Record Information
Version 1.0
Update Date 1/22/2018 11:54:54 AM
Metabolite IDPAMDB000030
Identification
Name: Cytidine triphosphate
Description:Cytidine 5'-(tetrahydrogen triphosphate) or CTP is a cytosine nucleotide containing three phosphate groups esterified to a ribose moiety at the 5' position. CTP is integral to the synthesis or mRNA, rRNA and tRNA through RNA polymerases. Cytidine triphosphate (CTP) is also critical to the synthesis of phosphatidylcholine via the enzyme CTP: phosphocholine cytidyltransferase. This reaction is the rate-limiting step in the synthesis of phosphatidylcholine.
Structure
Thumb
Synonyms:
  • 5'-(Tetrahydrogen triphosphate) cytidine
  • 5'-(Tetrahydrogen triphosphoric acid) cytidine
  • 5'-CTP
  • CTP
  • Cytidine 3'-triphosphate
  • Cytidine 3'-triphosphoric acid
  • Cytidine 5'-(tetrahydrogen triphosphate)
  • Cytidine 5'-(tetrahydrogen triphosphoric acid)
  • Cytidine 5'-triphosphate
  • Cytidine 5'-triphosphorate
  • Cytidine 5'-triphosphoric acid
  • Cytidine 5-Prime-Triphosphate
  • Cytidine 5-prime-triphosphoric acid
  • Cytidine mono
  • Cytidine mono(tetrahydrogen triphosphate) (ester)
  • Cytidine mono(tetrahydrogen triphosphoric acid) (ester)
  • Cytidine Triphosphate
  • Cytidine triphosphoric acid
  • Cytidine-5'-triphosphate
  • Cytidine-5'-triphosphoric acid
  • Cytidine-triphosphate
  • Cytidine-triphosphoric acid
  • Deoxycytosine triphosphate
  • Deoxycytosine triphosphoric acid
  • H4ctp
Chemical Formula: C9H16N3O14P3
Average Molecular Weight: 483.1563
Monoisotopic Molecular Weight: 482.984511771
InChI Key: PCDQPRRSZKQHHS-XVFCMESISA-N
InChI:InChI=1S/C9H16N3O14P3/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1
CAS number: 65-47-4
IUPAC Name:({[({[(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid
Traditional IUPAC Name: CTP
SMILES:NC1=NC(=O)N(C=C1)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
Chemical Taxonomy
Taxonomy DescriptionThis compound belongs to the class of organic compounds known as pyrimidine ribonucleoside triphosphates. These are pyrimidine ribobucleotides with triphosphate group linked to the ribose moiety.
Kingdom Organic compounds
Super ClassNucleosides, nucleotides, and analogues
Class Pyrimidine nucleotides
Sub ClassPyrimidine ribonucleotides
Direct Parent Pyrimidine ribonucleoside triphosphates
Alternative Parents
Substituents
  • Pyrimidine ribonucleoside triphosphate
  • N-glycosyl compound
  • Glycosyl compound
  • Organic pyrophosphate
  • Monosaccharide phosphate
  • Hydroxypyrimidine
  • Monoalkyl phosphate
  • Aminopyrimidine
  • Alkyl phosphate
  • Pyrimidine
  • Phosphoric acid ester
  • Organic phosphoric acid derivative
  • Organic phosphate
  • Monosaccharide
  • Hydropyrimidine
  • Saccharide
  • Heteroaromatic compound
  • Oxolane
  • Secondary alcohol
  • 1,2-diol
  • Oxacycle
  • Azacycle
  • Organoheterocyclic compound
  • Hydrocarbon derivative
  • Organooxygen compound
  • Organonitrogen compound
  • Alcohol
  • Aromatic heteromonocyclic compound
Molecular Framework Aromatic heteromonocyclic compounds
External Descriptors
Physical Properties
State: Solid
Charge:-3
Melting point: 215-218 °C
Experimental Properties:
PropertyValueSource
Predicted Properties
PropertyValueSource
Water Solubility11.2 mg/mLALOGPS
logP-0.34ALOGPS
logP-4.3ChemAxon
logS-1.6ALOGPS
pKa (Strongest Acidic)0.91ChemAxon
pKa (Strongest Basic)-0.54ChemAxon
Physiological Charge-3ChemAxon
Hydrogen Acceptor Count13ChemAxon
Hydrogen Donor Count7ChemAxon
Polar Surface Area268.2 Å2ChemAxon
Rotatable Bond Count8ChemAxon
Refractivity87.16 m3·mol-1ChemAxon
Polarizability35.87 Å3ChemAxon
