3-phosphate + Inorganic phosphate + NAD > 3-phospho-D-glyceroyl phosphate + NADH
Galactitol 1-phosphate + NAD > L-Tagatose-6-phosphate + NADH
Glycerol + NAD > Dihydroxyacetone + NADH
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD > 3-(2,3-Dihydroxyphenyl)propanoate + NADH
cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD > Trans-2,3-Dihydroxycinnamate + NADH
Reduced ferredoxin + NAD > oxidized ferredoxin + NADH
Hydrocinnamic acid + NADH + Oxygen > cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD
trans-Cinnamic acid + NADH + Oxygen > Trans-2,3-Dihydroxycinnamate + NAD
L-Histidinol + Water + 2 NAD > L-Histidine +2 NADH
Inosinic acid + NAD + Water > Xanthylic acid + NADH
2-Keto-3-deoxy-D-gluconic acid + NAD > (4S)-4,6-Dihydroxy-2,5-dioxohexanoate + NADH
3-Isopropylmalate + NAD > Ketoleucine + Carbon dioxide + NADH
L-Malic acid + NAD > Oxalacetic acid + NADH
3-(3-Hydroxyphenyl)propanoic acid + NADH + Oxygen > 3-(2,3-Dihydroxyphenyl)propanoate + Water + NAD
3-Hydroxycinnamic acid + NADH + Oxygen > Trans-2,3-Dihydroxycinnamate + Water + NAD
Mannitol 1-phosphate + NAD > Fructose 6-phosphate + NADH
Tetrahydropteridine + NAD > 6,7-Dihydropteridine + NADH
ADP + (6S)-6-beta-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide > Adenosine monophosphate + Inorganic phosphate + NADH
Reduced NO reductase rubredoxin + NAD > oxidized NO reductase rubredoxin + NADH
NADH + Quinone > NAD + Hydroquinone
4-Phospho-D-erythronate + NAD > 2-Oxo-3-hydroxy-4-phosphobutanoic acid + NADH
Dihydrouracil + NAD > Uracil + NADH
Dihydrothymine + NAD > Thymine + NADH
FMNH(2) + NAD > Flavin Mononucleotide + NADH
3-Phospho-D-glycerate + NAD > Phosphohydroxypyruvic acid + NADH
D-2-Hydroxyglutaric acid + NAD > Oxoglutaric acid + NADH
Sorbitol-6-phosphate + NAD > Fructose 6-phosphate + NADH
L-Threonine + NAD > L-2-Amino-3-oxobutanoic acid + NADH
UDP-Glucose + 2 NAD + Water > UDP-Glucuronic acid +2 NADH
D-Altronate + NAD > D-tagaturonate + NADH
D-Mannonate + NAD > D-Fructuronate + NADH
UDP-N-Acetyl-D-mannosamine + 2 NAD + Water > UDP-N-Acetyl-D-mannosaminouronate +2 NADH
Xanthine + NAD + Water > Uric acid + NADH
Hypoxanthine + NAD + Water > Xanthine + NADH
Succinic acid semialdehyde + NAD + NADP + Water <> Succinic acid + NADH + NADPH +2 Hydrogen ion
Glyceric acid + NAD + NADP <> Tartronate semialdehyde + NADH + NADPH + Hydrogen ion
Protein dithiol + NAD + NADP <> Protein disulfide + NADH + NADPH + Hydrogen ion
Isopentenyl pyrophosphate + NAD + NADP + Water + Dimethylallylpyrophosphate <> 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate + NADH + NADPH + Hydrogen ion
Tetrahydrodipicolinate + NAD + NADP + Water <> (2S,4S)-4-Hydroxy-2,3,4,5-tetrahydrodipicolinate + NADH + NADPH + Hydrogen ion
Protein N6-(dihydrolipoyl)lysine + NAD <> Protein N6-(lipoyl)lysine + NADH + Hydrogen ion
3-(3-Hydroxyphenyl)propanoic acid + NADH + Hydrogen ion + Oxygen + 3-Hydroxycinnamic acid <> 3-(2,3-Dihydroxyphenyl)propionic acid + Water + NAD + Trans-2,3-Dihydroxycinnamate
NADH + Hydrogen ion + Acceptor <> NAD + Reduced acceptor
Quinate + NAD + NADP + Shikimic acid <> 3-Dehydroquinate + NADH + NADPH + Hydrogen ion + 3-Dehydro-shikimate
