Record Information
Version 1.0
Update Date 1/22/2018 12:54:54 PM
Metabolite IDPAMDB110246
Identification
Name: diphosphate
Description:An acyclic phosphorus acid anhydride obtained by condensation of two molecules of phosphoric acid.
Structure
Thumb
Synonyms:
  • PPi
  • PP
  • pyrophosphate
Chemical Formula: HO7P2
Average Molecular Weight: 174.95
Monoisotopic Molecular Weight: 177.9432255031
InChI Key: XPPKVPWEQAFLFU-UHFFFAOYSA-K
InChI: InChI=1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-3
CAS number: 14000-31-8
IUPAC Name:1,5-dihydrido-2,4-dihydroxido-2,4-dioxido-1,3,5-trioxy-2,4-diphosphy-[5]catena
Traditional IUPAC Name: diphosphate
SMILES:O=P(O)(OP([O-])([O-])=O)[O-]
Chemical Taxonomy
Taxonomy DescriptionThis compound belongs to the class of chemical entities known as non-metal pyrophosphates. These are inorganic non-metallic compounds containing a pyrophosphate as its largest oxoanion.
Kingdom Chemical entities
Super ClassInorganic compounds
Class Homogeneous non-metal compounds
Sub ClassNon-metal oxoanionic compounds
Direct Parent Non-metal pyrophosphates
Alternative Parents
Substituents
  • Non-metal pyrophosphate
  • Inorganic oxide
Molecular Framework Not Available
External Descriptors
Physical Properties
State: Solid
Charge:0
Melting point: 61 °C
Experimental Properties:
PropertyValueReference
Melting Point61 °CNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Predicted Properties
PropertyValueSource
logP-1.4ChemAxon
pKa (Strongest Acidic)1.7ChemAxon
Physiological Charge-3ChemAxon
Hydrogen Acceptor Count6ChemAxon
Hydrogen Donor Count0ChemAxon
Polar Surface Area135.61 Å2ChemAxon
Rotatable Bond Count2ChemAxon
Refractivity21.04 m3·mol-1ChemAxon
Polarizability9.03 Å3ChemAxon
Number of Rings0ChemAxon
Bioavailability1ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations: Not Available
Reactions:
Odd-Straight-Chain-234-Sat-FA + ATP + coenzyme A → Odd-Saturated-Fatty-Acyl-CoA + AMP + diphosphate
Citronellates + coenzyme A + ATP → citronellyll-CoA + AMP + diphosphate
coenzyme A + acetoacetate + ATP → acetoacetyl-CoA + diphosphate + AMP
3-Methyl-Saturated-Fatty-Acids + coenzyme A + ATP → 3-Methyl-Saturated-Fatty-Acyl-CoA + AMP + diphosphate
IMP + diphosphate → Hypoxanthine + 5-phospho-α-D-ribose 1-diphosphate
Hydrogen ion + D-glycero-β-D-manno-heptose 1-phosphate + ATP → ADP-D-glycero-β-D-manno-heptose + diphosphate
CTP + 2-3-4-Saturated-L-Phosphatidates + Hydrogen ion → diphosphate + CDP-2-3-4-Saturated-Diacylglycerols
dCTP + Water → Hydrogen ion + dCMP + diphosphate
trans-cinnamate + coenzyme A + ATP → (E)-cinnamoyl-CoA + AMP + diphosphate
tRNA-uridine34 + TusE-S-sulfanylcysteine + ATP → tRNA-2-thiouridine34 + TusE-L-cysteine + AMP + diphosphate
coenzyme A + propanoate + ATP → propanoyl-CoA + diphosphate + AMP
linoleate + coenzyme A + ATP → linoleoyl-CoA + diphosphate + AMP
L-Glutamine + L-aspartate + ATP + Water → Hydrogen ion + L-glutamate + L-Asparagine + diphosphate + AMP
UTP → diphosphate
GTP → cyclic di-3',5'-guanylate + diphosphate
ATP + α-linolenate + coenzyme A → α-linolenoyl-CoA + diphosphate + AMP
selenate + ATP + Hydrogen ion → adenosine 5'-phosphoselenate + diphosphate
GTP + Water → 7,8-dihydroneopterin 2',3'-cyclic phosphate + formate + diphosphate + Hydrogen ion
oleate + coenzyme A + ATP → oleoyl-CoA + AMP + diphosphate
CTP + Water → Hydrogen ion + CMP + diphosphate
Long-Chain-Fatty-Acids + coenzyme A + ATP → Long-Chain-Acyl-CoAs + diphosphate + AMP
undecaprenyl-diphospho-(N-acetylglucosamine)-N-acetylmuramoyl-L-alanyl-γ-D-isoglutaminyl-N-(β-D-asparatyl)-L-lysyl-D-alanyl-D-alanine + Ammonium + ATP → Hydrogen ion + undecaprenyl-diphospho-(N-acetylglucosamine)-N-acetylmuramoyl-L-alanyl-γ-D-isoglutaminyl-N-(β-D-asparaginyl)-L-lysyl-D-alanyl-D-alanine + AMP + diphosphate
5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide + diphosphate → 5-amino-4-imidazolecarboxyamide + 5-phospho-α-D-ribose 1-diphosphate