Number of Rings2ChemAxon
Bioavailability0ChemAxon
Rule of FiveYesChemAxon
Ghose FilterYesChemAxon
Veber's RuleYesChemAxon
MDDR-like RuleYesChemAxon
Biological Properties
Cellular Locations: Cytoplasm
Reactions:
Cytidine triphosphate + 2 Flavodoxin reduced + 2 Hydrogen ion > dCTP +2 flavodoxin semi oxidized + Water
Cytidine triphosphate + Water > Cytidine monophosphate + Hydrogen ion + Pyrophosphate
Adenosine triphosphate + CDP <> ADP + Cytidine triphosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-didodecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadec-9-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dihexadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-dioctadec-11-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-Dioctadecanoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradec-7-enoylglycerol + Pyrophosphate
Cytidine triphosphate + Hydrogen ion + PA(16:0/16:0) > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
Cytidine triphosphate + 3-Deoxy-D-manno-octulosonate <> CMP-3-Deoxy-D-manno-octulosonate + Pyrophosphate
Adenosine triphosphate + L-Glutamine + Water + Uridine triphosphate > ADP + Cytidine triphosphate + L-Glutamate +2 Hydrogen ion + Phosphate
Cytidine triphosphate + Hydrogen ion + Molybdopterin > Molybdopterin cytosine dinucleotide + Pyrophosphate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine > 4-Phosphopantothenoylcysteine + Cytidine monophosphate + Hydrogen ion + Pyrophosphate
Cytidine triphosphate + Water > CDP + Hydrogen ion + Phosphate
Cytidine triphosphate + RNA <> Pyrophosphate + RNA
Cytidine triphosphate + Water <> Cytidine monophosphate + Pyrophosphate
Cytidine triphosphate + Water <> Uridine triphosphate + Ammonia
Adenosine triphosphate + Uridine triphosphate + Ammonia <> ADP + Phosphate + Cytidine triphosphate
Adenosine triphosphate + Uridine triphosphate + L-Glutamine + Water <> ADP + Phosphate + Cytidine triphosphate + L-Glutamate
Cytidine triphosphate + PA(16:0/16:0) <> Pyrophosphate + CDP-diacylglycerol
dCTP + Thioredoxin disulfide + Water <> Cytidine triphosphate + Thioredoxin
Cytidine triphosphate + D-Tagatose 6-phosphate <> CDP + D-Tagatose 1,6-bisphosphate
Cytidine triphosphate + D-4'-Phosphopantothenate + L-Cysteine <> Cytidine monophosphate + Pyrophosphate + 4-Phosphopantothenoylcysteine
2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate <> 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate <> tRNA with a 3' CCA end +3 Pyrophosphate
tRNA precursor + Cytidine triphosphate <> tRNA with a 3' cytidine + Pyrophosphate
tRNA with a 3' cytidine + Cytidine triphosphate <> tRNA with a 3' CC end + Pyrophosphate
Hydrogen ion + 2-C-Methyl-D-erythritol-4-phosphate + Cytidine triphosphate > 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol + Pyrophosphate
Cytidine triphosphate + PA(16:0/16:0) + Hydrogen ion > Pyrophosphate + a CDP-diacylglycerol
Cytidine triphosphate + a 2,3,4-saturated L-phosphatidate + Hydrogen ion > Pyrophosphate + a CDP-2,3,4-saturated-diacylglycerol
Hydrogen ion + molybdenum cofactor + Cytidine triphosphate > Molybdopterin cytosine dinucleotide + Pyrophosphate
A tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate > a tRNA with a 3' CCA end +3 Pyrophosphate
Adenosine triphosphate + Uridine triphosphate + Ammonia > ADP + Inorganic phosphate + Cytidine triphosphate
Adenosine triphosphate + Uridine triphosphate + L-Glutamine + Water + Ammonia <> ADP + Phosphate + Cytidine triphosphate + L-Glutamate
Cytidine triphosphate + Water + dCTP <> Cytidine monophosphate + Pyrophosphate + dCMP