Dihydrouracil + NAD + Dihydrothymine <> Uracil + NADH + Hydrogen ion + Thymine
NADH + Hydrogen ion + Oxygen + Hydrocinnamic acid <> cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + Trans-2,3-Dihydroxycinnamate
cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol + NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol <> 3-(2,3-Dihydroxyphenyl)propionic acid + NADH + Hydrogen ion + Trans-2,3-Dihydroxycinnamate
NAD + Hydrogen ion <> NADH
Nitric oxide + 2 Oxygen + NADH + NADPH <>2 Nitrate + NAD + NADP + Hydrogen ion
Sorbitol 6-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
3-Dehydro-L-gulonate + NAD + NADP <> 2,3-Diketo-L-gulonate + NADH + NADPH + Hydrogen ion
Mannitol 1-phosphate + NAD <> Fructose 6-phosphate + NADH + Hydrogen ion
5-Methyltetrahydrofolic acid + NAD + NADP <> 5,10-Methylene-THF + NADH + NADPH + Hydrogen ion
ADP + (6S)-6-beta-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide + (6S)-6beta-Hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide phosphate <> Adenosine monophosphate + Phosphate + NADH + NADPH
NAD + 2-Amino-3-oxo-4-phosphonooxybutyrate + O-Phospho-4-hydroxy-L-threonine <> 3-Amino-2-oxopropyl phosphate + Carbon dioxide + NADH + Hydrogen ion
3-Isopropylmalate + NAD + 2-Isopropyl-3-oxosuccinate <> Ketoleucine + Carbon dioxide + NADH + Hydrogen ion
S-(Hydroxymethyl)glutathione + NAD + NADP <> S-Formylglutathione + NADH + NADPH + Hydrogen ion
L-Proline + NAD + NADP <> (S)-1-pyrroline-5-carboxylate + NADH + NADPH + Hydrogen ion
Tetrahydropteridine + NAD + NADP <> 6,7-Dihydropteridine + NADH + NADPH + Hydrogen ion
NADH + NADPH + Hydrogen ion + Quinone <> NAD + NADP + Hydroquinone
Acyl-[acyl-carrier protein] + NAD <> trans-2,3-Dehydroacyl-[acyl-carrier protein] + NADH + Hydrogen ion
Primary alcohol + NAD + Secondary alcohol <> Aldehyde + NADH + Hydrogen ion + Ketone
L-Malic acid + NAD + Oxalacetic acid <> Pyruvic acid + Carbon dioxide + NADH
L-Gulonate + NAD <> D-Fructuronate + NADH + Hydrogen ion
Cholic acid + NAD <> NADH + Hydrogen ion
NAD + Galactitol 1-phosphate <> L-Tagatose-6-phosphate + NADH + Hydrogen ion
NADH + Ubiquinone-1 <> NAD + Ubiquinol-8
(3S)-3-Hydroxyacyl-CoA + NAD <> 3-Oxoacyl-CoA + NADH + Hydrogen ion
(R)-Propane-1,2-diol + (S)-Propane-1,2-diol + NAD <> D-Lactaldehyde + (S)-Lactaldehyde + NADH + Hydrogen ion
3-Phospho-D-glycerate + NAD + D-2-Hydroxyglutaric acid <> Phosphohydroxypyruvic acid + NADH + Hydrogen ion + alpha-Ketoglutarate
Glycerol 3-phosphate + NAD + NADP <> Dihydroxyacetone phosphate + NADH + NADPH + Hydrogen ion
4-Hydroxybutanoic acid + NAD <> Succinic acid semialdehyde + NADH + Hydrogen ion
Gluconic acid + NAD + NADP <> 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion
L-Idonate + NAD + NADP <> 5-Keto-D-gluconate + NADH + NADPH + Hydrogen ion
Ammonia + NAD + 3 NADP + 2 Water <> Nitrite + NADH +3 NADPH +5 Hydrogen ion
(S)-Ureidoglycolic acid + NAD + NADP <> Oxalureate + NADH + NADPH + Hydrogen ion
Nitrite + 3 NADH + 5 Hydrogen ion + Nitrite Ammonia +2 Water +3 NAD
(3S)-3-hydroxyacyl-CoA + NAD > NADH + Hydrogen ion + a 3-oxoacyl-CoA?