eicosapentaenoate + ATP + coenzyme A → eicosapentaenoyl-CoA + diphosphate + AMP
dATP + Water → Hydrogen ion + dAMP + diphosphate
3-oxocholest-4-en-26-oate + ATP + coenzyme A → 3-oxocholest-4-en-26-oyl-CoA + AMP + diphosphate
dGTP + Water → Hydrogen ion + dGMP + diphosphate
4-(β-D-ribofuranosyl)aminobenzene-5'-phosphate + 6-Hydroxymethyl-dihydropterin pyrophosphate → Hydrogen ion + 7,8-dihydropterin-6-ylmethyl-4-(β-D-ribofuranosyl)aminobenzene 5'-phosphate + diphosphate
ferroheme b + (2E,6E)-farnesyl diphosphate + Water → HEME_O + diphosphate
Hydrogen ion + L-Serine + ATP → diphosphate + AMP
DEOXYNUCLEOTIDESM + ATP + Deoxynucleotides → AMP + diphosphate + Deoxynucleotides
CPD66-39 + coenzyme A + ATP → Saturated-Fatty-Acyl-CoA + diphosphate + AMP
phytenate + ATP + coenzyme A → phytenoyl-CoA + AMP + diphosphate
ATP → AMP + diphosphate
2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate + 2-Methyl-4-amino-5-hydroxymethylpyrimidine diphosphate + Hydrogen ion → thiamin phosphate + Carbon dioxide + diphosphate
dTTP + Water → Hydrogen ion + dTMP + diphosphate
biotin + ATP → diphosphate + AMP
2'-(5''-triphospho-α-D-ribosyl)-3'-dephospho-CoA → diphosphate
ITP + Water → Hydrogen ion + IMP + diphosphate
phenylacetate + ATP + coenzyme A → phenylacetyl-CoA + AMP + diphosphate
(2E,6E)-farnesyl diphosphate + isopentenyl diphosphate → all-trans-octaprenyl diphosphate + diphosphate
UTP + Water → UMP + diphosphate + Hydrogen ion
(R)-4'-phosphopantothenate + L-Cysteine + ATP → Hydrogen ion + R-4'-phosphopantothenoyl-L-cysteine + diphosphate + AMP
R2OH-Straight-Chain-234-Sat-FA + ATP + coenzyme A → R2-2OH-Straight-Chain-234-Sat-FA-CoA + AMP + diphosphate
(2E,6E)-farnesyl diphosphate + isopentenyl diphosphate → di-trans,octa-cis-undecaprenyl diphosphate + diphosphate
5-hydroxy-CTP + Water → 5-hydroxy-CMP + diphosphate + Hydrogen ion
GTP + Water → GMP + diphosphate + Hydrogen ion
CTP + ATP → diphosphate
(15Z)-tetracosenoate + coenzyme A + ATP → (Z)-15-tetracosenoyl-CoA + diphosphate + AMP
O-ureidohomoserine + L-aspartate + ATP → Hydrogen ion + canavaninosuccinate + AMP + diphosphate
palmitate + coenzyme A + ATP → palmitoyl-CoA + diphosphate + AMP
3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoate + ATP + coenzyme A → 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA + AMP + diphosphate
L-glutamate + ATP + Hydrogen ion → AMP + diphosphate
pristanate + coenzyme A + ATP → pristanoyl-CoA + diphosphate + AMP
GMP + diphosphate → Guanine + 5-phospho-α-D-ribose 1-diphosphate
2-Me-Branched-234-Sat-FA + coenzyme A + ATP → 2-Me-Branched-234-Sat-Fatty-Acyl-CoA + diphosphate + AMP
tRNAs-Asp-with-queuosine + ATP + L-glutamate → tRNAs-with-glutamylated-queuosine + AMP + diphosphate + Hydrogen ion
Nucleoside-Triphosphates + Water → Nucleoside-Monophosphates + diphosphate + Hydrogen ion
More...

Pathways:
Spectra
Spectra:
Spectrum TypeDescriptionSplash Key
GC-MSGC-MS Spectrum - GC-MS (4 TMS)splash10-0udi-0320900000-0abbcb28a43d7e24fe81View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 10V, Positive (Annotated)splash10-004j-5900000000-6633d5123eb37c266247View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 25V, Positive (Annotated)splash10-0002-9000000000-1274b83242b279e9dac7View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 40V, Positive (Annotated)splash10-001i-9000000000-69bc4c795fec87fef4b8View in MoNA
References
References:
  • Kukko E, Heinonen J (1982)The intracellular concentration of pyrophosphate in the batch culture of Escherichia coli. European journal of biochemistry 127, Pubmed: 6291941
Synthesis Reference: Dittmer, Donald C.; Silverstein, V. Opshelor. Production of pyrophosphate from S-n-butyl phosphorothioate. Journal of Organic Chemistry (1961), 26 4706-7.
Material Safety Data Sheet (MSDS) Download (PDF)
External Links:
ResourceLink
CAS2466-09-3
ChEBI29888
ChemSpider996
DrugBankDB04160
HMDBHMDB00250
IAF126033511
KEGGC00013
MetaboLightsMTBLC33019
PubChem1023