tRNA precursor + 2 Cytidine triphosphate + Adenosine triphosphate + tRNA with a 3' cytidine + tRNA with a 3' CC end <> tRNA with a 3' CCA end +3 Pyrophosphate
Cytidine triphosphate + D-4'-Phosphopantothenate + L-Cysteine + D-4'-Phosphopantothenate > Cytidine monophosphate + Pyrophosphate + 4-Phosphopantothenoylcysteine + Cytidine monophosphate
D-4'-Phosphopantothenate + Cytidine triphosphate + L-Cysteine + D-4'-Phosphopantothenate > Cytidine monophosphate + Pyrophosphate + Hydrogen ion + 4-Phosphopantothenoylcysteine + Cytidine monophosphate
3-deoxy-D-manno-octulosonate + Cytidine triphosphate + 3-Deoxy-D-manno-octulosonate > Pyrophosphate + CMP-3-Deoxy-D-manno-octulosonate
Cytidine triphosphate + Hydrogen ion + PA(18:0/18:0) > Pyrophosphate + CDP-1,2-Dioctadecanoylglycerol
DG(22:6(4Z,7Z,10Z,13Z,16Z,19Z)/18:1(11Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z)) + Pyrophosphate + CDP-DG(18:1(11Z)/22:6(4Z,7Z,10Z,13Z,16Z,19Z))
DG(19:1(9Z)/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > Pyrophosphate + CDP-DG(19:1(9Z)/18:1(9Z))
DG(18:1(9Z)/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(18:1(9Z)/18:1(9Z)/0:0) > Pyrophosphate + CDP-DG(18:1(9Z)/18:0) + CDP-DG(18:1(9Z)/18:0)
DG(16:0/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/10:0) + Pyrophosphate
DG(10:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/10:0) + Pyrophosphate
DG(16:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/12:0) + Pyrophosphate
DG(16:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:0/15:0/0:0) > CDP-DG(16:0/15:0) + Pyrophosphate
Hydrogen ion + Cytidine triphosphate + CDP-DG(10:0/12:0) > Pyrophosphate + DG(10:0/12:0/0:0)
1-hexadecanoyl-2-octadecanoyl-sn-glycerol + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/18:0) + Pyrophosphate + CDP-DG(16:0/18:0)
DG(10:0/14:0/0:0) + Hydrogen ion + Cytidine triphosphate CDP-DG(10:0/14:0) + Pyrophosphate
DG(10:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/15:0) + Pyrophosphate
DG(10:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/16:0) + Pyrophosphate
DG(16:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:0/19:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/10:0) + Pyrophosphate
DG(10:0/16:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/16:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/12:0) + Pyrophosphate
DG(10:0/18:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/18:0) + Pyrophosphate
DG(16:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:1(9Z)/15:0/0:0) > CDP-DG(16:1(9Z)/15:0) + Pyrophosphate
DG(16:1(9Z)/18:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(16:1(9Z)/18:0/0:0) > CDP-DG(16:1(9Z)/18:0) + Pyrophosphate
DG(16:1(9Z)/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(16:1(9Z)/18:1(9Z)/0:0) > CDP-DG(16:1(9Z)/18:1(9Z)) + Pyrophosphate
DG(16:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(18:0/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/10:0) + Pyrophosphate
DG(10:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/18:1(9Z)) + Pyrophosphate
DG(18:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/12:0) + Pyrophosphate
DG(18:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/14:0/0:0) > CDP-DG(18:0/14:0) + Pyrophosphate
DG(10:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(10:0/19:1(9Z)) + Pyrophosphate
DG(18:0/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/15:0/0:0) > CDP-DG(18:0/15:0) + Pyrophosphate
DG(12:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/10:0) + Pyrophosphate
DG(18:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/16:0/0:0) > CDP-DG(18:0/16:0) + Pyrophosphate + CDP-DG(18:0/16:0)
DG(12:0/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/14:0) + Pyrophosphate