3-Hydroxybutyryl-CoA + NAD + 3-Hydroxybutyryl-CoA > NADH + Hydrogen ion + Acetoacetyl-CoA + Acetoacetyl-CoA
(S)-Hydroxyoctanoyl-CoA + NAD + (S)-Hydroxyoctanoyl-CoA NADH + Hydrogen ion + 3-Oxooctanoyl-CoA
(S)-3-Hydroxyoctadecanoyl-CoA + NAD > NADH + Hydrogen ion + 3-Oxooctadecanoyl-CoA + 3-Oxooctadecanoyl-CoA
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2,3-Dihydroxybenzoic acid + NADH + Hydrogen ion
2,3-dihydroxy-2,3-dihydrobenzoate + NAD > 2-Pyrocatechuic acid + NADH + Hydrogen ion
NAD + 3-Hydroxy-5-methylhex-4-enoyl-CoA > NADH + Hydrogen ion + 5-Methyl-3-oxo-4-hexenoyl-CoA
(3S)-3-Hydroxyadipyl-CoA + NAD > 3-Oxoadipyl-CoA + NADH + Hydrogen ion
Isocitric acid + NAD + Isocitric acid > Oxoglutaric acid + Carbon dioxide + NADH + Hydrogen ion
Oxoglutaric acid + NAD + Coenzyme A > Succinyl-CoA + NADH + Hydrogen ion + Carbon dioxide + Succinyl-CoA
L-Malic acid + NAD + L-Malic acid <> Oxalacetic acid + NADH + Hydrogen ion
Oxoglutaric acid + NAD + Coenzyme A > NADH + Carbon dioxide + Succinyl-CoA + Succinyl-CoA
D-Glyceraldehyde 3-phosphate + NAD + Phosphate + D-Glyceraldehyde 3-phosphate > Glyceric acid 1,3-biphosphate + NADH + Hydrogen ion + Glyceric acid 1,3-biphosphate
N2-Succinyl-L-glutamic acid 5-semialdehyde + Water + NAD >2 Hydrogen ion + NADH + N2-succinylglutamate + N2-succinylglutamate
2,3-Diketo-L-gulonate + NADH + Hydrogen ion + 2,3-Diketo-L-gulonate > 3-Dehydro-L-gulonate + NAD
L-Glutamic-gamma-semialdehyde + NAD + Water >2 Hydrogen ion + NADH + L-Glutamic acid + L-Glutamate
trans-?3-cis-?7-tetradecenoyl-[acp] + Hydrogen ion + NADH > NAD + cis-?7-tetradecenoyl-[acp]?
trans tetradec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + myristoyl-[acp]
trans-?3-cis-?5-dodecenoyl-[acp] + Hydrogen ion + NADH > cis-?5-dodecenoyl-[acp]? + NAD
trans-?3-cis-?9-hexadecenoyl-[acp] + Hydrogen ion + NADH > NAD + a palmitoleoyl-[acp]?
cis-vaccen-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + a cis-vaccenoyl-[acp]
trans-2-enoyl-[acyl-carrier protein] + Hydrogen ion + NADH > NAD + 2,3,4-saturated fatty acyl-[acp]
crotonyl-[acp] + Hydrogen ion + NADH > NAD + butyryl-[acp]
trans hex-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + hexanoyl-[acyl-carrier-protein]
trans oct-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + Octanoyl-[acyl-carrier protein]
a trans-?2-decenoyl-[acp]? + Hydrogen ion + NADH > NAD + decanoyl-[acp]
trans dodec-2-enoyl-[acp] + Hydrogen ion + NADH > NAD + dodecanoyl-[acp]?