DG(12:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/15:0) + Pyrophosphate
DG(18:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/16:1(9Z)/0:0) > CDP-DG(18:0/16:1(9Z)) + Pyrophosphate
1,2-Diacyl-sn-glycerol (dioctadecanoyl, n-C18:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/18:0) + Pyrophosphate + CDP-DG(18:0/18:0)
DG(12:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/16:0) + Pyrophosphate
DG(12:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/16:1(9Z)) + Pyrophosphate
DG(18:0/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:0/18:1(9Z)/0:0) > CDP-DG(18:0/18:1(9Z)) + Pyrophosphate + CDP-DG(18:0/18:1(9Z))
DG(12:0/18:0/0:0) + Cytidine triphosphate + Hydrogen ion CDP-DG(12:0/18:0) + Pyrophosphate
DG(18:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:0/19:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/10:0) + Pyrophosphate
DG(18:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/12:0) + Pyrophosphate
DG(18:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/14:0/0:0) > CDP-DG(18:1(9Z)/14:0) + Pyrophosphate
DG(12:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(12:0/18:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/15:0/0:0) > CDP-DG(18:1(9Z)/15:0) + Pyrophosphate
DG(18:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/16:0/0:0) > CDP-DG(18:1(9Z)/16:0) + Pyrophosphate + CDP-DG(18:1(9Z)/16:0)
DG(18:1(9Z)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion + DG(18:1(9Z)/16:1(9Z)/0:0) > CDP-DG(18:1(9Z)/16:1(9Z)) + Pyrophosphate
DG(18:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(19:1(9Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/10:0) + Pyrophosphate
DG(19:1(9Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/12:0) + Pyrophosphate
DG(19:1(9Z)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/14:0) + Pyrophosphate
DG(19:1(9Z)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/15:0) + Pyrophosphate
DG(19:1(9Z)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/16:0) + Pyrophosphate
DG(19:1(9Z)/18:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/18:0) + Pyrophosphate
DG(12:0/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/19:1(9Z)) + Pyrophosphate
DG(19:1(9Z)/19:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:1(9Z)/19:1(9Z)) + Pyrophosphate
DG(14:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/10:0) + Pyrophosphate
DG(14:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/12:0) + Pyrophosphate
DG(14:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(14:0/15:0/0:0) > CDP-DG(14:0/15:0) + Pyrophosphate
Hydrogen ion + Cytidine triphosphate + DG(14:0/18:0/0:0) + DG(14:0/18:0/0:0) > CDP-DG(14:0/18:0) + Pyrophosphate
DG(14:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(14:0/18:1(9Z)/0:0) > CDP-DG(14:0/18:1(9Z)) + Pyrophosphate
DG(14:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(14:0/19:1(9Z)) + Pyrophosphate
DG(15:0/10:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/10:0) + Pyrophosphate
DG(15:0/12:0/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/12:0) + Pyrophosphate
DG(15:0/14:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/14:0/0:0) > CDP-DG(15:0/14:0) + Pyrophosphate
DG(15:0/15:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/15:0/0:0) > CDP-DG(15:0/15:0) + Pyrophosphate
DG(15:0/16:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/16:0/0:0) > CDP-DG(15:0/16:0) + Pyrophosphate
DG(15:0/16:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/16:1(9Z)/0:0) > CDP-DG(15:0/16:1(9Z)) + Pyrophosphate
DG(15:0/18:0/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/18:0/0:0) > CDP-DG(15:0/18:0) + Pyrophosphate