Hydrogen ion + NADH + trans hexadecenoyl-[acp] > NAD + palmitoyl-[acp]
3-Phosphoglyceric acid + NAD + 3-Phosphoglycerate > NADH + Hydrogen ion + Phosphohydroxypyruvic acid
Prephenate + NAD > NADH + Carbon dioxide + 4-hydroxyphenylpyruvate
Water + NAD + Histidinal >2 Hydrogen ion + NADH + L-Histidine + L-Histidine
L-Malic acid + NAD + L-Malic acid > Carbon dioxide + NADH + Pyruvic acid
Galactose 1-phosphate + NAD + Galactose 1-phosphate > NADH + Hydrogen ion + D-tagatofuranose 6-phosphate
NAD + Water + (S)-lactaldehyde + Lactaldehyde > NADH +2 Hydrogen ion + L-Lactic acid + L-Lactic acid
(S)-lactaldehyde + NADH + Hydrogen ion + Lactaldehyde > NAD + Propylene glycol
D-Fructuronate + NADH + Hydrogen ion > NAD + D-altronate
D-tagaturonate + NADH + Hydrogen ion + D-Tagaturonate > NAD + D-altronate + D-altronate
UDP-N-acetyl-D-mannosamine + 2 NAD + Water + UDP-N-Acetyl-D-mannosamine > UDP-N-acetyl-α-D-mannosaminuronate +2 NADH +3 Hydrogen ion
UDP-Glucose + 2 NAD + Water > UDP-Glucuronic acid +2 NADH +3 Hydrogen ion
UDP-Glucuronic acid + NAD > Carbon dioxide + NADH + UDP-β-L-threo-pentapyranos-4-ulose
Precorrin-2 + NAD > NADH + Hydrogen ion + Sirohydrochlorin
3-Hydroxycinnamic acid + Hydrogen ion + NADH + Oxygen > NAD + Water + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
Cinnamic acid + NADH + Oxygen <> cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol + NAD
NADH + Oxygen + 3-phenylpropanoate <> NAD + cis-3-(Carboxy-ethyl)-3,5-cyclo-hexadiene-1,2-diol
NADH + Oxygen + 3-phenylpropanoate <> NAD + Cis-3-(3-carboxyethyl)-3,5-cyclohexadiene-1,2-diol
Copper + NADH > NAD + Cu(+)
Fructose 6-phosphate + NADH + Hydrogen ion + Fructose 6-phosphate <> NAD + Mannitol 1-phosphate
NAD + cis-3-(3-Carboxyethenyl)-3,5-cyclohexadiene-1,2-diol > NADH + Hydrogen ion + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid + 2-Hydroxy-3-(4-hydroxyphenyl)propenoic acid
L-Threonine + NAD + L-Threonine > Hydrogen ion + NADH + L-2-Amino-3-oxobutanoic acid
NADH + 5 Hydrogen ion + Ubiquinone-1 > Hydrogen ion + NAD + Ubiquinol-1
NADH + 4 Hydrogen ion + 2 Hydrogen ion + menaquinone-8 NAD + Hydrogen ion + Menaquinol 8 + Electron +4 Hydrogen ion
1-Amino-2-propanol + NAD + 4,5-Dihydro-4-hydroxy-5-S-glutathionyl-benzo[a]pyrene < NADH + Hydrogen ion + Aminoacetone
More...