DG(15:0/18:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate + DG(15:0/18:1(9Z)/0:0) > Pyrophosphate + CDP-DG(15:0/18:1(9Z))
DG(15:0/19:1(9Z)/0:0) + Hydrogen ion + Cytidine triphosphate > CDP-DG(15:0/19:1(9Z)) + Pyrophosphate
DG(17:0cycw7c/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/17:0cycw7c) + Pyrophosphate
2 DG(18:1(9Z)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/19:0cycv8c) + Carbon dioxide
2 DG(19:0cycv8c/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/15:0cyclo) + Pyrophosphate
DG(19:0cycv8c/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/14:0) + Pyrophosphate
DG(19:0cycv8c/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/16:0) + Pyrophosphate
DG(14:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + DG(14:0/16:0/0:0) > CDP-DG(14:0/16:0) + Pyrophosphate
DG(17:0cycw7c/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/19:0cycv8c) + Pyrophosphate
DG(19:0cycv8c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/16:1(9Z)) + Pyrophosphate
DG(17:0cycw7c/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/16:1(9Z)) + Pyrophosphate
DG(19:0cycv8c/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/17:0cycw7c) + Pyrophosphate
2 DG(14:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0/17:0cycw7c) + Pyrophosphate
2 DG(19:0cycv8c/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/18:1(9Z)) + Pyrophosphate
DG(19:0cycv8c/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycv8c/19:0cycv8c) + Pyrophosphate
2 DG(14:0/16:0/0:0) + Cytidine triphosphate + Hydrogen ion + 2 DG(14:0/16:0/0:0) >2 CDP-DG(14:0/16:0) + Pyrophosphate
Cytidine triphosphate + a reduced flavodoxin > Water + an oxidized flavodoxin + dCTP
Uridine triphosphate + L-Glutamine + Water + Adenosine triphosphate + Uridine triphosphate > Adenosine diphosphate + Hydrogen ion + Phosphate + L-Glutamic acid + Cytidine triphosphate + ADP + L-Glutamate
2-C-methyl-D-erythritol 4-phosphate + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol + 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol
DG(17:0cycw7c/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/18:1(9Z)) + Pyrophosphate
2 DG(10:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion 2 CDP-DG(10:0(3-OH)/10:0) + Pyrophosphate
2 DG(10:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(10:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/12:0) + Pyrophosphate
2 DG(10:0(3-OH)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/15:0cyclo) + Pyrophosphate
2 DG(10:0(3-OH)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/16:0) + Pyrophosphate
2 DG(10:0(3-OH)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/16:1(9Z)) + Pyrophosphate
2 DG(10:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/17:0cycw7c) + Pyrophosphate
1,2-Diacyl-sn-glycerol (ditetradecanoyl, n-C14:0) + Cytidine triphosphate + Hydrogen ion > CDP-1,2-ditetradecanoylglycerol + Pyrophosphate
2 DG(10:0(3-OH)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0(3-OH)/19:0cycv8c) + Pyrophosphate
2 DG(10:0(3-OH)/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0(3-OH)/19:iso) + Pyrophosphate
2 DG(10:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0/10:0(3-OH)) + Pyrophosphate
2 DG(10:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(10:0/12:0(3-OH)) + Pyrophosphate
DG(10:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(10:0/17:0cycw7c) + Pyrophosphate
2 DG(12:0(3-OH)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/10:0(3-OH)) + Pyrophosphate
2 DG(12:0(3-OH)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/10:0) + Pyrophosphate
DG(12:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(12:0/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-1,2-didodecanoylglycerol + Pyrophosphate
DG(12:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0(3-OH)/12:0) + Pyrophosphate
2 DG(12:0(3-OH)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/14:0(3-OH)) + Pyrophosphate
2 DG(12:0(3-OH)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/14:0) + Pyrophosphate
2 DG(12:0(3-OH)/15:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/15:0) + Pyrophosphate
2 DG(12:0(3-OH)/15:0cyclo/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/15:0cyclo) + Pyrophosphate
2 DG(12:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/17:0cycw7c) + Pyrophosphate
2 DG(12:0(3-OH)/18:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/18:1(9Z)) + Pyrophosphate
2 DG(12:0(3-OH)/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/19:0cycv8c) + Pyrophosphate
2 DG(12:0(3-OH)/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0(3-OH)/19:iso) + Pyrophosphate
2 DG(12:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/10:0(3-OH)) + Pyrophosphate
DG(12:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/12:0(3-OH)) + Pyrophosphate
2 DG(12:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/14:0(3-OH)) + Pyrophosphate
DG(12:0/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(12:0/17:0cycw7c) + Pyrophosphate
2 DG(12:0/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(12:0/19:iso) + Pyrophosphate
2 DG(14:0(3-OH)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/12:0(3-OH)) + Pyrophosphate
2 DG(14:0(3-OH)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/12:0) + Pyrophosphate
DG(14:0(3-OH)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/14:0(3-OH)) + Pyrophosphate
DG(14:0(3-OH)/14:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/14:0) + Pyrophosphate
DG(14:0(3-OH)/16:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0(3-OH)/16:0) + Pyrophosphate
2 DG(14:0(3-OH)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/16:1(9Z)) + Pyrophosphate
2 DG(14:0(3-OH)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0(3-OH)/17:0cycw7c) + Pyrophosphate
2 DG(14:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(14:0/12:0(3-OH)) + Pyrophosphate
DG(14:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(14:0/14:0(3-OH)) + Pyrophosphate
2 DG(15:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0/10:0(3-OH)) + Pyrophosphate
2 DG(15:0/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0/12:0(3-OH)) + Pyrophosphate
DG(15:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion > Pyrophosphate + CDP-DG(15:0/14:0(3-OH))
2 DG(15:0cyclo/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(15:0cyclo/10:0(3-OH)) + Pyrophosphate
2 DG(16:0/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/10:0(3-OH)) + Pyrophosphate
2 DG(16:0/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:0/14:0(3-OH)) + Pyrophosphate
2 DG(16:1(9Z)/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:1(9Z)/14:0(3-OH)) + Pyrophosphate
2 DG(16:1(9Z)/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(16:1(9Z)/17:0cycw7c) + Pyrophosphate
DG(16:1(9Z)/0:0/19:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(16:1(9Z)/19:0) + Pyrophosphate
DG(17:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0/16:1(9Z)) + Pyrophosphate
2 DG(17:0cycw7c/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/10:0(3-OH)) + Pyrophosphate
DG(17:0cycw7c/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/10:0) + Pyrophosphate
2 DG(17:0cycw7c/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/12:0(3-OH)) + Pyrophosphate