Pathways:
Spectra
Spectra:
Spectrum TypeDescriptionSplash Key
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Positivesplash10-000i-0931104000-bf6579d19ee9bc297e13View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Positivesplash10-000i-0901000000-92672b1d4b96838f8652View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Positivesplash10-000i-1900000000-ef56d203da65089e145fView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, Negativesplash10-03e9-1900207000-f248eb28a7283de7118bView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, Negativesplash10-001i-1900100000-efadf1d6c54e9e86671dView in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, Negativesplash10-0a7i-3900000000-f258fc2bf1d8e54ac6daView in MoNA
References
References:
  • Belenky P, Bogan KL, Brenner C: NAD+ metabolism in health and disease. Trends Biochem Sci. 2007 Jan;32(1):12-9. Epub 2006 Dec 11. Pubmed: 17161604
  • Bennett, B. D., Kimball, E. H., Gao, M., Osterhout, R., Van Dien, S. J., Rabinowitz, J. D. (2009). "Absolute metabolite concentrations and implied enzyme active site occupancy in Escherichia coli." Nat Chem Biol 5:593-599. Pubmed: 19561621
  • Biellmann JF, Lapinte C, Haid E, Weimann G: Structure of lactate dehydrogenase inhibitor generated from coenzyme. Biochemistry. 1979 Apr 3;18(7):1212-7. Pubmed: 218616
  • Desir G, Bratusch-Marrain P, DeFronzo RA: Effect of hyperketonemia on renal ammonia excretion in man. Metabolism. 1986 Aug;35(8):736-43. Pubmed: 3736414
  • Fulco M, Schiltz RL, Iezzi S, King MT, Zhao P, Kashiwaya Y, Hoffman E, Veech RL, Sartorelli V: Sir2 regulates skeletal muscle differentiation as a potential sensor of the redox state. Mol Cell. 2003 Jul;12(1):51-62. Pubmed: 12887892
  • Harbord MG, Hwang PA, Robinson BH, Becker LE, Hunjan A, Murphy EG: Infant-onset progressive myoclonus epilepsy. J Child Neurol. 1991 Apr;6(2):134-42. Pubmed: 1904460
  • Heiman-Patterson TD, Argov Z, Chavin JM, Kalman B, Alder H, DiMauro S, Bank W, Tahmoush AJ: Biochemical and genetic studies in a family with mitochondrial myopathy. Muscle Nerve. 1997 Oct;20(10):1219-24. Pubmed: 9324076
  • Helge JW, Fraser AM, Kriketos AD, Jenkins AB, Calvert GD, Ayre KJ, Storlien LH: Interrelationships between muscle fibre type, substrate oxidation and body fat. Int J Obes Relat Metab Disord. 1999 Sep;23(9):986-91. Pubmed: 10490806
  • Jawed S, Stevens CR, Harrison R, Blake DR: Elevated circulating plasma NADH oxidising activity of xanthine oxidoreductase in plasma. Biochem Soc Trans. 1997 Aug;25(3):531S. Pubmed: 9388747
  • Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114. Pubmed: 22080510
  • Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590. Pubmed: 21097882
  • Khan JA, Forouhar F, Tao X, Tong L: Nicotinamide adenine dinucleotide metabolism as an attractive target for drug discovery. Expert Opin Ther Targets. 2007 May;11(5):695-705. Pubmed: 17465726
  • Krotz F, Sohn HY, Gloe T, Zahler S, Riexinger T, Schiele TM, Becker BF, Theisen K, Klauss V, Pohl U: NAD(P)H oxidase-dependent platelet superoxide anion release increases platelet recruitment. Blood. 2002 Aug 1;100(3):917-24. Pubmed: 12130503
  • Li D, Gan Y, Wientjes MG, Badalament RA, Au JL: Distribution of DT-diaphorase and reduced nicotinamide adenine dinucleotide phosphate: cytochrome p450 oxidoreductase in bladder tissues and tumors. J Urol. 2001 Dec;166(6):2500-5. Pubmed: 11696818
  • Lin SJ, Guarente L: Nicotinamide adenine dinucleotide, a metabolic regulator of transcription, longevity and disease. Curr Opin Cell Biol. 2003 Apr;15(2):241-6. Pubmed: 12648681