2 CDP-DG(10:0(3-OH)/19:iso) + Glycerol 3-phosphate >2 PGP(10:0(3-OH)/19:iso) + Cytidine triphosphate + Hydrogen ion
DG(17:0cycw7c/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(17:0cycw7c/12:0) + Pyrophosphate
2 DG(17:0cycw7c/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(17:0cycw7c/19:iso) + Pyrophosphate
DG(18:1(11Z)/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/10:0) + Pyrophosphate
DG(18:1(11Z)/12:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/12:0) + Pyrophosphate
DG(18:1(11Z)/17:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(18:1(11Z)/17:0) + Pyrophosphate
2 DG(18:1(11Z)/19:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(11Z)/19:0) + Pyrophosphate
2 CDP-DG(18:1(11Z)/19:0) + Cytidine triphosphate + Hydrogen ion >2 PGP(18:1(11Z)/19:0) + Pyrophosphate
2 DG(18:1(9Z)/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(18:1(9Z)/12:0(3-OH)) + Pyrophosphate
2 DG(19:0/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0/16:1(9Z)) + Pyrophosphate
2 DG(19:0/18:1(11Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0/18:1(11Z)) + Pyrophosphate
2 DG(19:0cycv8c/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/10:0(3-OH)) + Pyrophosphate
2 DG(19:0cycv8c/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:0cycv8c/12:0(3-OH)) + Pyrophosphate
DG(19:0cycw8c/10:0/0:0) + Cytidine triphosphate + Hydrogen ion > CDP-DG(19:0cycw8c/10:0) + Pyrophosphate
2 DG(19:1(9Z)/16:1(9Z)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:1(9Z)/16:1(9Z)) + Pyrophosphate
2 DG(19:iso/10:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/10:0(3-OH)) + Pyrophosphate
2 DG(19:iso/10:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/10:0) + Pyrophosphate
2 DG(19:iso/12:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/12:0(3-OH)) + Pyrophosphate
2 DG(19:iso/12:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/12:0) + Pyrophosphate
2 DG(19:iso/14:0(3-OH)/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/14:0(3-OH)) + Pyrophosphate
2 DG(19:iso/14:0/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/14:0) + Pyrophosphate
2 DG(19:iso/17:0cycw7c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/17:0cycw7c) + Pyrophosphate
2 DG(19:iso/19:0cycv8c/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/19:0cycv8c) + Pyrophosphate
2 DG(19:iso/19:iso/0:0) + Cytidine triphosphate + Hydrogen ion >2 CDP-DG(19:iso/19:iso) + Pyrophosphate
CDP-DG(18:1(11Z)/17:0) + L-Serine + L-Serine > PS(18:1(11Z)/17:0) + Cytidine triphosphate + Hydrogen ion
More...

Pathways:
Spectra
Spectra:
Spectrum TypeDescriptionSplash Key
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 10V, Positive (Annotated)splash10-00b9-5685900000-b067d3b0af4c194d5224View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 25V, Positive (Annotated)splash10-0a4i-0309200000-33e695326ec0d28103b4View in MoNA
LC-MS/MSLC-MS/MS Spectrum - Quattro_QQQ 40V, Positive (Annotated)splash10-057j-1926700000-417741bbe965170223c0View in MoNA
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, PositiveNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, PositiveNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, PositiveNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 10V, NegativeNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 20V, NegativeNot Available
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 40V, NegativeNot Available
1D NMR1H NMR SpectrumNot Available
1D NMR1H NMR SpectrumNot Available
1D NMR13C NMR SpectrumNot Available
2D NMR[1H,1H] 2D NMR SpectrumNot Available
2D NMR[1H,13C] 2D NMR SpectrumNot Available
References
References:
  • Bennett, B. D., Kimball, E. H., Gao, M., Osterhout, R., Van Dien, S. J., Rabinowitz, J. D. (2009). "Absolute metabolite concentrations and implied enzyme active site occupancy in Escherichia coli." Nat Chem Biol 5:593-599. Pubmed: 19561621
  • Cornell RB, Northwood IC: Regulation of CTP:phosphocholine cytidylyltransferase by amphitropism and relocalization. Trends Biochem Sci. 2000 Sep;25(9):441-7. Pubmed: 10973058
  • de Korte D, Haverkort WA, van Gennip AH, Roos D: Nucleotide profiles of normal human blood cells determined by high-performance liquid chromatography. Anal Biochem. 1985 May 15;147(1):197-209. Pubmed: 4025817
  • Ishii, N., Nakahigashi, K., Baba, T., Robert, M., Soga, T., Kanai, A., Hirasawa, T., Naba, M., Hirai, K., Hoque, A., Ho, P. Y., Kakazu, Y., Sugawara, K., Igarashi, S., Harada, S., Masuda, T., Sugiyama, N., Togashi, T., Hasegawa, M., Takai, Y., Yugi, K., Arakawa, K., Iwata, N., Toya, Y., Nakayama, Y., Nishioka, T., Shimizu, K., Mori, H., Tomita, M. (2007). "Multiple high-throughput analyses monitor the response of E. coli to perturbations." Science 316:593-597. Pubmed: 17379776
  • Kallander CF, Gronowitz JS, Olding-Stenkvist E: Varicella zoster virus deoxythymidine kinase is present in serum before the onset of varicella. Scand J Infect Dis. 1989;21(3):255-7. Pubmed: 2547243
  • Kanehisa, M., Goto, S., Sato, Y., Furumichi, M., Tanabe, M. (2012). "KEGG for integration and interpretation of large-scale molecular data sets." Nucleic Acids Res 40:D109-D114. Pubmed: 22080510
  • Keseler, I. M., Collado-Vides, J., Santos-Zavaleta, A., Peralta-Gil, M., Gama-Castro, S., Muniz-Rascado, L., Bonavides-Martinez, C., Paley, S., Krummenacker, M., Altman, T., Kaipa, P., Spaulding, A., Pacheco, J., Latendresse, M., Fulcher, C., Sarker, M., Shearer, A. G., Mackie, A., Paulsen, I., Gunsalus, R. P., Karp, P. D. (2011). "EcoCyc: a comprehensive database of Escherichia coli biology." Nucleic Acids Res 39:D583-D590. Pubmed: 21097882
  • Kondo T, Ohtsuka Y, Shimada M, Kawakami Y, Hiyoshi Y, Tsuji Y, Fujii H, Miwa S: Erythrocyte-oxidized glutathione transport in pyrimidine 5'-nucleotidase deficiency. Am J Hematol. 1987 Sep;26(1):37-45. Pubmed: 2888306
  • van der Werf, M. J., Overkamp, K. M., Muilwijk, B., Coulier, L., Hankemeier, T. (2007). "Microbial metabolomics: toward a platform with full metabolome coverage." Anal Biochem 370:17-25. Pubmed: 17765195
  • Verschuur AC, Brinkman J, Van Gennip AH, Leen R, Vet RJ, Evers LM, Voute PA, Van Kuilenburg AB: Cyclopentenyl cytosine induces apoptosis and increases cytarabine-induced apoptosis in a T-lymphoblastic leukemic cell-line. Leuk Res. 2001 Oct;25(10):891-900. Pubmed: 11532523
  • Watanabe T, Oguchi K, Ebara S, Fukui T: Measurement of 3-hydroxyisovaleric acid in urine of biotin-deficient infants and mice by HPLC. J Nutr. 2005 Mar;135(3):615-8. Pubmed: 15735103
  • Winder, C. L., Dunn, W. B., Schuler, S., Broadhurst, D., Jarvis, R., Stephens, G. M., Goodacre, R. (2008). "Global metabolic profiling of Escherichia coli cultures: an evaluation of methods for quenching and extraction of intracellular metabolites." Anal Chem 80:2939-2948. Pubmed: 18331064
Synthesis Reference: Simon, Ethan S.; Bednarski, Mark D.; Whitesides, George M. Synthesis of CMP-NeuAc from N-acetylglucosamine: generation of CTP from CMP using adenylate kinase. Journal of the American Chemical Society (1988), 110(21), 7159-63.
Material Safety Data Sheet (MSDS) Download (PDF)
External Links:
ResourceLink
CHEBI ID17677
HMDB IDHMDB00082
Pubchem Compound ID6176
Kegg IDC00063
ChemSpider ID5941
WikipediaCytidine triphosphate
BioCyc IDCTP
EcoCyc IDCTP
Ligand ExpoCTP