  • Mayevsky A, Meilin S, Manor T, Ornstein E, Zarchin N, Sonn J: Multiparametric monitoring of brain oxygen balance under experimental and clinical conditions. Neurol Res. 1998;20 Suppl 1:S76-80. Pubmed: 9584930
  • Mintun MA, Vlassenko AG, Rundle MM, Raichle ME: Increased lactate/pyruvate ratio augments blood flow in physiologically activated human brain. Proc Natl Acad Sci U S A. 2004 Jan 13;101(2):659-64. Epub 2004 Jan 2. Pubmed: 14704276
  • Nadlinger K, Westerthaler W, Storga-Tomic D, Birkmayer JG: Extracellular metabolisation of NADH by blood cells correlates with intracellular ATP levels. Biochim Biophys Acta. 2002 Nov 14;1573(2):177-82. Pubmed: 12399028
  • Nomura H, Koike F, Tsuruta Y, Iwaki A, Iwaki T: Autopsy case of autosomal recessive hereditary spastic paraplegia with reference to the muscular pathology. Neuropathology. 2001 Sep;21(3):212-7. Pubmed: 11666018
  • Odland LM, Heigenhauser GJ, Spriet LL: Effects of high fat provision on muscle PDH activation and malonyl-CoA content in moderate exercise. J Appl Physiol. 2000 Dec;89(6):2352-8. Pubmed: 11090589
  • Orallo F, Alvarez E, Camina M, Leiro JM, Gomez E, Fernandez P: The possible implication of trans-Resveratrol in the cardioprotective effects of long-term moderate wine consumption. Mol Pharmacol. 2002 Feb;61(2):294-302. Pubmed: 11809853
  • Pollak N, Dolle C, Ziegler M: The power to reduce: pyridine nucleotides--small molecules with a multitude of functions. Biochem J. 2007 Mar 1;402(2):205-18. Pubmed: 17295611
  • Rani K, Garg P, Pundir CS: Measurement of bile acid in serum and bile with arylamine-glass-bound 3alpha-hydroxysteroid dehydrogenase and diaphorase. Anal Biochem. 2004 Sep 1;332(1):32-7. Pubmed: 15301946
  • Saada A, Bar-Meir M, Belaiche C, Miller C, Elpeleg O: Evaluation of enzymatic assays and compounds affecting ATP production in mitochondrial respiratory chain complex I deficiency. Anal Biochem. 2004 Dec 1;335(1):66-72. Pubmed: 15519572
  • Uppal A, Ghosh N, Datta A, Gupta PK: Fluorimetric estimation of the concentration of NADH from human blood samples. Biotechnol Appl Biochem. 2005 Feb;41(Pt 1):43-7. Pubmed: 15035655
  • van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25. Pubmed: 17765195
  • WholeHealthMD: http://www.wholehealthmd.com/ME2/dirmod.asp?sid=17E09E7CFFF640448FFB0B4FC1B7FEF0&nm=Reference+Library&type=AWHN_Supplements&mod=Supplements&mid=&id=F8DDC620C82D41D1A6FBEDDD38337F63&tier=2
  • Yamamoto T, Moriwaki Y, Takahashi S, Suda M, Higashino K: Ethanol as a xanthine dehydrogenase inhibitor. Metabolism. 1995 Jun;44(6):779-85. Pubmed: 7783663
  • Yamamoto T, Moriwaki Y, Takahashi S, Suda M, Higashino K: Xylitol-induced increase in the concentration of oxypurines and its mechanism. Int J Clin Pharmacol Ther. 1995 Jun;33(6):360-5. Pubmed: 7582389
  • Yeo SF, Zhang Y, Schafer D, Campbell S, Wong B: A rapid, automated enzymatic fluorometric assay for determination of D-arabinitol in serum. J Clin Microbiol. 2000 Apr;38(4):1439-43. Pubmed: 10747122
Synthesis Reference: Marek, Miroslav; Vrbova, Eva; Horakova, Irena; Musil, Petr; Kefurt, Karel. NADH manufacture with immobilized Candida formate dehydrogenase. Czech. (1992), 4 pp.
Material Safety Data Sheet (MSDS) Download (PDF)
External Links:
ResourceLink
CHEBI ID16908
HMDB IDHMDB01487
Pubchem Compound ID928
Kegg IDC00004
ChemSpider ID903
WikipediaNADH
BioCyc IDNADH
EcoCyc IDNADH
Ligand ExpoNAI